diff --git a/.github/workflows/submodules.yml b/.github/workflows/submodules.yml
deleted file mode 100644
index 463aa5e..0000000
--- a/.github/workflows/submodules.yml
+++ /dev/null
@@ -1,20 +0,0 @@
-name: 'update submodules'
-
-on:
-  workflow_dispatch:
-
-jobs:
-  sync:
-    name: 'update submodules'
-    runs-on: ubuntu-latest
-    steps:
-      - name: checkout repo
-        uses: actions/checkout@v2
-        with:
-          submodules: true
-      - name: pull updates
-        run: |
-          git pull --recurse-submodules
-          git submodule update --remote --recursive
-      - name: commit changes
-        uses: stefanzweifel/git-auto-commit-action@v4
diff --git a/.gitignore b/.gitignore
index dbf0821..114de42 100644
--- a/.gitignore
+++ b/.gitignore
@@ -1 +1,9 @@
-node_modules/*
\ No newline at end of file
+# builds
+dist/
+
+# dependencies
+node_modules/
+
+# yarn
+.yarn/
+.pnp.*
\ No newline at end of file
diff --git a/.gitmodules b/.gitmodules
deleted file mode 100644
index d1db488..0000000
--- a/.gitmodules
+++ /dev/null
@@ -1,16 +0,0 @@
-[submodule "api"]
-	path = insert/api
-	url = git@github.com:notion-enhancer/api.git
-	branch = dev
-[submodule "repo"]
-	path = insert/repo
-	url = git@github.com:notion-enhancer/repo.git
-	branch = dev
-[submodule "media"]
-	path = insert/media
-	url = git@github.com:notion-enhancer/media.git
-	branch = main
-[submodule "dep"]
-	path = insert/dep
-	url = git@github.com:notion-enhancer/dep.git
-	branch = main
diff --git a/.yarnrc.yml b/.yarnrc.yml
new file mode 100644
index 0000000..36e01b3
--- /dev/null
+++ b/.yarnrc.yml
@@ -0,0 +1,4 @@
+nodeLinker: node-modules
+yarnPath: .yarn/releases/yarn-3.3.0.cjs
+
+enableMessageNames: false
diff --git a/bin.mjs b/bin.mjs
index b9d17d5..b35dccd 100755
--- a/bin.mjs
+++ b/bin.mjs
@@ -2,143 +2,374 @@
 
 /**
  * notion-enhancer
- * (c) 2021 dragonwocky <thedragonring.bod@gmail.com> (https://dragonwocky.me/)
+ * (c) 2022 dragonwocky <thedragonring.bod@gmail.com> (https://dragonwocky.me/)
  * (https://notion-enhancer.github.io/) under the MIT license
  */
 
-'use strict';
+import arg from "arg";
+import chalk from "chalk-template";
+import os from "node:os";
+import { createRequire } from "node:module";
+import {
+  getAppPath,
+  getBackupPath,
+  getCachePath,
+  checkEnhancementVersion,
+  setNotionPath,
+  unpackApp,
+  applyEnhancements,
+  takeBackup,
+  restoreBackup,
+  removeCache,
+} from "./scripts/enhance-desktop-app.mjs";
+import { existsSync } from "node:fs";
+const nodeRequire = createRequire(import.meta.url),
+  manifest = nodeRequire("./package.json");
 
-import os from 'os';
+let __quiet, __debug;
+const print = (...args) => __quiet || process.stdout.write(chalk(...args)),
+  printObject = (value) => __quiet || console.dir(value, { depth: null }),
+  clearLine = `\r\x1b[K`,
+  showCursor = `\x1b[?25h`,
+  hideCursor = `\x1b[?25l`,
+  cursorUp = (n) => `\x1b[${n}A`,
+  cursorForward = (n) => `\x1b[${n}C`;
 
-import { pkg, findNotion } from './pkg/helpers.mjs';
-import { line, options, log, help, args, lastSpinner } from './pkg/cli.mjs';
-
-import apply from './pkg/apply.mjs';
-import remove from './pkg/remove.mjs';
-import check from './pkg/check.mjs';
-
-const manifest = pkg(),
-  opts = options({
-    y: 'yes',
-    n: 'no',
-    d: 'dev',
-    h: 'help',
-    v: 'version',
-  }),
-  promptRes = opts.get('yes') ? 'y' : opts.get('no') ? 'n' : undefined;
-
-const displayHelp = () => {
-  help({
-    name: manifest.name,
-    version: manifest.version,
-    link: manifest.homepage,
-    commands: [
-      ['apply', 'add enhancements to the notion app'],
-      ['remove', 'return notion to its pre-enhanced/pre-modded state'],
-      ['check, status', 'check the current state of the notion app'],
-    ],
-    options: [
-      ['-y, --yes', 'skip prompts'],
-      ['-n, --no', 'skip prompts'],
-      ['-d, --dev', 'show detailed error messages (for debug purposes)'],
-      [
-        '--path=</path/to/notion/resources>',
-        'provide a file location to enhance (otherwise auto-picked)',
-      ],
-      ['--no-backup', 'skip backup (faster enhancement, but disables removal)'],
-      ['--patch', 'overwrite inserted files (useful for quick development/testing)'],
-      ['-h, --help', 'display usage information'],
-      ['-v, --version', 'display version number'],
-    ],
-  });
-};
-if (opts.get('help')) {
-  displayHelp();
-  process.exit(0);
-}
-
-if (opts.get('version')) {
-  log(
-    `${manifest.name}/${manifest.version} ${
-      process.platform
-    }-${os.arch()}/${os.release()} node/${process.version}`
-  );
-  process.exit(0);
-}
-
-function handleError(err) {
-  if (opts.get('dev')) {
-    const strs = [],
-      tags = [],
-      stack = err.stack.split('\n');
-    for (let i = 0; i < stack.length; i++) {
-      const text = stack[i].replace(/^    /, '  ');
-      if (i === 0) {
-        const [type, msg] = text.split(/:((.+)|$)/);
-        strs.push('{bold.red ');
-        tags.push(type);
-        strs.push(':} ');
-        tags.push(msg);
-      } else {
-        strs.push('{grey ');
-        tags.push(text);
-        strs.push('}');
-        tags.push('');
+let __confirmation;
+const readStdin = () => {
+    return new Promise((res) => {
+      process.stdin.resume();
+      process.stdin.setEncoding("utf8");
+      process.stdin.once("data", (key) => {
+        process.stdin.pause();
+        res(key);
+      });
+    });
+  },
+  promptConfirmation = async (prompt) => {
+    let input;
+    const validInputs = ["Y", "y", "N", "n"],
+      promptLength = `    > ${prompt} [Y/n]: `.length;
+    // prevent line clear remove existing stdout
+    print`\n`;
+    do {
+      // clear line and repeat prompt until valid input is received
+      print`${cursorUp(1)}${clearLine}    {inverse > ${prompt} [Y/n]:} `;
+      // autofill prompt response if --yes, --no or --quiet flags passed
+      if (validInputs.includes(__confirmation)) {
+        input = __confirmation;
+        print`${__confirmation}\n`;
+      } else input = (await readStdin()).trim();
+      if (!input) {
+        // default to Y if enter is pressed w/out input
+        input = "Y";
+        print`${cursorUp(1)}${cursorForward(promptLength)}Y\n`;
       }
-      if (i !== stack.length - 1) {
-        strs.push('\n');
-        tags.push('');
+    } while (!validInputs.includes(input));
+    // move cursor to immediately after input
+    print`${cursorUp(1)}${cursorForward(promptLength + 1)}`;
+    return input;
+  };
+
+let __spinner;
+const spinnerFrames = ["⠋", "⠙", "⠹", "⠸", "⠼", "⠴", "⠦", "⠧", "⠇", "⠏"],
+  stopSpinner = () => {
+    if (!__spinner) return;
+    clearInterval(__spinner);
+    // show cursor and overwrite spinner with arrow on completion
+    print`\b{bold.yellow →}\n${showCursor}`;
+    __spinner = undefined;
+  },
+  startSpinner = () => {
+    // cleanup prev spinner if necessary
+    stopSpinner();
+    // hide cursor and print first frame
+    print`${hideCursor}{bold.yellow ${spinnerFrames[0]}}`;
+    let i = 0;
+    __spinner = setInterval(() => {
+      i++;
+      // overwrite spinner with next frame
+      print`\b{bold.yellow ${spinnerFrames[i % spinnerFrames.length]}}`;
+    }, 80);
+  };
+
+const compileOptsToArgSpec = (options) => {
+    const args = {};
+    for (const [opt, [type]] of options) {
+      const aliases = opt.split(", ").map((alias) => alias.split("=")[0]),
+        param = aliases[1] ?? aliases[0];
+      args[param] = type;
+      for (let i = 0; i < aliases.length; i++) {
+        if (aliases[i] === param) continue;
+        args[aliases[i]] = param;
       }
     }
-    log(strs, ...tags);
-  } else {
-    log`{bold.red Error:} ${err.message} {grey (run with -d for more information)}`;
-  }
-}
+    return args;
+  },
+  compileOptsToJsonOutput = (options) => {
+    // the structure used to define options above
+    // is convenient and compact, but requires additional
+    // parsing to understand. this function processes
+    // options into a more explicitly defined structure
+    return options.map(([opt, [type, description]]) => {
+      const option = {
+          aliases: opt.split(", ").map((alias) => alias.split("=")[0]),
+          type,
+          description,
+        },
+        example = opt
+          .split(", ")
+          .map((alias) => alias.split("=")[1])
+          .find((value) => value);
+      if (example) option.example = example;
+      return option;
+    });
+  };
+
+const printHelp = (commands, options) => {
+    const { name, version, homepage } = manifest,
+      usage = `${name} <command> [options]`;
+    if (args["--json"]) {
+      printObject({
+        name,
+        version,
+        homepage,
+        usage,
+        commands: Object.fromEntries(commands),
+        options: compileOptsToJsonOutput(options),
+      });
+    } else {
+      const cmdPad = Math.max(...commands.map(([cmd]) => cmd.length)),
+        optPad = Math.max(...options.map((opt) => opt[0].length)),
+        parseCmd = (cmd) => chalk`  ${cmd[0].padEnd(cmdPad)}  {grey :}  ${cmd[1]}`,
+        parseOpt = (opt) => chalk`  ${opt[0].padEnd(optPad)}  {grey :}  ${opt[1][1]}`;
+      print`{bold.whiteBright ${name} v${version}}\n{grey ${homepage}}
+      \n{bold.whiteBright USAGE}\n${name} <command> [options]
+      \n{bold.whiteBright COMMANDS}\n${commands.map(parseCmd).join("\n")}
+      \n{bold.whiteBright OPTIONS}\n${options.map(parseOpt).join("\n")}\n`;
+    }
+  },
+  printVersion = () => {
+    if (args["--json"]) {
+      printObject({
+        [manifest.name]: manifest.version,
+        node: process.version.slice(1),
+        platform: process.platform,
+        architecture: process.arch,
+        os: os.release(),
+      });
+    } else {
+      const enhancerVersion = `${manifest.name}@v${manifest.version}`,
+        nodeVersion = `node@${process.version}`,
+        osVersion = `${process.platform}-${process.arch}/${os.release()}`;
+      print`${enhancerVersion} via ${nodeVersion} on ${osVersion}\n`;
+    }
+  };
 
 try {
-  const notionPath = opts.get('path') || findNotion();
+  const commands = [
+      // ["command", "description"]
+      ["apply", "add enhancements to the notion app"],
+      ["remove", "return notion to its pre-enhanced/pre-modded state"],
+      ["check", "check the current state of the notion app"],
+    ],
+    options = [
+      // ["alias, option=example", [type, "description"]]
+      [
+        "--path=</path/to/notion/resources>",
+        [String, "manually provide a notion installation location"],
+      ],
+      ["--overwrite", [Boolean, "for rapid development; unsafely overwrite sources"]],
+      ["--no-backup", [Boolean, "skip backup; enhancement will be faster but irreversible"]],
+      ["-y, --yes", [Boolean, 'skip prompts; assume "yes" and run non-interactively']],
+      ["-n, --no", [Boolean, 'skip prompts; assume "no" and run non-interactively']],
+      ["-q, --quiet", [Boolean, 'skip prompts; assume "no" unless -y and hide all output']],
+      ["-d, --debug", [Boolean, "show detailed error messages"]],
+      ["-j, --json", [Boolean, "display json output (where applicable)"]],
+      ["-h, --help", [Boolean, "display usage information"]],
+      ["-v, --version", [Boolean, "display version number"]],
+    ];
 
-  switch (args()[0]) {
-    case 'apply': {
-      log`{bold.rgb(245,245,245) [NOTION-ENHANCER] APPLY}`;
-      const res = await apply(notionPath, {
-        overwritePrevious: promptRes,
-        patchPrevious: opts.get('patch') ? true : false,
-        takeBackup: opts.get('no-backup') ? false : true,
-      });
-      if (res) {
-        log`{bold.rgb(245,245,245) SUCCESS} {green ✔}`;
-      } else log`{bold.rgb(245,245,245) CANCELLED} {red ✘}`;
-      break;
+  const args = arg(compileOptsToArgSpec(options));
+  if (args["--debug"]) __debug = true;
+  if (args["--quiet"]) __quiet = true;
+  if (args["--no"] || args["--quiet"]) __confirmation = "n";
+  if (args["--yes"]) __confirmation = "y";
+  if (args["--help"]) printHelp(commands, options), process.exit();
+  if (args["--version"]) printVersion(), process.exit();
+  if (args["--path"]) setNotionPath(args["--path"]);
+
+  const appPath = getAppPath(),
+    backupPath = getBackupPath(),
+    cachePath = getCachePath(),
+    insertVersion = checkEnhancementVersion();
+
+  const messages = {
+    "notion-found": `notion installation found`,
+    "notion-not-found": `notion installation not found (corrupted or nonexistent)`,
+    "notion-is-packed": `electron archive found: extracting app.asar`,
+
+    "not-applied": `notion-enhancer not applied`,
+    "version-applied": `notion-enhancer v${manifest.version} applied`,
+    "version-mismatch": `notion-enhancer v${insertVersion} applied != v${manifest.version} current`,
+    "prompt-version-replace": `replace?`,
+
+    "backup-found": `backup found`,
+    "backup-not-found": `backup not found`,
+    "creating-backup": `backing up notion before enhancement`,
+    "restoring-backup": `restoring`,
+    "inserting-enhancements": `inserting enhancements and patching notion sources`,
+    "manual-removal-instructions": `to remove the notion-enhancer from notion, uninstall notion and
+    then install a vanilla version of the app from https://www.notion.so/desktop (mac,
+    windows) or ${manifest.homepage}/getting-started/installation (linux)`,
+
+    "cache-found": `cache found`,
+    "cache-not-found": `cache not found: nothing to remove`,
+    "prompt-cache-removal": `remove?`,
+  };
+  const SUCCESS = chalk`{bold.whiteBright SUCCESS} {green ✔}`,
+    FAILURE = chalk`{bold.whiteBright FAILURE} {red ✘}`,
+    CANCELLED = chalk`{bold.whiteBright CANCELLED} {red ✘}`,
+    INCOMPLETE = Symbol();
+
+  const interactiveRestoreBackup = async () => {
+    if (backupPath) {
+      // replace enhanced app with vanilla app.bak/app.asar.bak
+      print`  {grey * ${messages["backup-found"]}: ${messages["restoring-backup"]}} `;
+      startSpinner();
+      await restoreBackup();
+      stopSpinner();
+      return INCOMPLETE;
+    } else {
+      print`  {red * ${messages["backup-not-found"]}: ${messages["manual-removal-instructions"]}}\n`;
+      return FAILURE;
     }
-    case 'remove': {
-      log`{bold.rgb(245,245,245) [NOTION-ENHANCER] REMOVE}`;
-      const res = await remove(notionPath, { delCache: promptRes });
-      if (res) {
-        log`{bold.rgb(245,245,245) SUCCESS} {green ✔}`;
-      } else log`{bold.rgb(245,245,245) CANCELLED} {red ✘}`;
-      break;
-    }
-    case 'check':
-    case 'status': {
-      log`{bold.rgb(245,245,245) [NOTION-ENHANCER] CHECK}`;
-      const status = check(notionPath);
-      line.prev();
-      if (opts.get('dev')) {
-        line.forward(24);
-        console.log(status);
-      } else {
-        line.forward(23);
-        line.write(': ' + status.message + '\r\n');
+  };
+
+  const canEnhancementsBeApplied = async () => {
+      if (!appPath) {
+        // notion not installed
+        print`  {red * ${messages["notion-not-found"]}}\n`;
+        return FAILURE;
+      } else if (insertVersion === manifest.version) {
+        // same version already applied
+        if (args["--overwrite"]) {
+          print`  {grey * ${messages["inserting-enhancements"]}} `;
+          startSpinner();
+          await applyEnhancements();
+          stopSpinner();
+          print`  {grey * ${messages["version-applied"]}}\n`;
+        } else print`  {grey * ${messages["notion-found"]}: ${messages["version-applied"]}}\n`;
+        return SUCCESS;
       }
+      if (insertVersion && insertVersion !== manifest.version) {
+        // diff version already applied
+        print`  {grey * ${messages["notion-found"]}: ${messages["version-mismatch"]}}\n`;
+        const replaceEnhancements = //
+          ["Y", "y"].includes(await promptConfirmation(messages["prompt-version-replace"]));
+        print`\n`;
+        return replaceEnhancements ? await interactiveRestoreBackup() : CANCELLED;
+      } else return INCOMPLETE;
+    },
+    interactiveApplyEnhancements = async () => {
+      if (appPath.endsWith(".asar")) {
+        print`  {grey * ${messages["notion-is-packed"]}} `;
+        // asar blocks thread = spinner won't actually spin
+        // first frame at least can serve as waiting indicator
+        startSpinner();
+        unpackApp();
+        stopSpinner();
+      }
+      // backup is used to restore app to pre-enhanced state
+      // new backup should be taken every enhancement
+      // e.g. in case old backup was from prev. version of app
+      if (!args["--no-backup"]) {
+        print`  {grey * ${messages["creating-backup"]}} `;
+        startSpinner();
+        await takeBackup();
+        stopSpinner();
+      }
+      print`  {grey * ${messages["inserting-enhancements"]}} `;
+      startSpinner();
+      await applyEnhancements();
+      stopSpinner();
+      print`  {grey * ${messages["version-applied"]}}\n`;
+      return SUCCESS;
+    };
+
+  const interactiveRemoveEnhancements = async () => {
+      if (!appPath) {
+        // notion not installed
+        print`  {red * ${messages["notion-not-found"]}}\n`;
+        return FAILURE;
+      } else if (insertVersion) {
+        print`  {grey * ${messages["notion-found"]}: ${messages["version-applied"]}}\n`;
+        return (await interactiveRestoreBackup()) === INCOMPLETE ? SUCCESS : FAILURE;
+      }
+      print`  {grey * ${messages["notion-found"]}: ${messages["not-applied"]}}\n`;
+      return SUCCESS;
+    },
+    promptCacheRemoval = async () => {
+      // optionally remove ~/.notion-enhancer
+      if (existsSync(cachePath)) {
+        print`  {grey * ${messages["cache-found"]}: ${cachePath}}\n`;
+        if (["Y", "y"].includes(await promptConfirmation(messages["prompt-cache-removal"]))) {
+          print` `;
+          startSpinner();
+          await removeCache();
+          stopSpinner();
+        } else print`\n`;
+      } else print`  {grey * ${messages["cache-not-found"]}}\n`;
+    };
+
+  switch (args["_"][0]) {
+    case "apply": {
+      print`{bold.whiteBright [NOTION-ENHANCER] APPLY}\n`;
+      let res = await canEnhancementsBeApplied();
+      if (res === INCOMPLETE) res = await interactiveApplyEnhancements();
+      print`${res}\n`;
       break;
     }
+    case "remove": {
+      print`{bold.whiteBright [NOTION-ENHANCER] REMOVE}\n`;
+      const res = await interactiveRemoveEnhancements();
+      await promptCacheRemoval();
+      print`${res}\n`;
+      break;
+    }
+    case "check": {
+      if (args["--json"]) {
+        printObject({
+          appPath,
+          backupPath,
+          cachePath,
+          cacheExists: existsSync(cachePath),
+          insertVersion,
+          currentVersion: manifest.version,
+        });
+        process.exit();
+      }
+      print`{bold.whiteBright [NOTION-ENHANCER] CHECK:} `;
+      if (manifest.version === insertVersion) {
+        print`${messages["version-applied"]}\n`;
+      } else if (insertVersion) {
+        print`${messages["version-mismatch"]}\n`;
+      } else if (appPath) {
+        print`${messages["not-applied"]}\n`;
+      } else print`${messages["notion-not-found"]}\n`;
+      break;
+    }
+
     default:
-      displayHelp();
+      printHelp(commands, options);
   }
-} catch (err) {
-  if (lastSpinner) lastSpinner.stop();
-  handleError(err);
-  process.exit(1);
+} catch (error) {
+  const message = error.message.split("\n")[0];
+  if (__debug) {
+    print`{bold.red ${error.name}:} ${message}\n{grey ${error.stack
+      .split("\n")
+      .splice(1)
+      .map((at) => at.replace(/\s{4}/g, "  "))
+      .join("\n")}}`;
+  } else print`{bold.red Error:} ${message} {grey (run with -d for more information)}\n`;
 }
diff --git a/insert/api b/insert/api
deleted file mode 160000
index 9815d73..0000000
--- a/insert/api
+++ /dev/null
@@ -1 +0,0 @@
-Subproject commit 9815d73b9277e96864654a8d8dd48762039c9845
diff --git a/insert/dep b/insert/dep
deleted file mode 160000
index 1a47625..0000000
--- a/insert/dep
+++ /dev/null
@@ -1 +0,0 @@
-Subproject commit 1a4762550fe185706be26678f734b0475066c3e4
diff --git a/insert/media b/insert/media
deleted file mode 160000
index 2a0a179..0000000
--- a/insert/media
+++ /dev/null
@@ -1 +0,0 @@
-Subproject commit 2a0a17998385f1d86148b9213451b3a5deff6bae
diff --git a/insert/repo b/insert/repo
deleted file mode 160000
index 3a67243..0000000
--- a/insert/repo
+++ /dev/null
@@ -1 +0,0 @@
-Subproject commit 3a67243fd5caec24b484276e563bdb8da7a0adcd
diff --git a/package.json b/package.json
index b837521..4052aa9 100644
--- a/package.json
+++ b/package.json
@@ -1,28 +1,25 @@
 {
   "name": "notion-enhancer",
-  "version": "0.11.0",
+  "version": "0.11.1-dev",
   "author": "dragonwocky <thedragonring.bod@gmail.com> (https://dragonwocky.me/)",
   "description": "an enhancer/customiser for the all-in-one productivity workspace notion.so",
-  "homepage": "https://github.com/notion-enhancer/desktop",
+  "homepage": "https://notion-enhancer.github.io",
+  "repository": "github:notion-enhancer/desktop",
+  "bugs": "https://github.com/notion-enhancer/desktop/issues",
+  "funding": "https://github.com/sponsors/dragonwocky",
   "license": "MIT",
-  "bin": {
-    "notion-enhancer": "bin.mjs"
-  },
+  "bin": "bin.mjs",
   "type": "module",
+  "scripts": {
+    "build-ext": "./scripts/build-browser-extension.sh"
+  },
   "engines": {
     "node": ">=16.x.x"
   },
-  "scripts": {
-    "test": "echo \"no test specified\"",
-    "preuninstall": "node bin.js remove -n"
-  },
   "dependencies": {
-    "asar": "^3.1.0",
-    "chalk": "^4.1.2"
-  },
-  "repository": {
-    "type": "git",
-    "url": "git+https://github.com/notion-enhancer/desktop.git"
+    "@electron/asar": "^3.2.2",
+    "arg": "^5.0.2",
+    "chalk-template": "^0.4.0"
   },
   "keywords": [
     "windows",
@@ -40,7 +37,5 @@
     "notion",
     "notion-enhancer"
   ],
-  "bugs": {
-    "url": "https://github.com/notion-enhancer/desktop/issues"
-  }
+  "packageManager": "yarn@3.3.0"
 }
diff --git a/pkg/apply.mjs b/pkg/apply.mjs
deleted file mode 100644
index 859e399..0000000
--- a/pkg/apply.mjs
+++ /dev/null
@@ -1,98 +0,0 @@
-/**
- * notion-enhancer
- * (c) 2021 dragonwocky <thedragonring.bod@gmail.com> (https://dragonwocky.me/)
- * (https://notion-enhancer.github.io/) under the MIT license
- */
-
-import fs from 'fs';
-import fsp from 'fs/promises';
-import path from 'path';
-import asar from 'asar';
-
-import { log, line, spinner } from './cli.mjs';
-import { __dirname, pkg, findNotion, copyDir, readDirDeep } from './helpers.mjs';
-
-import check from './check.mjs';
-import remove from './remove.mjs';
-
-export default async function (
-  notionFolder = findNotion(),
-  { overwritePrevious = undefined, patchPrevious = false, takeBackup = true } = {}
-) {
-  let status = check(notionFolder);
-  switch (status.code) {
-    case 0: // not applied
-      break;
-    case 1: // corrupted
-      throw Error(status.message);
-    case 2: // same version already applied
-      if (!patchPrevious) {
-        log`  {grey * notion-enhancer v${status.version} already applied}`;
-        return true;
-      }
-      break;
-    case 3: // diff version already applied
-      log`  * ${status.message}`;
-      const prompt = ['Y', 'y', 'N', 'n', ''],
-        res = prompt.includes(overwritePrevious)
-          ? overwritePrevious
-          : await line.read('  {inverse > overwrite? [Y/n]:} ', prompt);
-      if (res.toLowerCase() === 'n') {
-        log`  * keeping previous version: exiting`;
-        return false;
-      }
-      await remove(notionFolder, { cache: 'n' });
-      status = await check(notionFolder);
-  }
-
-  let s;
-  if (status.executable.endsWith('.asar')) {
-    s = spinner('  * unpacking app files').loop();
-    asar.extractAll(status.executable, status.executable.replace(/\.asar$/, ''));
-    s.stop();
-  }
-  if (status.code === 0 && takeBackup) {
-    s = spinner('  * backing up default app').loop();
-    if (status.executable.endsWith('.asar')) {
-      await fsp.rename(status.executable, status.executable + '.bak');
-      status.executable = status.executable.replace(/\.asar$/, '');
-    } else {
-      await copyDir(status.executable, status.executable + '.bak');
-    }
-    s.stop();
-  }
-
-  s = spinner('  * inserting enhancements').loop();
-  if (status.code === 0) {
-    const notionFiles = (await readDirDeep(status.executable))
-      .map((file) => file.path)
-      .filter((file) => file.endsWith('.js') && !file.includes('node_modules'));
-    for (const file of notionFiles) {
-      const target = file.slice(status.executable.length + 1, -3).replace(/\\/g, '/'),
-        replacer = path.resolve(`${__dirname(import.meta)}/replacers/${target}.mjs`);
-      if (fs.existsSync(replacer)) {
-        await (await import(`./replacers/${target}.mjs`)).default(file);
-      }
-      await fsp.appendFile(
-        file,
-        `\n\n//notion-enhancer\nrequire('notion-enhancer')('${target}', exports, (js) => eval(js));`
-      );
-    }
-  }
-  const node_modules = path.resolve(`${status.executable}/node_modules/notion-enhancer`);
-  await copyDir(`${__dirname(import.meta)}/../insert`, node_modules);
-  s.stop();
-
-  s = spinner('  * recording version').loop();
-  await fsp.writeFile(
-    path.resolve(`${node_modules}/package.json`),
-    `{
-      "name": "notion-enhancer",
-      "version": "${pkg().version}",
-      "main": "init.cjs"
-    }`
-  );
-  s.stop();
-
-  return true;
-}
diff --git a/pkg/check.mjs b/pkg/check.mjs
deleted file mode 100644
index 473dc4f..0000000
--- a/pkg/check.mjs
+++ /dev/null
@@ -1,63 +0,0 @@
-/**
- * notion-enhancer
- * (c) 2021 dragonwocky <thedragonring.bod@gmail.com> (https://dragonwocky.me/)
- * (https://notion-enhancer.github.io/) under the MIT license
- */
-
-import fs from 'fs';
-import path from 'path';
-
-import { pkg, findNotion, findEnhancerCache } from './helpers.mjs';
-
-export default function (notionFolder = findNotion()) {
-  const resolvePath = (filepath) => path.resolve(`${notionFolder}/${filepath}`),
-    pathExists = (filepath) => fs.existsSync(resolvePath(filepath)),
-    enhancerVersion = pkg().version;
-
-  const executableApp = pathExists('app'),
-    executableAsar = pathExists('app.asar'),
-    executable = executableApp ? 'app' : executableAsar ? 'app.asar' : undefined,
-    backupApp = pathExists('app.bak'),
-    backupAsar = pathExists('app.asar.bak'),
-    backup = backupApp ? 'app.bak' : backupAsar ? 'app.asar.bak' : undefined,
-    insert = pathExists('app/node_modules/notion-enhancer'),
-    insertVersion = insert
-      ? pkg(resolvePath('app/node_modules/notion-enhancer/package.json')).version
-      : undefined,
-    insertCache = findEnhancerCache();
-
-  const res = {
-    executable: executable ? resolvePath(executable) : undefined,
-    backup: backup ? resolvePath(backup) : undefined,
-    cache: fs.existsSync(insertCache) ? insertCache : undefined,
-    installation: path.resolve(
-      resolvePath('.')
-        .split(path.sep)
-        .reduceRight((prev, val) => {
-          if (val.toLowerCase().includes('notion') || prev.toLowerCase().includes('notion'))
-            prev = `${val}/${prev}`;
-          return prev;
-        }, '')
-    ),
-  };
-  if (insert) {
-    if (insertVersion === enhancerVersion) {
-      res.code = 2;
-      res.version = enhancerVersion;
-      res.message = `notion-enhancer v${enhancerVersion} applied.`;
-    } else {
-      res.code = 3;
-      res.version = insertVersion;
-      res.message = `notion-enhancer v${insertVersion} found applied != v${enhancerVersion} package.`;
-    }
-  } else {
-    if (executable) {
-      res.code = 0;
-      res.message = 'notion-enhancer has not been applied.';
-    } else {
-      res.code = 1;
-      res.message = 'notion installation has been corrupted, no executable found.';
-    }
-  }
-  return res;
-}
diff --git a/pkg/cli.mjs b/pkg/cli.mjs
deleted file mode 100644
index 08d21a8..0000000
--- a/pkg/cli.mjs
+++ /dev/null
@@ -1,142 +0,0 @@
-/**
- * notion-enhancer
- * (c) 2021 dragonwocky <thedragonring.bod@gmail.com> (https://dragonwocky.me/)
- * (https://notion-enhancer.github.io/) under the MIT license
- */
-
-'use strict';
-
-import chalk from 'chalk';
-
-export const log = (strs, ...tags) => {
-  if (!Array.isArray(strs)) strs = [strs];
-  if (!strs.raw) strs.raw = [...strs];
-  console.log(chalk(strs, ...tags));
-};
-
-export const cursor = {
-  hide: () => process.stdout.write('\x1b[?25l'),
-  show: () => process.stdout.write('\x1b[?25h'),
-};
-
-export const line = {
-  clear: () => process.stdout.write('\r\x1b[K'),
-  backspace: (n = 1) => process.stdout.write('\b'.repeat(n)),
-  write: (string) => process.stdout.write(string),
-  prev: (n = 1) => process.stdout.write(`\x1b[${n}A`),
-  next: (n = 1) => process.stdout.write(`\x1b[${n}B`),
-  forward: (n = 1) => process.stdout.write(`\x1b[${n}C`),
-  back: (n = 1) => process.stdout.write(`\x1b[${n}D`),
-  new: () => process.stdout.write('\n'),
-  async read(prompt = '', values = []) {
-    let input = '';
-    prompt = [prompt];
-    prompt.raw = [prompt[0]];
-    prompt = chalk(prompt);
-    this.new();
-    do {
-      this.prev();
-      this.clear();
-      this.write(prompt);
-      input = await new Promise((res, rej) => {
-        process.stdin.resume();
-        process.stdin.setEncoding('utf8');
-        process.stdin.once('data', (key) => {
-          process.stdin.pause();
-          res(key.slice(0, -1));
-        });
-      });
-    } while (values.length && !values.includes(input));
-    return input;
-  },
-};
-
-export let lastSpinner;
-
-export const spinner = (
-  message,
-  frames = ['⠋', '⠙', '⠹', '⠸', '⠼', '⠴', '⠦', '⠧', '⠇', '⠏'],
-  complete = '→'
-) => {
-  if (lastSpinner?.interval) lastSpinner.stop();
-  const spinner = {
-    interval: undefined,
-    i: 0,
-    step() {
-      this.i = (this.i + 1) % frames.length;
-      line.backspace(3);
-      line.write(chalk` {bold.yellow ${frames[this.i]}} `);
-      cursor.hide();
-      return this;
-    },
-    loop(ms = 80) {
-      if (this.interval) clearInterval(this.interval);
-      this.interval = setInterval(() => this.step(), ms);
-      return this;
-    },
-    stop() {
-      if (this.interval) {
-        clearInterval(this.interval);
-        this.interval = undefined;
-      }
-      line.backspace(3);
-      line.write(chalk` {bold.yellow ${complete}}\n`);
-      cursor.show();
-      return this;
-    },
-  };
-  line.write(chalk`${message} {bold.yellow ${frames[spinner.i]}} `);
-  lastSpinner = spinner;
-  return spinner;
-};
-
-export const args = () => process.argv.slice(2).filter((arg) => !arg.startsWith('-'));
-
-export const options = (aliases = {}) => {
-  return new Map(
-    process.argv
-      .slice(2)
-      .filter((arg) => arg.startsWith('-'))
-      .map((arg) => {
-        let opt,
-          val = true;
-        if (arg.startsWith('--')) {
-          if (arg.includes('=')) {
-            [opt, val] = arg.slice(2).split(/=((.+)|$)/);
-          } else opt = arg.slice(2);
-        } else {
-          opt = arg.slice(1);
-        }
-        if (parseInt(val).toString() === val) val = +val;
-        if (aliases[opt]) opt = aliases[opt];
-        return [opt, val];
-      })
-  );
-};
-
-export const help = ({
-  name = process.argv[1].split('/').reverse()[0],
-  usage = `${name} <command> [options]`,
-  version = '',
-  link = '',
-  commands = [],
-  options = [],
-}) => {
-  if (version) version = ' v' + version;
-  const cmdPad = Math.max(...commands.map((cmd) => cmd[0].length)),
-    optPad = Math.max(...options.map((opt) => opt[0].length));
-  commands = commands
-    .map((cmd) => `  ${cmd[0].padEnd(cmdPad)}  ${chalk`{grey :}`}  ${cmd[1]}`)
-    .join('\n');
-  options = options
-    .map((opt) => `  ${opt[0].padEnd(optPad)}  ${chalk`{grey :}`}  ${opt[1]}`)
-    .join('\n');
-  log`{bold.rgb(245,245,245) ${name}${version}}`;
-  if (link) log`{grey ${link}}`;
-  log`\n{bold.rgb(245,245,245) USAGE}`;
-  log`{yellow $} ${usage}`;
-  log`\n{bold.rgb(245,245,245) COMMANDS}`;
-  log`${commands}`;
-  log`\n{bold.rgb(245,245,245) OPTIONS}`;
-  log`${options}`;
-};
diff --git a/pkg/helpers.mjs b/pkg/helpers.mjs
deleted file mode 100644
index ff05f7d..0000000
--- a/pkg/helpers.mjs
+++ /dev/null
@@ -1,110 +0,0 @@
-/**
- * notion-enhancer
- * (c) 2021 dragonwocky <thedragonring.bod@gmail.com> (https://dragonwocky.me/)
- * (https://notion-enhancer.github.io/) under the MIT license
- */
-
-import os from 'os';
-import fs from 'fs';
-import fsp from 'fs/promises';
-import path from 'path';
-import { fileURLToPath } from 'url';
-import { execSync } from 'child_process';
-
-export const __dirname = (meta) => path.dirname(fileURLToPath(meta.url));
-
-export const pkg = (filepath = `${__dirname(import.meta)}/../package.json`) => {
-  try {
-    return JSON.parse(fs.readFileSync(path.resolve(filepath)));
-  } catch {
-    return {};
-  }
-};
-
-export const platform =
-  process.platform === 'linux' && os.release().toLowerCase().includes('microsoft')
-    ? 'wsl'
-    : process.platform;
-
-let __notion;
-export const findNotion = () => {
-  if (__notion) return __notion;
-  switch (platform) {
-    case 'darwin':
-      __notion = '';
-      const userInstall = `/Users/${process.env.USER}/Applications/Notion.app/Contents/Resources`,
-        globalInstall = '/Applications/Notion.app/Contents/Resources';
-      if (fs.existsSync(userInstall)) {
-        __notion = userInstall;
-      } else if (fs.existsSync(globalInstall)) {
-        __notion = globalInstall;
-      }
-      break;
-    case 'win32':
-      __notion = process.env.LOCALAPPDATA + '\\Programs\\Notion\\resources';
-      break;
-    case 'wsl':
-      const [drive, ...windowsPath] = execSync('cmd.exe /c echo %localappdata%', {
-        encoding: 'utf8',
-        stdio: 'pipe',
-      });
-      __notion = `/mnt/${drive.toLowerCase()}${windowsPath
-        .slice(1, -2)
-        .join('')
-        .replace(/\\/g, '/')}/Programs/Notion/resources`;
-      break;
-    case 'linux':
-      // https://aur.archlinux.org/packages/notion-app/
-      if (fs.existsSync('/opt/notion-app')) __notion = '/opt/notion-app';
-  }
-  return __notion;
-};
-
-let __enhancerCache;
-export const findEnhancerCache = () => {
-  if (__enhancerCache) return __enhancerCache;
-  let home = os.homedir();
-  if (platform === 'wsl') {
-    const [drive, ...windowsPath] = execSync('cmd.exe /c echo %systemdrive%%homepath%', {
-      encoding: 'utf8',
-      stdio: 'pipe',
-    });
-    home = `/mnt/${drive.toLowerCase()}${windowsPath
-      .slice(1, -2)
-      .join('')
-      .replace(/\\/g, '/')}`;
-  }
-  __enhancerCache = path.resolve(`${home}/.notion-enhancer`);
-  return __enhancerCache;
-};
-
-export const copyDir = async (src, dest) => {
-  src = path.resolve(src);
-  dest = path.resolve(dest);
-  if (!fs.existsSync(dest)) await fsp.mkdir(dest);
-  for (let file of await fsp.readdir(src)) {
-    const stat = await fsp.lstat(path.join(src, file));
-    if (stat.isDirectory()) {
-      await copyDir(path.join(src, file), path.join(dest, file));
-    } else if (stat.isSymbolicLink()) {
-      await fsp.symlink(await fsp.readlink(path.join(src, file)), path.join(dest, file));
-    } else await fsp.copyFile(path.join(src, file), path.join(dest, file));
-  }
-  return true;
-};
-
-export const readDirDeep = async (dir) => {
-  dir = path.resolve(dir);
-  let files = [];
-  for (let file of await fsp.readdir(dir)) {
-    if (['node_modules', '.git'].includes(file)) continue;
-    file = path.join(dir, file);
-    const stat = await fsp.lstat(file);
-    if (stat.isDirectory()) {
-      files = files.concat(await readDirDeep(file));
-    } else if (stat.isSymbolicLink()) {
-      files.push({ type: 'symbolic', path: file });
-    } else files.push({ type: 'file', path: file });
-  }
-  return files;
-};
diff --git a/pkg/remove.mjs b/pkg/remove.mjs
deleted file mode 100644
index de164f8..0000000
--- a/pkg/remove.mjs
+++ /dev/null
@@ -1,48 +0,0 @@
-/**
- * notion-enhancer
- * (c) 2021 dragonwocky <thedragonring.bod@gmail.com> (https://dragonwocky.me/)
- * (https://notion-enhancer.github.io/) under the MIT license
- */
-
-import fsp from 'fs/promises';
-
-import { log, spinner, line } from './cli.mjs';
-import { findNotion } from './helpers.mjs';
-
-import check from './check.mjs';
-
-export default async function (notionFolder = findNotion(), { delCache = undefined } = {}) {
-  const status = check(notionFolder);
-
-  let s;
-  if (status.code > 1 && status.executable) {
-    s = spinner('  * removing enhancements').loop();
-    await fsp.rm(status.executable, { recursive: true });
-    s.stop();
-  } else log`  {grey * enhancements not found: skipping}`;
-
-  if (status.backup) {
-    s = spinner('  * restoring backup').loop();
-    await fsp.rename(status.backup, status.backup.replace(/\.bak$/, ''));
-    s.stop();
-  } else log`  {grey * backup not found: skipping}`;
-
-  if (status.cache) {
-    log`  * enhancer cache found: ${status.cache}`;
-    const prompt = ['Y', 'y', 'N', 'n', ''];
-    let res;
-    if (prompt.includes(delCache)) {
-      res = delCache;
-      log`  {inverse > delete? [Y/n]:} ${delCache} {grey (auto-filled)}`;
-    } else res = await line.read('  {inverse > delete? [Y/n]:} ', prompt);
-    if (res.toLowerCase() === 'n') {
-      log`  * keeping enhancer cache`;
-    } else {
-      s = spinner('  * deleting enhancer cache').loop();
-      await fsp.rm(status.cache, { recursive: true });
-      s.stop();
-    }
-  } else log`  {grey * enhancer cache not found: skipping}`;
-
-  return true;
-}
diff --git a/pkg/replacers/main/main.mjs b/pkg/replacers/main/main.mjs
deleted file mode 100644
index 617e126..0000000
--- a/pkg/replacers/main/main.mjs
+++ /dev/null
@@ -1,23 +0,0 @@
-/**
- * notion-enhancer
- * (c) 2021 dragonwocky <thedragonring.bod@gmail.com> (https://dragonwocky.me/)
- * (https://notion-enhancer.github.io/) under the MIT license
- */
-
-'use strict';
-
-import fsp from 'fs/promises';
-
-export default async function (filepath) {
-  // https://github.com/notion-enhancer/desktop/issues/160
-  // enable the notion:// url scheme/protocol on linux
-  const contents = await fsp.readFile(filepath, 'utf8');
-  await fsp.writeFile(
-    filepath,
-    contents.replace(
-      /process.platform === "win32"/g,
-      'process.platform === "win32" || process.platform === "linux"'
-    )
-  );
-  return true;
-}
diff --git a/pkg/replacers/main/schemeHandler.mjs b/pkg/replacers/main/schemeHandler.mjs
deleted file mode 100644
index 02251dd..0000000
--- a/pkg/replacers/main/schemeHandler.mjs
+++ /dev/null
@@ -1,45 +0,0 @@
-/**
- * notion-enhancer
- * (c) 2021 dragonwocky <thedragonring.bod@gmail.com> (https://dragonwocky.me/)
- * (https://notion-enhancer.github.io/) under the MIT license
- */
-
-'use strict';
-
-import fsp from 'fs/promises';
-
-export default async function (filepath) {
-  // https://github.com/notion-enhancer/desktop/issues/291
-  // bypass csp issues by intercepting notion:// protocol
-  const contents = await fsp.readFile(filepath, 'utf8');
-  await fsp.writeFile(
-    filepath,
-    contents.replace(
-      /const success = protocol\.registerStreamProtocol\(config_1.default.protocol, async \(req, callback\) => \{/,
-      `const success = protocol.registerStreamProtocol(config_1.default.protocol, async (req, callback) => {
-      {
-        // notion-enhancer
-        const schemePrefix = 'notion://www.notion.so/__notion-enhancer/';
-        if (req.url.startsWith(schemePrefix)) {
-          const { search, hash, pathname } = new URL(req.url),
-            resolvePath = (path) => require('path').resolve(\`\${__dirname}/\${path}\`),
-            fileExt = pathname.split('.').reverse()[0],
-            mimeDB = Object.entries(require('notion-enhancer/dep/mime-db.json')),
-            mimeType = mimeDB
-              .filter(([mime, data]) => data.extensions)
-              .find(([mime, data]) => data.extensions.includes(fileExt));
-          let filePath = '../node_modules/notion-enhancer/';
-          filePath += req.url.slice(schemePrefix.length);
-          if (search) filePath = filePath.slice(0, -search.length);
-          if (hash) filePath = filePath.slice(0, -hash.length);
-          callback({
-            data: require('fs').createReadStream(resolvePath(filePath)),
-            headers: { 'content-type': mimeType },
-          });
-        }
-      }`
-    )
-  );
-
-  return true;
-}
diff --git a/pkg/replacers/main/systemMenu.mjs b/pkg/replacers/main/systemMenu.mjs
deleted file mode 100644
index f5d18ea..0000000
--- a/pkg/replacers/main/systemMenu.mjs
+++ /dev/null
@@ -1,22 +0,0 @@
-/**
- * notion-enhancer
- * (c) 2021 dragonwocky <thedragonring.bod@gmail.com> (https://dragonwocky.me/)
- * (https://notion-enhancer.github.io/) under the MIT license
- */
-
-'use strict';
-
-import fsp from 'fs/promises';
-
-export default async function (filepath) {
-  // so that e.g. tabs access and modify the template
-  const contents = await fsp.readFile(filepath, 'utf8');
-  await fsp.writeFile(
-    filepath,
-    contents.replace(
-      /electron_1\.Menu\.setApplicationMenu\(menu\);/g,
-      'electron_1.Menu.setApplicationMenu(menu); return template;'
-    )
-  );
-  return true;
-}
diff --git a/scripts/build-browser-extension.sh b/scripts/build-browser-extension.sh
new file mode 100755
index 0000000..0150883
--- /dev/null
+++ b/scripts/build-browser-extension.sh
@@ -0,0 +1,8 @@
+#!/usr/bin/env bash
+
+version=$(node -p "require('./package.json').version")
+
+cd src
+mkdir -p ../dist
+rm -f "../dist/notion-enhancer-$version.zip"
+zip -r9 "../dist/notion-enhancer-$version.zip" . -x electron/\*
\ No newline at end of file
diff --git a/scripts/enhance-desktop-app.mjs b/scripts/enhance-desktop-app.mjs
new file mode 100755
index 0000000..f95bbdb
--- /dev/null
+++ b/scripts/enhance-desktop-app.mjs
@@ -0,0 +1,189 @@
+/**
+ * notion-enhancer
+ * (c) 2022 dragonwocky <thedragonring.bod@gmail.com> (https://dragonwocky.me/)
+ * (https://notion-enhancer.github.io/) under the MIT license
+ */
+
+import asar from "@electron/asar";
+import os from "node:os";
+import { promises as fsp, existsSync } from "node:fs";
+import { fileURLToPath } from "node:url";
+import { join, resolve } from "node:path";
+import { execSync } from "node:child_process";
+import { createRequire } from "node:module";
+
+import patch from "./patch-desktop-app.mjs";
+
+let __notionResources, __enhancerCache;
+const nodeRequire = createRequire(import.meta.url),
+  manifest = nodeRequire("../package.json"),
+  platform =
+    process.platform === "linux" && os.release().toLowerCase().includes("microsoft")
+      ? "wsl"
+      : process.platform,
+  polyfillWslEnv = (name) => {
+    if (platform !== "wsl" || process.env[name]) return process.env[name];
+    // adds a windows environment variable to process.env
+    // in a wsl environment, inc. path conversion
+    const value = execSync(`cmd.exe /c echo %${name}%`, {
+        encoding: "utf8",
+        stdio: "pipe",
+      }).trim(),
+      isAbsolutePath = /^[a-zA-Z]:[\\\/]/.test(value),
+      onSystemDrive = /^[\\\/]/.test(value);
+    if (isAbsolutePath) {
+      // e.g. C:\Program Files
+      const drive = value[0].toLowerCase(),
+        path = value.slice(2).replace(/\\/g, "/");
+      process.env[name] = `/mnt/${drive}${path}`;
+    } else if (onSystemDrive) {
+      // e.g. \Program Files
+      const drive = polyfillWslEnv("SYSTEMDRIVE")[0].toLowerCase(),
+        path = value.replace(/\\/g, "/");
+      process.env[name] = `/mnt/${drive}${path}`;
+    } else process.env[name] = value;
+    return process.env[name];
+  },
+  readdirDeep = async (dir) => {
+    dir = resolve(dir);
+    let files = [];
+    for (let file of await fsp.readdir(dir)) {
+      if (["node_modules", ".git"].includes(file)) continue;
+      file = join(dir, file);
+      const stat = await fsp.lstat(file);
+      if (stat.isDirectory()) {
+        files = files.concat(await readdirDeep(file));
+      } else if (stat.isSymbolicLink()) {
+        //
+      } else files.push(file);
+    }
+    return files;
+  };
+
+const setNotionPath = (path) => {
+    // sets notion resource path to user provided value
+    // e.g. with the --path cli option
+    __notionResources = path;
+  },
+  getResourcePath = (path) => {
+    if (__notionResources) return resolve(`${__notionResources}/${path}`);
+    polyfillWslEnv("LOCALAPPDATA");
+    polyfillWslEnv("PROGRAMW6432");
+    const potentialPaths = [
+      // [["targeted", "platforms"], "/path/to/notion/resources"]
+      [["darwin"], `/Users/${process.env.USER}/Applications/Notion.app/Contents/Resources`],
+      [["darwin"], "/Applications/Notion.app/Contents/Resources"],
+      [["win32", "wsl"], resolve(`${process.env.LOCALAPPDATA}/Programs/Notion/resources`)],
+      [["win32", "wsl"], resolve(`${process.env.PROGRAMW6432}/Notion/resources`)],
+      // https://aur.archlinux.org/packages/notion-app/
+      [["linux"], "/opt/notion-app"],
+    ];
+    for (const [targetPlatforms, testPath] of potentialPaths) {
+      if (!targetPlatforms.includes(platform)) continue;
+      if (!existsSync(testPath)) continue;
+      __notionResources = testPath;
+      return resolve(`${__notionResources}/${path}`);
+    }
+  },
+  // prefer unpacked if both exist
+  getAppPath = () => ["app", "app.asar"].map(getResourcePath).find(existsSync),
+  getBackupPath = () => ["app.bak", "app.asar.bak"].map(getResourcePath).find(existsSync),
+  getCachePath = () => {
+    if (__enhancerCache) return __enhancerCache;
+    const home = platform === "wsl" ? polyfillWslEnv("HOMEPATH") : os.homedir();
+    __enhancerCache = resolve(`${home}/.notion-enhancer`);
+    return __enhancerCache;
+  },
+  checkEnhancementVersion = () => {
+    const manifestPath = getResourcePath("app/node_modules/notion-enhancer/package.json");
+    if (!existsSync(manifestPath)) return undefined;
+    const insertVersion = nodeRequire(manifestPath).version;
+    return insertVersion;
+  };
+
+const unpackApp = () => {
+    const appPath = getAppPath();
+    if (!appPath || !appPath.endsWith("asar")) return false;
+    // asar reads synchronously
+    asar.extractAll(appPath, appPath.replace(/\.asar$/, ""));
+    return true;
+  },
+  applyEnhancements = async () => {
+    const appPath = getAppPath();
+    if (!appPath || appPath.endsWith("asar")) return false;
+    const srcPath = fileURLToPath(new URL("../src", import.meta.url)),
+      insertPath = getResourcePath("app/node_modules/notion-enhancer");
+    if (existsSync(insertPath)) await fsp.rm(insertPath, { recursive: true });
+    // insert the notion-enhancer/src folder into notion's node_modules folder
+    const excludedDests = [
+      getResourcePath("app/node_modules/notion-enhancer/browser"),
+      getResourcePath("app/node_modules/notion-enhancer/manifest.json"),
+    ];
+    await fsp.cp(srcPath, insertPath, {
+      recursive: true,
+      // exclude browser-specific files
+      filter: (_, dest) => !excludedDests.includes(dest),
+    });
+    // call patch-desktop-app.mjs on each file
+    const notionScripts = (await readdirDeep(appPath)).filter((file) => file.endsWith(".js")),
+      scriptUpdates = [];
+    for (const file of notionScripts) {
+      const scriptId = file.slice(appPath.length + 1, -3).replace(/\\/g, "/"),
+        scriptContent = await fsp.readFile(file, { encoding: "utf8" }),
+        patchedContent = await patch(scriptId, scriptContent),
+        changesMade = patchedContent !== scriptContent;
+      if (changesMade) scriptUpdates.push(fsp.writeFile(file, patchedContent));
+    }
+    // create package.json
+    const manifestPath = getResourcePath("app/node_modules/notion-enhancer/package.json"),
+      insertManifest = { ...manifest, main: "electron/init.cjs" };
+    // remove cli-specific fields
+    delete insertManifest.bin;
+    delete insertManifest.type;
+    delete insertManifest.engines;
+    delete insertManifest.dependencies;
+    delete insertManifest.packageManager;
+    scriptUpdates.push(fsp.writeFile(manifestPath, JSON.stringify(insertManifest)));
+    await Promise.all(scriptUpdates);
+    return true;
+  },
+  takeBackup = async () => {
+    const appPath = getAppPath();
+    if (!appPath) return false;
+    const backupPath = getBackupPath();
+    if (backupPath) await fsp.rm(backupPath, { recursive: true });
+    const destPath = `${appPath}.bak`;
+    if (!appPath.endsWith(".asar")) {
+      await fsp.cp(appPath, destPath, { recursive: true });
+    } else await fsp.rename(appPath, destPath);
+    return true;
+  },
+  restoreBackup = async () => {
+    const backupPath = getBackupPath();
+    if (!backupPath) return false;
+    const destPath = backupPath.replace(/\.bak$/, "");
+    if (existsSync(destPath)) await fsp.rm(destPath, { recursive: true });
+    await fsp.rename(backupPath, destPath);
+    const appPath = getAppPath();
+    if (destPath !== appPath) await fsp.rm(appPath, { recursive: true });
+    return true;
+  },
+  removeCache = async () => {
+    if (!existsSync(getCachePath())) return;
+    await fsp.rm(getCachePath());
+    return true;
+  };
+
+export {
+  getResourcePath,
+  getAppPath,
+  getBackupPath,
+  getCachePath,
+  checkEnhancementVersion,
+  setNotionPath,
+  unpackApp,
+  applyEnhancements,
+  takeBackup,
+  restoreBackup,
+  removeCache,
+};
diff --git a/scripts/patch-desktop-app.mjs b/scripts/patch-desktop-app.mjs
new file mode 100755
index 0000000..10ee885
--- /dev/null
+++ b/scripts/patch-desktop-app.mjs
@@ -0,0 +1,67 @@
+/**
+ * notion-enhancer
+ * (c) 2022 dragonwocky <thedragonring.bod@gmail.com> (https://dragonwocky.me/)
+ * (https://notion-enhancer.github.io/) under the MIT license
+ */
+
+const patches = {
+  "*": async (scriptId, scriptContent) => {
+    const prevTriggerFound = /require\(['|"]notion-enhancer['|"]\)/.test(scriptContent);
+    if (prevTriggerFound) return scriptContent;
+    const enhancerTrigger =
+      '\n\n/*notion-enhancer*/require("notion-enhancer")' +
+      `('${scriptId}',exports,(js)=>eval(js));`;
+    return scriptContent + enhancerTrigger;
+  },
+
+  "main/main": async (scriptContent) => {
+    // https://github.com/notion-enhancer/desktop/issues/160
+    // enable the notion:// url scheme/protocol on linux
+    const searchValue = /process.platform === "win32"/g,
+      replaceValue = 'process.platform === "win32" || process.platform === "linux"';
+    if (scriptContent.includes(replaceValue)) return scriptContent;
+    return scriptContent.replace(searchValue, replaceValue);
+  },
+
+  "main/schemeHandler": async (scriptContent) => {
+    // https://github.com/notion-enhancer/desktop/issues/291
+    // bypass csp issues by intercepting notion:// protocol
+    const searchValue =
+        "protocol.registerStreamProtocol(config_1.default.protocol, async (req, callback) => {",
+      replaceValue = `${searchValue}
+        { /* notion-enhancer */
+        const schemePrefix = "notion://www.notion.so/__notion-enhancer/";
+        if (req.url.startsWith(schemePrefix)) {
+            const { search, hash, pathname } = new URL(req.url),
+            fileExt = pathname.split(".").reverse()[0],
+            filePath = \`../node_modules/notion-enhancer/\${req.url.slice(
+                schemePrefix.length,
+                -(search.length + hash.length)
+            )}\`,
+            mimeType = Object.entries(require("notion-enhancer/dep/mime-db.json"))
+                .filter(([_, data]) => data.extensions)
+                .find(([_, data]) => data.extensions.includes(fileExt));
+            callback({
+              data: require("fs").createReadStream(require("path").resolve(\`\${__dirname}/\${filePath}\`)),
+              headers: { "content-type": mimeType },
+            });
+        }
+        }`;
+    if (scriptContent.includes(replaceValue)) return scriptContent;
+    return scriptContent.replace(searchValue, replaceValue);
+  },
+
+  "main/systemMenu": async (scriptContent) => {
+    // exposes template for modification
+    const searchValue = "electron_1.Menu.setApplicationMenu(menu);",
+      replaceValue = `${searchValue} return template;`;
+    if (scriptContent.includes(replaceValue)) return scriptContent;
+    return scriptContent.replace(searchValue, replaceValue);
+  },
+};
+
+export default async (scriptId, scriptContent) => {
+  if (patches["*"]) scriptContent = await patches["*"](scriptId, scriptContent);
+  if (patches[scriptId]) scriptContent = await patches[scriptId](scriptContent);
+  return scriptContent;
+};
diff --git a/src/browser/LICENSE b/src/browser/LICENSE
new file mode 100644
index 0000000..b503961
--- /dev/null
+++ b/src/browser/LICENSE
@@ -0,0 +1,21 @@
+MIT License
+
+Copyright (c) 2021 dragonwocky <thedragonring.bod@gmail.com> (https://dragonwocky.me/)
+
+Permission is hereby granted, free of charge, to any person obtaining a copy
+of this software and associated documentation files (the "Software"), to deal
+in the Software without restriction, including without limitation the rights
+to use, copy, modify, merge, publish, distribute, sublicense, and/or sell
+copies of the Software, and to permit persons to whom the Software is
+furnished to do so, subject to the following conditions:
+
+The above copyright notice and this permission notice shall be included in all
+copies or substantial portions of the Software.
+
+THE SOFTWARE IS PROVIDED "AS IS", WITHOUT WARRANTY OF ANY KIND, EXPRESS OR
+IMPLIED, INCLUDING BUT NOT LIMITED TO THE WARRANTIES OF MERCHANTABILITY,
+FITNESS FOR A PARTICULAR PURPOSE AND NONINFRINGEMENT. IN NO EVENT SHALL THE
+AUTHORS OR COPYRIGHT HOLDERS BE LIABLE FOR ANY CLAIM, DAMAGES OR OTHER
+LIABILITY, WHETHER IN AN ACTION OF CONTRACT, TORT OR OTHERWISE, ARISING FROM,
+OUT OF OR IN CONNECTION WITH THE SOFTWARE OR THE USE OR OTHER DEALINGS IN THE
+SOFTWARE.
diff --git a/src/browser/README.md b/src/browser/README.md
new file mode 100644
index 0000000..420700e
--- /dev/null
+++ b/src/browser/README.md
@@ -0,0 +1,5 @@
+# notion-enhancer/extension
+
+an enhancer/customiser for the all-in-one productivity workspace notion.so (browser)
+
+[read the docs online](https://notion-enhancer.github.io/)
diff --git a/src/browser/env/env.mjs b/src/browser/env/env.mjs
new file mode 100644
index 0000000..17c905d
--- /dev/null
+++ b/src/browser/env/env.mjs
@@ -0,0 +1,41 @@
+/*
+ * notion-enhancer: api
+ * (c) 2021 dragonwocky <thedragonring.bod@gmail.com> (https://dragonwocky.me/)
+ * (https://notion-enhancer.github.io/) under the MIT license
+ */
+
+'use strict';
+
+/** environment-specific methods and constants */
+
+/**
+ * the environment/platform name code is currently being executed in
+ * @constant
+ * @type {string}
+ */
+export const name = 'extension';
+
+/**
+ * the current version of the enhancer
+ * @constant
+ * @type {string}
+ */
+export const version = chrome.runtime.getManifest().version;
+
+/**
+ * open the enhancer's menu
+ * @type {function}
+ */
+export const focusMenu = () => chrome.runtime.sendMessage({ action: 'focusMenu' });
+
+/**
+ * focus an active notion tab
+ * @type {function}
+ */
+export const focusNotion = () => chrome.runtime.sendMessage({ action: 'focusNotion' });
+
+/**
+ * reload all notion and enhancer menu tabs to apply changes
+ * @type {function}
+ */
+export const reload = () => chrome.runtime.sendMessage({ action: 'reload' });
diff --git a/src/browser/env/fs.mjs b/src/browser/env/fs.mjs
new file mode 100644
index 0000000..020a37d
--- /dev/null
+++ b/src/browser/env/fs.mjs
@@ -0,0 +1,48 @@
+/*
+ * notion-enhancer: api
+ * (c) 2021 dragonwocky <thedragonring.bod@gmail.com> (https://dragonwocky.me/)
+ * (https://notion-enhancer.github.io/) under the MIT license
+ */
+
+'use strict';
+
+/** environment-specific file reading */
+
+/**
+ * transform a path relative to the enhancer root directory into an absolute path
+ * @param {string} path - a url or within-the-enhancer filepath
+ * @returns {string} an absolute filepath
+ */
+export const localPath = chrome.runtime.getURL;
+
+/**
+ * fetch and parse a json file's contents
+ * @param {string} path - a url or within-the-enhancer filepath
+ * @param {object=} opts - the second argument of a fetch() request
+ * @returns {object} the json value of the requested file as a js object
+ */
+export const getJSON = (path, opts = {}) =>
+  fetch(path.startsWith('http') ? path : localPath(path), opts).then((res) => res.json());
+
+/**
+ * fetch a text file's contents
+ * @param {string} path - a url or within-the-enhancer filepath
+ * @param {object=} opts - the second argument of a fetch() request
+ * @returns {string} the text content of the requested file
+ */
+export const getText = (path, opts = {}) =>
+  fetch(path.startsWith('http') ? path : localPath(path), opts).then((res) => res.text());
+
+/**
+ * check if a file exists
+ * @param {string} path - a url or within-the-enhancer filepath
+ * @returns {boolean} whether or not the file exists
+ */
+export const isFile = async (path) => {
+  try {
+    await fetch(path.startsWith('http') ? path : localPath(path));
+    return true;
+  } catch {
+    return false;
+  }
+};
diff --git a/src/browser/env/storage.mjs b/src/browser/env/storage.mjs
new file mode 100644
index 0000000..0018513
--- /dev/null
+++ b/src/browser/env/storage.mjs
@@ -0,0 +1,116 @@
+/*
+ * notion-enhancer: api
+ * (c) 2021 dragonwocky <thedragonring.bod@gmail.com> (https://dragonwocky.me/)
+ * (https://notion-enhancer.github.io/) under the MIT license
+ */
+
+'use strict';
+
+/** environment-specific data persistence */
+
+const _queue = [],
+  _onChangeListeners = [];
+
+/**
+ * get persisted data
+ * @param {string[]} path - the path of keys to the value being fetched
+ * @param {unknown=} fallback - a default value if the path is not matched
+ * @returns {Promise} value ?? fallback
+ */
+export const get = (path, fallback = undefined) => {
+  if (!path.length) return fallback;
+  return new Promise((res, rej) =>
+    chrome.storage.local.get(async (values) => {
+      let value = values;
+      while (path.length) {
+        if (value === undefined) {
+          value = fallback;
+          break;
+        }
+        value = value[path.shift()];
+      }
+      res(value ?? fallback);
+    })
+  );
+};
+
+/**
+ * persist data
+ * @param {string[]} path - the path of keys to the value being set
+ * @param {unknown} value - the data to save
+ * @returns {Promise} resolves when data has been saved
+ */
+export const set = (path, value) => {
+  if (!path.length) return undefined;
+  const precursor = _queue[_queue.length - 1] || undefined,
+    interaction = new Promise(async (res, rej) => {
+      if (precursor !== undefined) {
+        await precursor;
+        _queue.shift();
+      }
+      const pathClone = [...path],
+        namespace = path[0];
+      chrome.storage.local.get(async (values) => {
+        let pointer = values,
+          old;
+        while (path.length) {
+          const key = path.shift();
+          if (!path.length) {
+            old = pointer[key];
+            pointer[key] = value;
+            break;
+          }
+          pointer[key] = pointer[key] ?? {};
+          pointer = pointer[key];
+        }
+        chrome.storage.local.set({ [namespace]: values[namespace] }, () => {
+          _onChangeListeners.forEach((listener) =>
+            listener({ path: pathClone, new: value, old })
+          );
+          res(value);
+        });
+      });
+    });
+  _queue.push(interaction);
+  return interaction;
+};
+
+/**
+ * create a wrapper for accessing a partition of the storage
+ * @param {string[]} namespace - the path of keys to prefix all storage requests with
+ * @param {function=} get - the storage get function to be wrapped
+ * @param {function=} set - the storage set function to be wrapped
+ * @returns {object} an object with the wrapped get/set functions
+ */
+export const db = (namespace, getFunc = get, setFunc = set) => {
+  if (typeof namespace === 'string') namespace = [namespace];
+  return {
+    get: (path = [], fallback = undefined) => getFunc([...namespace, ...path], fallback),
+    set: (path, value) => setFunc([...namespace, ...path], value),
+  };
+};
+
+/**
+ * add an event listener for changes in storage
+ * @param {onStorageChangeCallback} callback - called whenever a change in
+ * storage is initiated from the current process
+ */
+export const addChangeListener = (callback) => {
+  _onChangeListeners.push(callback);
+};
+
+/**
+ * remove a listener added with storage.addChangeListener
+ * @param {onStorageChangeCallback} callback
+ */
+export const removeChangeListener = (callback) => {
+  _onChangeListeners = _onChangeListeners.filter((listener) => listener !== callback);
+};
+
+/**
+ * @callback onStorageChangeCallback
+ * @param {object} event
+ * @param {string} event.path- the path of keys to the changed value
+ * @param {string=} event.new - the new value being persisted to the store
+ * @param {string=} event.old - the previous value associated with the key
+ */
diff --git a/src/browser/init.js b/src/browser/init.js
new file mode 100644
index 0000000..e8de939
--- /dev/null
+++ b/src/browser/init.js
@@ -0,0 +1,35 @@
+/*
+ * notion-enhancer
+ * (c) 2021 dragonwocky <thedragonring.bod@gmail.com> (https://dragonwocky.me/)
+ * (https://notion-enhancer.github.io/) under the MIT license
+ */
+
+'use strict';
+
+(async () => {
+  const site = location.host.endsWith('.notion.site'),
+    page = location.pathname.split(/[/-]/g).reverse()[0].length === 32,
+    whitelisted = ['/', '/onboarding'].includes(location.pathname),
+    signedIn = localStorage['LRU:KeyValueStore2:current-user-id'];
+
+  if (site || page || (whitelisted && signedIn)) {
+    const api = await import(chrome.runtime.getURL('api/index.mjs')),
+      { fs, registry, web } = api;
+
+    for (const mod of await registry.list((mod) => registry.enabled(mod.id))) {
+      for (const sheet of mod.css?.client || []) {
+        web.loadStylesheet(`repo/${mod._dir}/${sheet}`);
+      }
+      for (let script of mod.js?.client || []) {
+        script = await import(fs.localPath(`repo/${mod._dir}/${script}`));
+        script.default(api, await registry.db(mod.id));
+      }
+    }
+
+    const errors = await registry.errors();
+    if (errors.length) {
+      console.log('[notion-enhancer] registry errors:');
+      console.table(errors);
+    }
+  }
+})();
diff --git a/src/browser/worker.js b/src/browser/worker.js
new file mode 100644
index 0000000..48f5833
--- /dev/null
+++ b/src/browser/worker.js
@@ -0,0 +1,60 @@
+/*
+ * notion-enhancer
+ * (c) 2021 dragonwocky <thedragonring.bod@gmail.com> (https://dragonwocky.me/)
+ * (https://notion-enhancer.github.io/) under the MIT license
+ */
+
+'use strict';
+
+function focusMenu() {
+  chrome.tabs.query({ windowId: chrome.windows.WINDOW_ID_CURRENT }, (tabs) => {
+    const url = chrome.runtime.getURL('repo/menu/menu.html'),
+      menu = tabs.find((tab) => tab.url.startsWith(url));
+    if (menu) {
+      chrome.tabs.highlight({ 'tabs': menu.index });
+    } else chrome.tabs.create({ url });
+  });
+}
+chrome.browserAction.onClicked.addListener(focusMenu);
+
+function focusNotion() {
+  chrome.tabs.query({ windowId: chrome.windows.WINDOW_ID_CURRENT }, (tabs) => {
+    const notion = tabs.find((tab) => {
+      const url = new URL(tab.url),
+        matches = url.host.endsWith('.notion.so') || url.host.endsWith('.notion.site');
+      return matches;
+    });
+    if (notion) {
+      chrome.tabs.highlight({ 'tabs': notion.index });
+    } else chrome.tabs.create({ url: 'https://notion.so/' });
+  });
+}
+
+function reload() {
+  chrome.tabs.query({ windowId: chrome.windows.WINDOW_ID_CURRENT }, (tabs) => {
+    const menu = chrome.runtime.getURL('repo/menu/menu.html');
+    tabs.forEach((tab) => {
+      const url = new URL(tab.url),
+        matches =
+          url.host.endsWith('.notion.so') ||
+          url.host.endsWith('.notion.site') ||
+          tab.url.startsWith(menu);
+      if (matches) chrome.tabs.reload(tab.id);
+    });
+  });
+}
+
+chrome.runtime.onMessage.addListener((request, sender, sendResponse) => {
+  switch (request.action) {
+    case 'focusMenu':
+      focusMenu();
+      break;
+    case 'focusNotion':
+      focusNotion();
+      break;
+    case 'reload':
+      reload();
+      break;
+  }
+  return true;
+});
diff --git a/src/common/.github/workflows/update-parents.yml b/src/common/.github/workflows/update-parents.yml
new file mode 100644
index 0000000..ac428e4
--- /dev/null
+++ b/src/common/.github/workflows/update-parents.yml
@@ -0,0 +1,29 @@
+name: 'update parent repositories'
+
+on:
+  push:
+    branches:
+      - dev
+
+jobs:
+  sync:
+    name: update parent
+    runs-on: ubuntu-latest
+    strategy:
+      matrix:
+        repo: ['notion-enhancer/extension', 'notion-enhancer/desktop']
+    steps:
+      - name: checkout repo
+        uses: actions/checkout@v2
+        with:
+          token: ${{ secrets.CI_TOKEN }}
+          submodules: true
+          repository: ${{ matrix.repo }}
+      - name: pull updates
+        run: |
+          git pull --recurse-submodules
+          git submodule update --remote --recursive
+      - name: commit changes
+        uses: stefanzweifel/git-auto-commit-action@v4
+        with:
+          commit_message: '[${{ github.event.repository.name }}] ${{ github.event.head_commit.message }}'
diff --git a/src/common/LICENSE b/src/common/LICENSE
new file mode 100644
index 0000000..b503961
--- /dev/null
+++ b/src/common/LICENSE
@@ -0,0 +1,21 @@
+MIT License
+
+Copyright (c) 2021 dragonwocky <thedragonring.bod@gmail.com> (https://dragonwocky.me/)
+
+Permission is hereby granted, free of charge, to any person obtaining a copy
+of this software and associated documentation files (the "Software"), to deal
+in the Software without restriction, including without limitation the rights
+to use, copy, modify, merge, publish, distribute, sublicense, and/or sell
+copies of the Software, and to permit persons to whom the Software is
+furnished to do so, subject to the following conditions:
+
+The above copyright notice and this permission notice shall be included in all
+copies or substantial portions of the Software.
+
+THE SOFTWARE IS PROVIDED "AS IS", WITHOUT WARRANTY OF ANY KIND, EXPRESS OR
+IMPLIED, INCLUDING BUT NOT LIMITED TO THE WARRANTIES OF MERCHANTABILITY,
+FITNESS FOR A PARTICULAR PURPOSE AND NONINFRINGEMENT. IN NO EVENT SHALL THE
+AUTHORS OR COPYRIGHT HOLDERS BE LIABLE FOR ANY CLAIM, DAMAGES OR OTHER
+LIABILITY, WHETHER IN AN ACTION OF CONTRACT, TORT OR OTHERWISE, ARISING FROM,
+OUT OF OR IN CONNECTION WITH THE SOFTWARE OR THE USE OR OTHER DEALINGS IN THE
+SOFTWARE.
diff --git a/src/common/README.md b/src/common/README.md
new file mode 100644
index 0000000..ab8ffc8
--- /dev/null
+++ b/src/common/README.md
@@ -0,0 +1,5 @@
+# notion-enhancer/api
+
+the standard api available within the notion-enhancer
+
+[read the docs online](https://notion-enhancer.github.io/documentation/api)
diff --git a/src/common/components/corner-action.css b/src/common/components/corner-action.css
new file mode 100644
index 0000000..fdff4ac
--- /dev/null
+++ b/src/common/components/corner-action.css
@@ -0,0 +1,55 @@
+/**
+ * notion-enhancer: components
+ * (c) 2021 dragonwocky <thedragonring.bod@gmail.com> (https://dragonwocky.me/)
+ * (c) 2021 CloudHill <rl.cloudhill@gmail.com> (https://github.com/CloudHill)
+ * (https://notion-enhancer.github.io/) under the MIT license
+ */
+
+#enhancer--corner-actions {
+  position: absolute;
+  bottom: 26px;
+  right: 26px;
+  z-index: 101;
+  cursor: default;
+  pointer-events: none;
+  display: flex;
+  flex-direction: row-reverse;
+}
+
+#enhancer--corner-actions > div {
+  position: static !important;
+  width: 36px;
+  height: 36px;
+  margin-left: 12px;
+  pointer-events: auto;
+  border-radius: 100%;
+  font-size: 20px;
+
+  display: flex;
+  align-items: center;
+  justify-content: center;
+  color: var(--theme--icon);
+  fill: var(--theme--icon);
+  background: var(--theme--ui_corner_action) !important;
+  box-shadow: var(--theme--ui_shadow, rgba(15, 15, 15, 0.15)) 0px 0px 0px 1px,
+    var(--theme--ui_shadow, rgba(15, 15, 15, 0.15)) 0px 2px 4px !important;
+
+  user-select: none;
+  cursor: pointer;
+}
+#enhancer--corner-actions > div:hover {
+  background: var(--theme--ui_corner_action-hover) !important;
+}
+#enhancer--corner-actions > div:active {
+  background: var(--theme--ui_corner_action-active) !important;
+}
+#enhancer--corner-actions > div.hidden {
+  display: none;
+}
+
+#enhancer--corner-actions > div > svg {
+  width: 22px;
+  height: 22px;
+  color: var(--theme--icon);
+  fill: var(--theme--icon);
+}
diff --git a/src/common/components/corner-action.mjs b/src/common/components/corner-action.mjs
new file mode 100644
index 0000000..bf42f9b
--- /dev/null
+++ b/src/common/components/corner-action.mjs
@@ -0,0 +1,43 @@
+/**
+ * notion-enhancer: components
+ * (c) 2021 dragonwocky <thedragonring.bod@gmail.com> (https://dragonwocky.me/)
+ * (c) 2021 CloudHill <rl.cloudhill@gmail.com> (https://github.com/CloudHill)
+ * (https://notion-enhancer.github.io/) under the MIT license
+ */
+
+'use strict';
+
+/** shared notion-style elements */
+
+import { web } from '../index.mjs';
+
+let $stylesheet, $cornerButtonsContainer;
+
+/**
+ * adds a button to notion's bottom right corner
+ * @param {string} icon - an svg string
+ * @param {function} listener - the function to call when the button is clicked
+ * @returns {Element} the appended corner action element
+ */
+export const addCornerAction = async (icon, listener) => {
+  if (!$stylesheet) {
+    $stylesheet = web.loadStylesheet('api/components/corner-action.css');
+    $cornerButtonsContainer = web.html`<div id="enhancer--corner-actions"></div>`;
+  }
+
+  await web.whenReady(['.notion-help-button']);
+  const $helpButton = document.querySelector('.notion-help-button'),
+    $onboardingButton = document.querySelector('.onboarding-checklist-button');
+  if ($onboardingButton) $cornerButtonsContainer.prepend($onboardingButton);
+  $cornerButtonsContainer.prepend($helpButton);
+  web.render(
+    document.querySelector('.notion-app-inner > .notion-cursor-listener'),
+    $cornerButtonsContainer
+  );
+
+  const $actionButton = web.html`<div class="enhancer--corner-action-button">${icon}</div>`;
+  $actionButton.addEventListener('click', listener);
+  web.render($cornerButtonsContainer, $actionButton);
+
+  return $actionButton;
+};
diff --git a/src/common/components/feather.mjs b/src/common/components/feather.mjs
new file mode 100644
index 0000000..9bd68fd
--- /dev/null
+++ b/src/common/components/feather.mjs
@@ -0,0 +1,33 @@
+/**
+ * notion-enhancer: components
+ * (c) 2021 dragonwocky <thedragonring.bod@gmail.com> (https://dragonwocky.me/)
+ * (https://notion-enhancer.github.io/) under the MIT license
+ */
+
+'use strict';
+
+/** shared notion-style elements */
+
+import { fs, web } from '../index.mjs';
+
+let _$iconSheet;
+
+/**
+ * generate an icon from the feather icons set
+ * @param {string} name - the name/id of the icon
+ * @param {object} attrs - an object of attributes to apply to the icon e.g. classes
+ * @returns {string} an svg string
+ */
+export const feather = async (name, attrs = {}) => {
+  if (!_$iconSheet) {
+    _$iconSheet = web.html`${await fs.getText('dep/feather-sprite.svg')}`;
+  }
+  attrs.style = (
+    (attrs.style ? attrs.style + ';' : '') +
+    'stroke:currentColor;stroke-width:2;stroke-linecap:round;stroke-linejoin:round;fill:none;'
+  ).trim();
+  attrs.viewBox = '0 0 24 24';
+  return `<svg ${Object.entries(attrs)
+    .map(([key, val]) => `${web.escape(key)}="${web.escape(val)}"`)
+    .join(' ')}>${_$iconSheet.getElementById(name)?.innerHTML}</svg>`;
+};
diff --git a/src/common/components/index.mjs b/src/common/components/index.mjs
new file mode 100644
index 0000000..28c52b5
--- /dev/null
+++ b/src/common/components/index.mjs
@@ -0,0 +1,55 @@
+/**
+ * notion-enhancer: components
+ * (c) 2021 dragonwocky <thedragonring.bod@gmail.com> (https://dragonwocky.me/)
+ * (https://notion-enhancer.github.io/) under the MIT license
+ */
+
+'use strict';
+
+/**
+ * shared notion-style elements
+ * @namespace components
+ */
+import * as _api from '../index.mjs'; // trick jsdoc
+
+/**
+ * add a tooltip to show extra information on hover
+ * @param {HTMLElement} $ref - the element that will trigger the tooltip when hovered
+ * @param {string|HTMLElement} $content - markdown or element content of the tooltip
+ * @param {object=} options - configuration of how the tooltip should be displayed
+ * @param {number=} options.delay - the amount of time in ms the element needs to be hovered over
+ * for the tooltip to be shown (default: 100)
+ * @param {string=} options.offsetDirection - which side of the element the tooltip
+ * should be shown on: 'top', 'bottom', 'left' or 'right' (default: 'bottom')
+ * @param {number=} options.maxLines - the max number of lines that the content may be wrapped
+ * to, used to position and size the tooltip correctly (default: 1)
+ */
+export { addTooltip } from './tooltip.mjs';
+
+/**
+ * generate an icon from the feather icons set
+ * @param {string} name - the name/id of the icon
+ * @param {object} attrs - an object of attributes to apply to the icon e.g. classes
+ * @returns {string} an svg string
+ */
+export { feather } from './feather.mjs';
+
+/**
+ * adds a view to the enhancer's side panel
+ * @param {object} panel - information used to construct and render the panel
+ * @param {string} panel.id - a uuid, used to restore the last open view on reload
+ * @param {string} panel.icon - an svg string
+ * @param {string} panel.title - the name of the view
+ * @param {Element} panel.$content - an element containing the content of the view
+ * @param {function} panel.onBlur - runs when the view is selected/focused
+ * @param {function} panel.onFocus - runs when the view is unfocused/closed
+ */
+export { addPanelView } from './panel.mjs';
+
+/**
+ * adds a button to notion's bottom right corner
+ * @param {string} icon - an svg string
+ * @param {function} listener - the function to call when the button is clicked
+ * @returns {Element} the appended corner action element
+ */
+export { addCornerAction } from './corner-action.mjs';
diff --git a/src/common/components/panel.css b/src/common/components/panel.css
new file mode 100644
index 0000000..547d484
--- /dev/null
+++ b/src/common/components/panel.css
@@ -0,0 +1,221 @@
+/**
+ * notion-enhancer: components
+ * (c) 2021 dragonwocky <thedragonring.bod@gmail.com> (https://dragonwocky.me/)
+ * (c) 2021 CloudHill <rl.cloudhill@gmail.com> (https://github.com/CloudHill)
+ * (https://notion-enhancer.github.io/) under the MIT license
+ */
+
+:root {
+  --component--panel-width: 260px;
+}
+
+#enhancer--panel-hover-trigger {
+  height: 100vh;
+  width: 2.5rem;
+  max-height: 100%;
+  z-index: 999;
+  position: absolute;
+  top: 45px;
+  right: 0;
+  flex-grow: 0;
+  flex-shrink: 0;
+  transition: width 300ms ease-in-out;
+}
+#enhancer--panel-hover-trigger[data-enhancer-panel-pinned] {
+  /* taking up the physical space of the panel to move topbar buttons */
+  top: 0;
+  position: relative;
+  width: var(--component--panel-width);
+}
+
+.notion-frame {
+  transition: padding-right 300ms ease-in-out;
+}
+.notion-frame[data-enhancer-panel-pinned] {
+  padding-right: var(--component--panel-width);
+}
+.notion-cursor-listener > div[style*='flex-end'] {
+  transition: margin-right 300ms ease-in-out;
+}
+.notion-cursor-listener > div[style*='flex-end'][data-enhancer-panel-pinned],
+#enhancer--panel[data-enhancer-panel-pinned] + div[style*='flex-end'] {
+  margin-right: var(--component--panel-width);
+}
+
+#enhancer--panel {
+  z-index: 999;
+  position: absolute;
+  background: var(--theme--bg_secondary);
+  width: var(--component--panel-width);
+  right: calc(-1 * var(--component--panel-width));
+  opacity: 0;
+  height: 100vh;
+  flex-grow: 0;
+  flex-shrink: 0;
+  display: flex;
+  flex-direction: column;
+  transition: 300ms ease-in;
+
+  margin-top: 5rem;
+  max-height: calc(100vh - 10rem);
+}
+#enhancer--panel-hover-trigger:hover + #enhancer--panel:not([data-enhancer-panel-pinned]),
+#enhancer--panel:not([data-enhancer-panel-pinned]):hover {
+  opacity: 1;
+  transform: translateX(calc(-1 * var(--component--panel-width)));
+  box-shadow: var(--theme--ui_shadow, rgba(15, 15, 15, 0.05)) 0px 0px 0px 1px,
+    var(--theme--ui_shadow, rgba(15, 15, 15, 0.1)) 0px 3px 6px,
+    var(--theme--ui_shadow, rgba(15, 15, 15, 0.2)) 0px 9px 24px !important;
+}
+#enhancer--panel[data-enhancer-panel-pinned] {
+  opacity: 1;
+  max-height: 100%;
+  margin-top: 0;
+  transform: translateX(calc(-1 * var(--component--panel-width)));
+}
+
+.enhancer--panel-view-title {
+  margin: 0;
+  height: 1em;
+  display: flex;
+  align-items: center;
+  font-size: 1.1rem;
+  font-weight: 600;
+}
+.enhancer--panel-view-title svg,
+.enhancer--panel-view-title img {
+  height: 1em;
+  width: 1em;
+}
+.enhancer--panel-view-icon {
+  margin-bottom: -2px;
+}
+.enhancer--panel-view-title .enhancer--panel-view-title-text {
+  font-size: 0.9em;
+  margin: 0 0 0 0.75em;
+  padding-bottom: 0.3em;
+  white-space: nowrap;
+  overflow: hidden;
+}
+
+#enhancer--panel-header {
+  font-size: 1.2rem;
+  font-weight: 600;
+  display: flex;
+  align-items: center;
+  cursor: pointer;
+  user-select: none;
+  padding: 0.75rem 0 0.75rem 1rem;
+  background: var(--theme--bg_secondary);
+}
+#enhancer--panel-header-title {
+  max-width: calc(100% - 4.25rem);
+}
+#enhancer--panel-header-title .enhancer--panel-view-title {
+  font-size: 1.2rem;
+}
+#enhancer--panel-header-title .enhancer--panel-view-title-text {
+  max-width: calc(100% - 1.75em);
+  position: relative;
+}
+
+#enhancer--panel-switcher-overlay-container {
+  position: fixed;
+  top: 0;
+  right: 0;
+  bottom: 0;
+  left: 0;
+  z-index: 999;
+  overflow: hidden;
+}
+#enhancer--panel-switcher {
+  max-width: 320px;
+  position: relative;
+  right: 14px;
+  border-radius: 3px;
+  padding: 8px 0;
+  background: var(--theme--bg_card);
+  box-shadow: var(--theme--ui_shadow, rgba(15, 15, 15, 0.05)) 0px 0px 0px 1px,
+    var(--theme--ui_shadow, rgba(15, 15, 15, 0.1)) 0px 3px 6px,
+    var(--theme--ui_shadow, rgba(15, 15, 15, 0.2)) 0px 9px 24px !important;
+  overflow: hidden;
+}
+.enhancer--panel-switcher-item {
+  display: flex;
+  align-items: center;
+  width: 100%;
+  padding: 8px 14px;
+  user-select: none;
+  cursor: pointer;
+  overflow: hidden;
+  position: relative;
+  background: var(--theme--bg_card);
+}
+#enhancer--panel-header:hover,
+#enhancer--panel-header:focus-within,
+.enhancer--panel-switcher-item:hover,
+.enhancer--panel-switcher-item:focus {
+  background: var(--theme--ui_interactive-hover);
+}
+#enhancer--panel-header:active,
+.enhancer--panel-switcher-item:active {
+  background: var(--theme--ui_interactive-active);
+}
+
+#enhancer--panel-content {
+  margin: 0.75rem 1rem;
+  font-size: 1rem;
+}
+#enhancer--panel-header-switcher {
+  padding: 4px;
+}
+#enhancer--panel-header-toggle {
+  margin-left: auto;
+  padding-right: 1rem;
+  height: 100%;
+  width: 2.5em;
+  opacity: 0;
+  display: flex;
+}
+#enhancer--panel-header-toggle > div {
+  margin: auto 0 auto auto;
+}
+#enhancer--panel-header-switcher,
+#enhancer--panel-header-toggle > div {
+  color: var(--theme--icon_secondary);
+  height: 1em;
+  width: 1em;
+  cursor: pointer;
+  display: flex;
+  flex-direction: column;
+  transition: 300ms ease-in-out;
+}
+#enhancer--panel #enhancer--panel-header-toggle svg {
+  transition: 300ms ease-in-out;
+}
+#enhancer--panel:not([data-enhancer-panel-pinned]) #enhancer--panel-header-toggle svg {
+  transform: rotateZ(-180deg);
+}
+#enhancer--panel:hover #enhancer--panel-header-toggle {
+  opacity: 1;
+}
+
+#enhancer--panel-resize {
+  position: absolute;
+  left: -5px;
+  height: 100%;
+  width: 10px;
+}
+#enhancer--panel[data-enhancer-panel-pinned] #enhancer--panel-resize {
+  cursor: col-resize;
+}
+#enhancer--panel-resize div {
+  transition: background 150ms ease-in-out;
+  background: transparent;
+  width: 2px;
+  margin-left: 4px;
+  height: 100%;
+}
+#enhancer--panel[data-enhancer-panel-pinned] #enhancer--panel-resize:hover div {
+  background: var(--theme--ui_divider);
+}
diff --git a/src/common/components/panel.mjs b/src/common/components/panel.mjs
new file mode 100644
index 0000000..8f82a58
--- /dev/null
+++ b/src/common/components/panel.mjs
@@ -0,0 +1,292 @@
+/**
+ * notion-enhancer: components
+ * (c) 2021 dragonwocky <thedragonring.bod@gmail.com> (https://dragonwocky.me/)
+ * (c) 2021 CloudHill <rl.cloudhill@gmail.com> (https://github.com/CloudHill)
+ * (https://notion-enhancer.github.io/) under the MIT license
+ */
+
+'use strict';
+
+/** shared notion-style elements */
+
+import { web, components, registry } from '../index.mjs';
+
+const _views = [],
+  svgExpand = web.raw`<svg viewBox="-1 -1 9 11">
+    <path d="M 3.5 0L 3.98809 -0.569442L 3.5 -0.987808L 3.01191 -0.569442L 3.5 0ZM 3.5 9L 3.01191
+      9.56944L 3.5 9.98781L 3.98809 9.56944L 3.5 9ZM 0.488094 3.56944L 3.98809 0.569442L 3.01191
+      -0.569442L -0.488094 2.43056L 0.488094 3.56944ZM 3.01191 0.569442L 6.51191 3.56944L 7.48809
+      2.43056L 3.98809 -0.569442L 3.01191 0.569442ZM -0.488094 6.56944L 3.01191 9.56944L 3.98809
+      8.43056L 0.488094 5.43056L -0.488094 6.56944ZM 3.98809 9.56944L 7.48809 6.56944L 6.51191
+      5.43056L 3.01191 8.43056L 3.98809 9.56944Z"></path>
+  </svg>`;
+
+let $stylesheet,
+  db,
+  // open + close
+  $notionFrame,
+  $notionRightSidebar,
+  $panel,
+  $hoverTrigger,
+  // resize
+  $resizeHandle,
+  dragStartX,
+  dragStartWidth,
+  dragEventsFired,
+  panelWidth,
+  // render content
+  $notionApp,
+  $pinnedToggle,
+  $panelTitle,
+  $header,
+  $panelContent,
+  $switcher,
+  $switcherTrigger,
+  $switcherOverlayContainer;
+
+// open + close
+const panelPinnedAttr = 'data-enhancer-panel-pinned',
+  isPinned = () => $panel.hasAttribute(panelPinnedAttr),
+  togglePanel = () => {
+    const $elems = [$notionFrame, $notionRightSidebar, $hoverTrigger, $panel].filter(
+      ($el) => $el
+    );
+    if (isPinned()) {
+      closeSwitcher();
+      for (const $elem of $elems) $elem.removeAttribute(panelPinnedAttr);
+    } else {
+      for (const $elem of $elems) $elem.setAttribute(panelPinnedAttr, 'true');
+    }
+    db.set(['panel.pinned'], isPinned());
+  },
+  // resize
+  updateWidth = () => {
+    document.documentElement.style.setProperty('--component--panel-width', panelWidth + 'px');
+    db.set(['panel.width'], panelWidth);
+  },
+  resizeDrag = (event) => {
+    event.preventDefault();
+    dragEventsFired = true;
+    panelWidth = dragStartWidth + (dragStartX - event.clientX);
+    if (panelWidth < 190) panelWidth = 190;
+    if (panelWidth > 480) panelWidth = 480;
+    $panel.style.width = panelWidth + 'px';
+    $hoverTrigger.style.width = panelWidth + 'px';
+    $notionFrame.style.paddingRight = panelWidth + 'px';
+    if ($notionRightSidebar) $notionRightSidebar.style.right = panelWidth + 'px';
+  },
+  resizeEnd = (_event) => {
+    $panel.style.width = '';
+    $hoverTrigger.style.width = '';
+    $notionFrame.style.paddingRight = '';
+    if ($notionRightSidebar) $notionRightSidebar.style.right = '';
+    updateWidth();
+    $resizeHandle.style.cursor = '';
+    document.body.removeEventListener('mousemove', resizeDrag);
+    document.body.removeEventListener('mouseup', resizeEnd);
+  },
+  resizeStart = (event) => {
+    dragStartX = event.clientX;
+    dragStartWidth = panelWidth;
+    $resizeHandle.style.cursor = 'auto';
+    document.body.addEventListener('mousemove', resizeDrag);
+    document.body.addEventListener('mouseup', resizeEnd);
+  },
+  // render content
+  isSwitcherOpen = () => document.body.contains($switcher),
+  openSwitcher = () => {
+    if (!isPinned()) return togglePanel();
+    web.render($notionApp, $switcherOverlayContainer);
+    web.empty($switcher);
+    for (const view of _views) {
+      const open = $panelTitle.contains(view.$title),
+        $item = web.render(
+          web.html`<div class="enhancer--panel-switcher-item" tabindex="0" ${
+            open ? 'data-open' : ''
+          }></div>`,
+          web.render(
+            web.html`<span class="enhancer--panel-view-title"></span>`,
+            view.$icon.cloneNode(true),
+            view.$title.cloneNode(true)
+          )
+        );
+      $item.addEventListener('click', () => {
+        renderView(view);
+        db.set(['panel.open'], view.id);
+      });
+      web.render($switcher, $item);
+    }
+    const rect = $header.getBoundingClientRect();
+    web.render(
+      web.empty($switcherOverlayContainer),
+      web.render(
+        web.html`<div style="position: fixed; top: ${rect.top}px; left: ${rect.left}px;
+              width: ${rect.width}px; height: ${rect.height}px;"></div>`,
+        web.render(
+          web.html`<div style="position: relative; top: 100%; pointer-events: auto;"></div>`,
+          $switcher
+        )
+      )
+    );
+    $switcher.querySelector('[data-open]').focus();
+    $switcher.animate([{ opacity: 0 }, { opacity: 1 }], { duration: 200 });
+    document.addEventListener('keydown', switcherKeyListeners);
+  },
+  closeSwitcher = () => {
+    document.removeEventListener('keydown', switcherKeyListeners);
+    $switcher.animate([{ opacity: 1 }, { opacity: 0 }], { duration: 200 }).onfinish = () =>
+      $switcherOverlayContainer.remove();
+  },
+  switcherKeyListeners = (event) => {
+    if (isSwitcherOpen()) {
+      switch (event.key) {
+        case 'Escape':
+          closeSwitcher();
+          event.stopPropagation();
+          break;
+        case 'Enter':
+          document.activeElement.click();
+          event.stopPropagation();
+          break;
+        case 'ArrowUp': {
+          const $prev = event.target.previousElementSibling;
+          ($prev || event.target.parentElement.lastElementChild).focus();
+          event.stopPropagation();
+          break;
+        }
+        case 'ArrowDown': {
+          const $next = event.target.nextElementSibling;
+          ($next || event.target.parentElement.firstElementChild).focus();
+          event.stopPropagation();
+          break;
+        }
+      }
+    }
+  },
+  renderView = (view) => {
+    const prevView = _views.find(({ $content }) => document.contains($content));
+    web.render(
+      web.empty($panelTitle),
+      web.render(
+        web.html`<span class="enhancer--panel-view-title"></span>`,
+        view.$icon,
+        view.$title
+      )
+    );
+    view.onFocus();
+    web.render(web.empty($panelContent), view.$content);
+    if (prevView) prevView.onBlur();
+  };
+
+async function createPanel() {
+  await web.whenReady(['.notion-frame']);
+  $notionFrame = document.querySelector('.notion-frame');
+
+  $panel = web.html`<div id="enhancer--panel"></div>`;
+  $hoverTrigger = web.html`<div id="enhancer--panel-hover-trigger"></div>`;
+  $resizeHandle = web.html`<div id="enhancer--panel-resize"><div></div></div>`;
+  $panelTitle = web.html`<div id="enhancer--panel-header-title"></div>`;
+  $header = web.render(web.html`<div id="enhancer--panel-header"></div>`, $panelTitle);
+  $panelContent = web.html`<div id="enhancer--panel-content"></div>`;
+  $switcher = web.html`<div id="enhancer--panel-switcher"></div>`;
+  $switcherTrigger = web.html`<div id="enhancer--panel-header-switcher" tabindex="0">
+    ${svgExpand}
+  </div>`;
+  $switcherOverlayContainer = web.html`<div id="enhancer--panel-switcher-overlay-container"></div>`;
+
+  const notionRightSidebarSelector = '.notion-cursor-listener > div[style*="flex-end"]',
+    detectRightSidebar = () => {
+      if (!document.contains($notionRightSidebar)) {
+        $notionRightSidebar = document.querySelector(notionRightSidebarSelector);
+        if (isPinned() && $notionRightSidebar) {
+          $notionRightSidebar.setAttribute(panelPinnedAttr, 'true');
+        }
+      }
+    };
+  $notionRightSidebar = document.querySelector(notionRightSidebarSelector);
+  web.addDocumentObserver(detectRightSidebar, [notionRightSidebarSelector]);
+
+  if (await db.get(['panel.pinned'])) togglePanel();
+  web.addHotkeyListener(await db.get(['panel.hotkey']), togglePanel);
+  $pinnedToggle.addEventListener('click', (event) => {
+    event.stopPropagation();
+    togglePanel();
+  });
+  web.render(
+    $panel,
+    web.render($header, $panelTitle, $switcherTrigger, $pinnedToggle),
+    $panelContent,
+    $resizeHandle
+  );
+
+  await enablePanelResize();
+  await createViews();
+
+  const cursorListenerSelector =
+    '.notion-cursor-listener > .notion-sidebar-container ~ [style^="position: absolute"]';
+  await web.whenReady([cursorListenerSelector]);
+  document.querySelector(cursorListenerSelector).before($hoverTrigger, $panel);
+}
+
+async function enablePanelResize() {
+  panelWidth = await db.get(['panel.width'], 240);
+  updateWidth();
+  $resizeHandle.addEventListener('mousedown', resizeStart);
+  $resizeHandle.addEventListener('click', () => {
+    if (dragEventsFired) {
+      dragEventsFired = false;
+    } else togglePanel();
+  });
+}
+
+function createViews() {
+  $notionApp = document.querySelector('.notion-app-inner');
+  $header.addEventListener('click', openSwitcher);
+  $switcherTrigger.addEventListener('click', openSwitcher);
+  $switcherOverlayContainer.addEventListener('click', closeSwitcher);
+}
+
+/**
+ * adds a view to the enhancer's side panel
+ * @param {object} panel - information used to construct and render the panel
+ * @param {string} panel.id - a uuid, used to restore the last open view on reload
+ * @param {string} panel.icon - an svg string
+ * @param {string} panel.title - the name of the view
+ * @param {Element} panel.$content - an element containing the content of the view
+ * @param {function} panel.onBlur - runs when the view is selected/focused
+ * @param {function} panel.onFocus - runs when the view is unfocused/closed
+ */
+export const addPanelView = async ({
+  id,
+  icon,
+  title,
+  $content,
+  onFocus = () => {},
+  onBlur = () => {},
+}) => {
+  if (!$stylesheet) {
+    $stylesheet = web.loadStylesheet('api/components/panel.css');
+  }
+
+  if (!db) db = await registry.db('36a2ffc9-27ff-480e-84a7-c7700a7d232d');
+  if (!$pinnedToggle) {
+    $pinnedToggle = web.html`<div id="enhancer--panel-header-toggle" tabindex="0"><div>
+      ${await components.feather('chevrons-right')}
+    </div></div>`;
+  }
+
+  const view = {
+    id,
+    $icon: web.render(
+      web.html`<span class="enhancer--panel-view-title-icon"></span>`,
+      icon instanceof Element ? icon : web.html`${icon}`
+    ),
+    $title: web.render(web.html`<span class="enhancer--panel-view-title-text"></span>`, title),
+    $content,
+    onFocus,
+    onBlur,
+  };
+  _views.push(view);
+  if (_views.length === 1) await createPanel();
+  if (_views.length === 1 || (await db.get(['panel.open'])) === id) renderView(view);
+};
diff --git a/src/common/components/tooltip.css b/src/common/components/tooltip.css
new file mode 100644
index 0000000..32664dd
--- /dev/null
+++ b/src/common/components/tooltip.css
@@ -0,0 +1,31 @@
+/**
+ * notion-enhancer: components
+ * (c) 2021 dragonwocky <thedragonring.bod@gmail.com> (https://dragonwocky.me/)
+ * (https://notion-enhancer.github.io/) under the MIT license
+ */
+
+#enhancer--tooltip {
+  font-family: var(--theme--font_sans);
+  background: var(--theme--ui_tooltip);
+  border-radius: 3px;
+  box-shadow: var(--theme--ui_shadow) 0px 1px 4px;
+  color: var(--theme--ui_tooltip-description);
+  display: none;
+  font-size: 12px;
+  font-weight: 500;
+  line-height: 1.4;
+  max-width: 20rem;
+  overflow: hidden;
+  padding: 4px 8px;
+  position: absolute;
+  z-index: 999999999999999999;
+  pointer-events: none;
+}
+#enhancer--tooltip p {
+  margin: 0;
+}
+#enhancer--tooltip b,
+#enhancer--tooltip strong {
+  font-weight: 500;
+  color: var(--theme--ui_tooltip-title);
+}
diff --git a/src/common/components/tooltip.mjs b/src/common/components/tooltip.mjs
new file mode 100644
index 0000000..80f1d03
--- /dev/null
+++ b/src/common/components/tooltip.mjs
@@ -0,0 +1,118 @@
+/**
+ * notion-enhancer: components
+ * (c) 2021 dragonwocky <thedragonring.bod@gmail.com> (https://dragonwocky.me/)
+ * (https://notion-enhancer.github.io/) under the MIT license
+ */
+
+'use strict';
+
+/** shared notion-style elements */
+
+import { fs, web } from '../index.mjs';
+
+let $stylesheet, _$tooltip;
+
+const countLines = ($el) =>
+    [...$el.getClientRects()].reduce(
+      (prev, val) => (prev.some((p) => p.y === val.y) ? prev : [...prev, val]),
+      []
+    ).length,
+  position = ($ref, offsetDirection, maxLines) => {
+    _$tooltip.style.top = `0px`;
+    _$tooltip.style.left = `0px`;
+    const rect = $ref.getBoundingClientRect(),
+      { offsetWidth, offsetHeight } = _$tooltip,
+      pad = 6;
+    let x = rect.x,
+      y = Math.floor(rect.y);
+
+    if (['top', 'bottom'].includes(offsetDirection)) {
+      if (offsetDirection === 'top') y -= offsetHeight + pad;
+      if (offsetDirection === 'bottom') y += rect.height + pad;
+      x -= offsetWidth / 2 - rect.width / 2;
+      _$tooltip.style.left = `${x}px`;
+      _$tooltip.style.top = `${y}px`;
+      const testLines = () => countLines(_$tooltip.firstElementChild) > maxLines,
+        padEdgesX = testLines();
+      while (testLines()) {
+        _$tooltip.style.left = `${window.innerWidth - x > x ? x++ : x--}px`;
+      }
+      if (padEdgesX) {
+        x += window.innerWidth - x > x ? pad : -pad;
+        _$tooltip.style.left = `${x}px`;
+      }
+      _$tooltip.style.textAlign = 'center';
+    }
+
+    if (['left', 'right'].includes(offsetDirection)) {
+      y -= offsetHeight / 2 - rect.height / 2;
+      if (offsetDirection === 'left') x -= offsetWidth + pad;
+      if (offsetDirection === 'right') x += rect.width + pad;
+      _$tooltip.style.left = `${x}px`;
+      _$tooltip.style.top = `${y}px`;
+      _$tooltip.style.textAlign = 'start';
+    }
+
+    return true;
+  };
+
+/**
+ * add a tooltip to show extra information on hover
+ * @param {HTMLElement} $ref - the element that will trigger the tooltip when hovered
+ * @param {string|HTMLElement} $content - markdown or element content of the tooltip
+ * @param {object=} options - configuration of how the tooltip should be displayed
+ * @param {number=} options.delay - the amount of time in ms the element needs to be hovered over
+ * for the tooltip to be shown (default: 100)
+ * @param {string=} options.offsetDirection - which side of the element the tooltip
+ * should be shown on: 'top', 'bottom', 'left' or 'right' (default: 'bottom')
+ * @param {number=} options.maxLines - the max number of lines that the content may be wrapped
+ * to, used to position and size the tooltip correctly (default: 1)
+ */
+export const addTooltip = async (
+  $ref,
+  $content,
+  { delay = 100, offsetDirection = 'bottom', maxLines = 1 } = {}
+) => {
+  if (!$stylesheet) {
+    $stylesheet = web.loadStylesheet('api/components/tooltip.css');
+    _$tooltip = web.html`<div id="enhancer--tooltip"></div>`;
+    web.render(document.body, _$tooltip);
+  }
+
+  if (!globalThis.markdownit) await import(fs.localPath('dep/markdown-it.min.js'));
+  const md = markdownit({ linkify: true });
+
+  if (!($content instanceof Element))
+    $content = web.html`<div style="display:inline">
+      ${$content
+        .split('\n')
+        .map((text) => md.renderInline(text))
+        .join('<br>')}
+    </div>`;
+
+  let displayDelay;
+  $ref.addEventListener('mouseover', (_event) => {
+    if (!displayDelay) {
+      displayDelay = setTimeout(async () => {
+        if ($ref.matches(':hover')) {
+          if (_$tooltip.style.display !== 'block') {
+            _$tooltip.style.display = 'block';
+            web.render(web.empty(_$tooltip), $content);
+            position($ref, offsetDirection, maxLines);
+            await _$tooltip.animate([{ opacity: 0 }, { opacity: 1 }], { duration: 65 })
+              .finished;
+          }
+        }
+        displayDelay = undefined;
+      }, delay);
+    }
+  });
+
+  $ref.addEventListener('mouseout', async (_event) => {
+    displayDelay = undefined;
+    if (_$tooltip.style.display === 'block' && !$ref.matches(':hover')) {
+      await _$tooltip.animate([{ opacity: 1 }, { opacity: 0 }], { duration: 65 }).finished;
+      _$tooltip.style.display = '';
+    }
+  });
+};
diff --git a/src/common/electron.mjs b/src/common/electron.mjs
new file mode 100644
index 0000000..1492333
--- /dev/null
+++ b/src/common/electron.mjs
@@ -0,0 +1,106 @@
+/**
+ * notion-enhancer: api
+ * (c) 2021 dragonwocky <thedragonring.bod@gmail.com> (https://dragonwocky.me/)
+ * (https://notion-enhancer.github.io/) under the MIT license
+ */
+
+'use strict';
+
+/**
+ * access to electron renderer apis
+ * @namespace electron
+ */
+import * as _api from './index.mjs'; // trick jsdoc
+
+/**
+ * access to the electron BrowserWindow instance for the current window
+ * see https://www.electronjs.org/docs/latest/api/browser-window
+ * @type {BrowserWindow}
+ * @process electron (renderer process)
+ */
+export const browser = globalThis.__enhancerElectronApi?.browser;
+
+/**
+ * access to the electron webFrame instance for the current page
+ * see https://www.electronjs.org/docs/latest/api/web-frame
+ * @type {webFrame}
+ * @process electron (renderer process)
+ */
+export const webFrame = globalThis.__enhancerElectronApi?.webFrame;
+
+/**
+ * send a message to the main electron process
+ * @param {string} channel - the message identifier
+ * @param {any} data - the data to pass along with the message
+ * @param {string=} namespace - a prefix for the message to categorise
+ * it as e.g. enhancer-related. this should not be changed unless replicating
+ * builtin ipc events.
+ * @process electron (renderer process)
+ */
+export const sendMessage = (channel, data, namespace = 'notion-enhancer') => {
+  if (globalThis.__enhancerElectronApi) {
+    globalThis.__enhancerElectronApi.ipcRenderer.sendMessage(channel, data, namespace);
+  }
+};
+
+/**
+ * send a message to the webview's parent renderer process
+ * @param {string} channel - the message identifier
+ * @param {any} data - the data to pass along with the message
+ * @param {string=} namespace - a prefix for the message to categorise
+ * it as e.g. enhancer-related. this should not be changed unless replicating
+ * builtin ipc events.
+ * @process electron (renderer process)
+ */
+export const sendMessageToHost = (channel, data, namespace = 'notion-enhancer') => {
+  if (globalThis.__enhancerElectronApi) {
+    globalThis.__enhancerElectronApi.ipcRenderer.sendMessageToHost(channel, data, namespace);
+  }
+};
+
+/**
+ * receive a message from either the main process or
+ * the webview's parent renderer process
+ * @param {string} channel - the message identifier to listen for
+ * @param {function} callback - the message handler, passed the args (event, data)
+ * @param {string=} namespace - a prefix for the message to categorise
+ * it as e.g. enhancer-related. this should not be changed unless replicating
+ * builtin ipc events.
+ * @process electron (renderer process)
+ */
+export const onMessage = (channel, callback, namespace = 'notion-enhancer') => {
+  if (globalThis.__enhancerElectronApi) {
+    globalThis.__enhancerElectronApi.ipcRenderer.onMessage(channel, callback, namespace);
+  }
+};
+
+/**
+ * require() notion app files
+ * @param {string} path - within notion/resources/app/ e.g. main/createWindow.js
+ * @process electron (main process)
+ */
+export const notionRequire = (path) => {
+  return globalThis.__enhancerElectronApi
+    ? globalThis.__enhancerElectronApi.notionRequire(path)
+    : null;
+};
+
+/**
+ * get all available app windows excluding the menu
+ * @process electron (main process)
+ */
+export const getNotionWindows = () => {
+  return globalThis.__enhancerElectronApi
+    ? globalThis.__enhancerElectronApi.getNotionWindows()
+    : null;
+};
+
+/**
+ * get the currently focused notion window
+ * @process electron (main process)
+ */
+export const getFocusedNotionWindow = () => {
+  return globalThis.__enhancerElectronApi
+    ? globalThis.__enhancerElectronApi.getFocusedNotionWindow()
+    : null;
+};
diff --git a/src/common/env.mjs b/src/common/env.mjs
new file mode 100644
index 0000000..27f3ac4
--- /dev/null
+++ b/src/common/env.mjs
@@ -0,0 +1,46 @@
+/**
+ * notion-enhancer: api
+ * (c) 2021 dragonwocky <thedragonring.bod@gmail.com> (https://dragonwocky.me/)
+ * (https://notion-enhancer.github.io/) under the MIT license
+ */
+
+'use strict';
+
+/**
+ * environment-specific methods and constants
+ * @namespace env
+ */
+
+import * as env from '../env/env.mjs';
+
+/**
+ * the environment/platform name code is currently being executed in
+ * @constant
+ * @type {string}
+ */
+export const name = env.name;
+
+/**
+ * the current version of the enhancer
+ * @constant
+ * @type {string}
+ */
+export const version = env.version;
+
+/**
+ * open the enhancer's menu
+ * @type {function}
+ */
+export const focusMenu = env.focusMenu;
+
+/**
+ * focus an active notion tab
+ * @type {function}
+ */
+export const focusNotion = env.focusNotion;
+
+/**
+ * reload all notion and enhancer menu tabs to apply changes
+ * @type {function}
+ */
+export const reload = env.reload;
diff --git a/src/common/fmt.mjs b/src/common/fmt.mjs
new file mode 100644
index 0000000..57660cb
--- /dev/null
+++ b/src/common/fmt.mjs
@@ -0,0 +1,137 @@
+/**
+ * notion-enhancer: api
+ * (c) 2021 dragonwocky <thedragonring.bod@gmail.com> (https://dragonwocky.me/)
+ * (https://notion-enhancer.github.io/) under the MIT license
+ */
+
+'use strict';
+
+/**
+ * helpers for formatting or parsing text
+ * @namespace fmt
+ */
+
+import { fs } from './index.mjs';
+
+/**
+ * transform a heading into a slug (a lowercase alphanumeric string separated by hyphens),
+ * e.g. for use as an anchor id
+ * @param {string} heading - the original heading to be slugified
+ * @param {Set<string>=} slugs - a list of pre-generated slugs to avoid duplicates
+ * @returns {string} the generated slug
+ */
+export const slugger = (heading, slugs = new Set()) => {
+  heading = heading
+    .replace(/\s/g, '-')
+    .replace(/[^A-Za-z0-9-_]/g, '')
+    .toLowerCase();
+  let i = 0,
+    slug = heading;
+  while (slugs.has(slug)) {
+    i++;
+    slug = `${heading}-${i}`;
+  }
+  return slug;
+};
+
+/**
+ * generate a reasonably random uuidv4 string. uses crypto implementation if available
+ * (from https://stackoverflow.com/questions/105034/how-to-create-a-guid-uuid)
+ * @returns {string} a uuidv4
+ */
+export const uuidv4 = () => {
+  if (crypto?.randomUUID) return crypto.randomUUID();
+  return ([1e7] + -1e3 + -4e3 + -8e3 + -1e11).replace(/[018]/g, (c) =>
+    (c ^ (crypto.getRandomValues(new Uint8Array(1))[0] & (15 >> (c / 4)))).toString(16)
+  );
+};
+
+/**
+ * log-based shading of an rgb color, from
+ * https://stackoverflow.com/questions/5560248/programmatically-lighten-or-darken-a-hex-color-or-rgb-and-blend-colors
+ * @param {number} shade - a decimal amount to shade the color.
+ * 1 = white, 0 = the original color, -1 = black
+ * @param {string} color - the rgb color
+ * @returns {string} the shaded color
+ */
+export const rgbLogShade = (shade, color) => {
+  const int = parseInt,
+    round = Math.round,
+    [a, b, c, d] = color.split(','),
+    t = shade < 0 ? 0 : shade * 255 ** 2,
+    p = shade < 0 ? 1 + shade : 1 - shade;
+  return (
+    'rgb' +
+    (d ? 'a(' : '(') +
+    round((p * int(a[3] == 'a' ? a.slice(5) : a.slice(4)) ** 2 + t) ** 0.5) +
+    ',' +
+    round((p * int(b) ** 2 + t) ** 0.5) +
+    ',' +
+    round((p * int(c) ** 2 + t) ** 0.5) +
+    (d ? ',' + d : ')')
+  );
+};
+
+/**
+ * pick a contrasting color e.g. for text on a variable color background
+ * using the hsp (perceived brightness) constants from http://alienryderflex.com/hsp.html
+ * @param {number} r - red (0-255)
+ * @param {number} g - green (0-255)
+ * @param {number} b - blue (0-255)
+ * @returns {string} the contrasting rgb color, white or black
+ */
+export const rgbContrast = (r, g, b) => {
+  return Math.sqrt(0.299 * (r * r) + 0.587 * (g * g) + 0.114 * (b * b)) > 165.75
+    ? 'rgb(0,0,0)'
+    : 'rgb(255,255,255)';
+};
+
+const patterns = {
+  alphanumeric: /^[\w\.-]+$/,
+  uuid: /^[0-9a-f]{8}-[0-9a-f]{4}-[0-9a-f]{4}-[0-9a-f]{4}-[0-9a-f]{12}$/i,
+  semver:
+    /^(0|[1-9]\d*)\.(0|[1-9]\d*)\.(0|[1-9]\d*)(?:-((?:0|[1-9]\d*|\d*[a-zA-Z-][0-9a-zA-Z-]*)(?:\.(?:0|[1-9]\d*|\d*[a-zA-Z-][0-9a-zA-Z-]*))*))?(?:\+([0-9a-zA-Z-]+(?:\.[0-9a-zA-Z-]+)*))?$/i,
+  email:
+    /^(([^<>()\[\]\\.,;:\s@"]+(\.[^<>()\[\]\\.,;:\s@"]+)*)|(".+"))@((\[[0-9]{1,3}\.[0-9]{1,3}\.[0-9]{1,3}\.[0-9]{1,3}])|(([a-zA-Z\-0-9]+\.)+[a-zA-Z]{2,}))$/i,
+  url: /^[(http(s)?):\/\/(www\.)?a-zA-Z0-9@:%._\+~#=]{2,256}\.[a-z]{2,64}\b([-a-zA-Z0-9@:%_\+.~#?&//=]*)$/i,
+  color: /^(?:#|0x)(?:[a-f0-9]{3}|[a-f0-9]{6})\b|(?:rgb|hsl)a?\([^\)]*\)$/i,
+};
+function test(str, pattern) {
+  const match = str.match(pattern);
+  return !!(match && match.length);
+}
+
+/**
+ * test the type of a value. unifies builtin, regex, and environment/api checks
+ * @param {unknown} value - the value to check
+ * @param {string|string[]} type - the type the value should be or a list of allowed values
+ * @returns {boolean} whether or not the value matches the type
+ */
+export const is = async (value, type, { extension = '' } = {}) => {
+  extension = !value || !value.endsWith || value.endsWith(extension);
+  if (Array.isArray(type)) {
+    return type.includes(value);
+  }
+  switch (type) {
+    case 'array':
+      return Array.isArray(value);
+    case 'object':
+      return value && typeof value === 'object' && !Array.isArray(value);
+    case 'undefined':
+    case 'boolean':
+    case 'number':
+      return typeof value === type && extension;
+    case 'string':
+      return typeof value === type && extension;
+    case 'alphanumeric':
+    case 'uuid':
+    case 'semver':
+    case 'email':
+    case 'url':
+    case 'color':
+      return typeof value === 'string' && test(value, patterns[type]) && extension;
+    case 'file':
+      return typeof value === 'string' && value && (await fs.isFile(value)) && extension;
+  }
+  return false;
+};
diff --git a/src/common/fs.mjs b/src/common/fs.mjs
new file mode 100644
index 0000000..fa18d7b
--- /dev/null
+++ b/src/common/fs.mjs
@@ -0,0 +1,55 @@
+/**
+ * notion-enhancer: api
+ * (c) 2021 dragonwocky <thedragonring.bod@gmail.com> (https://dragonwocky.me/)
+ * (https://notion-enhancer.github.io/) under the MIT license
+ */
+
+'use strict';
+
+/**
+ * environment-specific file reading
+ * @namespace fs
+ */
+
+import * as fs from '../env/fs.mjs';
+
+/**
+ * get an absolute path to files within notion
+ * @param {string} path - relative to the root notion/resources/app/ e.g. renderer/search.js
+ * @process electron
+ */
+export const notionPath = fs.notionPath;
+
+/**
+ * transform a path relative to the enhancer root directory into an absolute path
+ * @type {function}
+ * @param {string} path - a url or within-the-enhancer filepath
+ * @returns {string} an absolute filepath
+ */
+export const localPath = fs.localPath;
+
+/**
+ * fetch and parse a json file's contents
+ * @type {function}
+ * @param {string} path - a url or within-the-enhancer filepath
+ * @param {FetchOptions=} opts - the second argument of a fetch() request
+ * @returns {unknown} the json value of the requested file as a js object
+ */
+export const getJSON = fs.getJSON;
+
+/**
+ * fetch a text file's contents
+ * @type {function}
+ * @param {string} path - a url or within-the-enhancer filepath
+ * @param {FetchOptions=} opts - the second argument of a fetch() request
+ * @returns {string} the text content of the requested file
+ */
+export const getText = fs.getText;
+
+/**
+ * check if a file exists
+ * @type {function}
+ * @param {string} path - a url or within-the-enhancer filepath
+ * @returns {boolean} whether or not the file exists
+ */
+export const isFile = fs.isFile;
diff --git a/src/common/index.cjs b/src/common/index.cjs
new file mode 100644
index 0000000..c130ac1
--- /dev/null
+++ b/src/common/index.cjs
@@ -0,0 +1,21 @@
+var le=Object.defineProperty;var Xe=e=>le(e,"__esModule",{value:!0});var y=(e,t)=>{Xe(e);for(var n in t)le(e,n,{get:t[n],enumerable:!0})};y(exports,{components:()=>R,electron:()=>V,env:()=>j,fmt:()=>h,fs:()=>u,notion:()=>X,registry:()=>g,storage:()=>_,web:()=>o});var j={};y(j,{focusMenu:()=>Ye,focusNotion:()=>De,name:()=>Ge,reload:()=>et,version:()=>Qe});"use strict";var de=globalThis.__enhancerElectronApi.platform,pe=globalThis.__enhancerElectronApi.version,ue=globalThis.__enhancerElectronApi.focusMenu,he=globalThis.__enhancerElectronApi.focusNotion,fe=globalThis.__enhancerElectronApi.reload;"use strict";var Ge=de,Qe=pe,Ye=ue,De=he,et=fe;var u={};y(u,{getJSON:()=>rt,getText:()=>st,isFile:()=>ot,localPath:()=>nt,notionPath:()=>tt});"use strict";var M=globalThis.__enhancerElectronApi.notionPath,L=e=>`notion://www.notion.so/__notion-enhancer/${e}`,me=(e,t={})=>{if(e=e.replace(/^https:\/\/www\.notion\.so\//,"notion://www.notion.so/"),e.startsWith("http")||e.startsWith("notion://"))return fetch(e,t).then(r=>r.json());try{return globalThis.__enhancerElectronApi.nodeRequire(`notion-enhancer/${e}`)}catch{return fetch(L(e),t).then(s=>s.json())}},ge=(e,t={})=>{if(e=e.replace(/^https:\/\/www\.notion\.so\//,"notion://www.notion.so/"),e.startsWith("http")||e.startsWith("notion://"))return fetch(e,t).then(r=>r.text());try{return globalThis.__enhancerElectronApi.nodeRequire("fs").readFileSync(M(`notion-enhancer/${e}`))}catch{return fetch(L(e),t).then(s=>s.text())}},ye=async e=>{try{let t=globalThis.__enhancerElectronApi.nodeRequire("fs");if(e.startsWith("http"))await fetch(e);else try{t.existsSync(M(`notion-enhancer/${e}`))}catch{await fetch(L(e))}return!0}catch{return!1}};"use strict";var tt=M,nt=L,rt=me,st=ge,ot=ye;var _={};y(_,{addChangeListener:()=>lt,db:()=>ct,get:()=>it,removeChangeListener:()=>dt,set:()=>at});"use strict";var H=(e,t=void 0)=>globalThis.__enhancerElectronApi.db.get(e,t),I=(e,t)=>globalThis.__enhancerElectronApi.db.set(e,t),we=(e,t=H,n=I)=>(typeof e=="string"&&(e=[e]),{get:(r=[],s=void 0)=>t([...e,...r],s),set:(r,s)=>n([...e,...r],s)}),ve=e=>globalThis.__enhancerElectronApi.db.addChangeListener(e),be=e=>globalThis.__enhancerElectronApi.db.removeChangeListener(e);"use strict";var it=H,at=I,ct=we,lt=ve,dt=be;var V={};y(V,{browser:()=>pt,getFocusedNotionWindow:()=>wt,getNotionWindows:()=>yt,notionRequire:()=>gt,onMessage:()=>mt,sendMessage:()=>ht,sendMessageToHost:()=>ft,webFrame:()=>ut});"use strict";var pt=globalThis.__enhancerElectronApi?.browser,ut=globalThis.__enhancerElectronApi?.webFrame,ht=(e,t,n="notion-enhancer")=>{globalThis.__enhancerElectronApi&&globalThis.__enhancerElectronApi.ipcRenderer.sendMessage(e,t,n)},ft=(e,t,n="notion-enhancer")=>{globalThis.__enhancerElectronApi&&globalThis.__enhancerElectronApi.ipcRenderer.sendMessageToHost(e,t,n)},mt=(e,t,n="notion-enhancer")=>{globalThis.__enhancerElectronApi&&globalThis.__enhancerElectronApi.ipcRenderer.onMessage(e,t,n)},gt=e=>globalThis.__enhancerElectronApi?globalThis.__enhancerElectronApi.notionRequire(e):null,yt=()=>globalThis.__enhancerElectronApi?globalThis.__enhancerElectronApi.getNotionWindows():null,wt=()=>globalThis.__enhancerElectronApi?globalThis.__enhancerElectronApi.getFocusedNotionWindow():null;var X={};y(X,{create:()=>xt,get:()=>xe,getPageID:()=>J,getSpaceID:()=>T,getUserID:()=>_e,search:()=>vt,set:()=>bt,sign:()=>$t,upload:()=>_t});"use strict";var m=e=>(e?.length===32&&!e.includes("-")&&(e=e.replace(/([\d\w]{8})([\d\w]{4})([\d\w]{4})([\d\w]{4})([\d\w]{12})/,"$1-$2-$3-$4-$5")),e),xe=async(e,t="block")=>{e=m(e);let n=await u.getJSON("https://www.notion.so/api/v3/getRecordValues",{headers:{"Content-Type":"application/json"},body:JSON.stringify({requests:[{table:t,id:e}]}),method:"POST"});return n?.results?.[0]?.value||n},_e=()=>JSON.parse(localStorage["LRU:KeyValueStore2:current-user-id"]||{}).value,J=()=>m(o.queryParams().get("p")||location.pathname.split(/(-|\/)/g).reverse()[0]),K,T=async()=>(K||(K=(await xe(J())).space_id),K),vt=async(e="",t=20,n=T())=>(n=m(await n),await u.getJSON("https://www.notion.so/api/v3/search",{headers:{"Content-Type":"application/json"},body:JSON.stringify({type:"BlocksInSpace",query:e,spaceId:n,limit:t,filters:{isDeletedOnly:!1,excludeTemplates:!1,isNavigableOnly:!1,requireEditPermissions:!1,ancestors:[],createdBy:[],editedBy:[],lastEditedTime:{},createdTime:{}},sort:"Relevance",source:"quick_find"}),method:"POST"})),bt=async({recordID:e,recordTable:t="block",spaceID:n=T(),path:r=[]},s={})=>{n=m(await n),e=m(e);let c=await u.getJSON("https://www.notion.so/api/v3/saveTransactions",{headers:{"Content-Type":"application/json"},body:JSON.stringify({requestId:h.uuidv4(),transactions:[{id:h.uuidv4(),spaceId:n,operations:[{pointer:{table:t,id:e,spaceId:n},path:r,command:r.length?"set":"update",args:s}]}]}),method:"POST"});return c.errorId?c:!0},xt=async({recordValue:e={},recordTable:t="block"}={},{prepend:n=!1,siblingID:r=void 0,parentID:s=J(),parentTable:c="block",spaceID:a=T(),userID:i=_e()}={})=>{a=m(await a),s=m(s),r=m(r);let d=m(e?.id??h.uuidv4()),x=[],A={type:"text",id:d,version:0,created_time:new Date().getTime(),last_edited_time:new Date().getTime(),parent_id:s,parent_table:c,alive:!0,created_by_table:"notion_user",created_by_id:i,last_edited_by_table:"notion_user",last_edited_by_id:i,space_id:a,permissions:[{type:"user_permission",role:"editor",user_id:i}]};c==="space"?(s=a,A.parent_id=a,x.push("pages"),A.type="page"):c==="collection_view"?(x.push("page_sort"),A.type="page"):x.push("content");let ce=await u.getJSON("https://www.notion.so/api/v3/saveTransactions",{headers:{"Content-Type":"application/json"},body:JSON.stringify({requestId:h.uuidv4(),transactions:[{id:h.uuidv4(),spaceId:a,operations:[{pointer:{table:c,id:s,spaceId:a},path:x,command:n?"listBefore":"listAfter",args:{...r?{after:r}:{},id:d}},{pointer:{table:t,id:d,spaceId:a},path:[],command:"set",args:{...A,...e}}]}]}),method:"POST"});return ce.errorId?ce:d},_t=async(e,{pageID:t=J(),spaceID:n=T()}={})=>{n=m(await n),t=m(t);let r=await u.getJSON("https://www.notion.so/api/v3/getUploadFileUrl",{method:"POST",headers:{"content-type":"application/json"},body:JSON.stringify({bucket:"secure",name:e.name,contentType:e.type,record:{table:"block",id:t,spaceId:n}})});return r.errorId?r:(fetch(r.signedPutUrl,{method:"PUT",headers:{"content-type":e.type},body:e}),r.url)},$t=(e,t,n="block")=>(e.startsWith("/")&&(e=`https://notion.so${e}`),e.includes("secure.notion-static.com")&&(e=new URL(e),e=`https://www.notion.so/signed/${encodeURIComponent(e.origin+e.pathname)}?table=${n}&id=${t}`),e);var h={};y(h,{is:()=>kt,rgbContrast:()=>Lt,rgbLogShade:()=>jt,slugger:()=>At,uuidv4:()=>Et});"use strict";var At=(e,t=new Set)=>{e=e.replace(/\s/g,"-").replace(/[^A-Za-z0-9-_]/g,"").toLowerCase();let n=0,r=e;for(;t.has(r);)n++,r=`${e}-${n}`;return r},Et=()=>crypto?.randomUUID?crypto.randomUUID():([1e7]+-1e3+-4e3+-8e3+-1e11).replace(/[018]/g,e=>(e^crypto.getRandomValues(new Uint8Array(1))[0]&15>>e/4).toString(16)),jt=(e,t)=>{var n=parseInt,r=Math.round,[s,c,t,a]=t.split(","),i=e<0,d=i?0:e*255**2,i=i?1+e:1-e;return"rgb"+(a?"a(":"(")+r((i*n(s[3]=="a"?s.slice(5):s.slice(4))**2+d)**.5)+","+r((i*n(c)**2+d)**.5)+","+r((i*n(t)**2+d)**.5)+(a?","+a:")")},Lt=(e,t,n)=>Math.sqrt(.299*(e*e)+.587*(t*t)+.114*(n*n))>165.75?"rgb(0,0,0)":"rgb(255,255,255)",Tt={alphanumeric:/^[\w\.-]+$/,uuid:/^[0-9a-f]{8}-[0-9a-f]{4}-[0-9a-f]{4}-[0-9a-f]{4}-[0-9a-f]{12}$/i,semver:/^(0|[1-9]\d*)\.(0|[1-9]\d*)\.(0|[1-9]\d*)(?:-((?:0|[1-9]\d*|\d*[a-zA-Z-][0-9a-zA-Z-]*)(?:\.(?:0|[1-9]\d*|\d*[a-zA-Z-][0-9a-zA-Z-]*))*))?(?:\+([0-9a-zA-Z-]+(?:\.[0-9a-zA-Z-]+)*))?$/i,email:/^(([^<>()\[\]\\.,;:\s@"]+(\.[^<>()\[\]\\.,;:\s@"]+)*)|(".+"))@((\[[0-9]{1,3}\.[0-9]{1,3}\.[0-9]{1,3}\.[0-9]{1,3}])|(([a-zA-Z\-0-9]+\.)+[a-zA-Z]{2,}))$/i,url:/^[(http(s)?):\/\/(www\.)?a-zA-Z0-9@:%._\+~#=]{2,256}\.[a-z]{2,64}\b([-a-zA-Z0-9@:%_\+.~#?&//=]*)$/i,color:/^(?:#|0x)(?:[a-f0-9]{3}|[a-f0-9]{6})\b|(?:rgb|hsl)a?\([^\)]*\)$/i};function St(e,t){let n=e.match(t);return!!(n&&n.length)}var kt=async(e,t,{extension:n=""}={})=>{if(n=!e||!e.endsWith||e.endsWith(n),Array.isArray(t))return t.includes(e);switch(t){case"array":return Array.isArray(e);case"object":return e&&typeof e=="object"&&!Array.isArray(e);case"undefined":case"boolean":case"number":return typeof e===t&&n;case"string":return typeof e===t&&n;case"alphanumeric":case"uuid":case"semver":case"email":case"url":case"color":return typeof e=="string"&&St(e,Tt[t])&&n;case"file":return typeof e=="string"&&e&&await u.isFile(e)&&n}return!1};var g={};y(g,{core:()=>Ae,db:()=>Ut,enabled:()=>zt,errors:()=>Wt,get:()=>ee,list:()=>D,optionDefault:()=>je,optionTypes:()=>Jt,profileDB:()=>G,profileName:()=>Ee,supportedEnvs:()=>Mt});"use strict";var l=async(e,t,n,r,{extension:s="",error:c=`invalid ${t} (${s?`${s} `:""}${r}): ${JSON.stringify(n)}`,optional:a=!1}={})=>{let i;for(let d of Array.isArray(r)?[r]:r.split("|"))if(d==="file"?i=n&&!n.startsWith("http")?await h.is(`repo/${e._dir}/${n}`,d,{extension:s}):!1:i=await h.is(n,d,{extension:s}),i)break;return i||a&&await h.is(n,"undefined")?!0:(c&&e._err(c),!1)},Pt=async e=>(e.environments=e.environments??g.supportedEnvs,await l(e,"environments",e.environments,"array")?e.environments.map(n=>l(e,"environments.env",n,g.supportedEnvs)):!1),Ct=async e=>{if(!await l(e,"tags",e.tags,"array"))return!1;let n=["core","extension","theme","integration"];if(!e.tags.filter(i=>n.includes(i)).length)return e._err(`invalid tags (must contain at least one of 'core', 'extension', 'theme' or 'integration'):
+        ${JSON.stringify(e.tags)}`),!1;let s=e.tags.includes("theme"),c=e.tags.includes("light")||e.tags.includes("dark"),a=e.tags.includes("light")&&e.tags.includes("dark");return s&&(!c||a)?(e._err(`invalid tags (themes must be either 'light' or 'dark', not neither or both):
+        ${JSON.stringify(e.tags)}`),!1):e.tags.map(i=>l(e,"tags.tag",i,"string"))},Ot=async e=>await l(e,"authors",e.authors,"array")?e.authors.map(n=>[l(e,"authors.author.name",n.name,"string"),l(e,"authors.author.email",n.email,"email",{optional:!0}),l(e,"authors.author.homepage",n.homepage,"url"),l(e,"authors.author.avatar",n.avatar,"url")]):!1,Nt=async e=>{if(!await l(e,"css",e.css,"object"))return!1;let n=[];for(let r of["frame","client","menu"]){if(!e.css[r])continue;let s=await l(e,`css.${r}`,e.css[r],"array");s&&(s=e.css[r].map(c=>l(e,`css.${r}.file`,c,"file",{extension:".css"}))),n.push(s)}return n},Rt=async e=>{if(!await l(e,"js",e.js,"object"))return!1;let n=[];for(let r of["frame","client","menu"]){if(!e.js[r])continue;let s=await l(e,`js.${r}`,e.js[r],"array");s&&(s=e.js[r].map(c=>l(e,`js.${r}.file`,c,"file",{extension:".mjs"}))),n.push(s)}if(e.js.electron)if(await l(e,"js.electron",e.js.electron,"array"))for(let s of e.js.electron){if(!await l(e,"js.electron.file",s,"object")){n.push(!1);continue}n.push([l(e,"js.electron.file.source",s.source,"file",{extension:".cjs"}),l(e,"js.electron.file.target",s.target,"string",{extension:".js"})])}else n.push(!1);return n},qt=async e=>{if(!await l(e,"options",e.options,"array"))return!1;let n=[];for(let r of e.options){let s="options.option";if(!await l(e,`${s}.type`,r.type,g.optionTypes)){n.push(!1);continue}switch(r.environments=r.environments??g.supportedEnvs,n.push([l(e,`${s}.key`,r.key,"alphanumeric"),l(e,`${s}.label`,r.label,"string"),l(e,`${s}.tooltip`,r.tooltip,"string",{optional:!0}),l(e,`${s}.environments`,r.environments,"array").then(a=>a?r.environments.map(i=>l(e,`${s}.environments.env`,i,g.supportedEnvs)):!1)]),r.type){case"toggle":n.push(l(e,`${s}.value`,r.value,"boolean"));break;case"select":{let a=await l(e,`${s}.values`,r.values,"array");a&&(a=r.values.map(i=>l(e,`${s}.values.value`,i,"string"))),n.push(a);break}case"text":case"hotkey":n.push(l(e,`${s}.value`,r.value,"string"));break;case"number":case"color":n.push(l(e,`${s}.value`,r.value,r.type));break;case"file":{let a=await l(e,`${s}.extensions`,r.extensions,"array");a&&(a=r.extensions.map(i=>l(e,`${s}.extensions.extension`,i,"string"))),n.push(a);break}}}return n};async function $e(e){let t=[l(e,"name",e.name,"string"),l(e,"id",e.id,"uuid"),l(e,"version",e.version,"semver"),Pt(e),l(e,"description",e.description,"string"),l(e,"preview",e.preview,"file|url",{optional:!0}),Ct(e),Ot(e),Nt(e),Rt(e),qt(e)];do t=await Promise.all(t.flat(1/0));while(t.some(n=>Array.isArray(n)));return t.every(n=>n)}"use strict";var Ae=["a6621988-551d-495a-97d8-3c568bca2e9e","0f0bf8b6-eae6-4273-b307-8fc43f2ee082","36a2ffc9-27ff-480e-84a7-c7700a7d232d"],Mt=["linux","win32","darwin","extension"],Jt=["toggle","select","text","number","color","file","hotkey"],Ee=async()=>_.get(["currentprofile"],"default"),G=async()=>_.db(["profiles",await Ee()]),Q,Y=[],D=async(e=t=>!0)=>{Q||(Q=new Promise(async(n,r)=>{let s=[];for(let c of await u.getJSON("repo/registry.json"))try{let a={...await u.getJSON(`repo/${c}/mod.json`),_dir:c,_err:i=>Y.push({source:c,message:i})};await $e(a)&&s.push(a)}catch{Y.push({source:c,message:"invalid mod.json"})}n(s)}));let t=[];for(let n of await Q)await e(n)&&t.push(n);return t},Wt=async()=>(await D(),Y),ee=async e=>(await D(t=>t.id===e))[0],zt=async e=>(await ee(e)).environments.includes(j.name)?Ae.includes(e)?!0:(await G()).get(["_mods",e],!1):!1,je=async(e,t)=>{let n=await ee(e),r=n.options.find(s=>s.key===t);if(!!r)switch(r.type){case"toggle":case"text":case"number":case"color":case"hotkey":return r.value;case"select":return r.values[0];case"file":return}},Ut=async e=>{let t=await G();return _.db([e],async(n,r=void 0)=>(typeof n=="string"&&(n=[n]),n.length===2&&(r=await je(e,n[1])??r),t.get(n,r)),t.set)};var o={};y(o,{addDocumentObserver:()=>Gt,addHotkeyListener:()=>Kt,copyToClipboard:()=>It,empty:()=>Ft,escape:()=>Te,html:()=>ke,loadStylesheet:()=>Ht,queryParams:()=>Bt,raw:()=>Se,readFromClipboard:()=>Vt,removeDocumentObserver:()=>Qt,removeHotkeyListener:()=>Xt,render:()=>Pe,whenReady:()=>Zt});"use strict";var Le=!1,S=[],te,W=[],ne=[],Zt=(e=[])=>new Promise((t,n)=>{let r=()=>{let s=setInterval(c,100);function c(){!e.every(i=>document.querySelector(i))||(clearInterval(s),t(!0))}c()};document.readyState!=="complete"?document.addEventListener("readystatechange",s=>{document.readyState==="complete"&&r()}):r()}),Bt=()=>new URLSearchParams(window.location.search),Te=e=>e.replace(/&/g,"&amp;").replace(/</g,"&lt;").replace(/>/g,"&gt;").replace(/'/g,"&#39;").replace(/"/g,"&quot;").replace(/\\/g,"&#x5C;"),Se=(e,...t)=>{let n=e.map(r=>r+(["string","number"].includes(typeof t[0])?t.shift():Te(JSON.stringify(t.shift(),null,2)??""))).join("");return n.includes("<pre")?n.trim():n.split(/\n/).map(r=>r.trim()).filter(r=>r.length).join(" ")},ke=(e,...t)=>{let n=document.createRange().createContextualFragment(Se(e,...t));return n.children.length===1?n.children[0]:n.children},Pe=(e,...t)=>(t=t.map(n=>n instanceof HTMLCollection?[...n]:n).flat(1/0).filter(n=>n),e.append(...t),e),Ft=e=>{for(;e.firstChild&&e.removeChild(e.firstChild););return e},Ht=e=>{let t=ke`<link
+    rel="stylesheet"
+    href="${e.startsWith("https://")?e:u.localPath(e)}"
+  />`;return Pe(document.head,t),t},It=async e=>{try{await navigator.clipboard.writeText(e)}catch{let t=document.createElement("textarea");t.value=e,t.setAttribute("readonly",""),t.style.position="absolute",t.style.left="-9999px",document.body.appendChild(t),t.select(),document.execCommand("copy"),document.body.removeChild(t)}},Vt=()=>navigator.clipboard.readText(),Ce=(e,t)=>{if(document.activeElement.nodeName==="INPUT"&&!t.listenInInput)return;let r={metaKey:["meta","os","win","cmd","command"],ctrlKey:["ctrl","control"],shiftKey:["shift"],altKey:["alt"]};if(!!t.keys.every(c=>{c=c.toLowerCase();for(let a in r)if(r[a].includes(c)&&e[a])return r[a]=[],!0;if(c==="space"&&(c=" "),c==="plus"&&(c="+"),c===e.key.toLowerCase())return!0})){for(let c in r){let a=e[c],i=r[c].length>0;if(a&&i)return}t.callback(e)}},Kt=(e,t,{listenInInput:n=!1,keydown:r=!1}={})=>{typeof e=="string"&&(e=e.split("+")),S.push({keys:e,callback:t,listenInInput:n,keydown:r}),Le||(Le=!0,document.addEventListener("keyup",s=>{for(let c of S.filter(({keydown:a})=>!a))Ce(s,c)}),document.addEventListener("keydown",s=>{for(let c of S.filter(({keydown:a})=>a))Ce(s,c)}))},Xt=e=>{S=S.filter(t=>t.callback!==e)},Gt=(e,t=[])=>{if(!te){let n=r=>{for(;r.length;){let s=r.shift(),c=(i,d)=>i instanceof Element&&(i.matches(d)||i.matches(`${d} *`)||i.querySelector(d)),a=i=>s.target.matches(i)||s.target.matches(`${i} *`)||[...s.addedNodes].some(d=>c(d,i));for(let i of W)(!i.selectors.length||i.selectors.some(a))&&i.callback(s)}};te=new MutationObserver((r,s)=>{ne.length||requestIdleCallback(()=>n(ne)),ne.push(...r)}),te.observe(document.body,{childList:!0,subtree:!0,attributes:!0})}W.push({callback:e,selectors:t})},Qt=e=>{W=W.filter(t=>t.callback!==e)};var R={};y(R,{addCornerAction:()=>Ke,addPanelView:()=>Ie,addTooltip:()=>Ne,feather:()=>Re});"use strict";var Oe,p,Yt=e=>[...e.getClientRects()].reduce((t,n)=>t.some(r=>r.y===n.y)?t:[...t,n],[]).length,Dt=async(e,t,n)=>{p.style.top="0px",p.style.left="0px";let r=e.getBoundingClientRect(),{offsetWidth:s,offsetHeight:c}=p,a=6,i=r.x,d=Math.floor(r.y);if(["top","bottom"].includes(t)){t==="top"&&(d-=c+a),t==="bottom"&&(d+=r.height+a),i-=s/2-r.width/2,p.style.left=`${i}px`,p.style.top=`${d}px`;let x=()=>Yt(p.firstElementChild)>n,A=x();for(;x();)p.style.left=`${window.innerWidth-i>i?i++:i--}px`;A&&(i+=window.innerWidth-i>i?a:-a,p.style.left=`${i}px`),p.style.textAlign="center"}return["left","right"].includes(t)&&(d-=c/2-r.height/2,t==="left"&&(i-=s+a),t==="right"&&(i+=r.width+a),p.style.left=`${i}px`,p.style.top=`${d}px`,p.style.textAlign="start"),!0},Ne=async(e,t,{delay:n=100,offsetDirection:r="bottom",maxLines:s=1}={})=>{Oe||(Oe=o.loadStylesheet("api/components/tooltip.css"),p=o.html`<div id="enhancer--tooltip"></div>`,o.render(document.body,p)),globalThis.markdownit||await import(u.localPath("dep/markdown-it.min.js"));let c=markdownit({linkify:!0});t instanceof Element||(t=o.html`<div style="display:inline">
+      ${t.split(`
+`).map(i=>c.renderInline(i)).join("<br>")}
+    </div>`);let a;e.addEventListener("mouseover",async i=>{a||(a=setTimeout(async()=>{e.matches(":hover")&&p.style.display!=="block"&&(p.style.display="block",o.render(o.empty(p),t),Dt(e,r,s),await p.animate([{opacity:0},{opacity:1}],{duration:65}).finished),a=void 0},n))}),e.addEventListener("mouseout",async i=>{a=void 0,p.style.display==="block"&&!e.matches(":hover")&&(await p.animate([{opacity:1},{opacity:0}],{duration:65}).finished,p.style.display="")})};"use strict";var re,Re=async(e,t={})=>(re||(re=o.html`${await u.getText("dep/feather-sprite.svg")}`),t.style=((t.style?t.style+";":"")+"stroke:currentColor;stroke-width:2;stroke-linecap:round;stroke-linejoin:round;fill:none;").trim(),t.viewBox="0 0 24 24",`<svg ${Object.entries(t).map(([n,r])=>`${o.escape(n)}="${o.escape(r)}"`).join(" ")}>${re.getElementById(e)?.innerHTML}</svg>`);"use strict";var k=[],en=o.raw`<svg viewBox="-1 -1 9 11">
+    <path d="M 3.5 0L 3.98809 -0.569442L 3.5 -0.987808L 3.01191 -0.569442L 3.5 0ZM 3.5 9L 3.01191
+      9.56944L 3.5 9.98781L 3.98809 9.56944L 3.5 9ZM 0.488094 3.56944L 3.98809 0.569442L 3.01191
+      -0.569442L -0.488094 2.43056L 0.488094 3.56944ZM 3.01191 0.569442L 6.51191 3.56944L 7.48809
+      2.43056L 3.98809 -0.569442L 3.01191 0.569442ZM -0.488094 6.56944L 3.01191 9.56944L 3.98809
+      8.43056L 0.488094 5.43056L -0.488094 6.56944ZM 3.98809 9.56944L 7.48809 6.56944L 6.51191
+      5.43056L 3.01191 8.43056L 3.98809 9.56944Z"></path>
+  </svg>`,qe,v,z,w,$,P,E,Me,Je,se,f,We,U,C,Z,oe,b,ie,O,B="data-enhancer-panel-pinned",F=()=>$.hasAttribute(B),N=()=>{let e=[z,w,P,$].filter(t=>t);if(F()){ae();for(let t of e)t.removeAttribute(B)}else for(let t of e)t.setAttribute(B,"true");v.set(["panel.pinned"],F())},ze=async()=>{document.documentElement.style.setProperty("--component--panel-width",f+"px"),v.set(["panel.width"],f)},Ue=e=>{e.preventDefault(),se=!0,f=Je+(Me-e.clientX),f<190&&(f=190),f>480&&(f=480),$.style.width=f+"px",P.style.width=f+"px",z.style.paddingRight=f+"px",w&&(w.style.right=f+"px")},Ze=e=>{$.style.width="",P.style.width="",z.style.paddingRight="",w&&(w.style.right=""),ze(),E.style.cursor="",document.body.removeEventListener("mousemove",Ue),document.body.removeEventListener("mouseup",Ze)},tn=e=>{Me=e.clientX,Je=f,E.style.cursor="auto",document.body.addEventListener("mousemove",Ue),document.body.addEventListener("mouseup",Ze)},nn=()=>document.body.contains(b),Be=()=>{if(!F())return N();o.render(We,O),o.empty(b);for(let t of k){let n=C.contains(t.$title),r=o.render(o.html`<div class="enhancer--panel-switcher-item" tabindex="0" ${n?"data-open":""}></div>`,o.render(o.html`<span class="enhancer--panel-view-title"></span>`,t.$icon.cloneNode(!0),t.$title.cloneNode(!0)));r.addEventListener("click",()=>{He(t),v.set(["panel.open"],t.id)}),o.render(b,r)}let e=Z.getBoundingClientRect();o.render(o.empty(O),o.render(o.html`<div style="position: fixed; top: ${e.top}px; left: ${e.left}px;
+              width: ${e.width}px; height: ${e.height}px;"></div>`,o.render(o.html`<div style="position: relative; top: 100%; pointer-events: auto;"></div>`,b))),b.querySelector("[data-open]").focus(),b.animate([{opacity:0},{opacity:1}],{duration:200}),document.addEventListener("keydown",Fe)},ae=()=>{document.removeEventListener("keydown",Fe),b.animate([{opacity:1},{opacity:0}],{duration:200}).onfinish=()=>O.remove()},Fe=e=>{if(nn())switch(e.key){case"Escape":ae(),e.stopPropagation();break;case"Enter":document.activeElement.click(),e.stopPropagation();break;case"ArrowUp":(e.target.previousElementSibling||e.target.parentElement.lastElementChild).focus(),e.stopPropagation();break;case"ArrowDown":(e.target.nextElementSibling||e.target.parentElement.firstElementChild).focus(),e.stopPropagation();break}},He=e=>{let t=k.find(({$content:n})=>document.contains(n));o.render(o.empty(C),o.render(o.html`<span class="enhancer--panel-view-title"></span>`,e.$icon,e.$title)),e.onFocus(),o.render(o.empty(oe),e.$content),t&&t.onBlur()};async function rn(){await o.whenReady([".notion-frame"]),z=document.querySelector(".notion-frame"),$=o.html`<div id="enhancer--panel"></div>`,P=o.html`<div id="enhancer--panel-hover-trigger"></div>`,E=o.html`<div id="enhancer--panel-resize"><div></div></div>`,C=o.html`<div id="enhancer--panel-header-title"></div>`,Z=o.render(o.html`<div id="enhancer--panel-header"></div>`,C),oe=o.html`<div id="enhancer--panel-content"></div>`,b=o.html`<div id="enhancer--panel-switcher"></div>`,ie=o.html`<div id="enhancer--panel-header-switcher" tabindex="0">
+    ${en}
+  </div>`,O=o.html`<div id="enhancer--panel-switcher-overlay-container"></div>`;let e='.notion-cursor-listener > div[style*="flex-end"]',t=()=>{document.contains(w)||(w=document.querySelector(e),F()&&w&&w.setAttribute(B,"true"))};w=document.querySelector(e),o.addDocumentObserver(t,[e]),await v.get(["panel.pinned"])&&N(),o.addHotkeyListener(await v.get(["panel.hotkey"]),N),U.addEventListener("click",r=>{r.stopPropagation(),N()}),o.render($,o.render(Z,C,ie,U),oe,E),await sn(),await on();let n='.notion-cursor-listener > .notion-sidebar-container ~ [style^="position: absolute"]';await o.whenReady([n]),document.querySelector(n).before(P,$)}async function sn(){f=await v.get(["panel.width"],240),ze(),E.addEventListener("mousedown",tn),E.addEventListener("click",()=>{se?se=!1:N()})}async function on(){We=document.querySelector(".notion-app-inner"),Z.addEventListener("click",Be),ie.addEventListener("click",Be),O.addEventListener("click",ae)}var Ie=async({id:e,icon:t,title:n,$content:r,onFocus:s=()=>{},onBlur:c=()=>{}})=>{qe||(qe=o.loadStylesheet("api/components/panel.css")),v||(v=await g.db("36a2ffc9-27ff-480e-84a7-c7700a7d232d")),U||(U=o.html`<div id="enhancer--panel-header-toggle" tabindex="0"><div>
+      ${await R.feather("chevrons-right")}
+    </div></div>`);let a={id:e,$icon:o.render(o.html`<span class="enhancer--panel-view-title-icon"></span>`,t instanceof Element?t:o.html`${t}`),$title:o.render(o.html`<span class="enhancer--panel-view-title-text"></span>`,n),$content:r,onFocus:s,onBlur:c};k.push(a),k.length===1&&await rn(),(k.length===1||await v.get(["panel.open"])===e)&&He(a)};"use strict";var Ve,q,Ke=async(e,t)=>{Ve||(Ve=o.loadStylesheet("api/components/corner-action.css"),q=o.html`<div id="enhancer--corner-actions"></div>`),await o.whenReady([".notion-help-button"]);let n=document.querySelector(".notion-help-button"),r=document.querySelector(".onboarding-checklist-button");r&&q.prepend(r),q.prepend(n),o.render(document.querySelector(".notion-app-inner > .notion-cursor-listener"),q);let s=o.html`<div class="enhancer--corner-action-button">${e}</div>`;return s.addEventListener("click",t),o.render(q,s),s};"use strict";"use strict";
diff --git a/src/common/index.mjs b/src/common/index.mjs
new file mode 100644
index 0000000..f3538f8
--- /dev/null
+++ b/src/common/index.mjs
@@ -0,0 +1,31 @@
+/**
+ * notion-enhancer: api
+ * (c) 2021 dragonwocky <thedragonring.bod@gmail.com> (https://dragonwocky.me/)
+ * (https://notion-enhancer.github.io/) under the MIT license
+ */
+
+'use strict';
+
+// compiles to .cjs for use in electron:
+// npx -y esbuild insert/api/index.mjs --minify --bundle --format=cjs --outfile=insert/api/index.cjs
+
+/** environment-specific methods and constants */
+export * as env from './env.mjs';
+/** environment-specific file reading */
+export * as fs from './fs.mjs';
+/** environment-specific data persistence */
+export * as storage from './storage.mjs';
+
+/** access to electron renderer apis */
+export * as electron from './electron.mjs';
+
+/** a basic wrapper around notion's unofficial api */
+export * as notion from './notion.mjs';
+/** helpers for formatting, validating and parsing values */
+export * as fmt from './fmt.mjs';
+/** interactions with the enhancer's repository of mods */
+export * as registry from './registry.mjs';
+/** helpers for manipulation of a webpage */
+export * as web from './web.mjs';
+/** shared notion-style elements */
+export * as components from './components/index.mjs';
diff --git a/src/common/notion.mjs b/src/common/notion.mjs
new file mode 100644
index 0000000..8757ba4
--- /dev/null
+++ b/src/common/notion.mjs
@@ -0,0 +1,367 @@
+/**
+ * notion-enhancer: api
+ * (c) 2021 dragonwocky <thedragonring.bod@gmail.com> (https://dragonwocky.me/)
+ * (https://notion-enhancer.github.io/) under the MIT license
+ */
+
+'use strict';
+
+/**
+ * a basic wrapper around notion's content apis
+ * @namespace notion
+ */
+
+import { web, fs, fmt } from './index.mjs';
+
+const standardiseUUID = (uuid) => {
+  if (uuid?.length === 32 && !uuid.includes('-')) {
+    uuid = uuid.replace(
+      /([\d\w]{8})([\d\w]{4})([\d\w]{4})([\d\w]{4})([\d\w]{12})/,
+      '$1-$2-$3-$4-$5'
+    );
+  }
+  return uuid;
+};
+
+/**
+ * unofficial content api: get a block by id
+ * (requires user to be signed in or content to be public).
+ * why not use the official api?
+ * 1. cors blocking prevents use on the client
+ * 2. the majority of blocks are still 'unsupported'
+ * @param {string} id - uuidv4 record id
+ * @param {string=} table - record type (default: 'block').
+ * may also be 'collection', 'collection_view', 'space', 'notion_user', 'discussion', or 'comment'
+ * @returns {Promise<object>} record data. type definitions can be found here:
+ * https://github.com/NotionX/react-notion-x/tree/master/packages/notion-types/src
+ */
+export const get = async (id, table = 'block') => {
+  id = standardiseUUID(id);
+  const json = await fs.getJSON('https://www.notion.so/api/v3/getRecordValues', {
+    headers: {
+      'Content-Type': 'application/json',
+    },
+    body: JSON.stringify({ requests: [{ table, id }] }),
+    method: 'POST',
+  });
+  return json?.results?.[0]?.value || json;
+};
+
+/**
+ * get the id of the current user (requires user to be signed in)
+ * @returns {string} uuidv4 user id
+ */
+export const getUserID = () =>
+  JSON.parse(localStorage['LRU:KeyValueStore2:current-user-id'] || {}).value;
+
+/**
+ * get the id of the currently open page
+ * @returns {string} uuidv4 page id
+ */
+export const getPageID = () =>
+  standardiseUUID(
+    web.queryParams().get('p') || location.pathname.split(/(-|\/)/g).reverse()[0]
+  );
+
+let _spaceID;
+/**
+ * get the id of the currently open workspace (requires user to be signed in)
+ * @returns {string} uuidv4 space id
+ */
+export const getSpaceID = async () => {
+  if (!_spaceID) _spaceID = (await get(getPageID())).space_id;
+  return _spaceID;
+};
+
+/**
+ * unofficial content api: search all blocks in a space
+ * (requires user to be signed in or content to be public).
+ * why not use the official api?
+ * 1. cors blocking prevents use on the client
+ * 2. the majority of blocks are still 'unsupported'
+ * @param {string=} query - query to search blocks in the space for
+ * @param {number=} limit - the max number of results to return (default: 20)
+ * @param {string=} spaceID - uuidv4 workspace id
+ * @returns {object} the number of total results, the list of matches, and related record values.
+ * type definitions can be found here: https://github.com/NotionX/react-notion-x/blob/master/packages/notion-types/src/api.ts
+ */
+export const search = async (query = '', limit = 20, spaceID = getSpaceID()) => {
+  spaceID = standardiseUUID(await spaceID);
+  const json = await fs.getJSON('https://www.notion.so/api/v3/search', {
+    headers: {
+      'Content-Type': 'application/json',
+    },
+    body: JSON.stringify({
+      type: 'BlocksInSpace',
+      query,
+      spaceId: spaceID,
+      limit,
+      filters: {
+        isDeletedOnly: false,
+        excludeTemplates: false,
+        isNavigableOnly: false,
+        requireEditPermissions: false,
+        ancestors: [],
+        createdBy: [],
+        editedBy: [],
+        lastEditedTime: {},
+        createdTime: {},
+      },
+      sort: 'Relevance',
+      source: 'quick_find',
+    }),
+    method: 'POST',
+  });
+  return json;
+};
+
+/**
+ * unofficial content api: update a property/the content of an existing record
+ * (requires user to be signed in or content to be public).
+ * TEST THIS THOROUGHLY. misuse can corrupt a record, leading the notion client
+ * to be unable to parse and render content properly and throw errors.
+ * why not use the official api?
+ * 1. cors blocking prevents use on the client
+ * 2. the majority of blocks are still 'unsupported'
+ * @param {object} pointer - the record being updated
+ * @param {object} recordValue - the new raw data values to set to the record.
+ * for examples, use notion.get to fetch an existing block record.
+ * to use this to update content, set pointer.path to ['properties', 'title]
+ * and recordValue to an array of rich text segments. a segment is an array
+ * where the first value is the displayed text and the second value
+ * is an array of decorations. a decoration is an array where the first value
+ * is a modifier and the second value specifies it. e.g.
+ * [
+ *   ['bold text', [['b']]],
+ *   [' '],
+ *   ['an italicised link', [['i'], ['a', 'https://github.com']]],
+ *   [' '],
+ *   ['highlighted text', [['h', 'pink_background']]],
+ * ]
+ * more examples can be creating a block with the desired content/formatting,
+ * then find the value of blockRecord.properties.title using notion.get.
+ * type definitions can be found here: https://github.com/NotionX/react-notion-x/blob/master/packages/notion-types/src/core.ts
+ * @param {string} pointer.recordID - uuidv4 record id
+ * @param {string=} pointer.recordTable - record type (default: 'block').
+ * may also be 'collection', 'collection_view', 'space', 'notion_user', 'discussion', or 'comment'
+ * @param {string=} pointer.property - the record property to update.
+ * for record content, it will be the default: 'title'.
+ * for page properties, it will be the property id (the key used in pageRecord.properties).
+ * other possible values are unknown/untested
+ * @param {string=} pointer.spaceID - uuidv4 workspace id
+ * @param {string=} pointer.path - the path to the key to be set within the record
+ * (default: [], the root of the record's values)
+ * @returns {boolean|object} true if success, else an error object
+ */
+export const set = async (
+  { recordID, recordTable = 'block', spaceID = getSpaceID(), path = [] },
+  recordValue = {}
+) => {
+  spaceID = standardiseUUID(await spaceID);
+  recordID = standardiseUUID(recordID);
+  const json = await fs.getJSON('https://www.notion.so/api/v3/saveTransactions', {
+    headers: {
+      'Content-Type': 'application/json',
+    },
+    body: JSON.stringify({
+      requestId: fmt.uuidv4(),
+      transactions: [
+        {
+          id: fmt.uuidv4(),
+          spaceId: spaceID,
+          operations: [
+            {
+              pointer: {
+                table: recordTable,
+                id: recordID,
+                spaceId: spaceID,
+              },
+              path,
+              command: path.length ? 'set' : 'update',
+              args: recordValue,
+            },
+          ],
+        },
+      ],
+    }),
+    method: 'POST',
+  });
+  return json.errorId ? json : true;
+};
+
+/**
+ * unofficial content api: create and add a new block to a page
+ * (requires user to be signed in or content to be public).
+ * TEST THIS THOROUGHLY. misuse can corrupt a record, leading the notion client
+ * to be unable to parse and render content properly and throw errors.
+ * why not use the official api?
+ * 1. cors blocking prevents use on the client
+ * 2. the majority of blocks are still 'unsupported'
+ * @param {object} insert - the new record.
+ * @param {object} pointer - where to insert the new block
+ * for examples, use notion.get to fetch an existing block record.
+ * type definitions can be found here: https://github.com/NotionX/react-notion-x/blob/master/packages/notion-types/src/block.ts
+ * may also be 'collection', 'collection_view', 'space', 'notion_user', 'discussion', or 'comment'
+ * @param {object=} insert.recordValue - the new raw data values to set to the record.
+ * @param {object=} insert.recordTable - record type (default: 'block').
+ * may also be 'collection', 'collection_view', 'space', 'notion_user', 'discussion', or 'comment'
+ * @param {string=} pointer.prepend - insert before pointer.siblingID. if false, will be appended after
+ * @param {string=} pointer.siblingID - uuidv4 sibling id. if unset, the record will be
+ * inserted at the end of the page start (or the start if pointer.prepend is true)
+ * @param {string=} pointer.parentID - uuidv4 parent id
+ * @param {string=} pointer.parentTable - parent record type (default: 'block').
+ * @param {string=} pointer.spaceID - uuidv4 space id
+ * @param {string=} pointer.userID - uuidv4 user id
+ * instead of the end
+ * @returns {string|object} error object or uuidv4 of the new record
+ */
+export const create = async (
+  { recordValue = {}, recordTable = 'block' } = {},
+  {
+    prepend = false,
+    siblingID = undefined,
+    parentID = getPageID(),
+    parentTable = 'block',
+    spaceID = getSpaceID(),
+    userID = getUserID(),
+  } = {}
+) => {
+  spaceID = standardiseUUID(await spaceID);
+  parentID = standardiseUUID(parentID);
+  siblingID = standardiseUUID(siblingID);
+  const recordID = standardiseUUID(recordValue?.id ?? fmt.uuidv4()),
+    path = [],
+    args = {
+      type: 'text',
+      id: recordID,
+      version: 0,
+      created_time: new Date().getTime(),
+      last_edited_time: new Date().getTime(),
+      parent_id: parentID,
+      parent_table: parentTable,
+      alive: true,
+      created_by_table: 'notion_user',
+      created_by_id: userID,
+      last_edited_by_table: 'notion_user',
+      last_edited_by_id: userID,
+      space_id: spaceID,
+      permissions: [{ type: 'user_permission', role: 'editor', user_id: userID }],
+    };
+  if (parentTable === 'space') {
+    parentID = spaceID;
+    args.parent_id = spaceID;
+    path.push('pages');
+    args.type = 'page';
+  } else if (parentTable === 'collection_view') {
+    path.push('page_sort');
+    args.type = 'page';
+  } else {
+    path.push('content');
+  }
+  const json = await fs.getJSON('https://www.notion.so/api/v3/saveTransactions', {
+    headers: {
+      'Content-Type': 'application/json',
+    },
+    body: JSON.stringify({
+      requestId: fmt.uuidv4(),
+      transactions: [
+        {
+          id: fmt.uuidv4(),
+          spaceId: spaceID,
+          operations: [
+            {
+              pointer: {
+                table: parentTable,
+                id: parentID,
+                spaceId: spaceID,
+              },
+              path,
+              command: prepend ? 'listBefore' : 'listAfter',
+              args: {
+                ...(siblingID ? { after: siblingID } : {}),
+                id: recordID,
+              },
+            },
+            {
+              pointer: {
+                table: recordTable,
+                id: recordID,
+                spaceId: spaceID,
+              },
+              path: [],
+              command: 'set',
+              args: {
+                ...args,
+                ...recordValue,
+              },
+            },
+          ],
+        },
+      ],
+    }),
+    method: 'POST',
+  });
+  return json.errorId ? json : recordID;
+};
+
+/**
+ * unofficial content api: upload a file to notion's aws servers
+ * (requires user to be signed in or content to be public).
+ * TEST THIS THOROUGHLY. misuse can corrupt a record, leading the notion client
+ * to be unable to parse and render content properly and throw errors.
+ * why not use the official api?
+ * 1. cors blocking prevents use on the client
+ * 2. the majority of blocks are still 'unsupported'
+ * @param {File} file - the file to upload
+ * @param {object=} pointer - where the file should be accessible from
+ * @param {string=} pointer.pageID - uuidv4 page id
+ * @param {string=} pointer.spaceID - uuidv4 space id
+ * @returns {string|object} error object or the url of the uploaded file
+ */
+export const upload = async (file, { pageID = getPageID(), spaceID = getSpaceID() } = {}) => {
+  spaceID = standardiseUUID(await spaceID);
+  pageID = standardiseUUID(pageID);
+  const json = await fs.getJSON('https://www.notion.so/api/v3/getUploadFileUrl', {
+    method: 'POST',
+    headers: {
+      'content-type': 'application/json',
+    },
+    body: JSON.stringify({
+      bucket: 'secure',
+      name: file.name,
+      contentType: file.type,
+      record: {
+        table: 'block',
+        id: pageID,
+        spaceId: spaceID,
+      },
+    }),
+  });
+  if (json.errorId) return json;
+  fetch(json.signedPutUrl, {
+    method: 'PUT',
+    headers: { 'content-type': file.type },
+    body: file,
+  });
+  return json.url;
+};
+
+/**
+ * redirect through notion to a resource's signed aws url for display outside of notion
+ * (requires user to be signed in or content to be public)
+ * @param src source url for file
+ * @param {string} recordID uuidv4 record/block/file id
+ * @param {string=} recordTable record type (default: 'block').
+ * may also be 'collection', 'collection_view', 'space', 'notion_user', 'discussion', or 'comment'
+ * @returns {string} url signed if necessary, else string as-is
+ */
+export const sign = (src, recordID, recordTable = 'block') => {
+  if (src.startsWith('/')) src = `https://notion.so${src}`;
+  if (src.includes('secure.notion-static.com')) {
+    src = new URL(src);
+    src = `https://www.notion.so/signed/${encodeURIComponent(
+      src.origin + src.pathname
+    )}?table=${recordTable}&id=${recordID}`;
+  }
+  return src;
+};
diff --git a/src/common/registry-validation.mjs b/src/common/registry-validation.mjs
new file mode 100644
index 0000000..1b032d2
--- /dev/null
+++ b/src/common/registry-validation.mjs
@@ -0,0 +1,224 @@
+/**
+ * notion-enhancer: api
+ * (c) 2021 dragonwocky <thedragonring.bod@gmail.com> (https://dragonwocky.me/)
+ * (https://notion-enhancer.github.io/) under the MIT license
+ */
+
+'use strict';
+
+import { fmt, registry } from './index.mjs';
+
+const check = async (
+  mod,
+  key,
+  value,
+  types,
+  {
+    extension = '',
+    error = `invalid ${key} (${extension ? `${extension} ` : ''}${types}): ${JSON.stringify(
+      value
+    )}`,
+    optional = false,
+  } = {}
+) => {
+  let test;
+  for (const type of Array.isArray(types) ? [types] : types.split('|')) {
+    if (type === 'file') {
+      test =
+        value && !value.startsWith('http')
+          ? await fmt.is(`repo/${mod._dir}/${value}`, type, { extension })
+          : false;
+    } else test = await fmt.is(value, type, { extension });
+    if (test) break;
+  }
+  if (!test) {
+    if (optional && (await fmt.is(value, 'undefined'))) return true;
+    if (error) mod._err(error);
+    return false;
+  }
+  return true;
+};
+
+const validateEnvironments = async (mod) => {
+    mod.environments = mod.environments ?? registry.supportedEnvs;
+    const isArray = await check(mod, 'environments', mod.environments, 'array');
+    if (!isArray) return false;
+    return mod.environments.map((tag) =>
+      check(mod, 'environments.env', tag, registry.supportedEnvs)
+    );
+  },
+  validateTags = async (mod) => {
+    const isArray = await check(mod, 'tags', mod.tags, 'array');
+    if (!isArray) return false;
+    const categoryTags = ['core', 'extension', 'theme', 'integration'],
+      containsCategory = mod.tags.filter((tag) => categoryTags.includes(tag)).length;
+    if (!containsCategory) {
+      mod._err(
+        `invalid tags (must contain at least one of 'core', 'extension', 'theme' or 'integration'):
+        ${JSON.stringify(mod.tags)}`
+      );
+      return false;
+    }
+    const isTheme = mod.tags.includes('theme'),
+      hasThemeMode = mod.tags.includes('light') || mod.tags.includes('dark'),
+      isBothThemeModes = mod.tags.includes('light') && mod.tags.includes('dark');
+    if (isTheme && (!hasThemeMode || isBothThemeModes)) {
+      mod._err(
+        `invalid tags (themes must be either 'light' or 'dark', not neither or both):
+        ${JSON.stringify(mod.tags)}`
+      );
+      return false;
+    }
+    return mod.tags.map((tag) => check(mod, 'tags.tag', tag, 'string'));
+  },
+  validateAuthors = async (mod) => {
+    const isArray = await check(mod, 'authors', mod.authors, 'array');
+    if (!isArray) return false;
+    return mod.authors.map((author) => [
+      check(mod, 'authors.author.name', author.name, 'string'),
+      check(mod, 'authors.author.email', author.email, 'email', { optional: true }),
+      check(mod, 'authors.author.homepage', author.homepage, 'url'),
+      check(mod, 'authors.author.avatar', author.avatar, 'url'),
+    ]);
+  },
+  validateCSS = async (mod) => {
+    const isArray = await check(mod, 'css', mod.css, 'object');
+    if (!isArray) return false;
+    const tests = [];
+    for (const dest of ['frame', 'client', 'menu']) {
+      if (!mod.css[dest]) continue;
+      let test = await check(mod, `css.${dest}`, mod.css[dest], 'array');
+      if (test) {
+        test = mod.css[dest].map((file) =>
+          check(mod, `css.${dest}.file`, file, 'file', { extension: '.css' })
+        );
+      }
+      tests.push(test);
+    }
+    return tests;
+  },
+  validateJS = async (mod) => {
+    const isArray = await check(mod, 'js', mod.js, 'object');
+    if (!isArray) return false;
+    const tests = [];
+    for (const dest of ['frame', 'client', 'menu']) {
+      if (!mod.js[dest]) continue;
+      let test = await check(mod, `js.${dest}`, mod.js[dest], 'array');
+      if (test) {
+        test = mod.js[dest].map((file) =>
+          check(mod, `js.${dest}.file`, file, 'file', { extension: '.mjs' })
+        );
+      }
+      tests.push(test);
+    }
+    if (mod.js.electron) {
+      const isArray = await check(mod, 'js.electron', mod.js.electron, 'array');
+      if (isArray) {
+        for (const file of mod.js.electron) {
+          const isObject = await check(mod, 'js.electron.file', file, 'object');
+          if (!isObject) {
+            tests.push(false);
+            continue;
+          }
+          tests.push([
+            check(mod, 'js.electron.file.source', file.source, 'file', {
+              extension: '.cjs',
+            }),
+            // referencing the file within the electron app
+            // existence can't be validated, so only format is
+            check(mod, 'js.electron.file.target', file.target, 'string', {
+              extension: '.js',
+            }),
+          ]);
+        }
+      } else tests.push(false);
+    }
+    return tests;
+  },
+  validateOptions = async (mod) => {
+    const isArray = await check(mod, 'options', mod.options, 'array');
+    if (!isArray) return false;
+    const tests = [];
+    for (const option of mod.options) {
+      const key = 'options.option',
+        optTypeValid = await check(mod, `${key}.type`, option.type, registry.optionTypes);
+      if (!optTypeValid) {
+        tests.push(false);
+        continue;
+      }
+      option.environments = option.environments ?? registry.supportedEnvs;
+      tests.push([
+        check(mod, `${key}.key`, option.key, 'alphanumeric'),
+        check(mod, `${key}.label`, option.label, 'string'),
+        check(mod, `${key}.tooltip`, option.tooltip, 'string', {
+          optional: true,
+        }),
+        check(mod, `${key}.environments`, option.environments, 'array').then((isArray) => {
+          if (!isArray) return false;
+          return option.environments.map((environment) =>
+            check(mod, `${key}.environments.env`, environment, registry.supportedEnvs)
+          );
+        }),
+      ]);
+      switch (option.type) {
+        case 'toggle':
+          tests.push(check(mod, `${key}.value`, option.value, 'boolean'));
+          break;
+        case 'select': {
+          let test = await check(mod, `${key}.values`, option.values, 'array');
+          if (test) {
+            test = option.values.map((value) =>
+              check(mod, `${key}.values.value`, value, 'string')
+            );
+          }
+          tests.push(test);
+          break;
+        }
+        case 'text':
+        case 'hotkey':
+          tests.push(check(mod, `${key}.value`, option.value, 'string'));
+          break;
+        case 'number':
+        case 'color':
+          tests.push(check(mod, `${key}.value`, option.value, option.type));
+          break;
+        case 'file': {
+          let test = await check(mod, `${key}.extensions`, option.extensions, 'array');
+          if (test) {
+            test = option.extensions.map((ext) =>
+              check(mod, `${key}.extensions.extension`, ext, 'string')
+            );
+          }
+          tests.push(test);
+          break;
+        }
+      }
+    }
+    return tests;
+  };
+
+/**
+ * internally used to validate mod.json files and provide helpful errors
+ * @private
+ * @param {object} mod - a mod's mod.json in object form
+ * @returns {boolean} whether or not the mod has passed validation
+ */
+export async function validate(mod) {
+  let conditions = [
+    check(mod, 'name', mod.name, 'string'),
+    check(mod, 'id', mod.id, 'uuid'),
+    check(mod, 'version', mod.version, 'semver'),
+    validateEnvironments(mod),
+    check(mod, 'description', mod.description, 'string'),
+    check(mod, 'preview', mod.preview, 'file|url', { optional: true }),
+    validateTags(mod),
+    validateAuthors(mod),
+    validateCSS(mod),
+    validateJS(mod),
+    validateOptions(mod),
+  ];
+  do {
+    conditions = await Promise.all(conditions.flat(Infinity));
+  } while (conditions.some((condition) => Array.isArray(condition)));
+  return conditions.every((passed) => passed);
+}
diff --git a/src/common/registry.mjs b/src/common/registry.mjs
new file mode 100644
index 0000000..4c2682b
--- /dev/null
+++ b/src/common/registry.mjs
@@ -0,0 +1,160 @@
+/**
+ * notion-enhancer: api
+ * (c) 2021 dragonwocky <thedragonring.bod@gmail.com> (https://dragonwocky.me/)
+ * (https://notion-enhancer.github.io/) under the MIT license
+ */
+
+'use strict';
+
+/**
+ * interactions with the enhancer's repository of mods
+ * @namespace registry
+ */
+
+import { env, fs, storage } from './index.mjs';
+import { validate } from './registry-validation.mjs';
+
+/**
+ * mod ids whitelisted as part of the enhancer's core, permanently enabled
+ * @constant
+ * @type {string[]}
+ */
+export const core = [
+  'a6621988-551d-495a-97d8-3c568bca2e9e',
+  '0f0bf8b6-eae6-4273-b307-8fc43f2ee082',
+  '36a2ffc9-27ff-480e-84a7-c7700a7d232d',
+];
+
+/**
+ * all environments/platforms currently supported by the enhancer
+ * @constant
+ * @type {string[]}
+ */
+export const supportedEnvs = ['linux', 'win32', 'darwin', 'extension'];
+
+/**
+ * all available configuration types
+ * @constant
+ * @type {string[]}
+ */
+export const optionTypes = ['toggle', 'select', 'text', 'number', 'color', 'file', 'hotkey'];
+
+/**
+ * the name of the active configuration profile
+ * @returns {string}
+ */
+export const profileName = () => storage.get(['currentprofile'], 'default');
+
+/**
+ * the root database for the current profile
+ * @returns {object} the get/set functions for the profile's storage
+ */
+export const profileDB = async () => storage.db(['profiles', await profileName()]);
+
+let _list;
+const _errors = [];
+/**
+ * list all available mods in the repo
+ * @param {function} filter - a function to filter out mods
+ * @returns {array} a validated list of mod.json objects
+ */
+export const list = async (filter = (mod) => true) => {
+  if (!_list) {
+    // deno-lint-ignore no-async-promise-executor
+    _list = new Promise(async (res, _rej) => {
+      const passed = [];
+      for (const dir of await fs.getJSON('repo/registry.json')) {
+        try {
+          const mod = {
+            ...(await fs.getJSON(`repo/${dir}/mod.json`)),
+            _dir: dir,
+            _err: (message) => _errors.push({ source: dir, message }),
+          };
+          if (await validate(mod)) passed.push(mod);
+        } catch {
+          _errors.push({ source: dir, message: 'invalid mod.json' });
+        }
+      }
+      res(passed);
+    });
+  }
+  const filtered = [];
+  for (const mod of await _list) if (await filter(mod)) filtered.push(mod);
+  return filtered;
+};
+
+/**
+ * list validation errors encountered when loading the repo
+ * @returns {{ source: string, message: string }[]} error objects with an error message and a source directory
+ */
+export const errors = async () => {
+  await list();
+  return _errors;
+};
+
+/**
+ * get a single mod from the repo
+ * @param {string} id - the uuid of the mod
+ * @returns {object} the mod's mod.json
+ */
+export const get = async (id) => {
+  return (await list((mod) => mod.id === id))[0];
+};
+
+/**
+ * checks if a mod is enabled: affected by the core whitelist,
+ * environment and menu configuration
+ * @param {string} id - the uuid of the mod
+ * @returns {boolean} whether or not the mod is enabled
+ */
+export const enabled = async (id) => {
+  const mod = await get(id);
+  if (!mod.environments.includes(env.name)) return false;
+  if (core.includes(id)) return true;
+  return (await profileDB()).get(['_mods', id], false);
+};
+
+/**
+ * get a default value of a mod's option according to its mod.json
+ * @param {string} id - the uuid of the mod
+ * @param {string} key - the key of the option
+ * @returns {string|number|boolean|undefined} the option's default value
+ */
+export const optionDefault = async (id, key) => {
+  const mod = await get(id),
+    opt = mod.options.find((opt) => opt.key === key);
+  if (!opt) return undefined;
+  switch (opt.type) {
+    case 'toggle':
+    case 'text':
+    case 'number':
+    case 'color':
+    case 'hotkey':
+      return opt.value;
+    case 'select':
+      return opt.values[0];
+    case 'file':
+      return undefined;
+  }
+};
+
+/**
+ * access the storage partition of a mod in the current profile
+ * @param {string} id - the uuid of the mod
+ * @returns {object} an object with the wrapped get/set functions
+ */
+export const db = async (id) => {
+  const db = await profileDB();
+  return storage.db(
+    [id],
+    async (path, fallback = undefined) => {
+      if (typeof path === 'string') path = [path];
+      if (path.length === 2) {
+        // profiles -> profile -> mod -> option
+        fallback = (await optionDefault(id, path[1])) ?? fallback;
+      }
+      return db.get(path, fallback);
+    },
+    db.set
+  );
+};
diff --git a/src/common/storage.mjs b/src/common/storage.mjs
new file mode 100644
index 0000000..8c7dc31
--- /dev/null
+++ b/src/common/storage.mjs
@@ -0,0 +1,65 @@
+/**
+ * notion-enhancer: api
+ * (c) 2021 dragonwocky <thedragonring.bod@gmail.com> (https://dragonwocky.me/)
+ * (https://notion-enhancer.github.io/) under the MIT license
+ */
+
+'use strict';
+
+/**
+ * environment-specific data persistence
+ * @namespace storage
+ */
+
+import * as storage from '../env/storage.mjs';
+
+/**
+ * get persisted data
+ * @type {function}
+ * @param {string[]} path - the path of keys to the value being fetched
+ * @param {unknown=} fallback - a default value if the path is not matched
+ * @returns {Promise} value ?? fallback
+ */
+export const get = storage.get;
+
+/**
+ * persist data
+ * @type {function}
+ * @param {string[]} path - the path of keys to the value being set
+ * @param {unknown} value - the data to save
+ * @returns {Promise} resolves when data has been saved
+ */
+export const set = storage.set;
+
+/**
+ * create a wrapper for accessing a partition of the storage
+ * @type {function}
+ * @param {string[]} namespace - the path of keys to prefix all storage requests with
+ * @param {function=} get - the storage get function to be wrapped
+ * @param {function=} set - the storage set function to be wrapped
+ * @returns {object} an object with the wrapped get/set functions
+ */
+export const db = storage.db;
+
+/**
+ * add an event listener for changes in storage
+ * @type {function}
+ * @param {onStorageChangeCallback} callback - called whenever a change in
+ * storage is initiated from the current process
+ */
+export const addChangeListener = storage.addChangeListener;
+
+/**
+ * remove a listener added with storage.addChangeListener
+ * @type {function}
+ * @param {onStorageChangeCallback} callback
+ */
+export const removeChangeListener = storage.removeChangeListener;
+
+/**
+ * @callback onStorageChangeCallback
+ * @param {object} event
+ * @param {string} event.path- the path of keys to the changed value
+ * @param {string=} event.new - the new value being persisted to the store
+ * @param {string=} event.old - the previous value associated with the key
+ */
diff --git a/src/common/web.mjs b/src/common/web.mjs
new file mode 100644
index 0000000..8b201e0
--- /dev/null
+++ b/src/common/web.mjs
@@ -0,0 +1,301 @@
+/**
+ * notion-enhancer: api
+ * (c) 2021 dragonwocky <thedragonring.bod@gmail.com> (https://dragonwocky.me/)
+ * (https://notion-enhancer.github.io/) under the MIT license
+ */
+
+'use strict';
+
+/**
+ * helpers for manipulation of a webpage
+ * @namespace web
+ */
+
+import { fs } from './index.mjs';
+
+let _hotkeyListenersActivated = false,
+  _hotkeyEventListeners = [],
+  _documentObserver,
+  _documentObserverListeners = [];
+const _documentObserverEvents = [];
+
+/**
+ * wait until a page is loaded and ready for modification
+ * @param {array=} selectors - wait for the existence of elements that match these css selectors
+ * @returns {Promise} a promise that will resolve when the page is ready
+ */
+export const whenReady = (selectors = []) => {
+  return new Promise((res, _rej) => {
+    const onLoad = () => {
+      const interval = setInterval(isReady, 100);
+      function isReady() {
+        const ready = selectors.every((selector) => document.querySelector(selector));
+        if (!ready) return;
+        clearInterval(interval);
+        res(true);
+      }
+      isReady();
+    };
+    if (document.readyState !== 'complete') {
+      document.addEventListener('readystatechange', (_event) => {
+        if (document.readyState === 'complete') onLoad();
+      });
+    } else onLoad();
+  });
+};
+
+/**
+ * parse the current location search params into a usable form
+ * @returns {Map<string, string>} a map of the url search params
+ */
+export const queryParams = () => new URLSearchParams(window.location.search);
+
+/**
+ * replace special html characters with escaped versions
+ * @param {string} str
+ * @returns {string} escaped string
+ */
+export const escape = (str) =>
+  str
+    .replace(/&/g, '&amp;')
+    .replace(/</g, '&lt;')
+    .replace(/>/g, '&gt;')
+    .replace(/'/g, '&#39;')
+    .replace(/"/g, '&quot;')
+    .replace(/\\/g, '&#x5C;');
+
+/**
+ * a tagged template processor for raw html:
+ * stringifies, minifies, and syntax highlights
+ * @example web.raw`<p>hello</p>`
+ * @returns {string} the processed html
+ */
+export const raw = (str, ...templates) => {
+  const html = str
+    .map(
+      (chunk) =>
+        chunk +
+        (['string', 'number'].includes(typeof templates[0])
+          ? templates.shift()
+          : escape(JSON.stringify(templates.shift(), null, 2) ?? ''))
+    )
+    .join('');
+  return html.includes('<pre')
+    ? html.trim()
+    : html
+        .split(/\n/)
+        .map((line) => line.trim())
+        .filter((line) => line.length)
+        .join(' ');
+};
+
+/**
+ * create a single html element inc. attributes and children from a string
+ * @example web.html`<p>hello</p>`
+ * @returns {Element} the constructed html element
+ */
+export const html = (str, ...templates) => {
+  const $fragment = document.createRange().createContextualFragment(raw(str, ...templates));
+  return $fragment.children.length === 1 ? $fragment.children[0] : $fragment.children;
+};
+
+/**
+ * appends a list of html elements to a parent
+ * @param $container - the parent element
+ * @param $elems - the elements to be appended
+ * @returns {Element} the updated $container
+ */
+export const render = ($container, ...$elems) => {
+  $elems = $elems
+    .map(($elem) => ($elem instanceof HTMLCollection ? [...$elem] : $elem))
+    .flat(Infinity)
+    .filter(($elem) => $elem);
+  $container.append(...$elems);
+  return $container;
+};
+
+/**
+ * removes all children from an element without deleting them/their behaviours
+ * @param $container - the parent element
+ * @returns {Element} the updated $container
+ */
+export const empty = ($container) => {
+  while ($container.firstChild && $container.removeChild($container.firstChild));
+  return $container;
+};
+
+/**
+ * loads/applies a css stylesheet to the page
+ * @param {string} path - a url or within-the-enhancer filepath
+ */
+export const loadStylesheet = (path) => {
+  const $stylesheet = html`<link
+    rel="stylesheet"
+    href="${path.startsWith('https://') ? path : fs.localPath(path)}"
+  />`;
+  render(document.head, $stylesheet);
+  return $stylesheet;
+};
+
+/**
+ * copy text to the clipboard
+ * @param {string} str - the string to copy
+ * @returns {Promise<void>}
+ */
+export const copyToClipboard = async (str) => {
+  try {
+    await navigator.clipboard.writeText(str);
+  } catch {
+    const $el = document.createElement('textarea');
+    $el.value = str;
+    $el.setAttribute('readonly', '');
+    $el.style.position = 'absolute';
+    $el.style.left = '-9999px';
+    document.body.appendChild($el);
+    $el.select();
+    document.execCommand('copy');
+    document.body.removeChild($el);
+  }
+};
+
+/**
+ * read text from the clipboard
+ * @returns {Promise<string>}
+ */
+export const readFromClipboard = () => {
+  return navigator.clipboard.readText();
+};
+
+const triggerHotkeyListener = (event, hotkey) => {
+  const inInput = document.activeElement.nodeName === 'INPUT' && !hotkey.listenInInput;
+  if (inInput) return;
+  const modifiers = {
+      metaKey: ['meta', 'os', 'win', 'cmd', 'command'],
+      ctrlKey: ['ctrl', 'control'],
+      shiftKey: ['shift'],
+      altKey: ['alt'],
+    },
+    pressed = hotkey.keys.every((key) => {
+      key = key.toLowerCase();
+      for (const modifier in modifiers) {
+        const pressed = modifiers[modifier].includes(key) && event[modifier];
+        if (pressed) {
+          // mark modifier as part of hotkey
+          modifiers[modifier] = [];
+          return true;
+        }
+      }
+      if (key === 'space') key = ' ';
+      if (key === 'plus') key = '+';
+      if (key === event.key.toLowerCase()) return true;
+    });
+  if (!pressed) return;
+  // test for modifiers not in hotkey
+  // e.g. to differentiate ctrl+x from ctrl+shift+x
+  for (const modifier in modifiers) {
+    const modifierPressed = event[modifier],
+      modifierNotInHotkey = modifiers[modifier].length > 0;
+    if (modifierPressed && modifierNotInHotkey) return;
+  }
+  hotkey.callback(event);
+};
+
+/**
+ * register a hotkey listener to the page
+ * @param {array|string} keys - the combination of keys that will trigger the hotkey.
+ * key codes can be tested at http://keycode.info/ and are case-insensitive.
+ * available modifiers are 'alt', 'ctrl', 'meta', and 'shift'.
+ * can be provided as a + separated string.
+ * @param {function} callback - called whenever the keys are pressed
+ * @param {object=} opts - fine-tuned control over when the hotkey should be triggered
+ * @param {boolean=} opts.listenInInput - whether the hotkey callback should be triggered
+ * when an input is focused
+ * @param {boolean=} opts.keydown - whether to listen for the hotkey on keydown.
+ * by default, hotkeys are triggered by the keyup event.
+ */
+export const addHotkeyListener = (
+  keys,
+  callback,
+  { listenInInput = false, keydown = false } = {}
+) => {
+  if (typeof keys === 'string') keys = keys.split('+');
+  _hotkeyEventListeners.push({ keys, callback, listenInInput, keydown });
+
+  if (!_hotkeyListenersActivated) {
+    _hotkeyListenersActivated = true;
+    document.addEventListener('keyup', (event) => {
+      for (const hotkey of _hotkeyEventListeners.filter(({ keydown }) => !keydown)) {
+        triggerHotkeyListener(event, hotkey);
+      }
+    });
+    document.addEventListener('keydown', (event) => {
+      for (const hotkey of _hotkeyEventListeners.filter(({ keydown }) => keydown)) {
+        triggerHotkeyListener(event, hotkey);
+      }
+    });
+  }
+};
+/**
+ * remove a listener added with web.addHotkeyListener
+ * @param {function} callback
+ */
+export const removeHotkeyListener = (callback) => {
+  _hotkeyEventListeners = _hotkeyEventListeners.filter(
+    (listener) => listener.callback !== callback
+  );
+};
+
+/**
+ * add a listener to watch for changes to the dom
+ * @param {onDocumentObservedCallback} callback
+ * @param {string[]=} selectors
+ */
+export const addDocumentObserver = (callback, selectors = []) => {
+  if (!_documentObserver) {
+    const handle = (queue) => {
+      while (queue.length) {
+        const event = queue.shift(),
+          matchesAddedNode = ($node, selector) =>
+            $node instanceof Element &&
+            ($node.matches(selector) ||
+              $node.matches(`${selector} *`) ||
+              $node.querySelector(selector)),
+          matchesTarget = (selector) =>
+            event.target.matches(selector) ||
+            event.target.matches(`${selector} *`) ||
+            [...event.addedNodes].some(($node) => matchesAddedNode($node, selector));
+        for (const listener of _documentObserverListeners) {
+          if (!listener.selectors.length || listener.selectors.some(matchesTarget)) {
+            listener.callback(event);
+          }
+        }
+      }
+    };
+    _documentObserver = new MutationObserver((list, _observer) => {
+      if (!_documentObserverEvents.length)
+        requestIdleCallback(() => handle(_documentObserverEvents));
+      _documentObserverEvents.push(...list);
+    });
+    _documentObserver.observe(document.body, {
+      childList: true,
+      subtree: true,
+      attributes: true,
+    });
+  }
+  _documentObserverListeners.push({ callback, selectors });
+};
+
+/**
+ * remove a listener added with web.addDocumentObserver
+ * @param {onDocumentObservedCallback} callback
+ */
+export const removeDocumentObserver = (callback) => {
+  _documentObserverListeners = _documentObserverListeners.filter(
+    (listener) => listener.callback !== callback
+  );
+};
+
+/**
+ * @callback onDocumentObservedCallback
+ * @param {MutationRecord} event - the observed dom mutation event
+ */
diff --git a/src/dep/README.md b/src/dep/README.md
new file mode 100644
index 0000000..db23dd7
--- /dev/null
+++ b/src/dep/README.md
@@ -0,0 +1,5 @@
+# notion-enhancer/dep
+
+libraries depended on by the notion-enhancer
+
+[read the docs online](https://notion-enhancer.github.io/about/credits/#dependencies)
diff --git a/src/dep/feather-sprite.svg b/src/dep/feather-sprite.svg
new file mode 100644
index 0000000..6e20a2c
--- /dev/null
+++ b/src/dep/feather-sprite.svg
@@ -0,0 +1 @@
+<svg xmlns="http://www.w3.org/2000/svg"><defs><symbol id="activity" viewBox="0 0 24 24"><polyline points="22 12 18 12 15 21 9 3 6 12 2 12"></polyline></symbol><symbol id="airplay" viewBox="0 0 24 24"><path d="M5 17H4a2 2 0 0 1-2-2V5a2 2 0 0 1 2-2h16a2 2 0 0 1 2 2v10a2 2 0 0 1-2 2h-1"></path><polygon points="12 15 17 21 7 21 12 15"></polygon></symbol><symbol id="alert-circle" viewBox="0 0 24 24"><circle cx="12" cy="12" r="10"></circle><line x1="12" y1="8" x2="12" y2="12"></line><line x1="12" y1="16" x2="12.01" y2="16"></line></symbol><symbol id="alert-octagon" viewBox="0 0 24 24"><polygon points="7.86 2 16.14 2 22 7.86 22 16.14 16.14 22 7.86 22 2 16.14 2 7.86 7.86 2"></polygon><line x1="12" y1="8" x2="12" y2="12"></line><line x1="12" y1="16" x2="12.01" y2="16"></line></symbol><symbol id="alert-triangle" viewBox="0 0 24 24"><path d="M10.29 3.86L1.82 18a2 2 0 0 0 1.71 3h16.94a2 2 0 0 0 1.71-3L13.71 3.86a2 2 0 0 0-3.42 0z"></path><line x1="12" y1="9" x2="12" y2="13"></line><line x1="12" y1="17" x2="12.01" y2="17"></line></symbol><symbol id="align-center" viewBox="0 0 24 24"><line x1="18" y1="10" x2="6" y2="10"></line><line x1="21" y1="6" x2="3" y2="6"></line><line x1="21" y1="14" x2="3" y2="14"></line><line x1="18" y1="18" x2="6" y2="18"></line></symbol><symbol id="align-justify" viewBox="0 0 24 24"><line x1="21" y1="10" x2="3" y2="10"></line><line x1="21" y1="6" x2="3" y2="6"></line><line x1="21" y1="14" x2="3" y2="14"></line><line x1="21" y1="18" x2="3" y2="18"></line></symbol><symbol id="align-left" viewBox="0 0 24 24"><line x1="17" y1="10" x2="3" y2="10"></line><line x1="21" y1="6" x2="3" y2="6"></line><line x1="21" y1="14" x2="3" y2="14"></line><line x1="17" y1="18" x2="3" y2="18"></line></symbol><symbol id="align-right" viewBox="0 0 24 24"><line x1="21" y1="10" x2="7" y2="10"></line><line x1="21" y1="6" x2="3" y2="6"></line><line x1="21" y1="14" x2="3" y2="14"></line><line x1="21" y1="18" x2="7" y2="18"></line></symbol><symbol id="anchor" viewBox="0 0 24 24"><circle cx="12" cy="5" r="3"></circle><line x1="12" y1="22" x2="12" y2="8"></line><path d="M5 12H2a10 10 0 0 0 20 0h-3"></path></symbol><symbol id="aperture" viewBox="0 0 24 24"><circle cx="12" cy="12" r="10"></circle><line x1="14.31" y1="8" x2="20.05" y2="17.94"></line><line x1="9.69" y1="8" x2="21.17" y2="8"></line><line x1="7.38" y1="12" x2="13.12" y2="2.06"></line><line x1="9.69" y1="16" x2="3.95" y2="6.06"></line><line x1="14.31" y1="16" x2="2.83" y2="16"></line><line x1="16.62" y1="12" x2="10.88" y2="21.94"></line></symbol><symbol id="archive" viewBox="0 0 24 24"><polyline points="21 8 21 21 3 21 3 8"></polyline><rect x="1" y="3" width="22" height="5"></rect><line x1="10" y1="12" x2="14" y2="12"></line></symbol><symbol id="arrow-down-circle" viewBox="0 0 24 24"><circle cx="12" cy="12" r="10"></circle><polyline points="8 12 12 16 16 12"></polyline><line x1="12" y1="8" x2="12" y2="16"></line></symbol><symbol id="arrow-down-left" viewBox="0 0 24 24"><line x1="17" y1="7" x2="7" y2="17"></line><polyline points="17 17 7 17 7 7"></polyline></symbol><symbol id="arrow-down-right" viewBox="0 0 24 24"><line x1="7" y1="7" x2="17" y2="17"></line><polyline points="17 7 17 17 7 17"></polyline></symbol><symbol id="arrow-down" viewBox="0 0 24 24"><line x1="12" y1="5" x2="12" y2="19"></line><polyline points="19 12 12 19 5 12"></polyline></symbol><symbol id="arrow-left-circle" viewBox="0 0 24 24"><circle cx="12" cy="12" r="10"></circle><polyline points="12 8 8 12 12 16"></polyline><line x1="16" y1="12" x2="8" y2="12"></line></symbol><symbol id="arrow-left" viewBox="0 0 24 24"><line x1="19" y1="12" x2="5" y2="12"></line><polyline points="12 19 5 12 12 5"></polyline></symbol><symbol id="arrow-right-circle" viewBox="0 0 24 24"><circle cx="12" cy="12" r="10"></circle><polyline points="12 16 16 12 12 8"></polyline><line x1="8" y1="12" x2="16" y2="12"></line></symbol><symbol id="arrow-right" viewBox="0 0 24 24"><line x1="5" y1="12" x2="19" y2="12"></line><polyline points="12 5 19 12 12 19"></polyline></symbol><symbol id="arrow-up-circle" viewBox="0 0 24 24"><circle cx="12" cy="12" r="10"></circle><polyline points="16 12 12 8 8 12"></polyline><line x1="12" y1="16" x2="12" y2="8"></line></symbol><symbol id="arrow-up-left" viewBox="0 0 24 24"><line x1="17" y1="17" x2="7" y2="7"></line><polyline points="7 17 7 7 17 7"></polyline></symbol><symbol id="arrow-up-right" viewBox="0 0 24 24"><line x1="7" y1="17" x2="17" y2="7"></line><polyline points="7 7 17 7 17 17"></polyline></symbol><symbol id="arrow-up" viewBox="0 0 24 24"><line x1="12" y1="19" x2="12" y2="5"></line><polyline points="5 12 12 5 19 12"></polyline></symbol><symbol id="at-sign" viewBox="0 0 24 24"><circle cx="12" cy="12" r="4"></circle><path d="M16 8v5a3 3 0 0 0 6 0v-1a10 10 0 1 0-3.92 7.94"></path></symbol><symbol id="award" viewBox="0 0 24 24"><circle cx="12" cy="8" r="7"></circle><polyline points="8.21 13.89 7 23 12 20 17 23 15.79 13.88"></polyline></symbol><symbol id="bar-chart-2" viewBox="0 0 24 24"><line x1="18" y1="20" x2="18" y2="10"></line><line x1="12" y1="20" x2="12" y2="4"></line><line x1="6" y1="20" x2="6" y2="14"></line></symbol><symbol id="bar-chart" viewBox="0 0 24 24"><line x1="12" y1="20" x2="12" y2="10"></line><line x1="18" y1="20" x2="18" y2="4"></line><line x1="6" y1="20" x2="6" y2="16"></line></symbol><symbol id="battery-charging" viewBox="0 0 24 24"><path d="M5 18H3a2 2 0 0 1-2-2V8a2 2 0 0 1 2-2h3.19M15 6h2a2 2 0 0 1 2 2v8a2 2 0 0 1-2 2h-3.19"></path><line x1="23" y1="13" x2="23" y2="11"></line><polyline points="11 6 7 12 13 12 9 18"></polyline></symbol><symbol id="battery" viewBox="0 0 24 24"><rect x="1" y="6" width="18" height="12" rx="2" ry="2"></rect><line x1="23" y1="13" x2="23" y2="11"></line></symbol><symbol id="bell-off" viewBox="0 0 24 24"><path d="M13.73 21a2 2 0 0 1-3.46 0"></path><path d="M18.63 13A17.89 17.89 0 0 1 18 8"></path><path d="M6.26 6.26A5.86 5.86 0 0 0 6 8c0 7-3 9-3 9h14"></path><path d="M18 8a6 6 0 0 0-9.33-5"></path><line x1="1" y1="1" x2="23" y2="23"></line></symbol><symbol id="bell" viewBox="0 0 24 24"><path d="M18 8A6 6 0 0 0 6 8c0 7-3 9-3 9h18s-3-2-3-9"></path><path d="M13.73 21a2 2 0 0 1-3.46 0"></path></symbol><symbol id="bluetooth" viewBox="0 0 24 24"><polyline points="6.5 6.5 17.5 17.5 12 23 12 1 17.5 6.5 6.5 17.5"></polyline></symbol><symbol id="bold" viewBox="0 0 24 24"><path d="M6 4h8a4 4 0 0 1 4 4 4 4 0 0 1-4 4H6z"></path><path d="M6 12h9a4 4 0 0 1 4 4 4 4 0 0 1-4 4H6z"></path></symbol><symbol id="book-open" viewBox="0 0 24 24"><path d="M2 3h6a4 4 0 0 1 4 4v14a3 3 0 0 0-3-3H2z"></path><path d="M22 3h-6a4 4 0 0 0-4 4v14a3 3 0 0 1 3-3h7z"></path></symbol><symbol id="book" viewBox="0 0 24 24"><path d="M4 19.5A2.5 2.5 0 0 1 6.5 17H20"></path><path d="M6.5 2H20v20H6.5A2.5 2.5 0 0 1 4 19.5v-15A2.5 2.5 0 0 1 6.5 2z"></path></symbol><symbol id="bookmark" viewBox="0 0 24 24"><path d="M19 21l-7-5-7 5V5a2 2 0 0 1 2-2h10a2 2 0 0 1 2 2z"></path></symbol><symbol id="box" viewBox="0 0 24 24"><path d="M21 16V8a2 2 0 0 0-1-1.73l-7-4a2 2 0 0 0-2 0l-7 4A2 2 0 0 0 3 8v8a2 2 0 0 0 1 1.73l7 4a2 2 0 0 0 2 0l7-4A2 2 0 0 0 21 16z"></path><polyline points="3.27 6.96 12 12.01 20.73 6.96"></polyline><line x1="12" y1="22.08" x2="12" y2="12"></line></symbol><symbol id="briefcase" viewBox="0 0 24 24"><rect x="2" y="7" width="20" height="14" rx="2" ry="2"></rect><path d="M16 21V5a2 2 0 0 0-2-2h-4a2 2 0 0 0-2 2v16"></path></symbol><symbol id="calendar" viewBox="0 0 24 24"><rect x="3" y="4" width="18" height="18" rx="2" ry="2"></rect><line x1="16" y1="2" x2="16" y2="6"></line><line x1="8" y1="2" x2="8" y2="6"></line><line x1="3" y1="10" x2="21" y2="10"></line></symbol><symbol id="camera-off" viewBox="0 0 24 24"><line x1="1" y1="1" x2="23" y2="23"></line><path d="M21 21H3a2 2 0 0 1-2-2V8a2 2 0 0 1 2-2h3m3-3h6l2 3h4a2 2 0 0 1 2 2v9.34m-7.72-2.06a4 4 0 1 1-5.56-5.56"></path></symbol><symbol id="camera" viewBox="0 0 24 24"><path d="M23 19a2 2 0 0 1-2 2H3a2 2 0 0 1-2-2V8a2 2 0 0 1 2-2h4l2-3h6l2 3h4a2 2 0 0 1 2 2z"></path><circle cx="12" cy="13" r="4"></circle></symbol><symbol id="cast" viewBox="0 0 24 24"><path d="M2 16.1A5 5 0 0 1 5.9 20M2 12.05A9 9 0 0 1 9.95 20M2 8V6a2 2 0 0 1 2-2h16a2 2 0 0 1 2 2v12a2 2 0 0 1-2 2h-6"></path><line x1="2" y1="20" x2="2.01" y2="20"></line></symbol><symbol id="check-circle" viewBox="0 0 24 24"><path d="M22 11.08V12a10 10 0 1 1-5.93-9.14"></path><polyline points="22 4 12 14.01 9 11.01"></polyline></symbol><symbol id="check-square" viewBox="0 0 24 24"><polyline points="9 11 12 14 22 4"></polyline><path d="M21 12v7a2 2 0 0 1-2 2H5a2 2 0 0 1-2-2V5a2 2 0 0 1 2-2h11"></path></symbol><symbol id="check" viewBox="0 0 24 24"><polyline points="20 6 9 17 4 12"></polyline></symbol><symbol id="chevron-down" viewBox="0 0 24 24"><polyline points="6 9 12 15 18 9"></polyline></symbol><symbol id="chevron-left" viewBox="0 0 24 24"><polyline points="15 18 9 12 15 6"></polyline></symbol><symbol id="chevron-right" viewBox="0 0 24 24"><polyline points="9 18 15 12 9 6"></polyline></symbol><symbol id="chevron-up" viewBox="0 0 24 24"><polyline points="18 15 12 9 6 15"></polyline></symbol><symbol id="chevrons-down" viewBox="0 0 24 24"><polyline points="7 13 12 18 17 13"></polyline><polyline points="7 6 12 11 17 6"></polyline></symbol><symbol id="chevrons-left" viewBox="0 0 24 24"><polyline points="11 17 6 12 11 7"></polyline><polyline points="18 17 13 12 18 7"></polyline></symbol><symbol id="chevrons-right" viewBox="0 0 24 24"><polyline points="13 17 18 12 13 7"></polyline><polyline points="6 17 11 12 6 7"></polyline></symbol><symbol id="chevrons-up" viewBox="0 0 24 24"><polyline points="17 11 12 6 7 11"></polyline><polyline points="17 18 12 13 7 18"></polyline></symbol><symbol id="chrome" viewBox="0 0 24 24"><circle cx="12" cy="12" r="10"></circle><circle cx="12" cy="12" r="4"></circle><line x1="21.17" y1="8" x2="12" y2="8"></line><line x1="3.95" y1="6.06" x2="8.54" y2="14"></line><line x1="10.88" y1="21.94" x2="15.46" y2="14"></line></symbol><symbol id="circle" viewBox="0 0 24 24"><circle cx="12" cy="12" r="10"></circle></symbol><symbol id="clipboard" viewBox="0 0 24 24"><path d="M16 4h2a2 2 0 0 1 2 2v14a2 2 0 0 1-2 2H6a2 2 0 0 1-2-2V6a2 2 0 0 1 2-2h2"></path><rect x="8" y="2" width="8" height="4" rx="1" ry="1"></rect></symbol><symbol id="clock" viewBox="0 0 24 24"><circle cx="12" cy="12" r="10"></circle><polyline points="12 6 12 12 16 14"></polyline></symbol><symbol id="cloud-drizzle" viewBox="0 0 24 24"><line x1="8" y1="19" x2="8" y2="21"></line><line x1="8" y1="13" x2="8" y2="15"></line><line x1="16" y1="19" x2="16" y2="21"></line><line x1="16" y1="13" x2="16" y2="15"></line><line x1="12" y1="21" x2="12" y2="23"></line><line x1="12" y1="15" x2="12" y2="17"></line><path d="M20 16.58A5 5 0 0 0 18 7h-1.26A8 8 0 1 0 4 15.25"></path></symbol><symbol id="cloud-lightning" viewBox="0 0 24 24"><path d="M19 16.9A5 5 0 0 0 18 7h-1.26a8 8 0 1 0-11.62 9"></path><polyline points="13 11 9 17 15 17 11 23"></polyline></symbol><symbol id="cloud-off" viewBox="0 0 24 24"><path d="M22.61 16.95A5 5 0 0 0 18 10h-1.26a8 8 0 0 0-7.05-6M5 5a8 8 0 0 0 4 15h9a5 5 0 0 0 1.7-.3"></path><line x1="1" y1="1" x2="23" y2="23"></line></symbol><symbol id="cloud-rain" viewBox="0 0 24 24"><line x1="16" y1="13" x2="16" y2="21"></line><line x1="8" y1="13" x2="8" y2="21"></line><line x1="12" y1="15" x2="12" y2="23"></line><path d="M20 16.58A5 5 0 0 0 18 7h-1.26A8 8 0 1 0 4 15.25"></path></symbol><symbol id="cloud-snow" viewBox="0 0 24 24"><path d="M20 17.58A5 5 0 0 0 18 8h-1.26A8 8 0 1 0 4 16.25"></path><line x1="8" y1="16" x2="8.01" y2="16"></line><line x1="8" y1="20" x2="8.01" y2="20"></line><line x1="12" y1="18" x2="12.01" y2="18"></line><line x1="12" y1="22" x2="12.01" y2="22"></line><line x1="16" y1="16" x2="16.01" y2="16"></line><line x1="16" y1="20" x2="16.01" y2="20"></line></symbol><symbol id="cloud" viewBox="0 0 24 24"><path d="M18 10h-1.26A8 8 0 1 0 9 20h9a5 5 0 0 0 0-10z"></path></symbol><symbol id="code" viewBox="0 0 24 24"><polyline points="16 18 22 12 16 6"></polyline><polyline points="8 6 2 12 8 18"></polyline></symbol><symbol id="codepen" viewBox="0 0 24 24"><polygon points="12 2 22 8.5 22 15.5 12 22 2 15.5 2 8.5 12 2"></polygon><line x1="12" y1="22" x2="12" y2="15.5"></line><polyline points="22 8.5 12 15.5 2 8.5"></polyline><polyline points="2 15.5 12 8.5 22 15.5"></polyline><line x1="12" y1="2" x2="12" y2="8.5"></line></symbol><symbol id="codesandbox" viewBox="0 0 24 24"><path d="M21 16V8a2 2 0 0 0-1-1.73l-7-4a2 2 0 0 0-2 0l-7 4A2 2 0 0 0 3 8v8a2 2 0 0 0 1 1.73l7 4a2 2 0 0 0 2 0l7-4A2 2 0 0 0 21 16z"></path><polyline points="7.5 4.21 12 6.81 16.5 4.21"></polyline><polyline points="7.5 19.79 7.5 14.6 3 12"></polyline><polyline points="21 12 16.5 14.6 16.5 19.79"></polyline><polyline points="3.27 6.96 12 12.01 20.73 6.96"></polyline><line x1="12" y1="22.08" x2="12" y2="12"></line></symbol><symbol id="coffee" viewBox="0 0 24 24"><path d="M18 8h1a4 4 0 0 1 0 8h-1"></path><path d="M2 8h16v9a4 4 0 0 1-4 4H6a4 4 0 0 1-4-4V8z"></path><line x1="6" y1="1" x2="6" y2="4"></line><line x1="10" y1="1" x2="10" y2="4"></line><line x1="14" y1="1" x2="14" y2="4"></line></symbol><symbol id="columns" viewBox="0 0 24 24"><path d="M12 3h7a2 2 0 0 1 2 2v14a2 2 0 0 1-2 2h-7m0-18H5a2 2 0 0 0-2 2v14a2 2 0 0 0 2 2h7m0-18v18"></path></symbol><symbol id="command" viewBox="0 0 24 24"><path d="M18 3a3 3 0 0 0-3 3v12a3 3 0 0 0 3 3 3 3 0 0 0 3-3 3 3 0 0 0-3-3H6a3 3 0 0 0-3 3 3 3 0 0 0 3 3 3 3 0 0 0 3-3V6a3 3 0 0 0-3-3 3 3 0 0 0-3 3 3 3 0 0 0 3 3h12a3 3 0 0 0 3-3 3 3 0 0 0-3-3z"></path></symbol><symbol id="compass" viewBox="0 0 24 24"><circle cx="12" cy="12" r="10"></circle><polygon points="16.24 7.76 14.12 14.12 7.76 16.24 9.88 9.88 16.24 7.76"></polygon></symbol><symbol id="copy" viewBox="0 0 24 24"><rect x="9" y="9" width="13" height="13" rx="2" ry="2"></rect><path d="M5 15H4a2 2 0 0 1-2-2V4a2 2 0 0 1 2-2h9a2 2 0 0 1 2 2v1"></path></symbol><symbol id="corner-down-left" viewBox="0 0 24 24"><polyline points="9 10 4 15 9 20"></polyline><path d="M20 4v7a4 4 0 0 1-4 4H4"></path></symbol><symbol id="corner-down-right" viewBox="0 0 24 24"><polyline points="15 10 20 15 15 20"></polyline><path d="M4 4v7a4 4 0 0 0 4 4h12"></path></symbol><symbol id="corner-left-down" viewBox="0 0 24 24"><polyline points="14 15 9 20 4 15"></polyline><path d="M20 4h-7a4 4 0 0 0-4 4v12"></path></symbol><symbol id="corner-left-up" viewBox="0 0 24 24"><polyline points="14 9 9 4 4 9"></polyline><path d="M20 20h-7a4 4 0 0 1-4-4V4"></path></symbol><symbol id="corner-right-down" viewBox="0 0 24 24"><polyline points="10 15 15 20 20 15"></polyline><path d="M4 4h7a4 4 0 0 1 4 4v12"></path></symbol><symbol id="corner-right-up" viewBox="0 0 24 24"><polyline points="10 9 15 4 20 9"></polyline><path d="M4 20h7a4 4 0 0 0 4-4V4"></path></symbol><symbol id="corner-up-left" viewBox="0 0 24 24"><polyline points="9 14 4 9 9 4"></polyline><path d="M20 20v-7a4 4 0 0 0-4-4H4"></path></symbol><symbol id="corner-up-right" viewBox="0 0 24 24"><polyline points="15 14 20 9 15 4"></polyline><path d="M4 20v-7a4 4 0 0 1 4-4h12"></path></symbol><symbol id="cpu" viewBox="0 0 24 24"><rect x="4" y="4" width="16" height="16" rx="2" ry="2"></rect><rect x="9" y="9" width="6" height="6"></rect><line x1="9" y1="1" x2="9" y2="4"></line><line x1="15" y1="1" x2="15" y2="4"></line><line x1="9" y1="20" x2="9" y2="23"></line><line x1="15" y1="20" x2="15" y2="23"></line><line x1="20" y1="9" x2="23" y2="9"></line><line x1="20" y1="14" x2="23" y2="14"></line><line x1="1" y1="9" x2="4" y2="9"></line><line x1="1" y1="14" x2="4" y2="14"></line></symbol><symbol id="credit-card" viewBox="0 0 24 24"><rect x="1" y="4" width="22" height="16" rx="2" ry="2"></rect><line x1="1" y1="10" x2="23" y2="10"></line></symbol><symbol id="crop" viewBox="0 0 24 24"><path d="M6.13 1L6 16a2 2 0 0 0 2 2h15"></path><path d="M1 6.13L16 6a2 2 0 0 1 2 2v15"></path></symbol><symbol id="crosshair" viewBox="0 0 24 24"><circle cx="12" cy="12" r="10"></circle><line x1="22" y1="12" x2="18" y2="12"></line><line x1="6" y1="12" x2="2" y2="12"></line><line x1="12" y1="6" x2="12" y2="2"></line><line x1="12" y1="22" x2="12" y2="18"></line></symbol><symbol id="database" viewBox="0 0 24 24"><ellipse cx="12" cy="5" rx="9" ry="3"></ellipse><path d="M21 12c0 1.66-4 3-9 3s-9-1.34-9-3"></path><path d="M3 5v14c0 1.66 4 3 9 3s9-1.34 9-3V5"></path></symbol><symbol id="delete" viewBox="0 0 24 24"><path d="M21 4H8l-7 8 7 8h13a2 2 0 0 0 2-2V6a2 2 0 0 0-2-2z"></path><line x1="18" y1="9" x2="12" y2="15"></line><line x1="12" y1="9" x2="18" y2="15"></line></symbol><symbol id="disc" viewBox="0 0 24 24"><circle cx="12" cy="12" r="10"></circle><circle cx="12" cy="12" r="3"></circle></symbol><symbol id="divide-circle" viewBox="0 0 24 24"><line x1="8" y1="12" x2="16" y2="12"></line><line x1="12" y1="16" x2="12" y2="16"></line><line x1="12" y1="8" x2="12" y2="8"></line><circle cx="12" cy="12" r="10"></circle></symbol><symbol id="divide-square" viewBox="0 0 24 24"><rect x="3" y="3" width="18" height="18" rx="2" ry="2"></rect><line x1="8" y1="12" x2="16" y2="12"></line><line x1="12" y1="16" x2="12" y2="16"></line><line x1="12" y1="8" x2="12" y2="8"></line></symbol><symbol id="divide" viewBox="0 0 24 24"><circle cx="12" cy="6" r="2"></circle><line x1="5" y1="12" x2="19" y2="12"></line><circle cx="12" cy="18" r="2"></circle></symbol><symbol id="dollar-sign" viewBox="0 0 24 24"><line x1="12" y1="1" x2="12" y2="23"></line><path d="M17 5H9.5a3.5 3.5 0 0 0 0 7h5a3.5 3.5 0 0 1 0 7H6"></path></symbol><symbol id="download-cloud" viewBox="0 0 24 24"><polyline points="8 17 12 21 16 17"></polyline><line x1="12" y1="12" x2="12" y2="21"></line><path d="M20.88 18.09A5 5 0 0 0 18 9h-1.26A8 8 0 1 0 3 16.29"></path></symbol><symbol id="download" viewBox="0 0 24 24"><path d="M21 15v4a2 2 0 0 1-2 2H5a2 2 0 0 1-2-2v-4"></path><polyline points="7 10 12 15 17 10"></polyline><line x1="12" y1="15" x2="12" y2="3"></line></symbol><symbol id="dribbble" viewBox="0 0 24 24"><circle cx="12" cy="12" r="10"></circle><path d="M8.56 2.75c4.37 6.03 6.02 9.42 8.03 17.72m2.54-15.38c-3.72 4.35-8.94 5.66-16.88 5.85m19.5 1.9c-3.5-.93-6.63-.82-8.94 0-2.58.92-5.01 2.86-7.44 6.32"></path></symbol><symbol id="droplet" viewBox="0 0 24 24"><path d="M12 2.69l5.66 5.66a8 8 0 1 1-11.31 0z"></path></symbol><symbol id="edit-2" viewBox="0 0 24 24"><path d="M17 3a2.828 2.828 0 1 1 4 4L7.5 20.5 2 22l1.5-5.5L17 3z"></path></symbol><symbol id="edit-3" viewBox="0 0 24 24"><path d="M12 20h9"></path><path d="M16.5 3.5a2.121 2.121 0 0 1 3 3L7 19l-4 1 1-4L16.5 3.5z"></path></symbol><symbol id="edit" viewBox="0 0 24 24"><path d="M11 4H4a2 2 0 0 0-2 2v14a2 2 0 0 0 2 2h14a2 2 0 0 0 2-2v-7"></path><path d="M18.5 2.5a2.121 2.121 0 0 1 3 3L12 15l-4 1 1-4 9.5-9.5z"></path></symbol><symbol id="external-link" viewBox="0 0 24 24"><path d="M18 13v6a2 2 0 0 1-2 2H5a2 2 0 0 1-2-2V8a2 2 0 0 1 2-2h6"></path><polyline points="15 3 21 3 21 9"></polyline><line x1="10" y1="14" x2="21" y2="3"></line></symbol><symbol id="eye-off" viewBox="0 0 24 24"><path d="M17.94 17.94A10.07 10.07 0 0 1 12 20c-7 0-11-8-11-8a18.45 18.45 0 0 1 5.06-5.94M9.9 4.24A9.12 9.12 0 0 1 12 4c7 0 11 8 11 8a18.5 18.5 0 0 1-2.16 3.19m-6.72-1.07a3 3 0 1 1-4.24-4.24"></path><line x1="1" y1="1" x2="23" y2="23"></line></symbol><symbol id="eye" viewBox="0 0 24 24"><path d="M1 12s4-8 11-8 11 8 11 8-4 8-11 8-11-8-11-8z"></path><circle cx="12" cy="12" r="3"></circle></symbol><symbol id="facebook" viewBox="0 0 24 24"><path d="M18 2h-3a5 5 0 0 0-5 5v3H7v4h3v8h4v-8h3l1-4h-4V7a1 1 0 0 1 1-1h3z"></path></symbol><symbol id="fast-forward" viewBox="0 0 24 24"><polygon points="13 19 22 12 13 5 13 19"></polygon><polygon points="2 19 11 12 2 5 2 19"></polygon></symbol><symbol id="feather" viewBox="0 0 24 24"><path d="M20.24 12.24a6 6 0 0 0-8.49-8.49L5 10.5V19h8.5z"></path><line x1="16" y1="8" x2="2" y2="22"></line><line x1="17.5" y1="15" x2="9" y2="15"></line></symbol><symbol id="figma" viewBox="0 0 24 24"><path d="M5 5.5A3.5 3.5 0 0 1 8.5 2H12v7H8.5A3.5 3.5 0 0 1 5 5.5z"></path><path d="M12 2h3.5a3.5 3.5 0 1 1 0 7H12V2z"></path><path d="M12 12.5a3.5 3.5 0 1 1 7 0 3.5 3.5 0 1 1-7 0z"></path><path d="M5 19.5A3.5 3.5 0 0 1 8.5 16H12v3.5a3.5 3.5 0 1 1-7 0z"></path><path d="M5 12.5A3.5 3.5 0 0 1 8.5 9H12v7H8.5A3.5 3.5 0 0 1 5 12.5z"></path></symbol><symbol id="file-minus" viewBox="0 0 24 24"><path d="M14 2H6a2 2 0 0 0-2 2v16a2 2 0 0 0 2 2h12a2 2 0 0 0 2-2V8z"></path><polyline points="14 2 14 8 20 8"></polyline><line x1="9" y1="15" x2="15" y2="15"></line></symbol><symbol id="file-plus" viewBox="0 0 24 24"><path d="M14 2H6a2 2 0 0 0-2 2v16a2 2 0 0 0 2 2h12a2 2 0 0 0 2-2V8z"></path><polyline points="14 2 14 8 20 8"></polyline><line x1="12" y1="18" x2="12" y2="12"></line><line x1="9" y1="15" x2="15" y2="15"></line></symbol><symbol id="file-text" viewBox="0 0 24 24"><path d="M14 2H6a2 2 0 0 0-2 2v16a2 2 0 0 0 2 2h12a2 2 0 0 0 2-2V8z"></path><polyline points="14 2 14 8 20 8"></polyline><line x1="16" y1="13" x2="8" y2="13"></line><line x1="16" y1="17" x2="8" y2="17"></line><polyline points="10 9 9 9 8 9"></polyline></symbol><symbol id="file" viewBox="0 0 24 24"><path d="M13 2H6a2 2 0 0 0-2 2v16a2 2 0 0 0 2 2h12a2 2 0 0 0 2-2V9z"></path><polyline points="13 2 13 9 20 9"></polyline></symbol><symbol id="film" viewBox="0 0 24 24"><rect x="2" y="2" width="20" height="20" rx="2.18" ry="2.18"></rect><line x1="7" y1="2" x2="7" y2="22"></line><line x1="17" y1="2" x2="17" y2="22"></line><line x1="2" y1="12" x2="22" y2="12"></line><line x1="2" y1="7" x2="7" y2="7"></line><line x1="2" y1="17" x2="7" y2="17"></line><line x1="17" y1="17" x2="22" y2="17"></line><line x1="17" y1="7" x2="22" y2="7"></line></symbol><symbol id="filter" viewBox="0 0 24 24"><polygon points="22 3 2 3 10 12.46 10 19 14 21 14 12.46 22 3"></polygon></symbol><symbol id="flag" viewBox="0 0 24 24"><path d="M4 15s1-1 4-1 5 2 8 2 4-1 4-1V3s-1 1-4 1-5-2-8-2-4 1-4 1z"></path><line x1="4" y1="22" x2="4" y2="15"></line></symbol><symbol id="folder-minus" viewBox="0 0 24 24"><path d="M22 19a2 2 0 0 1-2 2H4a2 2 0 0 1-2-2V5a2 2 0 0 1 2-2h5l2 3h9a2 2 0 0 1 2 2z"></path><line x1="9" y1="14" x2="15" y2="14"></line></symbol><symbol id="folder-plus" viewBox="0 0 24 24"><path d="M22 19a2 2 0 0 1-2 2H4a2 2 0 0 1-2-2V5a2 2 0 0 1 2-2h5l2 3h9a2 2 0 0 1 2 2z"></path><line x1="12" y1="11" x2="12" y2="17"></line><line x1="9" y1="14" x2="15" y2="14"></line></symbol><symbol id="folder" viewBox="0 0 24 24"><path d="M22 19a2 2 0 0 1-2 2H4a2 2 0 0 1-2-2V5a2 2 0 0 1 2-2h5l2 3h9a2 2 0 0 1 2 2z"></path></symbol><symbol id="framer" viewBox="0 0 24 24"><path d="M5 16V9h14V2H5l14 14h-7m-7 0l7 7v-7m-7 0h7"></path></symbol><symbol id="frown" viewBox="0 0 24 24"><circle cx="12" cy="12" r="10"></circle><path d="M16 16s-1.5-2-4-2-4 2-4 2"></path><line x1="9" y1="9" x2="9.01" y2="9"></line><line x1="15" y1="9" x2="15.01" y2="9"></line></symbol><symbol id="gift" viewBox="0 0 24 24"><polyline points="20 12 20 22 4 22 4 12"></polyline><rect x="2" y="7" width="20" height="5"></rect><line x1="12" y1="22" x2="12" y2="7"></line><path d="M12 7H7.5a2.5 2.5 0 0 1 0-5C11 2 12 7 12 7z"></path><path d="M12 7h4.5a2.5 2.5 0 0 0 0-5C13 2 12 7 12 7z"></path></symbol><symbol id="git-branch" viewBox="0 0 24 24"><line x1="6" y1="3" x2="6" y2="15"></line><circle cx="18" cy="6" r="3"></circle><circle cx="6" cy="18" r="3"></circle><path d="M18 9a9 9 0 0 1-9 9"></path></symbol><symbol id="git-commit" viewBox="0 0 24 24"><circle cx="12" cy="12" r="4"></circle><line x1="1.05" y1="12" x2="7" y2="12"></line><line x1="17.01" y1="12" x2="22.96" y2="12"></line></symbol><symbol id="git-merge" viewBox="0 0 24 24"><circle cx="18" cy="18" r="3"></circle><circle cx="6" cy="6" r="3"></circle><path d="M6 21V9a9 9 0 0 0 9 9"></path></symbol><symbol id="git-pull-request" viewBox="0 0 24 24"><circle cx="18" cy="18" r="3"></circle><circle cx="6" cy="6" r="3"></circle><path d="M13 6h3a2 2 0 0 1 2 2v7"></path><line x1="6" y1="9" x2="6" y2="21"></line></symbol><symbol id="github" viewBox="0 0 24 24"><path d="M9 19c-5 1.5-5-2.5-7-3m14 6v-3.87a3.37 3.37 0 0 0-.94-2.61c3.14-.35 6.44-1.54 6.44-7A5.44 5.44 0 0 0 20 4.77 5.07 5.07 0 0 0 19.91 1S18.73.65 16 2.48a13.38 13.38 0 0 0-7 0C6.27.65 5.09 1 5.09 1A5.07 5.07 0 0 0 5 4.77a5.44 5.44 0 0 0-1.5 3.78c0 5.42 3.3 6.61 6.44 7A3.37 3.37 0 0 0 9 18.13V22"></path></symbol><symbol id="gitlab" viewBox="0 0 24 24"><path d="M22.65 14.39L12 22.13 1.35 14.39a.84.84 0 0 1-.3-.94l1.22-3.78 2.44-7.51A.42.42 0 0 1 4.82 2a.43.43 0 0 1 .58 0 .42.42 0 0 1 .11.18l2.44 7.49h8.1l2.44-7.51A.42.42 0 0 1 18.6 2a.43.43 0 0 1 .58 0 .42.42 0 0 1 .11.18l2.44 7.51L23 13.45a.84.84 0 0 1-.35.94z"></path></symbol><symbol id="globe" viewBox="0 0 24 24"><circle cx="12" cy="12" r="10"></circle><line x1="2" y1="12" x2="22" y2="12"></line><path d="M12 2a15.3 15.3 0 0 1 4 10 15.3 15.3 0 0 1-4 10 15.3 15.3 0 0 1-4-10 15.3 15.3 0 0 1 4-10z"></path></symbol><symbol id="grid" viewBox="0 0 24 24"><rect x="3" y="3" width="7" height="7"></rect><rect x="14" y="3" width="7" height="7"></rect><rect x="14" y="14" width="7" height="7"></rect><rect x="3" y="14" width="7" height="7"></rect></symbol><symbol id="hard-drive" viewBox="0 0 24 24"><line x1="22" y1="12" x2="2" y2="12"></line><path d="M5.45 5.11L2 12v6a2 2 0 0 0 2 2h16a2 2 0 0 0 2-2v-6l-3.45-6.89A2 2 0 0 0 16.76 4H7.24a2 2 0 0 0-1.79 1.11z"></path><line x1="6" y1="16" x2="6.01" y2="16"></line><line x1="10" y1="16" x2="10.01" y2="16"></line></symbol><symbol id="hash" viewBox="0 0 24 24"><line x1="4" y1="9" x2="20" y2="9"></line><line x1="4" y1="15" x2="20" y2="15"></line><line x1="10" y1="3" x2="8" y2="21"></line><line x1="16" y1="3" x2="14" y2="21"></line></symbol><symbol id="headphones" viewBox="0 0 24 24"><path d="M3 18v-6a9 9 0 0 1 18 0v6"></path><path d="M21 19a2 2 0 0 1-2 2h-1a2 2 0 0 1-2-2v-3a2 2 0 0 1 2-2h3zM3 19a2 2 0 0 0 2 2h1a2 2 0 0 0 2-2v-3a2 2 0 0 0-2-2H3z"></path></symbol><symbol id="heart" viewBox="0 0 24 24"><path d="M20.84 4.61a5.5 5.5 0 0 0-7.78 0L12 5.67l-1.06-1.06a5.5 5.5 0 0 0-7.78 7.78l1.06 1.06L12 21.23l7.78-7.78 1.06-1.06a5.5 5.5 0 0 0 0-7.78z"></path></symbol><symbol id="help-circle" viewBox="0 0 24 24"><circle cx="12" cy="12" r="10"></circle><path d="M9.09 9a3 3 0 0 1 5.83 1c0 2-3 3-3 3"></path><line x1="12" y1="17" x2="12.01" y2="17"></line></symbol><symbol id="hexagon" viewBox="0 0 24 24"><path d="M21 16V8a2 2 0 0 0-1-1.73l-7-4a2 2 0 0 0-2 0l-7 4A2 2 0 0 0 3 8v8a2 2 0 0 0 1 1.73l7 4a2 2 0 0 0 2 0l7-4A2 2 0 0 0 21 16z"></path></symbol><symbol id="home" viewBox="0 0 24 24"><path d="M3 9l9-7 9 7v11a2 2 0 0 1-2 2H5a2 2 0 0 1-2-2z"></path><polyline points="9 22 9 12 15 12 15 22"></polyline></symbol><symbol id="image" viewBox="0 0 24 24"><rect x="3" y="3" width="18" height="18" rx="2" ry="2"></rect><circle cx="8.5" cy="8.5" r="1.5"></circle><polyline points="21 15 16 10 5 21"></polyline></symbol><symbol id="inbox" viewBox="0 0 24 24"><polyline points="22 12 16 12 14 15 10 15 8 12 2 12"></polyline><path d="M5.45 5.11L2 12v6a2 2 0 0 0 2 2h16a2 2 0 0 0 2-2v-6l-3.45-6.89A2 2 0 0 0 16.76 4H7.24a2 2 0 0 0-1.79 1.11z"></path></symbol><symbol id="info" viewBox="0 0 24 24"><circle cx="12" cy="12" r="10"></circle><line x1="12" y1="16" x2="12" y2="12"></line><line x1="12" y1="8" x2="12.01" y2="8"></line></symbol><symbol id="instagram" viewBox="0 0 24 24"><rect x="2" y="2" width="20" height="20" rx="5" ry="5"></rect><path d="M16 11.37A4 4 0 1 1 12.63 8 4 4 0 0 1 16 11.37z"></path><line x1="17.5" y1="6.5" x2="17.51" y2="6.5"></line></symbol><symbol id="italic" viewBox="0 0 24 24"><line x1="19" y1="4" x2="10" y2="4"></line><line x1="14" y1="20" x2="5" y2="20"></line><line x1="15" y1="4" x2="9" y2="20"></line></symbol><symbol id="key" viewBox="0 0 24 24"><path d="M21 2l-2 2m-7.61 7.61a5.5 5.5 0 1 1-7.778 7.778 5.5 5.5 0 0 1 7.777-7.777zm0 0L15.5 7.5m0 0l3 3L22 7l-3-3m-3.5 3.5L19 4"></path></symbol><symbol id="layers" viewBox="0 0 24 24"><polygon points="12 2 2 7 12 12 22 7 12 2"></polygon><polyline points="2 17 12 22 22 17"></polyline><polyline points="2 12 12 17 22 12"></polyline></symbol><symbol id="layout" viewBox="0 0 24 24"><rect x="3" y="3" width="18" height="18" rx="2" ry="2"></rect><line x1="3" y1="9" x2="21" y2="9"></line><line x1="9" y1="21" x2="9" y2="9"></line></symbol><symbol id="life-buoy" viewBox="0 0 24 24"><circle cx="12" cy="12" r="10"></circle><circle cx="12" cy="12" r="4"></circle><line x1="4.93" y1="4.93" x2="9.17" y2="9.17"></line><line x1="14.83" y1="14.83" x2="19.07" y2="19.07"></line><line x1="14.83" y1="9.17" x2="19.07" y2="4.93"></line><line x1="14.83" y1="9.17" x2="18.36" y2="5.64"></line><line x1="4.93" y1="19.07" x2="9.17" y2="14.83"></line></symbol><symbol id="link-2" viewBox="0 0 24 24"><path d="M15 7h3a5 5 0 0 1 5 5 5 5 0 0 1-5 5h-3m-6 0H6a5 5 0 0 1-5-5 5 5 0 0 1 5-5h3"></path><line x1="8" y1="12" x2="16" y2="12"></line></symbol><symbol id="link" viewBox="0 0 24 24"><path d="M10 13a5 5 0 0 0 7.54.54l3-3a5 5 0 0 0-7.07-7.07l-1.72 1.71"></path><path d="M14 11a5 5 0 0 0-7.54-.54l-3 3a5 5 0 0 0 7.07 7.07l1.71-1.71"></path></symbol><symbol id="linkedin" viewBox="0 0 24 24"><path d="M16 8a6 6 0 0 1 6 6v7h-4v-7a2 2 0 0 0-2-2 2 2 0 0 0-2 2v7h-4v-7a6 6 0 0 1 6-6z"></path><rect x="2" y="9" width="4" height="12"></rect><circle cx="4" cy="4" r="2"></circle></symbol><symbol id="list" viewBox="0 0 24 24"><line x1="8" y1="6" x2="21" y2="6"></line><line x1="8" y1="12" x2="21" y2="12"></line><line x1="8" y1="18" x2="21" y2="18"></line><line x1="3" y1="6" x2="3.01" y2="6"></line><line x1="3" y1="12" x2="3.01" y2="12"></line><line x1="3" y1="18" x2="3.01" y2="18"></line></symbol><symbol id="loader" viewBox="0 0 24 24"><line x1="12" y1="2" x2="12" y2="6"></line><line x1="12" y1="18" x2="12" y2="22"></line><line x1="4.93" y1="4.93" x2="7.76" y2="7.76"></line><line x1="16.24" y1="16.24" x2="19.07" y2="19.07"></line><line x1="2" y1="12" x2="6" y2="12"></line><line x1="18" y1="12" x2="22" y2="12"></line><line x1="4.93" y1="19.07" x2="7.76" y2="16.24"></line><line x1="16.24" y1="7.76" x2="19.07" y2="4.93"></line></symbol><symbol id="lock" viewBox="0 0 24 24"><rect x="3" y="11" width="18" height="11" rx="2" ry="2"></rect><path d="M7 11V7a5 5 0 0 1 10 0v4"></path></symbol><symbol id="log-in" viewBox="0 0 24 24"><path d="M15 3h4a2 2 0 0 1 2 2v14a2 2 0 0 1-2 2h-4"></path><polyline points="10 17 15 12 10 7"></polyline><line x1="15" y1="12" x2="3" y2="12"></line></symbol><symbol id="log-out" viewBox="0 0 24 24"><path d="M9 21H5a2 2 0 0 1-2-2V5a2 2 0 0 1 2-2h4"></path><polyline points="16 17 21 12 16 7"></polyline><line x1="21" y1="12" x2="9" y2="12"></line></symbol><symbol id="mail" viewBox="0 0 24 24"><path d="M4 4h16c1.1 0 2 .9 2 2v12c0 1.1-.9 2-2 2H4c-1.1 0-2-.9-2-2V6c0-1.1.9-2 2-2z"></path><polyline points="22,6 12,13 2,6"></polyline></symbol><symbol id="map-pin" viewBox="0 0 24 24"><path d="M21 10c0 7-9 13-9 13s-9-6-9-13a9 9 0 0 1 18 0z"></path><circle cx="12" cy="10" r="3"></circle></symbol><symbol id="map" viewBox="0 0 24 24"><polygon points="1 6 1 22 8 18 16 22 23 18 23 2 16 6 8 2 1 6"></polygon><line x1="8" y1="2" x2="8" y2="18"></line><line x1="16" y1="6" x2="16" y2="22"></line></symbol><symbol id="maximize-2" viewBox="0 0 24 24"><polyline points="15 3 21 3 21 9"></polyline><polyline points="9 21 3 21 3 15"></polyline><line x1="21" y1="3" x2="14" y2="10"></line><line x1="3" y1="21" x2="10" y2="14"></line></symbol><symbol id="maximize" viewBox="0 0 24 24"><path d="M8 3H5a2 2 0 0 0-2 2v3m18 0V5a2 2 0 0 0-2-2h-3m0 18h3a2 2 0 0 0 2-2v-3M3 16v3a2 2 0 0 0 2 2h3"></path></symbol><symbol id="meh" viewBox="0 0 24 24"><circle cx="12" cy="12" r="10"></circle><line x1="8" y1="15" x2="16" y2="15"></line><line x1="9" y1="9" x2="9.01" y2="9"></line><line x1="15" y1="9" x2="15.01" y2="9"></line></symbol><symbol id="menu" viewBox="0 0 24 24"><line x1="3" y1="12" x2="21" y2="12"></line><line x1="3" y1="6" x2="21" y2="6"></line><line x1="3" y1="18" x2="21" y2="18"></line></symbol><symbol id="message-circle" viewBox="0 0 24 24"><path d="M21 11.5a8.38 8.38 0 0 1-.9 3.8 8.5 8.5 0 0 1-7.6 4.7 8.38 8.38 0 0 1-3.8-.9L3 21l1.9-5.7a8.38 8.38 0 0 1-.9-3.8 8.5 8.5 0 0 1 4.7-7.6 8.38 8.38 0 0 1 3.8-.9h.5a8.48 8.48 0 0 1 8 8v.5z"></path></symbol><symbol id="message-square" viewBox="0 0 24 24"><path d="M21 15a2 2 0 0 1-2 2H7l-4 4V5a2 2 0 0 1 2-2h14a2 2 0 0 1 2 2z"></path></symbol><symbol id="mic-off" viewBox="0 0 24 24"><line x1="1" y1="1" x2="23" y2="23"></line><path d="M9 9v3a3 3 0 0 0 5.12 2.12M15 9.34V4a3 3 0 0 0-5.94-.6"></path><path d="M17 16.95A7 7 0 0 1 5 12v-2m14 0v2a7 7 0 0 1-.11 1.23"></path><line x1="12" y1="19" x2="12" y2="23"></line><line x1="8" y1="23" x2="16" y2="23"></line></symbol><symbol id="mic" viewBox="0 0 24 24"><path d="M12 1a3 3 0 0 0-3 3v8a3 3 0 0 0 6 0V4a3 3 0 0 0-3-3z"></path><path d="M19 10v2a7 7 0 0 1-14 0v-2"></path><line x1="12" y1="19" x2="12" y2="23"></line><line x1="8" y1="23" x2="16" y2="23"></line></symbol><symbol id="minimize-2" viewBox="0 0 24 24"><polyline points="4 14 10 14 10 20"></polyline><polyline points="20 10 14 10 14 4"></polyline><line x1="14" y1="10" x2="21" y2="3"></line><line x1="3" y1="21" x2="10" y2="14"></line></symbol><symbol id="minimize" viewBox="0 0 24 24"><path d="M8 3v3a2 2 0 0 1-2 2H3m18 0h-3a2 2 0 0 1-2-2V3m0 18v-3a2 2 0 0 1 2-2h3M3 16h3a2 2 0 0 1 2 2v3"></path></symbol><symbol id="minus-circle" viewBox="0 0 24 24"><circle cx="12" cy="12" r="10"></circle><line x1="8" y1="12" x2="16" y2="12"></line></symbol><symbol id="minus-square" viewBox="0 0 24 24"><rect x="3" y="3" width="18" height="18" rx="2" ry="2"></rect><line x1="8" y1="12" x2="16" y2="12"></line></symbol><symbol id="minus" viewBox="0 0 24 24"><line x1="5" y1="12" x2="19" y2="12"></line></symbol><symbol id="monitor" viewBox="0 0 24 24"><rect x="2" y="3" width="20" height="14" rx="2" ry="2"></rect><line x1="8" y1="21" x2="16" y2="21"></line><line x1="12" y1="17" x2="12" y2="21"></line></symbol><symbol id="moon" viewBox="0 0 24 24"><path d="M21 12.79A9 9 0 1 1 11.21 3 7 7 0 0 0 21 12.79z"></path></symbol><symbol id="more-horizontal" viewBox="0 0 24 24"><circle cx="12" cy="12" r="1"></circle><circle cx="19" cy="12" r="1"></circle><circle cx="5" cy="12" r="1"></circle></symbol><symbol id="more-vertical" viewBox="0 0 24 24"><circle cx="12" cy="12" r="1"></circle><circle cx="12" cy="5" r="1"></circle><circle cx="12" cy="19" r="1"></circle></symbol><symbol id="mouse-pointer" viewBox="0 0 24 24"><path d="M3 3l7.07 16.97 2.51-7.39 7.39-2.51L3 3z"></path><path d="M13 13l6 6"></path></symbol><symbol id="move" viewBox="0 0 24 24"><polyline points="5 9 2 12 5 15"></polyline><polyline points="9 5 12 2 15 5"></polyline><polyline points="15 19 12 22 9 19"></polyline><polyline points="19 9 22 12 19 15"></polyline><line x1="2" y1="12" x2="22" y2="12"></line><line x1="12" y1="2" x2="12" y2="22"></line></symbol><symbol id="music" viewBox="0 0 24 24"><path d="M9 18V5l12-2v13"></path><circle cx="6" cy="18" r="3"></circle><circle cx="18" cy="16" r="3"></circle></symbol><symbol id="navigation-2" viewBox="0 0 24 24"><polygon points="12 2 19 21 12 17 5 21 12 2"></polygon></symbol><symbol id="navigation" viewBox="0 0 24 24"><polygon points="3 11 22 2 13 21 11 13 3 11"></polygon></symbol><symbol id="octagon" viewBox="0 0 24 24"><polygon points="7.86 2 16.14 2 22 7.86 22 16.14 16.14 22 7.86 22 2 16.14 2 7.86 7.86 2"></polygon></symbol><symbol id="package" viewBox="0 0 24 24"><line x1="16.5" y1="9.4" x2="7.5" y2="4.21"></line><path d="M21 16V8a2 2 0 0 0-1-1.73l-7-4a2 2 0 0 0-2 0l-7 4A2 2 0 0 0 3 8v8a2 2 0 0 0 1 1.73l7 4a2 2 0 0 0 2 0l7-4A2 2 0 0 0 21 16z"></path><polyline points="3.27 6.96 12 12.01 20.73 6.96"></polyline><line x1="12" y1="22.08" x2="12" y2="12"></line></symbol><symbol id="paperclip" viewBox="0 0 24 24"><path d="M21.44 11.05l-9.19 9.19a6 6 0 0 1-8.49-8.49l9.19-9.19a4 4 0 0 1 5.66 5.66l-9.2 9.19a2 2 0 0 1-2.83-2.83l8.49-8.48"></path></symbol><symbol id="pause-circle" viewBox="0 0 24 24"><circle cx="12" cy="12" r="10"></circle><line x1="10" y1="15" x2="10" y2="9"></line><line x1="14" y1="15" x2="14" y2="9"></line></symbol><symbol id="pause" viewBox="0 0 24 24"><rect x="6" y="4" width="4" height="16"></rect><rect x="14" y="4" width="4" height="16"></rect></symbol><symbol id="pen-tool" viewBox="0 0 24 24"><path d="M12 19l7-7 3 3-7 7-3-3z"></path><path d="M18 13l-1.5-7.5L2 2l3.5 14.5L13 18l5-5z"></path><path d="M2 2l7.586 7.586"></path><circle cx="11" cy="11" r="2"></circle></symbol><symbol id="percent" viewBox="0 0 24 24"><line x1="19" y1="5" x2="5" y2="19"></line><circle cx="6.5" cy="6.5" r="2.5"></circle><circle cx="17.5" cy="17.5" r="2.5"></circle></symbol><symbol id="phone-call" viewBox="0 0 24 24"><path d="M15.05 5A5 5 0 0 1 19 8.95M15.05 1A9 9 0 0 1 23 8.94m-1 7.98v3a2 2 0 0 1-2.18 2 19.79 19.79 0 0 1-8.63-3.07 19.5 19.5 0 0 1-6-6 19.79 19.79 0 0 1-3.07-8.67A2 2 0 0 1 4.11 2h3a2 2 0 0 1 2 1.72 12.84 12.84 0 0 0 .7 2.81 2 2 0 0 1-.45 2.11L8.09 9.91a16 16 0 0 0 6 6l1.27-1.27a2 2 0 0 1 2.11-.45 12.84 12.84 0 0 0 2.81.7A2 2 0 0 1 22 16.92z"></path></symbol><symbol id="phone-forwarded" viewBox="0 0 24 24"><polyline points="19 1 23 5 19 9"></polyline><line x1="15" y1="5" x2="23" y2="5"></line><path d="M22 16.92v3a2 2 0 0 1-2.18 2 19.79 19.79 0 0 1-8.63-3.07 19.5 19.5 0 0 1-6-6 19.79 19.79 0 0 1-3.07-8.67A2 2 0 0 1 4.11 2h3a2 2 0 0 1 2 1.72 12.84 12.84 0 0 0 .7 2.81 2 2 0 0 1-.45 2.11L8.09 9.91a16 16 0 0 0 6 6l1.27-1.27a2 2 0 0 1 2.11-.45 12.84 12.84 0 0 0 2.81.7A2 2 0 0 1 22 16.92z"></path></symbol><symbol id="phone-incoming" viewBox="0 0 24 24"><polyline points="16 2 16 8 22 8"></polyline><line x1="23" y1="1" x2="16" y2="8"></line><path d="M22 16.92v3a2 2 0 0 1-2.18 2 19.79 19.79 0 0 1-8.63-3.07 19.5 19.5 0 0 1-6-6 19.79 19.79 0 0 1-3.07-8.67A2 2 0 0 1 4.11 2h3a2 2 0 0 1 2 1.72 12.84 12.84 0 0 0 .7 2.81 2 2 0 0 1-.45 2.11L8.09 9.91a16 16 0 0 0 6 6l1.27-1.27a2 2 0 0 1 2.11-.45 12.84 12.84 0 0 0 2.81.7A2 2 0 0 1 22 16.92z"></path></symbol><symbol id="phone-missed" viewBox="0 0 24 24"><line x1="23" y1="1" x2="17" y2="7"></line><line x1="17" y1="1" x2="23" y2="7"></line><path d="M22 16.92v3a2 2 0 0 1-2.18 2 19.79 19.79 0 0 1-8.63-3.07 19.5 19.5 0 0 1-6-6 19.79 19.79 0 0 1-3.07-8.67A2 2 0 0 1 4.11 2h3a2 2 0 0 1 2 1.72 12.84 12.84 0 0 0 .7 2.81 2 2 0 0 1-.45 2.11L8.09 9.91a16 16 0 0 0 6 6l1.27-1.27a2 2 0 0 1 2.11-.45 12.84 12.84 0 0 0 2.81.7A2 2 0 0 1 22 16.92z"></path></symbol><symbol id="phone-off" viewBox="0 0 24 24"><path d="M10.68 13.31a16 16 0 0 0 3.41 2.6l1.27-1.27a2 2 0 0 1 2.11-.45 12.84 12.84 0 0 0 2.81.7 2 2 0 0 1 1.72 2v3a2 2 0 0 1-2.18 2 19.79 19.79 0 0 1-8.63-3.07 19.42 19.42 0 0 1-3.33-2.67m-2.67-3.34a19.79 19.79 0 0 1-3.07-8.63A2 2 0 0 1 4.11 2h3a2 2 0 0 1 2 1.72 12.84 12.84 0 0 0 .7 2.81 2 2 0 0 1-.45 2.11L8.09 9.91"></path><line x1="23" y1="1" x2="1" y2="23"></line></symbol><symbol id="phone-outgoing" viewBox="0 0 24 24"><polyline points="23 7 23 1 17 1"></polyline><line x1="16" y1="8" x2="23" y2="1"></line><path d="M22 16.92v3a2 2 0 0 1-2.18 2 19.79 19.79 0 0 1-8.63-3.07 19.5 19.5 0 0 1-6-6 19.79 19.79 0 0 1-3.07-8.67A2 2 0 0 1 4.11 2h3a2 2 0 0 1 2 1.72 12.84 12.84 0 0 0 .7 2.81 2 2 0 0 1-.45 2.11L8.09 9.91a16 16 0 0 0 6 6l1.27-1.27a2 2 0 0 1 2.11-.45 12.84 12.84 0 0 0 2.81.7A2 2 0 0 1 22 16.92z"></path></symbol><symbol id="phone" viewBox="0 0 24 24"><path d="M22 16.92v3a2 2 0 0 1-2.18 2 19.79 19.79 0 0 1-8.63-3.07 19.5 19.5 0 0 1-6-6 19.79 19.79 0 0 1-3.07-8.67A2 2 0 0 1 4.11 2h3a2 2 0 0 1 2 1.72 12.84 12.84 0 0 0 .7 2.81 2 2 0 0 1-.45 2.11L8.09 9.91a16 16 0 0 0 6 6l1.27-1.27a2 2 0 0 1 2.11-.45 12.84 12.84 0 0 0 2.81.7A2 2 0 0 1 22 16.92z"></path></symbol><symbol id="pie-chart" viewBox="0 0 24 24"><path d="M21.21 15.89A10 10 0 1 1 8 2.83"></path><path d="M22 12A10 10 0 0 0 12 2v10z"></path></symbol><symbol id="play-circle" viewBox="0 0 24 24"><circle cx="12" cy="12" r="10"></circle><polygon points="10 8 16 12 10 16 10 8"></polygon></symbol><symbol id="play" viewBox="0 0 24 24"><polygon points="5 3 19 12 5 21 5 3"></polygon></symbol><symbol id="plus-circle" viewBox="0 0 24 24"><circle cx="12" cy="12" r="10"></circle><line x1="12" y1="8" x2="12" y2="16"></line><line x1="8" y1="12" x2="16" y2="12"></line></symbol><symbol id="plus-square" viewBox="0 0 24 24"><rect x="3" y="3" width="18" height="18" rx="2" ry="2"></rect><line x1="12" y1="8" x2="12" y2="16"></line><line x1="8" y1="12" x2="16" y2="12"></line></symbol><symbol id="plus" viewBox="0 0 24 24"><line x1="12" y1="5" x2="12" y2="19"></line><line x1="5" y1="12" x2="19" y2="12"></line></symbol><symbol id="pocket" viewBox="0 0 24 24"><path d="M4 3h16a2 2 0 0 1 2 2v6a10 10 0 0 1-10 10A10 10 0 0 1 2 11V5a2 2 0 0 1 2-2z"></path><polyline points="8 10 12 14 16 10"></polyline></symbol><symbol id="power" viewBox="0 0 24 24"><path d="M18.36 6.64a9 9 0 1 1-12.73 0"></path><line x1="12" y1="2" x2="12" y2="12"></line></symbol><symbol id="printer" viewBox="0 0 24 24"><polyline points="6 9 6 2 18 2 18 9"></polyline><path d="M6 18H4a2 2 0 0 1-2-2v-5a2 2 0 0 1 2-2h16a2 2 0 0 1 2 2v5a2 2 0 0 1-2 2h-2"></path><rect x="6" y="14" width="12" height="8"></rect></symbol><symbol id="radio" viewBox="0 0 24 24"><circle cx="12" cy="12" r="2"></circle><path d="M16.24 7.76a6 6 0 0 1 0 8.49m-8.48-.01a6 6 0 0 1 0-8.49m11.31-2.82a10 10 0 0 1 0 14.14m-14.14 0a10 10 0 0 1 0-14.14"></path></symbol><symbol id="refresh-ccw" viewBox="0 0 24 24"><polyline points="1 4 1 10 7 10"></polyline><polyline points="23 20 23 14 17 14"></polyline><path d="M20.49 9A9 9 0 0 0 5.64 5.64L1 10m22 4l-4.64 4.36A9 9 0 0 1 3.51 15"></path></symbol><symbol id="refresh-cw" viewBox="0 0 24 24"><polyline points="23 4 23 10 17 10"></polyline><polyline points="1 20 1 14 7 14"></polyline><path d="M3.51 9a9 9 0 0 1 14.85-3.36L23 10M1 14l4.64 4.36A9 9 0 0 0 20.49 15"></path></symbol><symbol id="repeat" viewBox="0 0 24 24"><polyline points="17 1 21 5 17 9"></polyline><path d="M3 11V9a4 4 0 0 1 4-4h14"></path><polyline points="7 23 3 19 7 15"></polyline><path d="M21 13v2a4 4 0 0 1-4 4H3"></path></symbol><symbol id="rewind" viewBox="0 0 24 24"><polygon points="11 19 2 12 11 5 11 19"></polygon><polygon points="22 19 13 12 22 5 22 19"></polygon></symbol><symbol id="rotate-ccw" viewBox="0 0 24 24"><polyline points="1 4 1 10 7 10"></polyline><path d="M3.51 15a9 9 0 1 0 2.13-9.36L1 10"></path></symbol><symbol id="rotate-cw" viewBox="0 0 24 24"><polyline points="23 4 23 10 17 10"></polyline><path d="M20.49 15a9 9 0 1 1-2.12-9.36L23 10"></path></symbol><symbol id="rss" viewBox="0 0 24 24"><path d="M4 11a9 9 0 0 1 9 9"></path><path d="M4 4a16 16 0 0 1 16 16"></path><circle cx="5" cy="19" r="1"></circle></symbol><symbol id="save" viewBox="0 0 24 24"><path d="M19 21H5a2 2 0 0 1-2-2V5a2 2 0 0 1 2-2h11l5 5v11a2 2 0 0 1-2 2z"></path><polyline points="17 21 17 13 7 13 7 21"></polyline><polyline points="7 3 7 8 15 8"></polyline></symbol><symbol id="scissors" viewBox="0 0 24 24"><circle cx="6" cy="6" r="3"></circle><circle cx="6" cy="18" r="3"></circle><line x1="20" y1="4" x2="8.12" y2="15.88"></line><line x1="14.47" y1="14.48" x2="20" y2="20"></line><line x1="8.12" y1="8.12" x2="12" y2="12"></line></symbol><symbol id="search" viewBox="0 0 24 24"><circle cx="11" cy="11" r="8"></circle><line x1="21" y1="21" x2="16.65" y2="16.65"></line></symbol><symbol id="send" viewBox="0 0 24 24"><line x1="22" y1="2" x2="11" y2="13"></line><polygon points="22 2 15 22 11 13 2 9 22 2"></polygon></symbol><symbol id="server" viewBox="0 0 24 24"><rect x="2" y="2" width="20" height="8" rx="2" ry="2"></rect><rect x="2" y="14" width="20" height="8" rx="2" ry="2"></rect><line x1="6" y1="6" x2="6.01" y2="6"></line><line x1="6" y1="18" x2="6.01" y2="18"></line></symbol><symbol id="settings" viewBox="0 0 24 24"><circle cx="12" cy="12" r="3"></circle><path d="M19.4 15a1.65 1.65 0 0 0 .33 1.82l.06.06a2 2 0 0 1 0 2.83 2 2 0 0 1-2.83 0l-.06-.06a1.65 1.65 0 0 0-1.82-.33 1.65 1.65 0 0 0-1 1.51V21a2 2 0 0 1-2 2 2 2 0 0 1-2-2v-.09A1.65 1.65 0 0 0 9 19.4a1.65 1.65 0 0 0-1.82.33l-.06.06a2 2 0 0 1-2.83 0 2 2 0 0 1 0-2.83l.06-.06a1.65 1.65 0 0 0 .33-1.82 1.65 1.65 0 0 0-1.51-1H3a2 2 0 0 1-2-2 2 2 0 0 1 2-2h.09A1.65 1.65 0 0 0 4.6 9a1.65 1.65 0 0 0-.33-1.82l-.06-.06a2 2 0 0 1 0-2.83 2 2 0 0 1 2.83 0l.06.06a1.65 1.65 0 0 0 1.82.33H9a1.65 1.65 0 0 0 1-1.51V3a2 2 0 0 1 2-2 2 2 0 0 1 2 2v.09a1.65 1.65 0 0 0 1 1.51 1.65 1.65 0 0 0 1.82-.33l.06-.06a2 2 0 0 1 2.83 0 2 2 0 0 1 0 2.83l-.06.06a1.65 1.65 0 0 0-.33 1.82V9a1.65 1.65 0 0 0 1.51 1H21a2 2 0 0 1 2 2 2 2 0 0 1-2 2h-.09a1.65 1.65 0 0 0-1.51 1z"></path></symbol><symbol id="share-2" viewBox="0 0 24 24"><circle cx="18" cy="5" r="3"></circle><circle cx="6" cy="12" r="3"></circle><circle cx="18" cy="19" r="3"></circle><line x1="8.59" y1="13.51" x2="15.42" y2="17.49"></line><line x1="15.41" y1="6.51" x2="8.59" y2="10.49"></line></symbol><symbol id="share" viewBox="0 0 24 24"><path d="M4 12v8a2 2 0 0 0 2 2h12a2 2 0 0 0 2-2v-8"></path><polyline points="16 6 12 2 8 6"></polyline><line x1="12" y1="2" x2="12" y2="15"></line></symbol><symbol id="shield-off" viewBox="0 0 24 24"><path d="M19.69 14a6.9 6.9 0 0 0 .31-2V5l-8-3-3.16 1.18"></path><path d="M4.73 4.73L4 5v7c0 6 8 10 8 10a20.29 20.29 0 0 0 5.62-4.38"></path><line x1="1" y1="1" x2="23" y2="23"></line></symbol><symbol id="shield" viewBox="0 0 24 24"><path d="M12 22s8-4 8-10V5l-8-3-8 3v7c0 6 8 10 8 10z"></path></symbol><symbol id="shopping-bag" viewBox="0 0 24 24"><path d="M6 2L3 6v14a2 2 0 0 0 2 2h14a2 2 0 0 0 2-2V6l-3-4z"></path><line x1="3" y1="6" x2="21" y2="6"></line><path d="M16 10a4 4 0 0 1-8 0"></path></symbol><symbol id="shopping-cart" viewBox="0 0 24 24"><circle cx="9" cy="21" r="1"></circle><circle cx="20" cy="21" r="1"></circle><path d="M1 1h4l2.68 13.39a2 2 0 0 0 2 1.61h9.72a2 2 0 0 0 2-1.61L23 6H6"></path></symbol><symbol id="shuffle" viewBox="0 0 24 24"><polyline points="16 3 21 3 21 8"></polyline><line x1="4" y1="20" x2="21" y2="3"></line><polyline points="21 16 21 21 16 21"></polyline><line x1="15" y1="15" x2="21" y2="21"></line><line x1="4" y1="4" x2="9" y2="9"></line></symbol><symbol id="sidebar" viewBox="0 0 24 24"><rect x="3" y="3" width="18" height="18" rx="2" ry="2"></rect><line x1="9" y1="3" x2="9" y2="21"></line></symbol><symbol id="skip-back" viewBox="0 0 24 24"><polygon points="19 20 9 12 19 4 19 20"></polygon><line x1="5" y1="19" x2="5" y2="5"></line></symbol><symbol id="skip-forward" viewBox="0 0 24 24"><polygon points="5 4 15 12 5 20 5 4"></polygon><line x1="19" y1="5" x2="19" y2="19"></line></symbol><symbol id="slack" viewBox="0 0 24 24"><path d="M14.5 10c-.83 0-1.5-.67-1.5-1.5v-5c0-.83.67-1.5 1.5-1.5s1.5.67 1.5 1.5v5c0 .83-.67 1.5-1.5 1.5z"></path><path d="M20.5 10H19V8.5c0-.83.67-1.5 1.5-1.5s1.5.67 1.5 1.5-.67 1.5-1.5 1.5z"></path><path d="M9.5 14c.83 0 1.5.67 1.5 1.5v5c0 .83-.67 1.5-1.5 1.5S8 21.33 8 20.5v-5c0-.83.67-1.5 1.5-1.5z"></path><path d="M3.5 14H5v1.5c0 .83-.67 1.5-1.5 1.5S2 16.33 2 15.5 2.67 14 3.5 14z"></path><path d="M14 14.5c0-.83.67-1.5 1.5-1.5h5c.83 0 1.5.67 1.5 1.5s-.67 1.5-1.5 1.5h-5c-.83 0-1.5-.67-1.5-1.5z"></path><path d="M15.5 19H14v1.5c0 .83.67 1.5 1.5 1.5s1.5-.67 1.5-1.5-.67-1.5-1.5-1.5z"></path><path d="M10 9.5C10 8.67 9.33 8 8.5 8h-5C2.67 8 2 8.67 2 9.5S2.67 11 3.5 11h5c.83 0 1.5-.67 1.5-1.5z"></path><path d="M8.5 5H10V3.5C10 2.67 9.33 2 8.5 2S7 2.67 7 3.5 7.67 5 8.5 5z"></path></symbol><symbol id="slash" viewBox="0 0 24 24"><circle cx="12" cy="12" r="10"></circle><line x1="4.93" y1="4.93" x2="19.07" y2="19.07"></line></symbol><symbol id="sliders" viewBox="0 0 24 24"><line x1="4" y1="21" x2="4" y2="14"></line><line x1="4" y1="10" x2="4" y2="3"></line><line x1="12" y1="21" x2="12" y2="12"></line><line x1="12" y1="8" x2="12" y2="3"></line><line x1="20" y1="21" x2="20" y2="16"></line><line x1="20" y1="12" x2="20" y2="3"></line><line x1="1" y1="14" x2="7" y2="14"></line><line x1="9" y1="8" x2="15" y2="8"></line><line x1="17" y1="16" x2="23" y2="16"></line></symbol><symbol id="smartphone" viewBox="0 0 24 24"><rect x="5" y="2" width="14" height="20" rx="2" ry="2"></rect><line x1="12" y1="18" x2="12.01" y2="18"></line></symbol><symbol id="smile" viewBox="0 0 24 24"><circle cx="12" cy="12" r="10"></circle><path d="M8 14s1.5 2 4 2 4-2 4-2"></path><line x1="9" y1="9" x2="9.01" y2="9"></line><line x1="15" y1="9" x2="15.01" y2="9"></line></symbol><symbol id="speaker" viewBox="0 0 24 24"><rect x="4" y="2" width="16" height="20" rx="2" ry="2"></rect><circle cx="12" cy="14" r="4"></circle><line x1="12" y1="6" x2="12.01" y2="6"></line></symbol><symbol id="square" viewBox="0 0 24 24"><rect x="3" y="3" width="18" height="18" rx="2" ry="2"></rect></symbol><symbol id="star" viewBox="0 0 24 24"><polygon points="12 2 15.09 8.26 22 9.27 17 14.14 18.18 21.02 12 17.77 5.82 21.02 7 14.14 2 9.27 8.91 8.26 12 2"></polygon></symbol><symbol id="stop-circle" viewBox="0 0 24 24"><circle cx="12" cy="12" r="10"></circle><rect x="9" y="9" width="6" height="6"></rect></symbol><symbol id="sun" viewBox="0 0 24 24"><circle cx="12" cy="12" r="5"></circle><line x1="12" y1="1" x2="12" y2="3"></line><line x1="12" y1="21" x2="12" y2="23"></line><line x1="4.22" y1="4.22" x2="5.64" y2="5.64"></line><line x1="18.36" y1="18.36" x2="19.78" y2="19.78"></line><line x1="1" y1="12" x2="3" y2="12"></line><line x1="21" y1="12" x2="23" y2="12"></line><line x1="4.22" y1="19.78" x2="5.64" y2="18.36"></line><line x1="18.36" y1="5.64" x2="19.78" y2="4.22"></line></symbol><symbol id="sunrise" viewBox="0 0 24 24"><path d="M17 18a5 5 0 0 0-10 0"></path><line x1="12" y1="2" x2="12" y2="9"></line><line x1="4.22" y1="10.22" x2="5.64" y2="11.64"></line><line x1="1" y1="18" x2="3" y2="18"></line><line x1="21" y1="18" x2="23" y2="18"></line><line x1="18.36" y1="11.64" x2="19.78" y2="10.22"></line><line x1="23" y1="22" x2="1" y2="22"></line><polyline points="8 6 12 2 16 6"></polyline></symbol><symbol id="sunset" viewBox="0 0 24 24"><path d="M17 18a5 5 0 0 0-10 0"></path><line x1="12" y1="9" x2="12" y2="2"></line><line x1="4.22" y1="10.22" x2="5.64" y2="11.64"></line><line x1="1" y1="18" x2="3" y2="18"></line><line x1="21" y1="18" x2="23" y2="18"></line><line x1="18.36" y1="11.64" x2="19.78" y2="10.22"></line><line x1="23" y1="22" x2="1" y2="22"></line><polyline points="16 5 12 9 8 5"></polyline></symbol><symbol id="tablet" viewBox="0 0 24 24"><rect x="4" y="2" width="16" height="20" rx="2" ry="2"></rect><line x1="12" y1="18" x2="12.01" y2="18"></line></symbol><symbol id="tag" viewBox="0 0 24 24"><path d="M20.59 13.41l-7.17 7.17a2 2 0 0 1-2.83 0L2 12V2h10l8.59 8.59a2 2 0 0 1 0 2.82z"></path><line x1="7" y1="7" x2="7.01" y2="7"></line></symbol><symbol id="target" viewBox="0 0 24 24"><circle cx="12" cy="12" r="10"></circle><circle cx="12" cy="12" r="6"></circle><circle cx="12" cy="12" r="2"></circle></symbol><symbol id="terminal" viewBox="0 0 24 24"><polyline points="4 17 10 11 4 5"></polyline><line x1="12" y1="19" x2="20" y2="19"></line></symbol><symbol id="thermometer" viewBox="0 0 24 24"><path d="M14 14.76V3.5a2.5 2.5 0 0 0-5 0v11.26a4.5 4.5 0 1 0 5 0z"></path></symbol><symbol id="thumbs-down" viewBox="0 0 24 24"><path d="M10 15v4a3 3 0 0 0 3 3l4-9V2H5.72a2 2 0 0 0-2 1.7l-1.38 9a2 2 0 0 0 2 2.3zm7-13h2.67A2.31 2.31 0 0 1 22 4v7a2.31 2.31 0 0 1-2.33 2H17"></path></symbol><symbol id="thumbs-up" viewBox="0 0 24 24"><path d="M14 9V5a3 3 0 0 0-3-3l-4 9v11h11.28a2 2 0 0 0 2-1.7l1.38-9a2 2 0 0 0-2-2.3zM7 22H4a2 2 0 0 1-2-2v-7a2 2 0 0 1 2-2h3"></path></symbol><symbol id="toggle-left" viewBox="0 0 24 24"><rect x="1" y="5" width="22" height="14" rx="7" ry="7"></rect><circle cx="8" cy="12" r="3"></circle></symbol><symbol id="toggle-right" viewBox="0 0 24 24"><rect x="1" y="5" width="22" height="14" rx="7" ry="7"></rect><circle cx="16" cy="12" r="3"></circle></symbol><symbol id="tool" viewBox="0 0 24 24"><path d="M14.7 6.3a1 1 0 0 0 0 1.4l1.6 1.6a1 1 0 0 0 1.4 0l3.77-3.77a6 6 0 0 1-7.94 7.94l-6.91 6.91a2.12 2.12 0 0 1-3-3l6.91-6.91a6 6 0 0 1 7.94-7.94l-3.76 3.76z"></path></symbol><symbol id="trash-2" viewBox="0 0 24 24"><polyline points="3 6 5 6 21 6"></polyline><path d="M19 6v14a2 2 0 0 1-2 2H7a2 2 0 0 1-2-2V6m3 0V4a2 2 0 0 1 2-2h4a2 2 0 0 1 2 2v2"></path><line x1="10" y1="11" x2="10" y2="17"></line><line x1="14" y1="11" x2="14" y2="17"></line></symbol><symbol id="trash" viewBox="0 0 24 24"><polyline points="3 6 5 6 21 6"></polyline><path d="M19 6v14a2 2 0 0 1-2 2H7a2 2 0 0 1-2-2V6m3 0V4a2 2 0 0 1 2-2h4a2 2 0 0 1 2 2v2"></path></symbol><symbol id="trello" viewBox="0 0 24 24"><rect x="3" y="3" width="18" height="18" rx="2" ry="2"></rect><rect x="7" y="7" width="3" height="9"></rect><rect x="14" y="7" width="3" height="5"></rect></symbol><symbol id="trending-down" viewBox="0 0 24 24"><polyline points="23 18 13.5 8.5 8.5 13.5 1 6"></polyline><polyline points="17 18 23 18 23 12"></polyline></symbol><symbol id="trending-up" viewBox="0 0 24 24"><polyline points="23 6 13.5 15.5 8.5 10.5 1 18"></polyline><polyline points="17 6 23 6 23 12"></polyline></symbol><symbol id="triangle" viewBox="0 0 24 24"><path d="M10.29 3.86L1.82 18a2 2 0 0 0 1.71 3h16.94a2 2 0 0 0 1.71-3L13.71 3.86a2 2 0 0 0-3.42 0z"></path></symbol><symbol id="truck" viewBox="0 0 24 24"><rect x="1" y="3" width="15" height="13"></rect><polygon points="16 8 20 8 23 11 23 16 16 16 16 8"></polygon><circle cx="5.5" cy="18.5" r="2.5"></circle><circle cx="18.5" cy="18.5" r="2.5"></circle></symbol><symbol id="tv" viewBox="0 0 24 24"><rect x="2" y="7" width="20" height="15" rx="2" ry="2"></rect><polyline points="17 2 12 7 7 2"></polyline></symbol><symbol id="twitch" viewBox="0 0 24 24"><path d="M21 2H3v16h5v4l4-4h5l4-4V2zm-10 9V7m5 4V7"></path></symbol><symbol id="twitter" viewBox="0 0 24 24"><path d="M23 3a10.9 10.9 0 0 1-3.14 1.53 4.48 4.48 0 0 0-7.86 3v1A10.66 10.66 0 0 1 3 4s-4 9 5 13a11.64 11.64 0 0 1-7 2c9 5 20 0 20-11.5a4.5 4.5 0 0 0-.08-.83A7.72 7.72 0 0 0 23 3z"></path></symbol><symbol id="type" viewBox="0 0 24 24"><polyline points="4 7 4 4 20 4 20 7"></polyline><line x1="9" y1="20" x2="15" y2="20"></line><line x1="12" y1="4" x2="12" y2="20"></line></symbol><symbol id="umbrella" viewBox="0 0 24 24"><path d="M23 12a11.05 11.05 0 0 0-22 0zm-5 7a3 3 0 0 1-6 0v-7"></path></symbol><symbol id="underline" viewBox="0 0 24 24"><path d="M6 3v7a6 6 0 0 0 6 6 6 6 0 0 0 6-6V3"></path><line x1="4" y1="21" x2="20" y2="21"></line></symbol><symbol id="unlock" viewBox="0 0 24 24"><rect x="3" y="11" width="18" height="11" rx="2" ry="2"></rect><path d="M7 11V7a5 5 0 0 1 9.9-1"></path></symbol><symbol id="upload-cloud" viewBox="0 0 24 24"><polyline points="16 16 12 12 8 16"></polyline><line x1="12" y1="12" x2="12" y2="21"></line><path d="M20.39 18.39A5 5 0 0 0 18 9h-1.26A8 8 0 1 0 3 16.3"></path><polyline points="16 16 12 12 8 16"></polyline></symbol><symbol id="upload" viewBox="0 0 24 24"><path d="M21 15v4a2 2 0 0 1-2 2H5a2 2 0 0 1-2-2v-4"></path><polyline points="17 8 12 3 7 8"></polyline><line x1="12" y1="3" x2="12" y2="15"></line></symbol><symbol id="user-check" viewBox="0 0 24 24"><path d="M16 21v-2a4 4 0 0 0-4-4H5a4 4 0 0 0-4 4v2"></path><circle cx="8.5" cy="7" r="4"></circle><polyline points="17 11 19 13 23 9"></polyline></symbol><symbol id="user-minus" viewBox="0 0 24 24"><path d="M16 21v-2a4 4 0 0 0-4-4H5a4 4 0 0 0-4 4v2"></path><circle cx="8.5" cy="7" r="4"></circle><line x1="23" y1="11" x2="17" y2="11"></line></symbol><symbol id="user-plus" viewBox="0 0 24 24"><path d="M16 21v-2a4 4 0 0 0-4-4H5a4 4 0 0 0-4 4v2"></path><circle cx="8.5" cy="7" r="4"></circle><line x1="20" y1="8" x2="20" y2="14"></line><line x1="23" y1="11" x2="17" y2="11"></line></symbol><symbol id="user-x" viewBox="0 0 24 24"><path d="M16 21v-2a4 4 0 0 0-4-4H5a4 4 0 0 0-4 4v2"></path><circle cx="8.5" cy="7" r="4"></circle><line x1="18" y1="8" x2="23" y2="13"></line><line x1="23" y1="8" x2="18" y2="13"></line></symbol><symbol id="user" viewBox="0 0 24 24"><path d="M20 21v-2a4 4 0 0 0-4-4H8a4 4 0 0 0-4 4v2"></path><circle cx="12" cy="7" r="4"></circle></symbol><symbol id="users" viewBox="0 0 24 24"><path d="M17 21v-2a4 4 0 0 0-4-4H5a4 4 0 0 0-4 4v2"></path><circle cx="9" cy="7" r="4"></circle><path d="M23 21v-2a4 4 0 0 0-3-3.87"></path><path d="M16 3.13a4 4 0 0 1 0 7.75"></path></symbol><symbol id="video-off" viewBox="0 0 24 24"><path d="M16 16v1a2 2 0 0 1-2 2H3a2 2 0 0 1-2-2V7a2 2 0 0 1 2-2h2m5.66 0H14a2 2 0 0 1 2 2v3.34l1 1L23 7v10"></path><line x1="1" y1="1" x2="23" y2="23"></line></symbol><symbol id="video" viewBox="0 0 24 24"><polygon points="23 7 16 12 23 17 23 7"></polygon><rect x="1" y="5" width="15" height="14" rx="2" ry="2"></rect></symbol><symbol id="voicemail" viewBox="0 0 24 24"><circle cx="5.5" cy="11.5" r="4.5"></circle><circle cx="18.5" cy="11.5" r="4.5"></circle><line x1="5.5" y1="16" x2="18.5" y2="16"></line></symbol><symbol id="volume-1" viewBox="0 0 24 24"><polygon points="11 5 6 9 2 9 2 15 6 15 11 19 11 5"></polygon><path d="M15.54 8.46a5 5 0 0 1 0 7.07"></path></symbol><symbol id="volume-2" viewBox="0 0 24 24"><polygon points="11 5 6 9 2 9 2 15 6 15 11 19 11 5"></polygon><path d="M19.07 4.93a10 10 0 0 1 0 14.14M15.54 8.46a5 5 0 0 1 0 7.07"></path></symbol><symbol id="volume-x" viewBox="0 0 24 24"><polygon points="11 5 6 9 2 9 2 15 6 15 11 19 11 5"></polygon><line x1="23" y1="9" x2="17" y2="15"></line><line x1="17" y1="9" x2="23" y2="15"></line></symbol><symbol id="volume" viewBox="0 0 24 24"><polygon points="11 5 6 9 2 9 2 15 6 15 11 19 11 5"></polygon></symbol><symbol id="watch" viewBox="0 0 24 24"><circle cx="12" cy="12" r="7"></circle><polyline points="12 9 12 12 13.5 13.5"></polyline><path d="M16.51 17.35l-.35 3.83a2 2 0 0 1-2 1.82H9.83a2 2 0 0 1-2-1.82l-.35-3.83m.01-10.7l.35-3.83A2 2 0 0 1 9.83 1h4.35a2 2 0 0 1 2 1.82l.35 3.83"></path></symbol><symbol id="wifi-off" viewBox="0 0 24 24"><line x1="1" y1="1" x2="23" y2="23"></line><path d="M16.72 11.06A10.94 10.94 0 0 1 19 12.55"></path><path d="M5 12.55a10.94 10.94 0 0 1 5.17-2.39"></path><path d="M10.71 5.05A16 16 0 0 1 22.58 9"></path><path d="M1.42 9a15.91 15.91 0 0 1 4.7-2.88"></path><path d="M8.53 16.11a6 6 0 0 1 6.95 0"></path><line x1="12" y1="20" x2="12.01" y2="20"></line></symbol><symbol id="wifi" viewBox="0 0 24 24"><path d="M5 12.55a11 11 0 0 1 14.08 0"></path><path d="M1.42 9a16 16 0 0 1 21.16 0"></path><path d="M8.53 16.11a6 6 0 0 1 6.95 0"></path><line x1="12" y1="20" x2="12.01" y2="20"></line></symbol><symbol id="wind" viewBox="0 0 24 24"><path d="M9.59 4.59A2 2 0 1 1 11 8H2m10.59 11.41A2 2 0 1 0 14 16H2m15.73-8.27A2.5 2.5 0 1 1 19.5 12H2"></path></symbol><symbol id="x-circle" viewBox="0 0 24 24"><circle cx="12" cy="12" r="10"></circle><line x1="15" y1="9" x2="9" y2="15"></line><line x1="9" y1="9" x2="15" y2="15"></line></symbol><symbol id="x-octagon" viewBox="0 0 24 24"><polygon points="7.86 2 16.14 2 22 7.86 22 16.14 16.14 22 7.86 22 2 16.14 2 7.86 7.86 2"></polygon><line x1="15" y1="9" x2="9" y2="15"></line><line x1="9" y1="9" x2="15" y2="15"></line></symbol><symbol id="x-square" viewBox="0 0 24 24"><rect x="3" y="3" width="18" height="18" rx="2" ry="2"></rect><line x1="9" y1="9" x2="15" y2="15"></line><line x1="15" y1="9" x2="9" y2="15"></line></symbol><symbol id="x" viewBox="0 0 24 24"><line x1="18" y1="6" x2="6" y2="18"></line><line x1="6" y1="6" x2="18" y2="18"></line></symbol><symbol id="youtube" viewBox="0 0 24 24"><path d="M22.54 6.42a2.78 2.78 0 0 0-1.94-2C18.88 4 12 4 12 4s-6.88 0-8.6.46a2.78 2.78 0 0 0-1.94 2A29 29 0 0 0 1 11.75a29 29 0 0 0 .46 5.33A2.78 2.78 0 0 0 3.4 19c1.72.46 8.6.46 8.6.46s6.88 0 8.6-.46a2.78 2.78 0 0 0 1.94-2 29 29 0 0 0 .46-5.25 29 29 0 0 0-.46-5.33z"></path><polygon points="9.75 15.02 15.5 11.75 9.75 8.48 9.75 15.02"></polygon></symbol><symbol id="zap-off" viewBox="0 0 24 24"><polyline points="12.41 6.75 13 2 10.57 4.92"></polyline><polyline points="18.57 12.91 21 10 15.66 10"></polyline><polyline points="8 8 3 14 12 14 11 22 16 16"></polyline><line x1="1" y1="1" x2="23" y2="23"></line></symbol><symbol id="zap" viewBox="0 0 24 24"><polygon points="13 2 3 14 12 14 11 22 21 10 12 10 13 2"></polygon></symbol><symbol id="zoom-in" viewBox="0 0 24 24"><circle cx="11" cy="11" r="8"></circle><line x1="21" y1="21" x2="16.65" y2="16.65"></line><line x1="11" y1="8" x2="11" y2="14"></line><line x1="8" y1="11" x2="14" y2="11"></line></symbol><symbol id="zoom-out" viewBox="0 0 24 24"><circle cx="11" cy="11" r="8"></circle><line x1="21" y1="21" x2="16.65" y2="16.65"></line><line x1="8" y1="11" x2="14" y2="11"></line></symbol></defs></svg>
\ No newline at end of file
diff --git a/src/dep/jscolor.min.js b/src/dep/jscolor.min.js
new file mode 100644
index 0000000..8bb82f9
--- /dev/null
+++ b/src/dep/jscolor.min.js
@@ -0,0 +1,6 @@
+/**
+ * JSColor v2.4.6
+ * @licence GNU GLP v3
+ * @source https://jscolor.com/
+ */
+(function (global, factory) { "use strict"; if (typeof module === "object" && typeof module.exports === "object") { module.exports = global.document ? factory(global) : function (win) { if (!win.document) { throw new Error("jscolor needs a window with document") } return factory(win) }; return } factory(global) })(typeof window !== "undefined" ? window : this, function (window) { "use strict"; var jscolor = function () { var jsc = { initialized: false, instances: [], readyQueue: [], register: function () { if (typeof window !== "undefined" && window.document) { window.document.addEventListener("DOMContentLoaded", jsc.pub.init, false) } }, installBySelector: function (selector, rootNode) { rootNode = rootNode ? jsc.node(rootNode) : window.document; if (!rootNode) { throw new Error("Missing root node") } var elms = rootNode.querySelectorAll(selector); var matchClass = new RegExp("(^|\\s)(" + jsc.pub.lookupClass + ")(\\s*(\\{[^}]*\\})|\\s|$)", "i"); for (var i = 0; i < elms.length; i += 1){ if (elms[i].jscolor && elms[i].jscolor instanceof jsc.pub) { continue } if (elms[i].type !== undefined && elms[i].type.toLowerCase() == "color" && jsc.isColorAttrSupported) { continue } var dataOpts, m; if ((dataOpts = jsc.getDataAttr(elms[i], "jscolor")) !== null || elms[i].className && (m = elms[i].className.match(matchClass))) { var targetElm = elms[i]; var optsStr = ""; if (dataOpts !== null) { optsStr = dataOpts } else if (m) { console.warn('Installation using class name is DEPRECATED. Use data-jscolor="" attribute instead.' + jsc.docsRef); if (m[4]) { optsStr = m[4] } } var opts = null; if (optsStr.trim()) { try { opts = jsc.parseOptionsStr(optsStr) } catch (e) { console.warn(e + "\n" + optsStr) } } try { new jsc.pub(targetElm, opts) } catch (e) { console.warn(e) } } } }, parseOptionsStr: function (str) { var opts = null; try { opts = JSON.parse(str) } catch (eParse) { if (!jsc.pub.looseJSON) { throw new Error("Could not parse jscolor options as JSON: " + eParse) } else { try { opts = new Function("var opts = (" + str + '); return typeof opts === "object" ? opts : {};')() } catch (eEval) { throw new Error("Could not evaluate jscolor options: " + eEval) } } } return opts }, getInstances: function () { var inst = []; for (var i = 0; i < jsc.instances.length; i += 1){ if (jsc.instances[i] && jsc.instances[i].targetElement) { inst.push(jsc.instances[i]) } } return inst }, createEl: function (tagName) { var el = window.document.createElement(tagName); jsc.setData(el, "gui", true); return el }, node: function (nodeOrSelector) { if (!nodeOrSelector) { return null } if (typeof nodeOrSelector === "string") { var sel = nodeOrSelector; var el = null; try { el = window.document.querySelector(sel) } catch (e) { console.warn(e); return null } if (!el) { console.warn("No element matches the selector: %s", sel) } return el } if (jsc.isNode(nodeOrSelector)) { return nodeOrSelector } console.warn("Invalid node of type %s: %s", typeof nodeOrSelector, nodeOrSelector); return null }, isNode: function (val) { if (typeof Node === "object") { return val instanceof Node } return val && typeof val === "object" && typeof val.nodeType === "number" && typeof val.nodeName === "string" }, nodeName: function (node) { if (node && node.nodeName) { return node.nodeName.toLowerCase() } return false }, removeChildren: function (node) { while (node.firstChild) { node.removeChild(node.firstChild) } }, isTextInput: function (el) { return el && jsc.nodeName(el) === "input" && el.type.toLowerCase() === "text" }, isButton: function (el) { if (!el) { return false } var n = jsc.nodeName(el); return n === "button" || n === "input" && ["button", "submit", "reset"].indexOf(el.type.toLowerCase()) > -1 }, isButtonEmpty: function (el) { switch (jsc.nodeName(el)) { case "input": return !el.value || el.value.trim() === ""; case "button": return el.textContent.trim() === "" }return null }, isPassiveEventSupported: function () { var supported = false; try { var opts = Object.defineProperty({}, "passive", { get: function () { supported = true } }); window.addEventListener("testPassive", null, opts); window.removeEventListener("testPassive", null, opts) } catch (e) { } return supported }(), isColorAttrSupported: function () { var elm = window.document.createElement("input"); if (elm.setAttribute) { elm.setAttribute("type", "color"); if (elm.type.toLowerCase() == "color") { return true } } return false }(), dataProp: "_data_jscolor", setData: function () { var obj = arguments[0]; if (arguments.length === 3) { var data = obj.hasOwnProperty(jsc.dataProp) ? obj[jsc.dataProp] : obj[jsc.dataProp] = {}; var prop = arguments[1]; var value = arguments[2]; data[prop] = value; return true } else if (arguments.length === 2 && typeof arguments[1] === "object") { var data = obj.hasOwnProperty(jsc.dataProp) ? obj[jsc.dataProp] : obj[jsc.dataProp] = {}; var map = arguments[1]; for (var prop in map) { if (map.hasOwnProperty(prop)) { data[prop] = map[prop] } } return true } throw new Error("Invalid arguments") }, removeData: function () { var obj = arguments[0]; if (!obj.hasOwnProperty(jsc.dataProp)) { return true } for (var i = 1; i < arguments.length; i += 1){ var prop = arguments[i]; delete obj[jsc.dataProp][prop] } return true }, getData: function (obj, prop, setDefault) { if (!obj.hasOwnProperty(jsc.dataProp)) { if (setDefault !== undefined) { obj[jsc.dataProp] = {} } else { return undefined } } var data = obj[jsc.dataProp]; if (!data.hasOwnProperty(prop) && setDefault !== undefined) { data[prop] = setDefault } return data[prop] }, getDataAttr: function (el, name) { var attrName = "data-" + name; var attrValue = el.getAttribute(attrName); return attrValue }, setDataAttr: function (el, name, value) { var attrName = "data-" + name; el.setAttribute(attrName, value) }, _attachedGroupEvents: {}, attachGroupEvent: function (groupName, el, evnt, func) { if (!jsc._attachedGroupEvents.hasOwnProperty(groupName)) { jsc._attachedGroupEvents[groupName] = [] } jsc._attachedGroupEvents[groupName].push([el, evnt, func]); el.addEventListener(evnt, func, false) }, detachGroupEvents: function (groupName) { if (jsc._attachedGroupEvents.hasOwnProperty(groupName)) { for (var i = 0; i < jsc._attachedGroupEvents[groupName].length; i += 1){ var evt = jsc._attachedGroupEvents[groupName][i]; evt[0].removeEventListener(evt[1], evt[2], false) } delete jsc._attachedGroupEvents[groupName] } }, preventDefault: function (e) { if (e.preventDefault) { e.preventDefault() } e.returnValue = false }, captureTarget: function (target) { if (target.setCapture) { jsc._capturedTarget = target; jsc._capturedTarget.setCapture() } }, releaseTarget: function () { if (jsc._capturedTarget) { jsc._capturedTarget.releaseCapture(); jsc._capturedTarget = null } }, triggerEvent: function (el, eventName, bubbles, cancelable) { if (!el) { return } var ev = null; if (typeof Event === "function") { ev = new Event(eventName, { bubbles: bubbles, cancelable: cancelable }) } else { ev = window.document.createEvent("Event"); ev.initEvent(eventName, bubbles, cancelable) } if (!ev) { return false } jsc.setData(ev, "internal", true); el.dispatchEvent(ev); return true }, triggerInputEvent: function (el, eventName, bubbles, cancelable) { if (!el) { return } if (jsc.isTextInput(el)) { jsc.triggerEvent(el, eventName, bubbles, cancelable) } }, eventKey: function (ev) { var keys = { 9: "Tab", 13: "Enter", 27: "Escape" }; if (typeof ev.code === "string") { return ev.code } else if (ev.keyCode !== undefined && keys.hasOwnProperty(ev.keyCode)) { return keys[ev.keyCode] } return null }, strList: function (str) { if (!str) { return [] } return str.replace(/^\s+|\s+$/g, "").split(/\s+/) }, hasClass: function (elm, className) { if (!className) { return false } if (elm.classList !== undefined) { return elm.classList.contains(className) } return -1 != (" " + elm.className.replace(/\s+/g, " ") + " ").indexOf(" " + className + " ") }, addClass: function (elm, className) { var classNames = jsc.strList(className); if (elm.classList !== undefined) { for (var i = 0; i < classNames.length; i += 1){ elm.classList.add(classNames[i]) } return } for (var i = 0; i < classNames.length; i += 1){ if (!jsc.hasClass(elm, classNames[i])) { elm.className += (elm.className ? " " : "") + classNames[i] } } }, removeClass: function (elm, className) { var classNames = jsc.strList(className); if (elm.classList !== undefined) { for (var i = 0; i < classNames.length; i += 1){ elm.classList.remove(classNames[i]) } return } for (var i = 0; i < classNames.length; i += 1){ var repl = new RegExp("^\\s*" + classNames[i] + "\\s*|" + "\\s*" + classNames[i] + "\\s*$|" + "\\s+" + classNames[i] + "(\\s+)", "g"); elm.className = elm.className.replace(repl, "$1") } }, getCompStyle: function (elm) { var compStyle = window.getComputedStyle ? window.getComputedStyle(elm) : elm.currentStyle; if (!compStyle) { return {} } return compStyle }, setStyle: function (elm, styles, important, reversible) { var priority = important ? "important" : ""; var origStyle = null; for (var prop in styles) { if (styles.hasOwnProperty(prop)) { var setVal = null; if (styles[prop] === null) { if (!origStyle) { origStyle = jsc.getData(elm, "origStyle") } if (origStyle && origStyle.hasOwnProperty(prop)) { setVal = origStyle[prop] } } else { if (reversible) { if (!origStyle) { origStyle = jsc.getData(elm, "origStyle", {}) } if (!origStyle.hasOwnProperty(prop)) { origStyle[prop] = elm.style[prop] } } setVal = styles[prop] } if (setVal !== null) { elm.style.setProperty(prop, setVal, priority) } } } }, hexColor: function (r, g, b) { return "#" + (("0" + Math.round(r).toString(16)).substr(-2) + ("0" + Math.round(g).toString(16)).substr(-2) + ("0" + Math.round(b).toString(16)).substr(-2)).toUpperCase() }, hexaColor: function (r, g, b, a) { return "#" + (("0" + Math.round(r).toString(16)).substr(-2) + ("0" + Math.round(g).toString(16)).substr(-2) + ("0" + Math.round(b).toString(16)).substr(-2) + ("0" + Math.round(a * 255).toString(16)).substr(-2)).toUpperCase() }, rgbColor: function (r, g, b) { return "rgb(" + Math.round(r) + "," + Math.round(g) + "," + Math.round(b) + ")" }, rgbaColor: function (r, g, b, a) { return "rgba(" + Math.round(r) + "," + Math.round(g) + "," + Math.round(b) + "," + Math.round((a === undefined || a === null ? 1 : a) * 100) / 100 + ")" }, linearGradient: function () { function getFuncName() { var stdName = "linear-gradient"; var prefixes = ["", "-webkit-", "-moz-", "-o-", "-ms-"]; var helper = window.document.createElement("div"); for (var i = 0; i < prefixes.length; i += 1){ var tryFunc = prefixes[i] + stdName; var tryVal = tryFunc + "(to right, rgba(0,0,0,0), rgba(0,0,0,0))"; helper.style.background = tryVal; if (helper.style.background) { return tryFunc } } return stdName } var funcName = getFuncName(); return function () { return funcName + "(" + Array.prototype.join.call(arguments, ", ") + ")" } }(), setBorderRadius: function (elm, value) { jsc.setStyle(elm, { "border-radius": value || "0" }) }, setBoxShadow: function (elm, value) { jsc.setStyle(elm, { "box-shadow": value || "none" }) }, getElementPos: function (e, relativeToViewport) { var x = 0, y = 0; var rect = e.getBoundingClientRect(); x = rect.left; y = rect.top; if (!relativeToViewport) { var viewPos = jsc.getViewPos(); x += viewPos[0]; y += viewPos[1] } return [x, y] }, getElementSize: function (e) { return [e.offsetWidth, e.offsetHeight] }, getAbsPointerPos: function (e) { var x = 0, y = 0; if (typeof e.changedTouches !== "undefined" && e.changedTouches.length) { x = e.changedTouches[0].clientX; y = e.changedTouches[0].clientY } else if (typeof e.clientX === "number") { x = e.clientX; y = e.clientY } return { x: x, y: y } }, getRelPointerPos: function (e) { var target = e.target || e.srcElement; var targetRect = target.getBoundingClientRect(); var x = 0, y = 0; var clientX = 0, clientY = 0; if (typeof e.changedTouches !== "undefined" && e.changedTouches.length) { clientX = e.changedTouches[0].clientX; clientY = e.changedTouches[0].clientY } else if (typeof e.clientX === "number") { clientX = e.clientX; clientY = e.clientY } x = clientX - targetRect.left; y = clientY - targetRect.top; return { x: x, y: y } }, getViewPos: function () { var doc = window.document.documentElement; return [(window.pageXOffset || doc.scrollLeft) - (doc.clientLeft || 0), (window.pageYOffset || doc.scrollTop) - (doc.clientTop || 0)] }, getViewSize: function () { var doc = window.document.documentElement; return [window.innerWidth || doc.clientWidth, window.innerHeight || doc.clientHeight] }, RGB_HSV: function (r, g, b) { r /= 255; g /= 255; b /= 255; var n = Math.min(Math.min(r, g), b); var v = Math.max(Math.max(r, g), b); var m = v - n; if (m === 0) { return [null, 0, 100 * v] } var h = r === n ? 3 + (b - g) / m : g === n ? 5 + (r - b) / m : 1 + (g - r) / m; return [60 * (h === 6 ? 0 : h), 100 * (m / v), 100 * v] }, HSV_RGB: function (h, s, v) { var u = 255 * (v / 100); if (h === null) { return [u, u, u] } h /= 60; s /= 100; var i = Math.floor(h); var f = i % 2 ? h - i : 1 - (h - i); var m = u * (1 - s); var n = u * (1 - s * f); switch (i) { case 6: case 0: return [u, n, m]; case 1: return [n, u, m]; case 2: return [m, u, n]; case 3: return [m, n, u]; case 4: return [n, m, u]; case 5: return [u, m, n] } }, parseColorString: function (str) { var ret = { rgba: null, format: null }; var m; if (m = str.match(/^\W*([0-9A-F]{3,8})\W*$/i)) { if (m[1].length === 8) { ret.format = "hexa"; ret.rgba = [parseInt(m[1].substr(0, 2), 16), parseInt(m[1].substr(2, 2), 16), parseInt(m[1].substr(4, 2), 16), parseInt(m[1].substr(6, 2), 16) / 255] } else if (m[1].length === 6) { ret.format = "hex"; ret.rgba = [parseInt(m[1].substr(0, 2), 16), parseInt(m[1].substr(2, 2), 16), parseInt(m[1].substr(4, 2), 16), null] } else if (m[1].length === 3) { ret.format = "hex"; ret.rgba = [parseInt(m[1].charAt(0) + m[1].charAt(0), 16), parseInt(m[1].charAt(1) + m[1].charAt(1), 16), parseInt(m[1].charAt(2) + m[1].charAt(2), 16), null] } else { return false } return ret } if (m = str.match(/^\W*rgba?\(([^)]*)\)\W*$/i)) { var par = m[1].split(","); var re = /^\s*(\d+|\d*\.\d+|\d+\.\d*)\s*$/; var mR, mG, mB, mA; if (par.length >= 3 && (mR = par[0].match(re)) && (mG = par[1].match(re)) && (mB = par[2].match(re))) { ret.format = "rgb"; ret.rgba = [parseFloat(mR[1]) || 0, parseFloat(mG[1]) || 0, parseFloat(mB[1]) || 0, null]; if (par.length >= 4 && (mA = par[3].match(re))) { ret.format = "rgba"; ret.rgba[3] = parseFloat(mA[1]) || 0 } return ret } } return false }, parsePaletteValue: function (mixed) { var vals = []; if (typeof mixed === "string") { mixed.replace(/#[0-9A-F]{3}([0-9A-F]{3})?|rgba?\(([^)]*)\)/gi, function (val) { vals.push(val) }) } else if (Array.isArray(mixed)) { vals = mixed } var colors = []; for (var i = 0; i < vals.length; i++){ var color = jsc.parseColorString(vals[i]); if (color) { colors.push(color) } } return colors }, containsTranparentColor: function (colors) { for (var i = 0; i < colors.length; i++){ var a = colors[i].rgba[3]; if (a !== null && a < 1) { return true } } return false }, isAlphaFormat: function (format) { switch (format.toLowerCase()) { case "hexa": case "rgba": return true }return false }, scaleCanvasForHighDPR: function (canvas) { var dpr = window.devicePixelRatio || 1; canvas.width *= dpr; canvas.height *= dpr; var ctx = canvas.getContext("2d"); ctx.scale(dpr, dpr) }, genColorPreviewCanvas: function (color, separatorPos, specWidth, scaleForHighDPR) { var sepW = Math.round(jsc.pub.previewSeparator.length); var sqSize = jsc.pub.chessboardSize; var sqColor1 = jsc.pub.chessboardColor1; var sqColor2 = jsc.pub.chessboardColor2; var cWidth = specWidth ? specWidth : sqSize * 2; var cHeight = sqSize * 2; var canvas = jsc.createEl("canvas"); var ctx = canvas.getContext("2d"); canvas.width = cWidth; canvas.height = cHeight; if (scaleForHighDPR) { jsc.scaleCanvasForHighDPR(canvas) } ctx.fillStyle = sqColor1; ctx.fillRect(0, 0, cWidth, cHeight); ctx.fillStyle = sqColor2; for (var x = 0; x < cWidth; x += sqSize * 2){ ctx.fillRect(x, 0, sqSize, sqSize); ctx.fillRect(x + sqSize, sqSize, sqSize, sqSize) } if (color) { ctx.fillStyle = color; ctx.fillRect(0, 0, cWidth, cHeight) } var start = null; switch (separatorPos) { case "left": start = 0; ctx.clearRect(0, 0, sepW / 2, cHeight); break; case "right": start = cWidth - sepW; ctx.clearRect(cWidth - sepW / 2, 0, sepW / 2, cHeight); break }if (start !== null) { ctx.lineWidth = 1; for (var i = 0; i < jsc.pub.previewSeparator.length; i += 1){ ctx.beginPath(); ctx.strokeStyle = jsc.pub.previewSeparator[i]; ctx.moveTo(.5 + start + i, 0); ctx.lineTo(.5 + start + i, cHeight); ctx.stroke() } } return { canvas: canvas, width: cWidth, height: cHeight } }, genColorPreviewGradient: function (color, position, width) { var params = []; if (position && width) { params = ["to " + { left: "right", right: "left" }[position], color + " 0%", color + " " + width + "px", "rgba(0,0,0,0) " + (width + 1) + "px", "rgba(0,0,0,0) 100%"] } else { params = ["to right", color + " 0%", color + " 100%"] } return jsc.linearGradient.apply(this, params) }, redrawPosition: function () { if (!jsc.picker || !jsc.picker.owner) { return } var thisObj = jsc.picker.owner; var tp, vp; if (thisObj.fixed) { tp = jsc.getElementPos(thisObj.targetElement, true); vp = [0, 0] } else { tp = jsc.getElementPos(thisObj.targetElement); vp = jsc.getViewPos() } var ts = jsc.getElementSize(thisObj.targetElement); var vs = jsc.getViewSize(); var pd = jsc.getPickerDims(thisObj); var ps = [pd.borderW, pd.borderH]; var a, b, c; switch (thisObj.position.toLowerCase()) { case "left": a = 1; b = 0; c = -1; break; case "right": a = 1; b = 0; c = 1; break; case "top": a = 0; b = 1; c = -1; break; default: a = 0; b = 1; c = 1; break }var l = (ts[b] + ps[b]) / 2; if (!thisObj.smartPosition) { var pp = [tp[a], tp[b] + ts[b] - l + l * c] } else { var pp = [-vp[a] + tp[a] + ps[a] > vs[a] ? -vp[a] + tp[a] + ts[a] / 2 > vs[a] / 2 && tp[a] + ts[a] - ps[a] >= 0 ? tp[a] + ts[a] - ps[a] : tp[a] : tp[a], -vp[b] + tp[b] + ts[b] + ps[b] - l + l * c > vs[b] ? -vp[b] + tp[b] + ts[b] / 2 > vs[b] / 2 && tp[b] + ts[b] - l - l * c >= 0 ? tp[b] + ts[b] - l - l * c : tp[b] + ts[b] - l + l * c : tp[b] + ts[b] - l + l * c >= 0 ? tp[b] + ts[b] - l + l * c : tp[b] + ts[b] - l - l * c] } var x = pp[a]; var y = pp[b]; var positionValue = thisObj.fixed ? "fixed" : "absolute"; var contractShadow = (pp[0] + ps[0] > tp[0] || pp[0] < tp[0] + ts[0]) && pp[1] + ps[1] < tp[1] + ts[1]; jsc._drawPosition(thisObj, x, y, positionValue, contractShadow) }, _drawPosition: function (thisObj, x, y, positionValue, contractShadow) { var vShadow = contractShadow ? 0 : thisObj.shadowBlur; jsc.picker.wrap.style.position = positionValue; jsc.picker.wrap.style.left = x + "px"; jsc.picker.wrap.style.top = y + "px"; jsc.setBoxShadow(jsc.picker.boxS, thisObj.shadow ? new jsc.BoxShadow(0, vShadow, thisObj.shadowBlur, 0, thisObj.shadowColor) : null) }, getPickerDims: function (thisObj) { var w = 2 * thisObj.controlBorderWidth + thisObj.width; var h = 2 * thisObj.controlBorderWidth + thisObj.height; var sliderSpace = 2 * thisObj.controlBorderWidth + 2 * jsc.getControlPadding(thisObj) + thisObj.sliderSize; if (jsc.getSliderChannel(thisObj)) { w += sliderSpace } if (thisObj.hasAlphaChannel()) { w += sliderSpace } var pal = jsc.getPaletteDims(thisObj, w); if (pal.height) { h += pal.height + thisObj.padding } if (thisObj.closeButton) { h += 2 * thisObj.controlBorderWidth + thisObj.padding + thisObj.buttonHeight } var pW = w + 2 * thisObj.padding; var pH = h + 2 * thisObj.padding; return { contentW: w, contentH: h, paddedW: pW, paddedH: pH, borderW: pW + 2 * thisObj.borderWidth, borderH: pH + 2 * thisObj.borderWidth, palette: pal } }, getPaletteDims: function (thisObj, width) { var cols = 0, rows = 0, cellW = 0, cellH = 0, height = 0; var sampleCount = thisObj._palette ? thisObj._palette.length : 0; if (sampleCount) { cols = thisObj.paletteCols; rows = cols > 0 ? Math.ceil(sampleCount / cols) : 0; cellW = Math.max(1, Math.floor((width - (cols - 1) * thisObj.paletteSpacing) / cols)); cellH = thisObj.paletteHeight ? Math.min(thisObj.paletteHeight, cellW) : cellW } if (rows) { height = rows * cellH + (rows - 1) * thisObj.paletteSpacing } return { cols: cols, rows: rows, cellW: cellW, cellH: cellH, width: width, height: height } }, getControlPadding: function (thisObj) { return Math.max(thisObj.padding / 2, 2 * thisObj.pointerBorderWidth + thisObj.pointerThickness - thisObj.controlBorderWidth) }, getPadYChannel: function (thisObj) { switch (thisObj.mode.charAt(1).toLowerCase()) { case "v": return "v"; break }return "s" }, getSliderChannel: function (thisObj) { if (thisObj.mode.length > 2) { switch (thisObj.mode.charAt(2).toLowerCase()) { case "s": return "s"; break; case "v": return "v"; break } } return null }, triggerCallback: function (thisObj, prop) { if (!thisObj[prop]) { return } var callback = null; if (typeof thisObj[prop] === "string") { try { callback = new Function(thisObj[prop]) } catch (e) { console.error(e) } } else { callback = thisObj[prop] } if (callback) { callback.call(thisObj) } }, triggerGlobal: function (eventNames) { var inst = jsc.getInstances(); for (var i = 0; i < inst.length; i += 1){ inst[i].trigger(eventNames) } }, _pointerMoveEvent: { mouse: "mousemove", touch: "touchmove" }, _pointerEndEvent: { mouse: "mouseup", touch: "touchend" }, _pointerOrigin: null, _capturedTarget: null, onDocumentKeyUp: function (e) { if (["Tab", "Escape"].indexOf(jsc.eventKey(e)) !== -1) { if (jsc.picker && jsc.picker.owner) { jsc.picker.owner.tryHide() } } }, onWindowResize: function (e) { jsc.redrawPosition() }, onWindowScroll: function (e) { jsc.redrawPosition() }, onParentScroll: function (e) { if (jsc.picker && jsc.picker.owner) { jsc.picker.owner.tryHide() } }, onDocumentMouseDown: function (e) { var target = e.target || e.srcElement; if (target.jscolor && target.jscolor instanceof jsc.pub) { if (target.jscolor.showOnClick && !target.disabled) { target.jscolor.show() } } else if (jsc.getData(target, "gui")) { var control = jsc.getData(target, "control"); if (control) { jsc.onControlPointerStart(e, target, jsc.getData(target, "control"), "mouse") } } else { if (jsc.picker && jsc.picker.owner) { jsc.picker.owner.tryHide() } } }, onPickerTouchStart: function (e) { var target = e.target || e.srcElement; if (jsc.getData(target, "control")) { jsc.onControlPointerStart(e, target, jsc.getData(target, "control"), "touch") } }, onControlPointerStart: function (e, target, controlName, pointerType) { var thisObj = jsc.getData(target, "instance"); jsc.preventDefault(e); jsc.captureTarget(target); var registerDragEvents = function (doc, offset) { jsc.attachGroupEvent("drag", doc, jsc._pointerMoveEvent[pointerType], jsc.onDocumentPointerMove(e, target, controlName, pointerType, offset)); jsc.attachGroupEvent("drag", doc, jsc._pointerEndEvent[pointerType], jsc.onDocumentPointerEnd(e, target, controlName, pointerType)) }; registerDragEvents(window.document, [0, 0]); if (window.parent && window.frameElement) { var rect = window.frameElement.getBoundingClientRect(); var ofs = [-rect.left, -rect.top]; registerDragEvents(window.parent.window.document, ofs) } var abs = jsc.getAbsPointerPos(e); var rel = jsc.getRelPointerPos(e); jsc._pointerOrigin = { x: abs.x - rel.x, y: abs.y - rel.y }; switch (controlName) { case "pad": if (jsc.getSliderChannel(thisObj) === "v" && thisObj.channels.v === 0) { thisObj.fromHSVA(null, null, 100, null) } jsc.setPad(thisObj, e, 0, 0); break; case "sld": jsc.setSld(thisObj, e, 0); break; case "asld": jsc.setASld(thisObj, e, 0); break }thisObj.trigger("input") }, onDocumentPointerMove: function (e, target, controlName, pointerType, offset) { return function (e) { var thisObj = jsc.getData(target, "instance"); switch (controlName) { case "pad": jsc.setPad(thisObj, e, offset[0], offset[1]); break; case "sld": jsc.setSld(thisObj, e, offset[1]); break; case "asld": jsc.setASld(thisObj, e, offset[1]); break }thisObj.trigger("input") } }, onDocumentPointerEnd: function (e, target, controlName, pointerType) { return function (e) { var thisObj = jsc.getData(target, "instance"); jsc.detachGroupEvents("drag"); jsc.releaseTarget(); thisObj.trigger("input"); thisObj.trigger("change") } }, onPaletteSampleClick: function (e) { var target = e.currentTarget; var thisObj = jsc.getData(target, "instance"); var color = jsc.getData(target, "color"); if (thisObj.format.toLowerCase() === "any") { thisObj._setFormat(color.format); if (!jsc.isAlphaFormat(thisObj.getFormat())) { color.rgba[3] = 1 } } if (color.rgba[3] === null) { if (thisObj.paletteSetsAlpha === true || thisObj.paletteSetsAlpha === "auto" && thisObj._paletteHasTransparency) { color.rgba[3] = 1 } } thisObj.fromRGBA.apply(thisObj, color.rgba); thisObj.trigger("input"); thisObj.trigger("change"); if (thisObj.hideOnPaletteClick) { thisObj.hide() } }, setPad: function (thisObj, e, ofsX, ofsY) { var pointerAbs = jsc.getAbsPointerPos(e); var x = ofsX + pointerAbs.x - jsc._pointerOrigin.x - thisObj.padding - thisObj.controlBorderWidth; var y = ofsY + pointerAbs.y - jsc._pointerOrigin.y - thisObj.padding - thisObj.controlBorderWidth; var xVal = x * (360 / (thisObj.width - 1)); var yVal = 100 - y * (100 / (thisObj.height - 1)); switch (jsc.getPadYChannel(thisObj)) { case "s": thisObj.fromHSVA(xVal, yVal, null, null); break; case "v": thisObj.fromHSVA(xVal, null, yVal, null); break } }, setSld: function (thisObj, e, ofsY) { var pointerAbs = jsc.getAbsPointerPos(e); var y = ofsY + pointerAbs.y - jsc._pointerOrigin.y - thisObj.padding - thisObj.controlBorderWidth; var yVal = 100 - y * (100 / (thisObj.height - 1)); switch (jsc.getSliderChannel(thisObj)) { case "s": thisObj.fromHSVA(null, yVal, null, null); break; case "v": thisObj.fromHSVA(null, null, yVal, null); break } }, setASld: function (thisObj, e, ofsY) { var pointerAbs = jsc.getAbsPointerPos(e); var y = ofsY + pointerAbs.y - jsc._pointerOrigin.y - thisObj.padding - thisObj.controlBorderWidth; var yVal = 1 - y * (1 / (thisObj.height - 1)); if (yVal < 1) { var fmt = thisObj.getFormat(); if (thisObj.format.toLowerCase() === "any" && !jsc.isAlphaFormat(fmt)) { thisObj._setFormat(fmt === "hex" ? "hexa" : "rgba") } } thisObj.fromHSVA(null, null, null, yVal) }, createPadCanvas: function () { var ret = { elm: null, draw: null }; var canvas = jsc.createEl("canvas"); var ctx = canvas.getContext("2d"); var drawFunc = function (width, height, type) { canvas.width = width; canvas.height = height; ctx.clearRect(0, 0, canvas.width, canvas.height); var hGrad = ctx.createLinearGradient(0, 0, canvas.width, 0); hGrad.addColorStop(0 / 6, "#F00"); hGrad.addColorStop(1 / 6, "#FF0"); hGrad.addColorStop(2 / 6, "#0F0"); hGrad.addColorStop(3 / 6, "#0FF"); hGrad.addColorStop(4 / 6, "#00F"); hGrad.addColorStop(5 / 6, "#F0F"); hGrad.addColorStop(6 / 6, "#F00"); ctx.fillStyle = hGrad; ctx.fillRect(0, 0, canvas.width, canvas.height); var vGrad = ctx.createLinearGradient(0, 0, 0, canvas.height); switch (type.toLowerCase()) { case "s": vGrad.addColorStop(0, "rgba(255,255,255,0)"); vGrad.addColorStop(1, "rgba(255,255,255,1)"); break; case "v": vGrad.addColorStop(0, "rgba(0,0,0,0)"); vGrad.addColorStop(1, "rgba(0,0,0,1)"); break }ctx.fillStyle = vGrad; ctx.fillRect(0, 0, canvas.width, canvas.height) }; ret.elm = canvas; ret.draw = drawFunc; return ret }, createSliderGradient: function () { var ret = { elm: null, draw: null }; var canvas = jsc.createEl("canvas"); var ctx = canvas.getContext("2d"); var drawFunc = function (width, height, color1, color2) { canvas.width = width; canvas.height = height; ctx.clearRect(0, 0, canvas.width, canvas.height); var grad = ctx.createLinearGradient(0, 0, 0, canvas.height); grad.addColorStop(0, color1); grad.addColorStop(1, color2); ctx.fillStyle = grad; ctx.fillRect(0, 0, canvas.width, canvas.height) }; ret.elm = canvas; ret.draw = drawFunc; return ret }, createASliderGradient: function () { var ret = { elm: null, draw: null }; var canvas = jsc.createEl("canvas"); var ctx = canvas.getContext("2d"); var drawFunc = function (width, height, color) { canvas.width = width; canvas.height = height; ctx.clearRect(0, 0, canvas.width, canvas.height); var sqSize = canvas.width / 2; var sqColor1 = jsc.pub.chessboardColor1; var sqColor2 = jsc.pub.chessboardColor2; ctx.fillStyle = sqColor1; ctx.fillRect(0, 0, canvas.width, canvas.height); if (sqSize > 0) { for (var y = 0; y < canvas.height; y += sqSize * 2){ ctx.fillStyle = sqColor2; ctx.fillRect(0, y, sqSize, sqSize); ctx.fillRect(sqSize, y + sqSize, sqSize, sqSize) } } var grad = ctx.createLinearGradient(0, 0, 0, canvas.height); grad.addColorStop(0, color); grad.addColorStop(1, "rgba(0,0,0,0)"); ctx.fillStyle = grad; ctx.fillRect(0, 0, canvas.width, canvas.height) }; ret.elm = canvas; ret.draw = drawFunc; return ret }, BoxShadow: function () { var BoxShadow = function (hShadow, vShadow, blur, spread, color, inset) { this.hShadow = hShadow; this.vShadow = vShadow; this.blur = blur; this.spread = spread; this.color = color; this.inset = !!inset }; BoxShadow.prototype.toString = function () { var vals = [Math.round(this.hShadow) + "px", Math.round(this.vShadow) + "px", Math.round(this.blur) + "px", Math.round(this.spread) + "px", this.color]; if (this.inset) { vals.push("inset") } return vals.join(" ") }; return BoxShadow }(), flags: { leaveValue: 1 << 0, leaveAlpha: 1 << 1, leavePreview: 1 << 2 }, enumOpts: { format: ["auto", "any", "hex", "hexa", "rgb", "rgba"], previewPosition: ["left", "right"], mode: ["hsv", "hvs", "hs", "hv"], position: ["left", "right", "top", "bottom"], alphaChannel: ["auto", true, false], paletteSetsAlpha: ["auto", true, false] }, deprecatedOpts: { styleElement: "previewElement", onFineChange: "onInput", overwriteImportant: "forceStyle", closable: "closeButton", insetWidth: "controlBorderWidth", insetColor: "controlBorderColor", refine: null }, docsRef: " " + "See https://jscolor.com/docs/", pub: function (targetElement, opts) { var THIS = this; if (!opts) { opts = {} } this.channels = { r: 255, g: 255, b: 255, h: 0, s: 0, v: 100, a: 1 }; this.format = "auto"; this.value = undefined; this.alpha = undefined; this.random = false; this.onChange = undefined; this.onInput = undefined; this.valueElement = undefined; this.alphaElement = undefined; this.previewElement = undefined; this.previewPosition = "left"; this.previewSize = 32; this.previewPadding = 8; this.required = true; this.hash = true; this.uppercase = true; this.forceStyle = true; this.width = 181; this.height = 101; this.mode = "HSV"; this.alphaChannel = "auto"; this.position = "bottom"; this.smartPosition = true; this.showOnClick = true; this.hideOnLeave = true; this.palette = []; this.paletteCols = 10; this.paletteSetsAlpha = "auto"; this.paletteHeight = 16; this.paletteSpacing = 4; this.hideOnPaletteClick = false; this.sliderSize = 16; this.crossSize = 8; this.closeButton = false; this.closeText = "Close"; this.buttonColor = "rgba(0,0,0,1)"; this.buttonHeight = 18; this.padding = 12; this.backgroundColor = "rgba(255,255,255,1)"; this.borderWidth = 1; this.borderColor = "rgba(187,187,187,1)"; this.borderRadius = 8; this.controlBorderWidth = 1; this.controlBorderColor = "rgba(187,187,187,1)"; this.shadow = true; this.shadowBlur = 15; this.shadowColor = "rgba(0,0,0,0.2)"; this.pointerColor = "rgba(76,76,76,1)"; this.pointerBorderWidth = 1; this.pointerBorderColor = "rgba(255,255,255,1)"; this.pointerThickness = 2; this.zIndex = 5e3; this.container = undefined; this.minS = 0; this.maxS = 100; this.minV = 0; this.maxV = 100; this.minA = 0; this.maxA = 1; this.option = function () { if (!arguments.length) { throw new Error("No option specified") } if (arguments.length === 1 && typeof arguments[0] === "string") { try { return getOption(arguments[0]) } catch (e) { console.warn(e) } return false } else if (arguments.length >= 2 && typeof arguments[0] === "string") { try { if (!setOption(arguments[0], arguments[1])) { return false } } catch (e) { console.warn(e); return false } this.redraw(); this.exposeColor(); return true } else if (arguments.length === 1 && typeof arguments[0] === "object") { var opts = arguments[0]; var success = true; for (var opt in opts) { if (opts.hasOwnProperty(opt)) { try { if (!setOption(opt, opts[opt])) { success = false } } catch (e) { console.warn(e); success = false } } } this.redraw(); this.exposeColor(); return success } throw new Error("Invalid arguments") }; this.channel = function (name, value) { if (typeof name !== "string") { throw new Error("Invalid value for channel name: " + name) } if (value === undefined) { if (!this.channels.hasOwnProperty(name.toLowerCase())) { console.warn("Getting unknown channel: " + name); return false } return this.channels[name.toLowerCase()] } else { var res = false; switch (name.toLowerCase()) { case "r": res = this.fromRGBA(value, null, null, null); break; case "g": res = this.fromRGBA(null, value, null, null); break; case "b": res = this.fromRGBA(null, null, value, null); break; case "h": res = this.fromHSVA(value, null, null, null); break; case "s": res = this.fromHSVA(null, value, null, null); break; case "v": res = this.fromHSVA(null, null, value, null); break; case "a": res = this.fromHSVA(null, null, null, value); break; default: console.warn("Setting unknown channel: " + name); return false }if (res) { this.redraw(); return true } } return false }; this.trigger = function (eventNames) { var evs = jsc.strList(eventNames); for (var i = 0; i < evs.length; i += 1){ var ev = evs[i].toLowerCase(); var callbackProp = null; switch (ev) { case "input": callbackProp = "onInput"; break; case "change": callbackProp = "onChange"; break }if (callbackProp) { jsc.triggerCallback(this, callbackProp) } jsc.triggerInputEvent(this.valueElement, ev, true, true) } }; this.fromHSVA = function (h, s, v, a, flags) { if (h === undefined) { h = null } if (s === undefined) { s = null } if (v === undefined) { v = null } if (a === undefined) { a = null } if (h !== null) { if (isNaN(h)) { return false } this.channels.h = Math.max(0, Math.min(360, h)) } if (s !== null) { if (isNaN(s)) { return false } this.channels.s = Math.max(0, Math.min(100, this.maxS, s), this.minS) } if (v !== null) { if (isNaN(v)) { return false } this.channels.v = Math.max(0, Math.min(100, this.maxV, v), this.minV) } if (a !== null) { if (isNaN(a)) { return false } this.channels.a = this.hasAlphaChannel() ? Math.max(0, Math.min(1, this.maxA, a), this.minA) : 1 } var rgb = jsc.HSV_RGB(this.channels.h, this.channels.s, this.channels.v); this.channels.r = rgb[0]; this.channels.g = rgb[1]; this.channels.b = rgb[2]; this.exposeColor(flags); return true }; this.fromRGBA = function (r, g, b, a, flags) { if (r === undefined) { r = null } if (g === undefined) { g = null } if (b === undefined) { b = null } if (a === undefined) { a = null } if (r !== null) { if (isNaN(r)) { return false } r = Math.max(0, Math.min(255, r)) } if (g !== null) { if (isNaN(g)) { return false } g = Math.max(0, Math.min(255, g)) } if (b !== null) { if (isNaN(b)) { return false } b = Math.max(0, Math.min(255, b)) } if (a !== null) { if (isNaN(a)) { return false } this.channels.a = this.hasAlphaChannel() ? Math.max(0, Math.min(1, this.maxA, a), this.minA) : 1 } var hsv = jsc.RGB_HSV(r === null ? this.channels.r : r, g === null ? this.channels.g : g, b === null ? this.channels.b : b); if (hsv[0] !== null) { this.channels.h = Math.max(0, Math.min(360, hsv[0])) } if (hsv[2] !== 0) { this.channels.s = Math.max(0, this.minS, Math.min(100, this.maxS, hsv[1])) } this.channels.v = Math.max(0, this.minV, Math.min(100, this.maxV, hsv[2])); var rgb = jsc.HSV_RGB(this.channels.h, this.channels.s, this.channels.v); this.channels.r = rgb[0]; this.channels.g = rgb[1]; this.channels.b = rgb[2]; this.exposeColor(flags); return true }; this.fromHSV = function (h, s, v, flags) { console.warn("fromHSV() method is DEPRECATED. Using fromHSVA() instead." + jsc.docsRef); return this.fromHSVA(h, s, v, null, flags) }; this.fromRGB = function (r, g, b, flags) { console.warn("fromRGB() method is DEPRECATED. Using fromRGBA() instead." + jsc.docsRef); return this.fromRGBA(r, g, b, null, flags) }; this.fromString = function (str, flags) { if (!this.required && str.trim() === "") { this.setPreviewElementBg(null); this.setValueElementValue(""); return true } var color = jsc.parseColorString(str); if (!color) { return false } if (this.format.toLowerCase() === "any") { this._setFormat(color.format); if (!jsc.isAlphaFormat(this.getFormat())) { color.rgba[3] = 1 } } this.fromRGBA(color.rgba[0], color.rgba[1], color.rgba[2], color.rgba[3], flags); return true }; this.randomize = function (minV, maxV, minS, maxS, minH, maxH, minA, maxA) { if (minV === undefined) { minV = 0 } if (maxV === undefined) { maxV = 100 } if (minS === undefined) { minS = 0 } if (maxS === undefined) { maxS = 100 } if (minH === undefined) { minH = 0 } if (maxH === undefined) { maxH = 359 } if (minA === undefined) { minA = 1 } if (maxA === undefined) { maxA = 1 } this.fromHSVA(minH + Math.floor(Math.random() * (maxH - minH + 1)), minS + Math.floor(Math.random() * (maxS - minS + 1)), minV + Math.floor(Math.random() * (maxV - minV + 1)), (100 * minA + Math.floor(Math.random() * (100 * (maxA - minA) + 1))) / 100) }; this.toString = function (format) { if (format === undefined) { format = this.getFormat() } switch (format.toLowerCase()) { case "hex": return this.toHEXString(); break; case "hexa": return this.toHEXAString(); break; case "rgb": return this.toRGBString(); break; case "rgba": return this.toRGBAString(); break }return false }; this.toHEXString = function () { return jsc.hexColor(this.channels.r, this.channels.g, this.channels.b) }; this.toHEXAString = function () { return jsc.hexaColor(this.channels.r, this.channels.g, this.channels.b, this.channels.a) }; this.toRGBString = function () { return jsc.rgbColor(this.channels.r, this.channels.g, this.channels.b) }; this.toRGBAString = function () { return jsc.rgbaColor(this.channels.r, this.channels.g, this.channels.b, this.channels.a) }; this.toGrayscale = function () { return .213 * this.channels.r + .715 * this.channels.g + .072 * this.channels.b }; this.toCanvas = function () { return jsc.genColorPreviewCanvas(this.toRGBAString()).canvas }; this.toDataURL = function () { return this.toCanvas().toDataURL() }; this.toBackground = function () { return jsc.pub.background(this.toRGBAString()) }; this.isLight = function () { return this.toGrayscale() > 255 / 2 }; this.hide = function () { if (isPickerOwner()) { detachPicker() } }; this.show = function () { drawPicker() }; this.redraw = function () { if (isPickerOwner()) { drawPicker() } }; this.getFormat = function () { return this._currentFormat }; this._setFormat = function (format) { this._currentFormat = format.toLowerCase() }; this.hasAlphaChannel = function () { if (this.alphaChannel === "auto") { return this.format.toLowerCase() === "any" || jsc.isAlphaFormat(this.getFormat()) || this.alpha !== undefined || this.alphaElement !== undefined } return this.alphaChannel }; this.processValueInput = function (str) { if (!this.fromString(str)) { this.exposeColor() } }; this.processAlphaInput = function (str) { if (!this.fromHSVA(null, null, null, parseFloat(str))) { this.exposeColor() } }; this.exposeColor = function (flags) { var colorStr = this.toString(); var fmt = this.getFormat(); jsc.setDataAttr(this.targetElement, "current-color", colorStr); if (!(flags & jsc.flags.leaveValue) && this.valueElement) { if (fmt === "hex" || fmt === "hexa") { if (!this.uppercase) { colorStr = colorStr.toLowerCase() } if (!this.hash) { colorStr = colorStr.replace(/^#/, "") } } this.setValueElementValue(colorStr) } if (!(flags & jsc.flags.leaveAlpha) && this.alphaElement) { var alphaVal = Math.round(this.channels.a * 100) / 100; this.setAlphaElementValue(alphaVal) } if (!(flags & jsc.flags.leavePreview) && this.previewElement) { var previewPos = null; if (jsc.isTextInput(this.previewElement) || jsc.isButton(this.previewElement) && !jsc.isButtonEmpty(this.previewElement)) { previewPos = this.previewPosition } this.setPreviewElementBg(this.toRGBAString()) } if (isPickerOwner()) { redrawPad(); redrawSld(); redrawASld() } }; this.setPreviewElementBg = function (color) { if (!this.previewElement) { return } var position = null; var width = null; if (jsc.isTextInput(this.previewElement) || jsc.isButton(this.previewElement) && !jsc.isButtonEmpty(this.previewElement)) { position = this.previewPosition; width = this.previewSize } var backgrounds = []; if (!color) { backgrounds.push({ image: "none", position: "left top", size: "auto", repeat: "no-repeat", origin: "padding-box" }) } else { backgrounds.push({ image: jsc.genColorPreviewGradient(color, position, width ? width - jsc.pub.previewSeparator.length : null), position: "left top", size: "auto", repeat: position ? "repeat-y" : "repeat", origin: "padding-box" }); var preview = jsc.genColorPreviewCanvas("rgba(0,0,0,0)", position ? { left: "right", right: "left" }[position] : null, width, true); backgrounds.push({ image: "url('" + preview.canvas.toDataURL() + "')", position: (position || "left") + " top", size: preview.width + "px " + preview.height + "px", repeat: position ? "repeat-y" : "repeat", origin: "padding-box" }) } var bg = { image: [], position: [], size: [], repeat: [], origin: [] }; for (var i = 0; i < backgrounds.length; i += 1){ bg.image.push(backgrounds[i].image); bg.position.push(backgrounds[i].position); bg.size.push(backgrounds[i].size); bg.repeat.push(backgrounds[i].repeat); bg.origin.push(backgrounds[i].origin) } var sty = { "background-image": bg.image.join(", "), "background-position": bg.position.join(", "), "background-size": bg.size.join(", "), "background-repeat": bg.repeat.join(", "), "background-origin": bg.origin.join(", ") }; jsc.setStyle(this.previewElement, sty, this.forceStyle); var padding = { left: null, right: null }; if (position) { padding[position] = this.previewSize + this.previewPadding + "px" } var sty = { "padding-left": padding.left, "padding-right": padding.right }; jsc.setStyle(this.previewElement, sty, this.forceStyle, true) }; this.setValueElementValue = function (str) { if (this.valueElement) { if (jsc.nodeName(this.valueElement) === "input") { this.valueElement.value = str } else { this.valueElement.innerHTML = str } } }; this.setAlphaElementValue = function (str) { if (this.alphaElement) { if (jsc.nodeName(this.alphaElement) === "input") { this.alphaElement.value = str } else { this.alphaElement.innerHTML = str } } }; this._processParentElementsInDOM = function () { if (this._parentElementsProcessed) { return } this._parentElementsProcessed = true; var elm = this.targetElement; do { var compStyle = jsc.getCompStyle(elm); if (compStyle.position && compStyle.position.toLowerCase() === "fixed") { this.fixed = true } if (elm !== this.targetElement) { if (!jsc.getData(elm, "hasScrollListener")) { elm.addEventListener("scroll", jsc.onParentScroll, false); jsc.setData(elm, "hasScrollListener", true) } } } while ((elm = elm.parentNode) && jsc.nodeName(elm) !== "body") }; this.tryHide = function () { if (this.hideOnLeave) { this.hide() } }; this.set__palette = function (val) { this.palette = val; this._palette = jsc.parsePaletteValue(val); this._paletteHasTransparency = jsc.containsTranparentColor(this._palette) }; function setOption(option, value) { if (typeof option !== "string") { throw new Error("Invalid value for option name: " + option) } if (jsc.enumOpts.hasOwnProperty(option)) { if (typeof value === "string") { value = value.toLowerCase() } if (jsc.enumOpts[option].indexOf(value) === -1) { throw new Error("Option '" + option + "' has invalid value: " + value) } } if (jsc.deprecatedOpts.hasOwnProperty(option)) { var oldOpt = option; var newOpt = jsc.deprecatedOpts[option]; if (newOpt) { console.warn("Option '%s' is DEPRECATED, using '%s' instead." + jsc.docsRef, oldOpt, newOpt); option = newOpt } else { throw new Error("Option '" + option + "' is DEPRECATED") } } var setter = "set__" + option; if (typeof THIS[setter] === "function") { THIS[setter](value); return true } else if (option in THIS) { THIS[option] = value; return true } throw new Error("Unrecognized configuration option: " + option) } function getOption(option) { if (typeof option !== "string") { throw new Error("Invalid value for option name: " + option) } if (jsc.deprecatedOpts.hasOwnProperty(option)) { var oldOpt = option; var newOpt = jsc.deprecatedOpts[option]; if (newOpt) { console.warn("Option '%s' is DEPRECATED, using '%s' instead." + jsc.docsRef, oldOpt, newOpt); option = newOpt } else { throw new Error("Option '" + option + "' is DEPRECATED") } } var getter = "get__" + option; if (typeof THIS[getter] === "function") { return THIS[getter](value) } else if (option in THIS) { return THIS[option] } throw new Error("Unrecognized configuration option: " + option) } function detachPicker() { jsc.removeClass(THIS.targetElement, jsc.pub.activeClassName); jsc.picker.wrap.parentNode.removeChild(jsc.picker.wrap); delete jsc.picker.owner } function drawPicker() { THIS._processParentElementsInDOM(); if (!jsc.picker) { jsc.picker = { owner: null, wrap: jsc.createEl("div"), box: jsc.createEl("div"), boxS: jsc.createEl("div"), boxB: jsc.createEl("div"), pad: jsc.createEl("div"), padB: jsc.createEl("div"), padM: jsc.createEl("div"), padCanvas: jsc.createPadCanvas(), cross: jsc.createEl("div"), crossBY: jsc.createEl("div"), crossBX: jsc.createEl("div"), crossLY: jsc.createEl("div"), crossLX: jsc.createEl("div"), sld: jsc.createEl("div"), sldB: jsc.createEl("div"), sldM: jsc.createEl("div"), sldGrad: jsc.createSliderGradient(), sldPtrS: jsc.createEl("div"), sldPtrIB: jsc.createEl("div"), sldPtrMB: jsc.createEl("div"), sldPtrOB: jsc.createEl("div"), asld: jsc.createEl("div"), asldB: jsc.createEl("div"), asldM: jsc.createEl("div"), asldGrad: jsc.createASliderGradient(), asldPtrS: jsc.createEl("div"), asldPtrIB: jsc.createEl("div"), asldPtrMB: jsc.createEl("div"), asldPtrOB: jsc.createEl("div"), pal: jsc.createEl("div"), btn: jsc.createEl("div"), btnT: jsc.createEl("span") }; jsc.picker.pad.appendChild(jsc.picker.padCanvas.elm); jsc.picker.padB.appendChild(jsc.picker.pad); jsc.picker.cross.appendChild(jsc.picker.crossBY); jsc.picker.cross.appendChild(jsc.picker.crossBX); jsc.picker.cross.appendChild(jsc.picker.crossLY); jsc.picker.cross.appendChild(jsc.picker.crossLX); jsc.picker.padB.appendChild(jsc.picker.cross); jsc.picker.box.appendChild(jsc.picker.padB); jsc.picker.box.appendChild(jsc.picker.padM); jsc.picker.sld.appendChild(jsc.picker.sldGrad.elm); jsc.picker.sldB.appendChild(jsc.picker.sld); jsc.picker.sldB.appendChild(jsc.picker.sldPtrOB); jsc.picker.sldPtrOB.appendChild(jsc.picker.sldPtrMB); jsc.picker.sldPtrMB.appendChild(jsc.picker.sldPtrIB); jsc.picker.sldPtrIB.appendChild(jsc.picker.sldPtrS); jsc.picker.box.appendChild(jsc.picker.sldB); jsc.picker.box.appendChild(jsc.picker.sldM); jsc.picker.asld.appendChild(jsc.picker.asldGrad.elm); jsc.picker.asldB.appendChild(jsc.picker.asld); jsc.picker.asldB.appendChild(jsc.picker.asldPtrOB); jsc.picker.asldPtrOB.appendChild(jsc.picker.asldPtrMB); jsc.picker.asldPtrMB.appendChild(jsc.picker.asldPtrIB); jsc.picker.asldPtrIB.appendChild(jsc.picker.asldPtrS); jsc.picker.box.appendChild(jsc.picker.asldB); jsc.picker.box.appendChild(jsc.picker.asldM); jsc.picker.box.appendChild(jsc.picker.pal); jsc.picker.btn.appendChild(jsc.picker.btnT); jsc.picker.box.appendChild(jsc.picker.btn); jsc.picker.boxB.appendChild(jsc.picker.box); jsc.picker.wrap.appendChild(jsc.picker.boxS); jsc.picker.wrap.appendChild(jsc.picker.boxB); jsc.picker.wrap.addEventListener("touchstart", jsc.onPickerTouchStart, jsc.isPassiveEventSupported ? { passive: false } : false) } var p = jsc.picker; var displaySlider = !!jsc.getSliderChannel(THIS); var displayAlphaSlider = THIS.hasAlphaChannel(); var pickerDims = jsc.getPickerDims(THIS); var crossOuterSize = 2 * THIS.pointerBorderWidth + THIS.pointerThickness + 2 * THIS.crossSize; var controlPadding = jsc.getControlPadding(THIS); var borderRadius = Math.min(THIS.borderRadius, Math.round(THIS.padding * Math.PI)); var padCursor = "crosshair"; p.wrap.className = "jscolor-picker-wrap"; p.wrap.style.clear = "both"; p.wrap.style.width = pickerDims.borderW + "px"; p.wrap.style.height = pickerDims.borderH + "px"; p.wrap.style.zIndex = THIS.zIndex; p.box.className = "jscolor-picker"; p.box.style.width = pickerDims.paddedW + "px"; p.box.style.height = pickerDims.paddedH + "px"; p.box.style.position = "relative"; p.boxS.className = "jscolor-picker-shadow"; p.boxS.style.position = "absolute"; p.boxS.style.left = "0"; p.boxS.style.top = "0"; p.boxS.style.width = "100%"; p.boxS.style.height = "100%"; jsc.setBorderRadius(p.boxS, borderRadius + "px"); p.boxB.className = "jscolor-picker-border"; p.boxB.style.position = "relative"; p.boxB.style.border = THIS.borderWidth + "px solid"; p.boxB.style.borderColor = THIS.borderColor; p.boxB.style.background = THIS.backgroundColor; jsc.setBorderRadius(p.boxB, borderRadius + "px"); p.padM.style.background = "rgba(255,0,0,.2)"; p.sldM.style.background = "rgba(0,255,0,.2)"; p.asldM.style.background = "rgba(0,0,255,.2)"; p.padM.style.opacity = p.sldM.style.opacity = p.asldM.style.opacity = "0"; p.pad.style.position = "relative"; p.pad.style.width = THIS.width + "px"; p.pad.style.height = THIS.height + "px"; p.padCanvas.draw(THIS.width, THIS.height, jsc.getPadYChannel(THIS)); p.padB.style.position = "absolute"; p.padB.style.left = THIS.padding + "px"; p.padB.style.top = THIS.padding + "px"; p.padB.style.border = THIS.controlBorderWidth + "px solid"; p.padB.style.borderColor = THIS.controlBorderColor; p.padM.style.position = "absolute"; p.padM.style.left = 0 + "px"; p.padM.style.top = 0 + "px"; p.padM.style.width = THIS.padding + 2 * THIS.controlBorderWidth + THIS.width + controlPadding + "px"; p.padM.style.height = 2 * THIS.controlBorderWidth + 2 * THIS.padding + THIS.height + "px"; p.padM.style.cursor = padCursor; jsc.setData(p.padM, { instance: THIS, control: "pad" }); p.cross.style.position = "absolute"; p.cross.style.left = p.cross.style.top = "0"; p.cross.style.width = p.cross.style.height = crossOuterSize + "px"; p.crossBY.style.position = p.crossBX.style.position = "absolute"; p.crossBY.style.background = p.crossBX.style.background = THIS.pointerBorderColor; p.crossBY.style.width = p.crossBX.style.height = 2 * THIS.pointerBorderWidth + THIS.pointerThickness + "px"; p.crossBY.style.height = p.crossBX.style.width = crossOuterSize + "px"; p.crossBY.style.left = p.crossBX.style.top = Math.floor(crossOuterSize / 2) - Math.floor(THIS.pointerThickness / 2) - THIS.pointerBorderWidth + "px"; p.crossBY.style.top = p.crossBX.style.left = "0"; p.crossLY.style.position = p.crossLX.style.position = "absolute"; p.crossLY.style.background = p.crossLX.style.background = THIS.pointerColor; p.crossLY.style.height = p.crossLX.style.width = crossOuterSize - 2 * THIS.pointerBorderWidth + "px"; p.crossLY.style.width = p.crossLX.style.height = THIS.pointerThickness + "px"; p.crossLY.style.left = p.crossLX.style.top = Math.floor(crossOuterSize / 2) - Math.floor(THIS.pointerThickness / 2) + "px"; p.crossLY.style.top = p.crossLX.style.left = THIS.pointerBorderWidth + "px"; p.sld.style.overflow = "hidden"; p.sld.style.width = THIS.sliderSize + "px"; p.sld.style.height = THIS.height + "px"; p.sldGrad.draw(THIS.sliderSize, THIS.height, "#000", "#000"); p.sldB.style.display = displaySlider ? "block" : "none"; p.sldB.style.position = "absolute"; p.sldB.style.left = THIS.padding + THIS.width + 2 * THIS.controlBorderWidth + 2 * controlPadding + "px"; p.sldB.style.top = THIS.padding + "px"; p.sldB.style.border = THIS.controlBorderWidth + "px solid"; p.sldB.style.borderColor = THIS.controlBorderColor; p.sldM.style.display = displaySlider ? "block" : "none"; p.sldM.style.position = "absolute"; p.sldM.style.left = THIS.padding + THIS.width + 2 * THIS.controlBorderWidth + controlPadding + "px"; p.sldM.style.top = 0 + "px"; p.sldM.style.width = THIS.sliderSize + 2 * controlPadding + 2 * THIS.controlBorderWidth + (displayAlphaSlider ? 0 : Math.max(0, THIS.padding - controlPadding)) + "px"; p.sldM.style.height = 2 * THIS.controlBorderWidth + 2 * THIS.padding + THIS.height + "px"; p.sldM.style.cursor = "default"; jsc.setData(p.sldM, { instance: THIS, control: "sld" }); p.sldPtrIB.style.border = p.sldPtrOB.style.border = THIS.pointerBorderWidth + "px solid " + THIS.pointerBorderColor; p.sldPtrOB.style.position = "absolute"; p.sldPtrOB.style.left = -(2 * THIS.pointerBorderWidth + THIS.pointerThickness) + "px"; p.sldPtrOB.style.top = "0"; p.sldPtrMB.style.border = THIS.pointerThickness + "px solid " + THIS.pointerColor; p.sldPtrS.style.width = THIS.sliderSize + "px"; p.sldPtrS.style.height = jsc.pub.sliderInnerSpace + "px"; p.asld.style.overflow = "hidden"; p.asld.style.width = THIS.sliderSize + "px"; p.asld.style.height = THIS.height + "px"; p.asldGrad.draw(THIS.sliderSize, THIS.height, "#000"); p.asldB.style.display = displayAlphaSlider ? "block" : "none"; p.asldB.style.position = "absolute"; p.asldB.style.left = THIS.padding + THIS.width + 2 * THIS.controlBorderWidth + controlPadding + (displaySlider ? THIS.sliderSize + 3 * controlPadding + 2 * THIS.controlBorderWidth : 0) + "px"; p.asldB.style.top = THIS.padding + "px"; p.asldB.style.border = THIS.controlBorderWidth + "px solid"; p.asldB.style.borderColor = THIS.controlBorderColor; p.asldM.style.display = displayAlphaSlider ? "block" : "none"; p.asldM.style.position = "absolute"; p.asldM.style.left = THIS.padding + THIS.width + 2 * THIS.controlBorderWidth + controlPadding + (displaySlider ? THIS.sliderSize + 2 * controlPadding + 2 * THIS.controlBorderWidth : 0) + "px"; p.asldM.style.top = 0 + "px"; p.asldM.style.width = THIS.sliderSize + 2 * controlPadding + 2 * THIS.controlBorderWidth + Math.max(0, THIS.padding - controlPadding) + "px"; p.asldM.style.height = 2 * THIS.controlBorderWidth + 2 * THIS.padding + THIS.height + "px"; p.asldM.style.cursor = "default"; jsc.setData(p.asldM, { instance: THIS, control: "asld" }); p.asldPtrIB.style.border = p.asldPtrOB.style.border = THIS.pointerBorderWidth + "px solid " + THIS.pointerBorderColor; p.asldPtrOB.style.position = "absolute"; p.asldPtrOB.style.left = -(2 * THIS.pointerBorderWidth + THIS.pointerThickness) + "px"; p.asldPtrOB.style.top = "0"; p.asldPtrMB.style.border = THIS.pointerThickness + "px solid " + THIS.pointerColor; p.asldPtrS.style.width = THIS.sliderSize + "px"; p.asldPtrS.style.height = jsc.pub.sliderInnerSpace + "px"; p.pal.className = "jscolor-palette"; p.pal.style.display = pickerDims.palette.rows ? "block" : "none"; p.pal.style.position = "absolute"; p.pal.style.left = THIS.padding + "px"; p.pal.style.top = 2 * THIS.controlBorderWidth + 2 * THIS.padding + THIS.height + "px"; p.pal.innerHTML = ""; var chessboard = jsc.genColorPreviewCanvas("rgba(0,0,0,0)"); var si = 0; for (var r = 0; r < pickerDims.palette.rows; r++){ for (var c = 0; c < pickerDims.palette.cols && si < THIS._palette.length; c++, si++){ var sampleColor = THIS._palette[si]; var sampleCssColor = jsc.rgbaColor.apply(null, sampleColor.rgba); var sc = jsc.createEl("div"); sc.style.width = pickerDims.palette.cellW - 2 * THIS.controlBorderWidth + "px"; sc.style.height = pickerDims.palette.cellH - 2 * THIS.controlBorderWidth + "px"; sc.style.backgroundColor = sampleCssColor; var sw = jsc.createEl("div"); sw.className = "jscolor-palette-sample"; sw.style.display = "block"; sw.style.position = "absolute"; sw.style.left = (pickerDims.palette.cols <= 1 ? 0 : Math.round(10 * (c * ((pickerDims.contentW - pickerDims.palette.cellW) / (pickerDims.palette.cols - 1)))) / 10) + "px"; sw.style.top = r * (pickerDims.palette.cellH + THIS.paletteSpacing) + "px"; sw.style.border = THIS.controlBorderWidth + "px solid"; sw.style.borderColor = THIS.controlBorderColor; sw.style.cursor = "pointer"; if (sampleColor.rgba[3] !== null && sampleColor.rgba[3] < 1) { sw.style.backgroundImage = "url('" + chessboard.canvas.toDataURL() + "')"; sw.style.backgroundRepeat = "repeat"; sw.style.backgroundPosition = "center center" } jsc.setData(sw, { instance: THIS, control: "palette-sample", color: sampleColor }); sw.addEventListener("click", jsc.onPaletteSampleClick, false); sw.appendChild(sc); p.pal.appendChild(sw) } } function setBtnBorder() { var insetColors = THIS.controlBorderColor.split(/\s+/); var outsetColor = insetColors.length < 2 ? insetColors[0] : insetColors[1] + " " + insetColors[0] + " " + insetColors[0] + " " + insetColors[1]; p.btn.style.borderColor = outsetColor } var btnPadding = 15; p.btn.className = "jscolor-btn-close"; p.btn.style.display = THIS.closeButton ? "block" : "none"; p.btn.style.position = "absolute"; p.btn.style.left = THIS.padding + "px"; p.btn.style.bottom = THIS.padding + "px"; p.btn.style.padding = "0 " + btnPadding + "px"; p.btn.style.maxWidth = pickerDims.contentW - 2 * THIS.controlBorderWidth - 2 * btnPadding + "px"; p.btn.style.overflow = "hidden"; p.btn.style.height = THIS.buttonHeight + "px"; p.btn.style.whiteSpace = "nowrap"; p.btn.style.border = THIS.controlBorderWidth + "px solid"; setBtnBorder(); p.btn.style.color = THIS.buttonColor; p.btn.style.font = "12px sans-serif"; p.btn.style.textAlign = "center"; p.btn.style.cursor = "pointer"; p.btn.onmousedown = function () { THIS.hide() }; p.btnT.style.lineHeight = THIS.buttonHeight + "px"; p.btnT.innerHTML = ""; p.btnT.appendChild(window.document.createTextNode(THIS.closeText)); redrawPad(); redrawSld(); redrawASld(); if (jsc.picker.owner && jsc.picker.owner !== THIS) { jsc.removeClass(jsc.picker.owner.targetElement, jsc.pub.activeClassName) } jsc.picker.owner = THIS; if (THIS.container === window.document.body) { jsc.redrawPosition() } else { jsc._drawPosition(THIS, 0, 0, "relative", false) } if (p.wrap.parentNode !== THIS.container) { THIS.container.appendChild(p.wrap) } jsc.addClass(THIS.targetElement, jsc.pub.activeClassName) } function redrawPad() { var yChannel = jsc.getPadYChannel(THIS); var x = Math.round(THIS.channels.h / 360 * (THIS.width - 1)); var y = Math.round((1 - THIS.channels[yChannel] / 100) * (THIS.height - 1)); var crossOuterSize = 2 * THIS.pointerBorderWidth + THIS.pointerThickness + 2 * THIS.crossSize; var ofs = -Math.floor(crossOuterSize / 2); jsc.picker.cross.style.left = x + ofs + "px"; jsc.picker.cross.style.top = y + ofs + "px"; switch (jsc.getSliderChannel(THIS)) { case "s": var rgb1 = jsc.HSV_RGB(THIS.channels.h, 100, THIS.channels.v); var rgb2 = jsc.HSV_RGB(THIS.channels.h, 0, THIS.channels.v); var color1 = "rgb(" + Math.round(rgb1[0]) + "," + Math.round(rgb1[1]) + "," + Math.round(rgb1[2]) + ")"; var color2 = "rgb(" + Math.round(rgb2[0]) + "," + Math.round(rgb2[1]) + "," + Math.round(rgb2[2]) + ")"; jsc.picker.sldGrad.draw(THIS.sliderSize, THIS.height, color1, color2); break; case "v": var rgb = jsc.HSV_RGB(THIS.channels.h, THIS.channels.s, 100); var color1 = "rgb(" + Math.round(rgb[0]) + "," + Math.round(rgb[1]) + "," + Math.round(rgb[2]) + ")"; var color2 = "#000"; jsc.picker.sldGrad.draw(THIS.sliderSize, THIS.height, color1, color2); break }jsc.picker.asldGrad.draw(THIS.sliderSize, THIS.height, THIS.toHEXString()) } function redrawSld() { var sldChannel = jsc.getSliderChannel(THIS); if (sldChannel) { var y = Math.round((1 - THIS.channels[sldChannel] / 100) * (THIS.height - 1)); jsc.picker.sldPtrOB.style.top = y - (2 * THIS.pointerBorderWidth + THIS.pointerThickness) - Math.floor(jsc.pub.sliderInnerSpace / 2) + "px" } jsc.picker.asldGrad.draw(THIS.sliderSize, THIS.height, THIS.toHEXString()) } function redrawASld() { var y = Math.round((1 - THIS.channels.a) * (THIS.height - 1)); jsc.picker.asldPtrOB.style.top = y - (2 * THIS.pointerBorderWidth + THIS.pointerThickness) - Math.floor(jsc.pub.sliderInnerSpace / 2) + "px" } function isPickerOwner() { return jsc.picker && jsc.picker.owner === THIS } function onValueKeyDown(ev) { if (jsc.eventKey(ev) === "Enter") { if (THIS.valueElement) { THIS.processValueInput(THIS.valueElement.value) } THIS.tryHide() } } function onAlphaKeyDown(ev) { if (jsc.eventKey(ev) === "Enter") { if (THIS.alphaElement) { THIS.processAlphaInput(THIS.alphaElement.value) } THIS.tryHide() } } function onValueChange(ev) { if (jsc.getData(ev, "internal")) { return } var oldVal = THIS.valueElement.value; THIS.processValueInput(THIS.valueElement.value); jsc.triggerCallback(THIS, "onChange"); if (THIS.valueElement.value !== oldVal) { jsc.triggerInputEvent(THIS.valueElement, "change", true, true) } } function onAlphaChange(ev) { if (jsc.getData(ev, "internal")) { return } var oldVal = THIS.alphaElement.value; THIS.processAlphaInput(THIS.alphaElement.value); jsc.triggerCallback(THIS, "onChange"); jsc.triggerInputEvent(THIS.valueElement, "change", true, true); if (THIS.alphaElement.value !== oldVal) { jsc.triggerInputEvent(THIS.alphaElement, "change", true, true) } } function onValueInput(ev) { if (jsc.getData(ev, "internal")) { return } if (THIS.valueElement) { THIS.fromString(THIS.valueElement.value, jsc.flags.leaveValue) } jsc.triggerCallback(THIS, "onInput") } function onAlphaInput(ev) { if (jsc.getData(ev, "internal")) { return } if (THIS.alphaElement) { THIS.fromHSVA(null, null, null, parseFloat(THIS.alphaElement.value), jsc.flags.leaveAlpha) } jsc.triggerCallback(THIS, "onInput"); jsc.triggerInputEvent(THIS.valueElement, "input", true, true) } if (jsc.pub.options) { for (var opt in jsc.pub.options) { if (jsc.pub.options.hasOwnProperty(opt)) { try { setOption(opt, jsc.pub.options[opt]) } catch (e) { console.warn(e) } } } } var presetsArr = []; if (opts.preset) { if (typeof opts.preset === "string") { presetsArr = opts.preset.split(/\s+/) } else if (Array.isArray(opts.preset)) { presetsArr = opts.preset.slice() } else { console.warn("Unrecognized preset value") } } if (presetsArr.indexOf("default") === -1) { presetsArr.push("default") } for (var i = presetsArr.length - 1; i >= 0; i -= 1){ var pres = presetsArr[i]; if (!pres) { continue } if (!jsc.pub.presets.hasOwnProperty(pres)) { console.warn("Unknown preset: %s", pres); continue } for (var opt in jsc.pub.presets[pres]) { if (jsc.pub.presets[pres].hasOwnProperty(opt)) { try { setOption(opt, jsc.pub.presets[pres][opt]) } catch (e) { console.warn(e) } } } } var nonProperties = ["preset"]; for (var opt in opts) { if (opts.hasOwnProperty(opt)) { if (nonProperties.indexOf(opt) === -1) { try { setOption(opt, opts[opt]) } catch (e) { console.warn(e) } } } } if (this.container === undefined) { this.container = window.document.body } else { this.container = jsc.node(this.container) } if (!this.container) { throw new Error("Cannot instantiate color picker without a container element") } this.targetElement = jsc.node(targetElement); if (!this.targetElement) { if (typeof targetElement === "string" && /^[a-zA-Z][\w:.-]*$/.test(targetElement)) { var possiblyId = targetElement; throw new Error("If '" + possiblyId + "' is supposed to be an ID, please use '#" + possiblyId + "' or any valid CSS selector.") } throw new Error("Cannot instantiate color picker without a target element") } if (this.targetElement.jscolor && this.targetElement.jscolor instanceof jsc.pub) { throw new Error("Color picker already installed on this element") } this.targetElement.jscolor = this; jsc.addClass(this.targetElement, jsc.pub.className); jsc.instances.push(this); if (jsc.isButton(this.targetElement)) { if (this.targetElement.type.toLowerCase() !== "button") { this.targetElement.type = "button" } if (jsc.isButtonEmpty(this.targetElement)) { jsc.removeChildren(this.targetElement); this.targetElement.appendChild(window.document.createTextNode(" ")); var compStyle = jsc.getCompStyle(this.targetElement); var currMinWidth = parseFloat(compStyle["min-width"]) || 0; if (currMinWidth < this.previewSize) { jsc.setStyle(this.targetElement, { "min-width": this.previewSize + "px" }, this.forceStyle) } } } if (this.valueElement === undefined) { if (jsc.isTextInput(this.targetElement)) { this.valueElement = this.targetElement } else { } } else if (this.valueElement === null) { } else { this.valueElement = jsc.node(this.valueElement) } if (this.alphaElement) { this.alphaElement = jsc.node(this.alphaElement) } if (this.previewElement === undefined) { this.previewElement = this.targetElement } else if (this.previewElement === null) { } else { this.previewElement = jsc.node(this.previewElement) } if (this.valueElement && jsc.isTextInput(this.valueElement)) { var valueElementOrigEvents = { onInput: this.valueElement.oninput }; this.valueElement.oninput = null; this.valueElement.addEventListener("keydown", onValueKeyDown, false); this.valueElement.addEventListener("change", onValueChange, false); this.valueElement.addEventListener("input", onValueInput, false); if (valueElementOrigEvents.onInput) { this.valueElement.addEventListener("input", valueElementOrigEvents.onInput, false) } this.valueElement.setAttribute("autocomplete", "off"); this.valueElement.setAttribute("autocorrect", "off"); this.valueElement.setAttribute("autocapitalize", "off"); this.valueElement.setAttribute("spellcheck", false) } if (this.alphaElement && jsc.isTextInput(this.alphaElement)) { this.alphaElement.addEventListener("keydown", onAlphaKeyDown, false); this.alphaElement.addEventListener("change", onAlphaChange, false); this.alphaElement.addEventListener("input", onAlphaInput, false); this.alphaElement.setAttribute("autocomplete", "off"); this.alphaElement.setAttribute("autocorrect", "off"); this.alphaElement.setAttribute("autocapitalize", "off"); this.alphaElement.setAttribute("spellcheck", false) } var initValue = "FFFFFF"; if (this.value !== undefined) { initValue = this.value } else if (this.valueElement && this.valueElement.value !== undefined) { initValue = this.valueElement.value } var initAlpha = undefined; if (this.alpha !== undefined) { initAlpha = "" + this.alpha } else if (this.alphaElement && this.alphaElement.value !== undefined) { initAlpha = this.alphaElement.value } this._currentFormat = null; if (["auto", "any"].indexOf(this.format.toLowerCase()) > -1) { var color = jsc.parseColorString(initValue); this._currentFormat = color ? color.format : "hex" } else { this._currentFormat = this.format.toLowerCase() } this.processValueInput(initValue); if (initAlpha !== undefined) { this.processAlphaInput(initAlpha) } if (this.random) { this.randomize.apply(this, Array.isArray(this.random) ? this.random : []) } } }; jsc.pub.className = "jscolor"; jsc.pub.activeClassName = "jscolor-active"; jsc.pub.looseJSON = true; jsc.pub.presets = {}; jsc.pub.presets["default"] = {}; jsc.pub.presets["light"] = { backgroundColor: "rgba(255,255,255,1)", controlBorderColor: "rgba(187,187,187,1)", buttonColor: "rgba(0,0,0,1)" }; jsc.pub.presets["dark"] = { backgroundColor: "rgba(51,51,51,1)", controlBorderColor: "rgba(153,153,153,1)", buttonColor: "rgba(240,240,240,1)" }; jsc.pub.presets["small"] = { width: 101, height: 101, padding: 10, sliderSize: 14, paletteCols: 8 }; jsc.pub.presets["medium"] = { width: 181, height: 101, padding: 12, sliderSize: 16, paletteCols: 10 }; jsc.pub.presets["large"] = { width: 271, height: 151, padding: 12, sliderSize: 24, paletteCols: 15 }; jsc.pub.presets["thin"] = { borderWidth: 1, controlBorderWidth: 1, pointerBorderWidth: 1 }; jsc.pub.presets["thick"] = { borderWidth: 2, controlBorderWidth: 2, pointerBorderWidth: 2 }; jsc.pub.sliderInnerSpace = 3; jsc.pub.chessboardSize = 8; jsc.pub.chessboardColor1 = "#666666"; jsc.pub.chessboardColor2 = "#999999"; jsc.pub.previewSeparator = ["rgba(255,255,255,.65)", "rgba(128,128,128,.65)"]; jsc.pub.init = function () { if (jsc.initialized) { return } window.document.addEventListener("mousedown", jsc.onDocumentMouseDown, false); window.document.addEventListener("keyup", jsc.onDocumentKeyUp, false); window.addEventListener("resize", jsc.onWindowResize, false); window.addEventListener("scroll", jsc.onWindowScroll, false); jsc.pub.install(); jsc.initialized = true; while (jsc.readyQueue.length) { var func = jsc.readyQueue.shift(); func() } }; jsc.pub.install = function (rootNode) { var success = true; try { jsc.installBySelector("[data-jscolor]", rootNode) } catch (e) { success = false; console.warn(e) } if (jsc.pub.lookupClass) { try { jsc.installBySelector("input." + jsc.pub.lookupClass + ", " + "button." + jsc.pub.lookupClass, rootNode) } catch (e) { } } return success }; jsc.pub.ready = function (func) { if (typeof func !== "function") { console.warn("Passed value is not a function"); return false } if (jsc.initialized) { func() } else { jsc.readyQueue.push(func) } return true }; jsc.pub.trigger = function (eventNames) { var triggerNow = function () { jsc.triggerGlobal(eventNames) }; if (jsc.initialized) { triggerNow() } else { jsc.pub.ready(triggerNow) } }; jsc.pub.hide = function () { if (jsc.picker && jsc.picker.owner) { jsc.picker.owner.hide() } }; jsc.pub.chessboard = function (color) { if (!color) { color = "rgba(0,0,0,0)" } var preview = jsc.genColorPreviewCanvas(color); return preview.canvas.toDataURL() }; jsc.pub.background = function (color) { var backgrounds = []; backgrounds.push(jsc.genColorPreviewGradient(color)); var preview = jsc.genColorPreviewCanvas(); backgrounds.push(["url('" + preview.canvas.toDataURL() + "')", "left top", "repeat"].join(" ")); return backgrounds.join(", ") }; jsc.pub.options = {}; jsc.pub.lookupClass = "jscolor"; jsc.pub.installByClassName = function () { console.error('jscolor.installByClassName() is DEPRECATED. Use data-jscolor="" attribute instead of a class name.' + jsc.docsRef); return false }; jsc.register(); return jsc.pub }(); if (typeof window.jscolor === "undefined") { window.jscolor = window.JSColor = jscolor } return jscolor });
diff --git a/src/dep/markdown-it.min.js b/src/dep/markdown-it.min.js
new file mode 100644
index 0000000..943e1f9
--- /dev/null
+++ b/src/dep/markdown-it.min.js
@@ -0,0 +1,12 @@
+/**
+ * markdown-it 12.2.0
+ * @licence MIT
+ * @source https://github.com/markdown-it/markdown-it
+ */
+!function(e,r){"object"==typeof exports&&"undefined"!=typeof module?module.exports=r():"function"==typeof define&&define.amd?define(r):(e="undefined"!=typeof globalThis?globalThis:e||self).markdownit=r()}(this,(function(){"use strict";function e(e){if(e.__esModule)return e;var r=Object.defineProperty({},"__esModule",{value:!0});return Object.keys(e).forEach((function(t){var n=Object.getOwnPropertyDescriptor(e,t);Object.defineProperty(r,t,n.get?n:{enumerable:!0,get:function(){return e[t]}})})),r}var r={Aacute:"\xc1",aacute:"\xe1",Abreve:"\u0102",abreve:"\u0103",ac:"\u223e",acd:"\u223f",acE:"\u223e\u0333",Acirc:"\xc2",acirc:"\xe2",acute:"\xb4",Acy:"\u0410",acy:"\u0430",AElig:"\xc6",aelig:"\xe6",af:"\u2061",Afr:"\ud835\udd04",afr:"\ud835\udd1e",Agrave:"\xc0",agrave:"\xe0",alefsym:"\u2135",aleph:"\u2135",Alpha:"\u0391",alpha:"\u03b1",Amacr:"\u0100",amacr:"\u0101",amalg:"\u2a3f",amp:"&",AMP:"&",andand:"\u2a55",And:"\u2a53",and:"\u2227",andd:"\u2a5c",andslope:"\u2a58",andv:"\u2a5a",ang:"\u2220",ange:"\u29a4",angle:"\u2220",angmsdaa:"\u29a8",angmsdab:"\u29a9",angmsdac:"\u29aa",angmsdad:"\u29ab",angmsdae:"\u29ac",angmsdaf:"\u29ad",angmsdag:"\u29ae",angmsdah:"\u29af",angmsd:"\u2221",angrt:"\u221f",angrtvb:"\u22be",angrtvbd:"\u299d",angsph:"\u2222",angst:"\xc5",angzarr:"\u237c",Aogon:"\u0104",aogon:"\u0105",Aopf:"\ud835\udd38",aopf:"\ud835\udd52",apacir:"\u2a6f",ap:"\u2248",apE:"\u2a70",ape:"\u224a",apid:"\u224b",apos:"'",ApplyFunction:"\u2061",approx:"\u2248",approxeq:"\u224a",Aring:"\xc5",aring:"\xe5",Ascr:"\ud835\udc9c",ascr:"\ud835\udcb6",Assign:"\u2254",ast:"*",asymp:"\u2248",asympeq:"\u224d",Atilde:"\xc3",atilde:"\xe3",Auml:"\xc4",auml:"\xe4",awconint:"\u2233",awint:"\u2a11",backcong:"\u224c",backepsilon:"\u03f6",backprime:"\u2035",backsim:"\u223d",backsimeq:"\u22cd",Backslash:"\u2216",Barv:"\u2ae7",barvee:"\u22bd",barwed:"\u2305",Barwed:"\u2306",barwedge:"\u2305",bbrk:"\u23b5",bbrktbrk:"\u23b6",bcong:"\u224c",Bcy:"\u0411",bcy:"\u0431",bdquo:"\u201e",becaus:"\u2235",because:"\u2235",Because:"\u2235",bemptyv:"\u29b0",bepsi:"\u03f6",bernou:"\u212c",Bernoullis:"\u212c",Beta:"\u0392",beta:"\u03b2",beth:"\u2136",between:"\u226c",Bfr:"\ud835\udd05",bfr:"\ud835\udd1f",bigcap:"\u22c2",bigcirc:"\u25ef",bigcup:"\u22c3",bigodot:"\u2a00",bigoplus:"\u2a01",bigotimes:"\u2a02",bigsqcup:"\u2a06",bigstar:"\u2605",bigtriangledown:"\u25bd",bigtriangleup:"\u25b3",biguplus:"\u2a04",bigvee:"\u22c1",bigwedge:"\u22c0",bkarow:"\u290d",blacklozenge:"\u29eb",blacksquare:"\u25aa",blacktriangle:"\u25b4",blacktriangledown:"\u25be",blacktriangleleft:"\u25c2",blacktriangleright:"\u25b8",blank:"\u2423",blk12:"\u2592",blk14:"\u2591",blk34:"\u2593",block:"\u2588",bne:"=\u20e5",bnequiv:"\u2261\u20e5",bNot:"\u2aed",bnot:"\u2310",Bopf:"\ud835\udd39",bopf:"\ud835\udd53",bot:"\u22a5",bottom:"\u22a5",bowtie:"\u22c8",boxbox:"\u29c9",boxdl:"\u2510",boxdL:"\u2555",boxDl:"\u2556",boxDL:"\u2557",boxdr:"\u250c",boxdR:"\u2552",boxDr:"\u2553",boxDR:"\u2554",boxh:"\u2500",boxH:"\u2550",boxhd:"\u252c",boxHd:"\u2564",boxhD:"\u2565",boxHD:"\u2566",boxhu:"\u2534",boxHu:"\u2567",boxhU:"\u2568",boxHU:"\u2569",boxminus:"\u229f",boxplus:"\u229e",boxtimes:"\u22a0",boxul:"\u2518",boxuL:"\u255b",boxUl:"\u255c",boxUL:"\u255d",boxur:"\u2514",boxuR:"\u2558",boxUr:"\u2559",boxUR:"\u255a",boxv:"\u2502",boxV:"\u2551",boxvh:"\u253c",boxvH:"\u256a",boxVh:"\u256b",boxVH:"\u256c",boxvl:"\u2524",boxvL:"\u2561",boxVl:"\u2562",boxVL:"\u2563",boxvr:"\u251c",boxvR:"\u255e",boxVr:"\u255f",boxVR:"\u2560",bprime:"\u2035",breve:"\u02d8",Breve:"\u02d8",brvbar:"\xa6",bscr:"\ud835\udcb7",Bscr:"\u212c",bsemi:"\u204f",bsim:"\u223d",bsime:"\u22cd",bsolb:"\u29c5",bsol:"\\",bsolhsub:"\u27c8",bull:"\u2022",bullet:"\u2022",bump:"\u224e",bumpE:"\u2aae",bumpe:"\u224f",Bumpeq:"\u224e",bumpeq:"\u224f",Cacute:"\u0106",cacute:"\u0107",capand:"\u2a44",capbrcup:"\u2a49",capcap:"\u2a4b",cap:"\u2229",Cap:"\u22d2",capcup:"\u2a47",capdot:"\u2a40",CapitalDifferentialD:"\u2145",caps:"\u2229\ufe00",caret:"\u2041",caron:"\u02c7",Cayleys:"\u212d",ccaps:"\u2a4d",Ccaron:"\u010c",ccaron:"\u010d",Ccedil:"\xc7",ccedil:"\xe7",Ccirc:"\u0108",ccirc:"\u0109",Cconint:"\u2230",ccups:"\u2a4c",ccupssm:"\u2a50",Cdot:"\u010a",cdot:"\u010b",cedil:"\xb8",Cedilla:"\xb8",cemptyv:"\u29b2",cent:"\xa2",centerdot:"\xb7",CenterDot:"\xb7",cfr:"\ud835\udd20",Cfr:"\u212d",CHcy:"\u0427",chcy:"\u0447",check:"\u2713",checkmark:"\u2713",Chi:"\u03a7",chi:"\u03c7",circ:"\u02c6",circeq:"\u2257",circlearrowleft:"\u21ba",circlearrowright:"\u21bb",circledast:"\u229b",circledcirc:"\u229a",circleddash:"\u229d",CircleDot:"\u2299",circledR:"\xae",circledS:"\u24c8",CircleMinus:"\u2296",CirclePlus:"\u2295",CircleTimes:"\u2297",cir:"\u25cb",cirE:"\u29c3",cire:"\u2257",cirfnint:"\u2a10",cirmid:"\u2aef",cirscir:"\u29c2",ClockwiseContourIntegral:"\u2232",CloseCurlyDoubleQuote:"\u201d",CloseCurlyQuote:"\u2019",clubs:"\u2663",clubsuit:"\u2663",colon:":",Colon:"\u2237",Colone:"\u2a74",colone:"\u2254",coloneq:"\u2254",comma:",",commat:"@",comp:"\u2201",compfn:"\u2218",complement:"\u2201",complexes:"\u2102",cong:"\u2245",congdot:"\u2a6d",Congruent:"\u2261",conint:"\u222e",Conint:"\u222f",ContourIntegral:"\u222e",copf:"\ud835\udd54",Copf:"\u2102",coprod:"\u2210",Coproduct:"\u2210",copy:"\xa9",COPY:"\xa9",copysr:"\u2117",CounterClockwiseContourIntegral:"\u2233",crarr:"\u21b5",cross:"\u2717",Cross:"\u2a2f",Cscr:"\ud835\udc9e",cscr:"\ud835\udcb8",csub:"\u2acf",csube:"\u2ad1",csup:"\u2ad0",csupe:"\u2ad2",ctdot:"\u22ef",cudarrl:"\u2938",cudarrr:"\u2935",cuepr:"\u22de",cuesc:"\u22df",cularr:"\u21b6",cularrp:"\u293d",cupbrcap:"\u2a48",cupcap:"\u2a46",CupCap:"\u224d",cup:"\u222a",Cup:"\u22d3",cupcup:"\u2a4a",cupdot:"\u228d",cupor:"\u2a45",cups:"\u222a\ufe00",curarr:"\u21b7",curarrm:"\u293c",curlyeqprec:"\u22de",curlyeqsucc:"\u22df",curlyvee:"\u22ce",curlywedge:"\u22cf",curren:"\xa4",curvearrowleft:"\u21b6",curvearrowright:"\u21b7",cuvee:"\u22ce",cuwed:"\u22cf",cwconint:"\u2232",cwint:"\u2231",cylcty:"\u232d",dagger:"\u2020",Dagger:"\u2021",daleth:"\u2138",darr:"\u2193",Darr:"\u21a1",dArr:"\u21d3",dash:"\u2010",Dashv:"\u2ae4",dashv:"\u22a3",dbkarow:"\u290f",dblac:"\u02dd",Dcaron:"\u010e",dcaron:"\u010f",Dcy:"\u0414",dcy:"\u0434",ddagger:"\u2021",ddarr:"\u21ca",DD:"\u2145",dd:"\u2146",DDotrahd:"\u2911",ddotseq:"\u2a77",deg:"\xb0",Del:"\u2207",Delta:"\u0394",delta:"\u03b4",demptyv:"\u29b1",dfisht:"\u297f",Dfr:"\ud835\udd07",dfr:"\ud835\udd21",dHar:"\u2965",dharl:"\u21c3",dharr:"\u21c2",DiacriticalAcute:"\xb4",DiacriticalDot:"\u02d9",DiacriticalDoubleAcute:"\u02dd",DiacriticalGrave:"`",DiacriticalTilde:"\u02dc",diam:"\u22c4",diamond:"\u22c4",Diamond:"\u22c4",diamondsuit:"\u2666",diams:"\u2666",die:"\xa8",DifferentialD:"\u2146",digamma:"\u03dd",disin:"\u22f2",div:"\xf7",divide:"\xf7",divideontimes:"\u22c7",divonx:"\u22c7",DJcy:"\u0402",djcy:"\u0452",dlcorn:"\u231e",dlcrop:"\u230d",dollar:"$",Dopf:"\ud835\udd3b",dopf:"\ud835\udd55",Dot:"\xa8",dot:"\u02d9",DotDot:"\u20dc",doteq:"\u2250",doteqdot:"\u2251",DotEqual:"\u2250",dotminus:"\u2238",dotplus:"\u2214",dotsquare:"\u22a1",doublebarwedge:"\u2306",DoubleContourIntegral:"\u222f",DoubleDot:"\xa8",DoubleDownArrow:"\u21d3",DoubleLeftArrow:"\u21d0",DoubleLeftRightArrow:"\u21d4",DoubleLeftTee:"\u2ae4",DoubleLongLeftArrow:"\u27f8",DoubleLongLeftRightArrow:"\u27fa",DoubleLongRightArrow:"\u27f9",DoubleRightArrow:"\u21d2",DoubleRightTee:"\u22a8",DoubleUpArrow:"\u21d1",DoubleUpDownArrow:"\u21d5",DoubleVerticalBar:"\u2225",DownArrowBar:"\u2913",downarrow:"\u2193",DownArrow:"\u2193",Downarrow:"\u21d3",DownArrowUpArrow:"\u21f5",DownBreve:"\u0311",downdownarrows:"\u21ca",downharpoonleft:"\u21c3",downharpoonright:"\u21c2",DownLeftRightVector:"\u2950",DownLeftTeeVector:"\u295e",DownLeftVectorBar:"\u2956",DownLeftVector:"\u21bd",DownRightTeeVector:"\u295f",DownRightVectorBar:"\u2957",DownRightVector:"\u21c1",DownTeeArrow:"\u21a7",DownTee:"\u22a4",drbkarow:"\u2910",drcorn:"\u231f",drcrop:"\u230c",Dscr:"\ud835\udc9f",dscr:"\ud835\udcb9",DScy:"\u0405",dscy:"\u0455",dsol:"\u29f6",Dstrok:"\u0110",dstrok:"\u0111",dtdot:"\u22f1",dtri:"\u25bf",dtrif:"\u25be",duarr:"\u21f5",duhar:"\u296f",dwangle:"\u29a6",DZcy:"\u040f",dzcy:"\u045f",dzigrarr:"\u27ff",Eacute:"\xc9",eacute:"\xe9",easter:"\u2a6e",Ecaron:"\u011a",ecaron:"\u011b",Ecirc:"\xca",ecirc:"\xea",ecir:"\u2256",ecolon:"\u2255",Ecy:"\u042d",ecy:"\u044d",eDDot:"\u2a77",Edot:"\u0116",edot:"\u0117",eDot:"\u2251",ee:"\u2147",efDot:"\u2252",Efr:"\ud835\udd08",efr:"\ud835\udd22",eg:"\u2a9a",Egrave:"\xc8",egrave:"\xe8",egs:"\u2a96",egsdot:"\u2a98",el:"\u2a99",Element:"\u2208",elinters:"\u23e7",ell:"\u2113",els:"\u2a95",elsdot:"\u2a97",Emacr:"\u0112",emacr:"\u0113",empty:"\u2205",emptyset:"\u2205",EmptySmallSquare:"\u25fb",emptyv:"\u2205",EmptyVerySmallSquare:"\u25ab",emsp13:"\u2004",emsp14:"\u2005",emsp:"\u2003",ENG:"\u014a",eng:"\u014b",ensp:"\u2002",Eogon:"\u0118",eogon:"\u0119",Eopf:"\ud835\udd3c",eopf:"\ud835\udd56",epar:"\u22d5",eparsl:"\u29e3",eplus:"\u2a71",epsi:"\u03b5",Epsilon:"\u0395",epsilon:"\u03b5",epsiv:"\u03f5",eqcirc:"\u2256",eqcolon:"\u2255",eqsim:"\u2242",eqslantgtr:"\u2a96",eqslantless:"\u2a95",Equal:"\u2a75",equals:"=",EqualTilde:"\u2242",equest:"\u225f",Equilibrium:"\u21cc",equiv:"\u2261",equivDD:"\u2a78",eqvparsl:"\u29e5",erarr:"\u2971",erDot:"\u2253",escr:"\u212f",Escr:"\u2130",esdot:"\u2250",Esim:"\u2a73",esim:"\u2242",Eta:"\u0397",eta:"\u03b7",ETH:"\xd0",eth:"\xf0",Euml:"\xcb",euml:"\xeb",euro:"\u20ac",excl:"!",exist:"\u2203",Exists:"\u2203",expectation:"\u2130",exponentiale:"\u2147",ExponentialE:"\u2147",fallingdotseq:"\u2252",Fcy:"\u0424",fcy:"\u0444",female:"\u2640",ffilig:"\ufb03",fflig:"\ufb00",ffllig:"\ufb04",Ffr:"\ud835\udd09",ffr:"\ud835\udd23",filig:"\ufb01",FilledSmallSquare:"\u25fc",FilledVerySmallSquare:"\u25aa",fjlig:"fj",flat:"\u266d",fllig:"\ufb02",fltns:"\u25b1",fnof:"\u0192",Fopf:"\ud835\udd3d",fopf:"\ud835\udd57",forall:"\u2200",ForAll:"\u2200",fork:"\u22d4",forkv:"\u2ad9",Fouriertrf:"\u2131",fpartint:"\u2a0d",frac12:"\xbd",frac13:"\u2153",frac14:"\xbc",frac15:"\u2155",frac16:"\u2159",frac18:"\u215b",frac23:"\u2154",frac25:"\u2156",frac34:"\xbe",frac35:"\u2157",frac38:"\u215c",frac45:"\u2158",frac56:"\u215a",frac58:"\u215d",frac78:"\u215e",frasl:"\u2044",frown:"\u2322",fscr:"\ud835\udcbb",Fscr:"\u2131",gacute:"\u01f5",Gamma:"\u0393",gamma:"\u03b3",Gammad:"\u03dc",gammad:"\u03dd",gap:"\u2a86",Gbreve:"\u011e",gbreve:"\u011f",Gcedil:"\u0122",Gcirc:"\u011c",gcirc:"\u011d",Gcy:"\u0413",gcy:"\u0433",Gdot:"\u0120",gdot:"\u0121",ge:"\u2265",gE:"\u2267",gEl:"\u2a8c",gel:"\u22db",geq:"\u2265",geqq:"\u2267",geqslant:"\u2a7e",gescc:"\u2aa9",ges:"\u2a7e",gesdot:"\u2a80",gesdoto:"\u2a82",gesdotol:"\u2a84",gesl:"\u22db\ufe00",gesles:"\u2a94",Gfr:"\ud835\udd0a",gfr:"\ud835\udd24",gg:"\u226b",Gg:"\u22d9",ggg:"\u22d9",gimel:"\u2137",GJcy:"\u0403",gjcy:"\u0453",gla:"\u2aa5",gl:"\u2277",glE:"\u2a92",glj:"\u2aa4",gnap:"\u2a8a",gnapprox:"\u2a8a",gne:"\u2a88",gnE:"\u2269",gneq:"\u2a88",gneqq:"\u2269",gnsim:"\u22e7",Gopf:"\ud835\udd3e",gopf:"\ud835\udd58",grave:"`",GreaterEqual:"\u2265",GreaterEqualLess:"\u22db",GreaterFullEqual:"\u2267",GreaterGreater:"\u2aa2",GreaterLess:"\u2277",GreaterSlantEqual:"\u2a7e",GreaterTilde:"\u2273",Gscr:"\ud835\udca2",gscr:"\u210a",gsim:"\u2273",gsime:"\u2a8e",gsiml:"\u2a90",gtcc:"\u2aa7",gtcir:"\u2a7a",gt:">",GT:">",Gt:"\u226b",gtdot:"\u22d7",gtlPar:"\u2995",gtquest:"\u2a7c",gtrapprox:"\u2a86",gtrarr:"\u2978",gtrdot:"\u22d7",gtreqless:"\u22db",gtreqqless:"\u2a8c",gtrless:"\u2277",gtrsim:"\u2273",gvertneqq:"\u2269\ufe00",gvnE:"\u2269\ufe00",Hacek:"\u02c7",hairsp:"\u200a",half:"\xbd",hamilt:"\u210b",HARDcy:"\u042a",hardcy:"\u044a",harrcir:"\u2948",harr:"\u2194",hArr:"\u21d4",harrw:"\u21ad",Hat:"^",hbar:"\u210f",Hcirc:"\u0124",hcirc:"\u0125",hearts:"\u2665",heartsuit:"\u2665",hellip:"\u2026",hercon:"\u22b9",hfr:"\ud835\udd25",Hfr:"\u210c",HilbertSpace:"\u210b",hksearow:"\u2925",hkswarow:"\u2926",hoarr:"\u21ff",homtht:"\u223b",hookleftarrow:"\u21a9",hookrightarrow:"\u21aa",hopf:"\ud835\udd59",Hopf:"\u210d",horbar:"\u2015",HorizontalLine:"\u2500",hscr:"\ud835\udcbd",Hscr:"\u210b",hslash:"\u210f",Hstrok:"\u0126",hstrok:"\u0127",HumpDownHump:"\u224e",HumpEqual:"\u224f",hybull:"\u2043",hyphen:"\u2010",Iacute:"\xcd",iacute:"\xed",ic:"\u2063",Icirc:"\xce",icirc:"\xee",Icy:"\u0418",icy:"\u0438",Idot:"\u0130",IEcy:"\u0415",iecy:"\u0435",iexcl:"\xa1",iff:"\u21d4",ifr:"\ud835\udd26",Ifr:"\u2111",Igrave:"\xcc",igrave:"\xec",ii:"\u2148",iiiint:"\u2a0c",iiint:"\u222d",iinfin:"\u29dc",iiota:"\u2129",IJlig:"\u0132",ijlig:"\u0133",Imacr:"\u012a",imacr:"\u012b",image:"\u2111",ImaginaryI:"\u2148",imagline:"\u2110",imagpart:"\u2111",imath:"\u0131",Im:"\u2111",imof:"\u22b7",imped:"\u01b5",Implies:"\u21d2",incare:"\u2105",in:"\u2208",infin:"\u221e",infintie:"\u29dd",inodot:"\u0131",intcal:"\u22ba",int:"\u222b",Int:"\u222c",integers:"\u2124",Integral:"\u222b",intercal:"\u22ba",Intersection:"\u22c2",intlarhk:"\u2a17",intprod:"\u2a3c",InvisibleComma:"\u2063",InvisibleTimes:"\u2062",IOcy:"\u0401",iocy:"\u0451",Iogon:"\u012e",iogon:"\u012f",Iopf:"\ud835\udd40",iopf:"\ud835\udd5a",Iota:"\u0399",iota:"\u03b9",iprod:"\u2a3c",iquest:"\xbf",iscr:"\ud835\udcbe",Iscr:"\u2110",isin:"\u2208",isindot:"\u22f5",isinE:"\u22f9",isins:"\u22f4",isinsv:"\u22f3",isinv:"\u2208",it:"\u2062",Itilde:"\u0128",itilde:"\u0129",Iukcy:"\u0406",iukcy:"\u0456",Iuml:"\xcf",iuml:"\xef",Jcirc:"\u0134",jcirc:"\u0135",Jcy:"\u0419",jcy:"\u0439",Jfr:"\ud835\udd0d",jfr:"\ud835\udd27",jmath:"\u0237",Jopf:"\ud835\udd41",jopf:"\ud835\udd5b",Jscr:"\ud835\udca5",jscr:"\ud835\udcbf",Jsercy:"\u0408",jsercy:"\u0458",Jukcy:"\u0404",jukcy:"\u0454",Kappa:"\u039a",kappa:"\u03ba",kappav:"\u03f0",Kcedil:"\u0136",kcedil:"\u0137",Kcy:"\u041a",kcy:"\u043a",Kfr:"\ud835\udd0e",kfr:"\ud835\udd28",kgreen:"\u0138",KHcy:"\u0425",khcy:"\u0445",KJcy:"\u040c",kjcy:"\u045c",Kopf:"\ud835\udd42",kopf:"\ud835\udd5c",Kscr:"\ud835\udca6",kscr:"\ud835\udcc0",lAarr:"\u21da",Lacute:"\u0139",lacute:"\u013a",laemptyv:"\u29b4",lagran:"\u2112",Lambda:"\u039b",lambda:"\u03bb",lang:"\u27e8",Lang:"\u27ea",langd:"\u2991",langle:"\u27e8",lap:"\u2a85",Laplacetrf:"\u2112",laquo:"\xab",larrb:"\u21e4",larrbfs:"\u291f",larr:"\u2190",Larr:"\u219e",lArr:"\u21d0",larrfs:"\u291d",larrhk:"\u21a9",larrlp:"\u21ab",larrpl:"\u2939",larrsim:"\u2973",larrtl:"\u21a2",latail:"\u2919",lAtail:"\u291b",lat:"\u2aab",late:"\u2aad",lates:"\u2aad\ufe00",lbarr:"\u290c",lBarr:"\u290e",lbbrk:"\u2772",lbrace:"{",lbrack:"[",lbrke:"\u298b",lbrksld:"\u298f",lbrkslu:"\u298d",Lcaron:"\u013d",lcaron:"\u013e",Lcedil:"\u013b",lcedil:"\u013c",lceil:"\u2308",lcub:"{",Lcy:"\u041b",lcy:"\u043b",ldca:"\u2936",ldquo:"\u201c",ldquor:"\u201e",ldrdhar:"\u2967",ldrushar:"\u294b",ldsh:"\u21b2",le:"\u2264",lE:"\u2266",LeftAngleBracket:"\u27e8",LeftArrowBar:"\u21e4",leftarrow:"\u2190",LeftArrow:"\u2190",Leftarrow:"\u21d0",LeftArrowRightArrow:"\u21c6",leftarrowtail:"\u21a2",LeftCeiling:"\u2308",LeftDoubleBracket:"\u27e6",LeftDownTeeVector:"\u2961",LeftDownVectorBar:"\u2959",LeftDownVector:"\u21c3",LeftFloor:"\u230a",leftharpoondown:"\u21bd",leftharpoonup:"\u21bc",leftleftarrows:"\u21c7",leftrightarrow:"\u2194",LeftRightArrow:"\u2194",Leftrightarrow:"\u21d4",leftrightarrows:"\u21c6",leftrightharpoons:"\u21cb",leftrightsquigarrow:"\u21ad",LeftRightVector:"\u294e",LeftTeeArrow:"\u21a4",LeftTee:"\u22a3",LeftTeeVector:"\u295a",leftthreetimes:"\u22cb",LeftTriangleBar:"\u29cf",LeftTriangle:"\u22b2",LeftTriangleEqual:"\u22b4",LeftUpDownVector:"\u2951",LeftUpTeeVector:"\u2960",LeftUpVectorBar:"\u2958",LeftUpVector:"\u21bf",LeftVectorBar:"\u2952",LeftVector:"\u21bc",lEg:"\u2a8b",leg:"\u22da",leq:"\u2264",leqq:"\u2266",leqslant:"\u2a7d",lescc:"\u2aa8",les:"\u2a7d",lesdot:"\u2a7f",lesdoto:"\u2a81",lesdotor:"\u2a83",lesg:"\u22da\ufe00",lesges:"\u2a93",lessapprox:"\u2a85",lessdot:"\u22d6",lesseqgtr:"\u22da",lesseqqgtr:"\u2a8b",LessEqualGreater:"\u22da",LessFullEqual:"\u2266",LessGreater:"\u2276",lessgtr:"\u2276",LessLess:"\u2aa1",lesssim:"\u2272",LessSlantEqual:"\u2a7d",LessTilde:"\u2272",lfisht:"\u297c",lfloor:"\u230a",Lfr:"\ud835\udd0f",lfr:"\ud835\udd29",lg:"\u2276",lgE:"\u2a91",lHar:"\u2962",lhard:"\u21bd",lharu:"\u21bc",lharul:"\u296a",lhblk:"\u2584",LJcy:"\u0409",ljcy:"\u0459",llarr:"\u21c7",ll:"\u226a",Ll:"\u22d8",llcorner:"\u231e",Lleftarrow:"\u21da",llhard:"\u296b",lltri:"\u25fa",Lmidot:"\u013f",lmidot:"\u0140",lmoustache:"\u23b0",lmoust:"\u23b0",lnap:"\u2a89",lnapprox:"\u2a89",lne:"\u2a87",lnE:"\u2268",lneq:"\u2a87",lneqq:"\u2268",lnsim:"\u22e6",loang:"\u27ec",loarr:"\u21fd",lobrk:"\u27e6",longleftarrow:"\u27f5",LongLeftArrow:"\u27f5",Longleftarrow:"\u27f8",longleftrightarrow:"\u27f7",LongLeftRightArrow:"\u27f7",Longleftrightarrow:"\u27fa",longmapsto:"\u27fc",longrightarrow:"\u27f6",LongRightArrow:"\u27f6",Longrightarrow:"\u27f9",looparrowleft:"\u21ab",looparrowright:"\u21ac",lopar:"\u2985",Lopf:"\ud835\udd43",lopf:"\ud835\udd5d",loplus:"\u2a2d",lotimes:"\u2a34",lowast:"\u2217",lowbar:"_",LowerLeftArrow:"\u2199",LowerRightArrow:"\u2198",loz:"\u25ca",lozenge:"\u25ca",lozf:"\u29eb",lpar:"(",lparlt:"\u2993",lrarr:"\u21c6",lrcorner:"\u231f",lrhar:"\u21cb",lrhard:"\u296d",lrm:"\u200e",lrtri:"\u22bf",lsaquo:"\u2039",lscr:"\ud835\udcc1",Lscr:"\u2112",lsh:"\u21b0",Lsh:"\u21b0",lsim:"\u2272",lsime:"\u2a8d",lsimg:"\u2a8f",lsqb:"[",lsquo:"\u2018",lsquor:"\u201a",Lstrok:"\u0141",lstrok:"\u0142",ltcc:"\u2aa6",ltcir:"\u2a79",lt:"<",LT:"<",Lt:"\u226a",ltdot:"\u22d6",lthree:"\u22cb",ltimes:"\u22c9",ltlarr:"\u2976",ltquest:"\u2a7b",ltri:"\u25c3",ltrie:"\u22b4",ltrif:"\u25c2",ltrPar:"\u2996",lurdshar:"\u294a",luruhar:"\u2966",lvertneqq:"\u2268\ufe00",lvnE:"\u2268\ufe00",macr:"\xaf",male:"\u2642",malt:"\u2720",maltese:"\u2720",Map:"\u2905",map:"\u21a6",mapsto:"\u21a6",mapstodown:"\u21a7",mapstoleft:"\u21a4",mapstoup:"\u21a5",marker:"\u25ae",mcomma:"\u2a29",Mcy:"\u041c",mcy:"\u043c",mdash:"\u2014",mDDot:"\u223a",measuredangle:"\u2221",MediumSpace:"\u205f",Mellintrf:"\u2133",Mfr:"\ud835\udd10",mfr:"\ud835\udd2a",mho:"\u2127",micro:"\xb5",midast:"*",midcir:"\u2af0",mid:"\u2223",middot:"\xb7",minusb:"\u229f",minus:"\u2212",minusd:"\u2238",minusdu:"\u2a2a",MinusPlus:"\u2213",mlcp:"\u2adb",mldr:"\u2026",mnplus:"\u2213",models:"\u22a7",Mopf:"\ud835\udd44",mopf:"\ud835\udd5e",mp:"\u2213",mscr:"\ud835\udcc2",Mscr:"\u2133",mstpos:"\u223e",Mu:"\u039c",mu:"\u03bc",multimap:"\u22b8",mumap:"\u22b8",nabla:"\u2207",Nacute:"\u0143",nacute:"\u0144",nang:"\u2220\u20d2",nap:"\u2249",napE:"\u2a70\u0338",napid:"\u224b\u0338",napos:"\u0149",napprox:"\u2249",natural:"\u266e",naturals:"\u2115",natur:"\u266e",nbsp:"\xa0",nbump:"\u224e\u0338",nbumpe:"\u224f\u0338",ncap:"\u2a43",Ncaron:"\u0147",ncaron:"\u0148",Ncedil:"\u0145",ncedil:"\u0146",ncong:"\u2247",ncongdot:"\u2a6d\u0338",ncup:"\u2a42",Ncy:"\u041d",ncy:"\u043d",ndash:"\u2013",nearhk:"\u2924",nearr:"\u2197",neArr:"\u21d7",nearrow:"\u2197",ne:"\u2260",nedot:"\u2250\u0338",NegativeMediumSpace:"\u200b",NegativeThickSpace:"\u200b",NegativeThinSpace:"\u200b",NegativeVeryThinSpace:"\u200b",nequiv:"\u2262",nesear:"\u2928",nesim:"\u2242\u0338",NestedGreaterGreater:"\u226b",NestedLessLess:"\u226a",NewLine:"\n",nexist:"\u2204",nexists:"\u2204",Nfr:"\ud835\udd11",nfr:"\ud835\udd2b",ngE:"\u2267\u0338",nge:"\u2271",ngeq:"\u2271",ngeqq:"\u2267\u0338",ngeqslant:"\u2a7e\u0338",nges:"\u2a7e\u0338",nGg:"\u22d9\u0338",ngsim:"\u2275",nGt:"\u226b\u20d2",ngt:"\u226f",ngtr:"\u226f",nGtv:"\u226b\u0338",nharr:"\u21ae",nhArr:"\u21ce",nhpar:"\u2af2",ni:"\u220b",nis:"\u22fc",nisd:"\u22fa",niv:"\u220b",NJcy:"\u040a",njcy:"\u045a",nlarr:"\u219a",nlArr:"\u21cd",nldr:"\u2025",nlE:"\u2266\u0338",nle:"\u2270",nleftarrow:"\u219a",nLeftarrow:"\u21cd",nleftrightarrow:"\u21ae",nLeftrightarrow:"\u21ce",nleq:"\u2270",nleqq:"\u2266\u0338",nleqslant:"\u2a7d\u0338",nles:"\u2a7d\u0338",nless:"\u226e",nLl:"\u22d8\u0338",nlsim:"\u2274",nLt:"\u226a\u20d2",nlt:"\u226e",nltri:"\u22ea",nltrie:"\u22ec",nLtv:"\u226a\u0338",nmid:"\u2224",NoBreak:"\u2060",NonBreakingSpace:"\xa0",nopf:"\ud835\udd5f",Nopf:"\u2115",Not:"\u2aec",not:"\xac",NotCongruent:"\u2262",NotCupCap:"\u226d",NotDoubleVerticalBar:"\u2226",NotElement:"\u2209",NotEqual:"\u2260",NotEqualTilde:"\u2242\u0338",NotExists:"\u2204",NotGreater:"\u226f",NotGreaterEqual:"\u2271",NotGreaterFullEqual:"\u2267\u0338",NotGreaterGreater:"\u226b\u0338",NotGreaterLess:"\u2279",NotGreaterSlantEqual:"\u2a7e\u0338",NotGreaterTilde:"\u2275",NotHumpDownHump:"\u224e\u0338",NotHumpEqual:"\u224f\u0338",notin:"\u2209",notindot:"\u22f5\u0338",notinE:"\u22f9\u0338",notinva:"\u2209",notinvb:"\u22f7",notinvc:"\u22f6",NotLeftTriangleBar:"\u29cf\u0338",NotLeftTriangle:"\u22ea",NotLeftTriangleEqual:"\u22ec",NotLess:"\u226e",NotLessEqual:"\u2270",NotLessGreater:"\u2278",NotLessLess:"\u226a\u0338",NotLessSlantEqual:"\u2a7d\u0338",NotLessTilde:"\u2274",NotNestedGreaterGreater:"\u2aa2\u0338",NotNestedLessLess:"\u2aa1\u0338",notni:"\u220c",notniva:"\u220c",notnivb:"\u22fe",notnivc:"\u22fd",NotPrecedes:"\u2280",NotPrecedesEqual:"\u2aaf\u0338",NotPrecedesSlantEqual:"\u22e0",NotReverseElement:"\u220c",NotRightTriangleBar:"\u29d0\u0338",NotRightTriangle:"\u22eb",NotRightTriangleEqual:"\u22ed",NotSquareSubset:"\u228f\u0338",NotSquareSubsetEqual:"\u22e2",NotSquareSuperset:"\u2290\u0338",NotSquareSupersetEqual:"\u22e3",NotSubset:"\u2282\u20d2",NotSubsetEqual:"\u2288",NotSucceeds:"\u2281",NotSucceedsEqual:"\u2ab0\u0338",NotSucceedsSlantEqual:"\u22e1",NotSucceedsTilde:"\u227f\u0338",NotSuperset:"\u2283\u20d2",NotSupersetEqual:"\u2289",NotTilde:"\u2241",NotTildeEqual:"\u2244",NotTildeFullEqual:"\u2247",NotTildeTilde:"\u2249",NotVerticalBar:"\u2224",nparallel:"\u2226",npar:"\u2226",nparsl:"\u2afd\u20e5",npart:"\u2202\u0338",npolint:"\u2a14",npr:"\u2280",nprcue:"\u22e0",nprec:"\u2280",npreceq:"\u2aaf\u0338",npre:"\u2aaf\u0338",nrarrc:"\u2933\u0338",nrarr:"\u219b",nrArr:"\u21cf",nrarrw:"\u219d\u0338",nrightarrow:"\u219b",nRightarrow:"\u21cf",nrtri:"\u22eb",nrtrie:"\u22ed",nsc:"\u2281",nsccue:"\u22e1",nsce:"\u2ab0\u0338",Nscr:"\ud835\udca9",nscr:"\ud835\udcc3",nshortmid:"\u2224",nshortparallel:"\u2226",nsim:"\u2241",nsime:"\u2244",nsimeq:"\u2244",nsmid:"\u2224",nspar:"\u2226",nsqsube:"\u22e2",nsqsupe:"\u22e3",nsub:"\u2284",nsubE:"\u2ac5\u0338",nsube:"\u2288",nsubset:"\u2282\u20d2",nsubseteq:"\u2288",nsubseteqq:"\u2ac5\u0338",nsucc:"\u2281",nsucceq:"\u2ab0\u0338",nsup:"\u2285",nsupE:"\u2ac6\u0338",nsupe:"\u2289",nsupset:"\u2283\u20d2",nsupseteq:"\u2289",nsupseteqq:"\u2ac6\u0338",ntgl:"\u2279",Ntilde:"\xd1",ntilde:"\xf1",ntlg:"\u2278",ntriangleleft:"\u22ea",ntrianglelefteq:"\u22ec",ntriangleright:"\u22eb",ntrianglerighteq:"\u22ed",Nu:"\u039d",nu:"\u03bd",num:"#",numero:"\u2116",numsp:"\u2007",nvap:"\u224d\u20d2",nvdash:"\u22ac",nvDash:"\u22ad",nVdash:"\u22ae",nVDash:"\u22af",nvge:"\u2265\u20d2",nvgt:">\u20d2",nvHarr:"\u2904",nvinfin:"\u29de",nvlArr:"\u2902",nvle:"\u2264\u20d2",nvlt:"<\u20d2",nvltrie:"\u22b4\u20d2",nvrArr:"\u2903",nvrtrie:"\u22b5\u20d2",nvsim:"\u223c\u20d2",nwarhk:"\u2923",nwarr:"\u2196",nwArr:"\u21d6",nwarrow:"\u2196",nwnear:"\u2927",Oacute:"\xd3",oacute:"\xf3",oast:"\u229b",Ocirc:"\xd4",ocirc:"\xf4",ocir:"\u229a",Ocy:"\u041e",ocy:"\u043e",odash:"\u229d",Odblac:"\u0150",odblac:"\u0151",odiv:"\u2a38",odot:"\u2299",odsold:"\u29bc",OElig:"\u0152",oelig:"\u0153",ofcir:"\u29bf",Ofr:"\ud835\udd12",ofr:"\ud835\udd2c",ogon:"\u02db",Ograve:"\xd2",ograve:"\xf2",ogt:"\u29c1",ohbar:"\u29b5",ohm:"\u03a9",oint:"\u222e",olarr:"\u21ba",olcir:"\u29be",olcross:"\u29bb",oline:"\u203e",olt:"\u29c0",Omacr:"\u014c",omacr:"\u014d",Omega:"\u03a9",omega:"\u03c9",Omicron:"\u039f",omicron:"\u03bf",omid:"\u29b6",ominus:"\u2296",Oopf:"\ud835\udd46",oopf:"\ud835\udd60",opar:"\u29b7",OpenCurlyDoubleQuote:"\u201c",OpenCurlyQuote:"\u2018",operp:"\u29b9",oplus:"\u2295",orarr:"\u21bb",Or:"\u2a54",or:"\u2228",ord:"\u2a5d",order:"\u2134",orderof:"\u2134",ordf:"\xaa",ordm:"\xba",origof:"\u22b6",oror:"\u2a56",orslope:"\u2a57",orv:"\u2a5b",oS:"\u24c8",Oscr:"\ud835\udcaa",oscr:"\u2134",Oslash:"\xd8",oslash:"\xf8",osol:"\u2298",Otilde:"\xd5",otilde:"\xf5",otimesas:"\u2a36",Otimes:"\u2a37",otimes:"\u2297",Ouml:"\xd6",ouml:"\xf6",ovbar:"\u233d",OverBar:"\u203e",OverBrace:"\u23de",OverBracket:"\u23b4",OverParenthesis:"\u23dc",para:"\xb6",parallel:"\u2225",par:"\u2225",parsim:"\u2af3",parsl:"\u2afd",part:"\u2202",PartialD:"\u2202",Pcy:"\u041f",pcy:"\u043f",percnt:"%",period:".",permil:"\u2030",perp:"\u22a5",pertenk:"\u2031",Pfr:"\ud835\udd13",pfr:"\ud835\udd2d",Phi:"\u03a6",phi:"\u03c6",phiv:"\u03d5",phmmat:"\u2133",phone:"\u260e",Pi:"\u03a0",pi:"\u03c0",pitchfork:"\u22d4",piv:"\u03d6",planck:"\u210f",planckh:"\u210e",plankv:"\u210f",plusacir:"\u2a23",plusb:"\u229e",pluscir:"\u2a22",plus:"+",plusdo:"\u2214",plusdu:"\u2a25",pluse:"\u2a72",PlusMinus:"\xb1",plusmn:"\xb1",plussim:"\u2a26",plustwo:"\u2a27",pm:"\xb1",Poincareplane:"\u210c",pointint:"\u2a15",popf:"\ud835\udd61",Popf:"\u2119",pound:"\xa3",prap:"\u2ab7",Pr:"\u2abb",pr:"\u227a",prcue:"\u227c",precapprox:"\u2ab7",prec:"\u227a",preccurlyeq:"\u227c",Precedes:"\u227a",PrecedesEqual:"\u2aaf",PrecedesSlantEqual:"\u227c",PrecedesTilde:"\u227e",preceq:"\u2aaf",precnapprox:"\u2ab9",precneqq:"\u2ab5",precnsim:"\u22e8",pre:"\u2aaf",prE:"\u2ab3",precsim:"\u227e",prime:"\u2032",Prime:"\u2033",primes:"\u2119",prnap:"\u2ab9",prnE:"\u2ab5",prnsim:"\u22e8",prod:"\u220f",Product:"\u220f",profalar:"\u232e",profline:"\u2312",profsurf:"\u2313",prop:"\u221d",Proportional:"\u221d",Proportion:"\u2237",propto:"\u221d",prsim:"\u227e",prurel:"\u22b0",Pscr:"\ud835\udcab",pscr:"\ud835\udcc5",Psi:"\u03a8",psi:"\u03c8",puncsp:"\u2008",Qfr:"\ud835\udd14",qfr:"\ud835\udd2e",qint:"\u2a0c",qopf:"\ud835\udd62",Qopf:"\u211a",qprime:"\u2057",Qscr:"\ud835\udcac",qscr:"\ud835\udcc6",quaternions:"\u210d",quatint:"\u2a16",quest:"?",questeq:"\u225f",quot:'"',QUOT:'"',rAarr:"\u21db",race:"\u223d\u0331",Racute:"\u0154",racute:"\u0155",radic:"\u221a",raemptyv:"\u29b3",rang:"\u27e9",Rang:"\u27eb",rangd:"\u2992",range:"\u29a5",rangle:"\u27e9",raquo:"\xbb",rarrap:"\u2975",rarrb:"\u21e5",rarrbfs:"\u2920",rarrc:"\u2933",rarr:"\u2192",Rarr:"\u21a0",rArr:"\u21d2",rarrfs:"\u291e",rarrhk:"\u21aa",rarrlp:"\u21ac",rarrpl:"\u2945",rarrsim:"\u2974",Rarrtl:"\u2916",rarrtl:"\u21a3",rarrw:"\u219d",ratail:"\u291a",rAtail:"\u291c",ratio:"\u2236",rationals:"\u211a",rbarr:"\u290d",rBarr:"\u290f",RBarr:"\u2910",rbbrk:"\u2773",rbrace:"}",rbrack:"]",rbrke:"\u298c",rbrksld:"\u298e",rbrkslu:"\u2990",Rcaron:"\u0158",rcaron:"\u0159",Rcedil:"\u0156",rcedil:"\u0157",rceil:"\u2309",rcub:"}",Rcy:"\u0420",rcy:"\u0440",rdca:"\u2937",rdldhar:"\u2969",rdquo:"\u201d",rdquor:"\u201d",rdsh:"\u21b3",real:"\u211c",realine:"\u211b",realpart:"\u211c",reals:"\u211d",Re:"\u211c",rect:"\u25ad",reg:"\xae",REG:"\xae",ReverseElement:"\u220b",ReverseEquilibrium:"\u21cb",ReverseUpEquilibrium:"\u296f",rfisht:"\u297d",rfloor:"\u230b",rfr:"\ud835\udd2f",Rfr:"\u211c",rHar:"\u2964",rhard:"\u21c1",rharu:"\u21c0",rharul:"\u296c",Rho:"\u03a1",rho:"\u03c1",rhov:"\u03f1",RightAngleBracket:"\u27e9",RightArrowBar:"\u21e5",rightarrow:"\u2192",RightArrow:"\u2192",Rightarrow:"\u21d2",RightArrowLeftArrow:"\u21c4",rightarrowtail:"\u21a3",RightCeiling:"\u2309",RightDoubleBracket:"\u27e7",RightDownTeeVector:"\u295d",RightDownVectorBar:"\u2955",RightDownVector:"\u21c2",RightFloor:"\u230b",rightharpoondown:"\u21c1",rightharpoonup:"\u21c0",rightleftarrows:"\u21c4",rightleftharpoons:"\u21cc",rightrightarrows:"\u21c9",rightsquigarrow:"\u219d",RightTeeArrow:"\u21a6",RightTee:"\u22a2",RightTeeVector:"\u295b",rightthreetimes:"\u22cc",RightTriangleBar:"\u29d0",RightTriangle:"\u22b3",RightTriangleEqual:"\u22b5",RightUpDownVector:"\u294f",RightUpTeeVector:"\u295c",RightUpVectorBar:"\u2954",RightUpVector:"\u21be",RightVectorBar:"\u2953",RightVector:"\u21c0",ring:"\u02da",risingdotseq:"\u2253",rlarr:"\u21c4",rlhar:"\u21cc",rlm:"\u200f",rmoustache:"\u23b1",rmoust:"\u23b1",rnmid:"\u2aee",roang:"\u27ed",roarr:"\u21fe",robrk:"\u27e7",ropar:"\u2986",ropf:"\ud835\udd63",Ropf:"\u211d",roplus:"\u2a2e",rotimes:"\u2a35",RoundImplies:"\u2970",rpar:")",rpargt:"\u2994",rppolint:"\u2a12",rrarr:"\u21c9",Rrightarrow:"\u21db",rsaquo:"\u203a",rscr:"\ud835\udcc7",Rscr:"\u211b",rsh:"\u21b1",Rsh:"\u21b1",rsqb:"]",rsquo:"\u2019",rsquor:"\u2019",rthree:"\u22cc",rtimes:"\u22ca",rtri:"\u25b9",rtrie:"\u22b5",rtrif:"\u25b8",rtriltri:"\u29ce",RuleDelayed:"\u29f4",ruluhar:"\u2968",rx:"\u211e",Sacute:"\u015a",sacute:"\u015b",sbquo:"\u201a",scap:"\u2ab8",Scaron:"\u0160",scaron:"\u0161",Sc:"\u2abc",sc:"\u227b",sccue:"\u227d",sce:"\u2ab0",scE:"\u2ab4",Scedil:"\u015e",scedil:"\u015f",Scirc:"\u015c",scirc:"\u015d",scnap:"\u2aba",scnE:"\u2ab6",scnsim:"\u22e9",scpolint:"\u2a13",scsim:"\u227f",Scy:"\u0421",scy:"\u0441",sdotb:"\u22a1",sdot:"\u22c5",sdote:"\u2a66",searhk:"\u2925",searr:"\u2198",seArr:"\u21d8",searrow:"\u2198",sect:"\xa7",semi:";",seswar:"\u2929",setminus:"\u2216",setmn:"\u2216",sext:"\u2736",Sfr:"\ud835\udd16",sfr:"\ud835\udd30",sfrown:"\u2322",sharp:"\u266f",SHCHcy:"\u0429",shchcy:"\u0449",SHcy:"\u0428",shcy:"\u0448",ShortDownArrow:"\u2193",ShortLeftArrow:"\u2190",shortmid:"\u2223",shortparallel:"\u2225",ShortRightArrow:"\u2192",ShortUpArrow:"\u2191",shy:"\xad",Sigma:"\u03a3",sigma:"\u03c3",sigmaf:"\u03c2",sigmav:"\u03c2",sim:"\u223c",simdot:"\u2a6a",sime:"\u2243",simeq:"\u2243",simg:"\u2a9e",simgE:"\u2aa0",siml:"\u2a9d",simlE:"\u2a9f",simne:"\u2246",simplus:"\u2a24",simrarr:"\u2972",slarr:"\u2190",SmallCircle:"\u2218",smallsetminus:"\u2216",smashp:"\u2a33",smeparsl:"\u29e4",smid:"\u2223",smile:"\u2323",smt:"\u2aaa",smte:"\u2aac",smtes:"\u2aac\ufe00",SOFTcy:"\u042c",softcy:"\u044c",solbar:"\u233f",solb:"\u29c4",sol:"/",Sopf:"\ud835\udd4a",sopf:"\ud835\udd64",spades:"\u2660",spadesuit:"\u2660",spar:"\u2225",sqcap:"\u2293",sqcaps:"\u2293\ufe00",sqcup:"\u2294",sqcups:"\u2294\ufe00",Sqrt:"\u221a",sqsub:"\u228f",sqsube:"\u2291",sqsubset:"\u228f",sqsubseteq:"\u2291",sqsup:"\u2290",sqsupe:"\u2292",sqsupset:"\u2290",sqsupseteq:"\u2292",square:"\u25a1",Square:"\u25a1",SquareIntersection:"\u2293",SquareSubset:"\u228f",SquareSubsetEqual:"\u2291",SquareSuperset:"\u2290",SquareSupersetEqual:"\u2292",SquareUnion:"\u2294",squarf:"\u25aa",squ:"\u25a1",squf:"\u25aa",srarr:"\u2192",Sscr:"\ud835\udcae",sscr:"\ud835\udcc8",ssetmn:"\u2216",ssmile:"\u2323",sstarf:"\u22c6",Star:"\u22c6",star:"\u2606",starf:"\u2605",straightepsilon:"\u03f5",straightphi:"\u03d5",strns:"\xaf",sub:"\u2282",Sub:"\u22d0",subdot:"\u2abd",subE:"\u2ac5",sube:"\u2286",subedot:"\u2ac3",submult:"\u2ac1",subnE:"\u2acb",subne:"\u228a",subplus:"\u2abf",subrarr:"\u2979",subset:"\u2282",Subset:"\u22d0",subseteq:"\u2286",subseteqq:"\u2ac5",SubsetEqual:"\u2286",subsetneq:"\u228a",subsetneqq:"\u2acb",subsim:"\u2ac7",subsub:"\u2ad5",subsup:"\u2ad3",succapprox:"\u2ab8",succ:"\u227b",succcurlyeq:"\u227d",Succeeds:"\u227b",SucceedsEqual:"\u2ab0",SucceedsSlantEqual:"\u227d",SucceedsTilde:"\u227f",succeq:"\u2ab0",succnapprox:"\u2aba",succneqq:"\u2ab6",succnsim:"\u22e9",succsim:"\u227f",SuchThat:"\u220b",sum:"\u2211",Sum:"\u2211",sung:"\u266a",sup1:"\xb9",sup2:"\xb2",sup3:"\xb3",sup:"\u2283",Sup:"\u22d1",supdot:"\u2abe",supdsub:"\u2ad8",supE:"\u2ac6",supe:"\u2287",supedot:"\u2ac4",Superset:"\u2283",SupersetEqual:"\u2287",suphsol:"\u27c9",suphsub:"\u2ad7",suplarr:"\u297b",supmult:"\u2ac2",supnE:"\u2acc",supne:"\u228b",supplus:"\u2ac0",supset:"\u2283",Supset:"\u22d1",supseteq:"\u2287",supseteqq:"\u2ac6",supsetneq:"\u228b",supsetneqq:"\u2acc",supsim:"\u2ac8",supsub:"\u2ad4",supsup:"\u2ad6",swarhk:"\u2926",swarr:"\u2199",swArr:"\u21d9",swarrow:"\u2199",swnwar:"\u292a",szlig:"\xdf",Tab:"\t",target:"\u2316",Tau:"\u03a4",tau:"\u03c4",tbrk:"\u23b4",Tcaron:"\u0164",tcaron:"\u0165",Tcedil:"\u0162",tcedil:"\u0163",Tcy:"\u0422",tcy:"\u0442",tdot:"\u20db",telrec:"\u2315",Tfr:"\ud835\udd17",tfr:"\ud835\udd31",there4:"\u2234",therefore:"\u2234",Therefore:"\u2234",Theta:"\u0398",theta:"\u03b8",thetasym:"\u03d1",thetav:"\u03d1",thickapprox:"\u2248",thicksim:"\u223c",ThickSpace:"\u205f\u200a",ThinSpace:"\u2009",thinsp:"\u2009",thkap:"\u2248",thksim:"\u223c",THORN:"\xde",thorn:"\xfe",tilde:"\u02dc",Tilde:"\u223c",TildeEqual:"\u2243",TildeFullEqual:"\u2245",TildeTilde:"\u2248",timesbar:"\u2a31",timesb:"\u22a0",times:"\xd7",timesd:"\u2a30",tint:"\u222d",toea:"\u2928",topbot:"\u2336",topcir:"\u2af1",top:"\u22a4",Topf:"\ud835\udd4b",topf:"\ud835\udd65",topfork:"\u2ada",tosa:"\u2929",tprime:"\u2034",trade:"\u2122",TRADE:"\u2122",triangle:"\u25b5",triangledown:"\u25bf",triangleleft:"\u25c3",trianglelefteq:"\u22b4",triangleq:"\u225c",triangleright:"\u25b9",trianglerighteq:"\u22b5",tridot:"\u25ec",trie:"\u225c",triminus:"\u2a3a",TripleDot:"\u20db",triplus:"\u2a39",trisb:"\u29cd",tritime:"\u2a3b",trpezium:"\u23e2",Tscr:"\ud835\udcaf",tscr:"\ud835\udcc9",TScy:"\u0426",tscy:"\u0446",TSHcy:"\u040b",tshcy:"\u045b",Tstrok:"\u0166",tstrok:"\u0167",twixt:"\u226c",twoheadleftarrow:"\u219e",twoheadrightarrow:"\u21a0",Uacute:"\xda",uacute:"\xfa",uarr:"\u2191",Uarr:"\u219f",uArr:"\u21d1",Uarrocir:"\u2949",Ubrcy:"\u040e",ubrcy:"\u045e",Ubreve:"\u016c",ubreve:"\u016d",Ucirc:"\xdb",ucirc:"\xfb",Ucy:"\u0423",ucy:"\u0443",udarr:"\u21c5",Udblac:"\u0170",udblac:"\u0171",udhar:"\u296e",ufisht:"\u297e",Ufr:"\ud835\udd18",ufr:"\ud835\udd32",Ugrave:"\xd9",ugrave:"\xf9",uHar:"\u2963",uharl:"\u21bf",uharr:"\u21be",uhblk:"\u2580",ulcorn:"\u231c",ulcorner:"\u231c",ulcrop:"\u230f",ultri:"\u25f8",Umacr:"\u016a",umacr:"\u016b",uml:"\xa8",UnderBar:"_",UnderBrace:"\u23df",UnderBracket:"\u23b5",UnderParenthesis:"\u23dd",Union:"\u22c3",UnionPlus:"\u228e",Uogon:"\u0172",uogon:"\u0173",Uopf:"\ud835\udd4c",uopf:"\ud835\udd66",UpArrowBar:"\u2912",uparrow:"\u2191",UpArrow:"\u2191",Uparrow:"\u21d1",UpArrowDownArrow:"\u21c5",updownarrow:"\u2195",UpDownArrow:"\u2195",Updownarrow:"\u21d5",UpEquilibrium:"\u296e",upharpoonleft:"\u21bf",upharpoonright:"\u21be",uplus:"\u228e",UpperLeftArrow:"\u2196",UpperRightArrow:"\u2197",upsi:"\u03c5",Upsi:"\u03d2",upsih:"\u03d2",Upsilon:"\u03a5",upsilon:"\u03c5",UpTeeArrow:"\u21a5",UpTee:"\u22a5",upuparrows:"\u21c8",urcorn:"\u231d",urcorner:"\u231d",urcrop:"\u230e",Uring:"\u016e",uring:"\u016f",urtri:"\u25f9",Uscr:"\ud835\udcb0",uscr:"\ud835\udcca",utdot:"\u22f0",Utilde:"\u0168",utilde:"\u0169",utri:"\u25b5",utrif:"\u25b4",uuarr:"\u21c8",Uuml:"\xdc",uuml:"\xfc",uwangle:"\u29a7",vangrt:"\u299c",varepsilon:"\u03f5",varkappa:"\u03f0",varnothing:"\u2205",varphi:"\u03d5",varpi:"\u03d6",varpropto:"\u221d",varr:"\u2195",vArr:"\u21d5",varrho:"\u03f1",varsigma:"\u03c2",varsubsetneq:"\u228a\ufe00",varsubsetneqq:"\u2acb\ufe00",varsupsetneq:"\u228b\ufe00",varsupsetneqq:"\u2acc\ufe00",vartheta:"\u03d1",vartriangleleft:"\u22b2",vartriangleright:"\u22b3",vBar:"\u2ae8",Vbar:"\u2aeb",vBarv:"\u2ae9",Vcy:"\u0412",vcy:"\u0432",vdash:"\u22a2",vDash:"\u22a8",Vdash:"\u22a9",VDash:"\u22ab",Vdashl:"\u2ae6",veebar:"\u22bb",vee:"\u2228",Vee:"\u22c1",veeeq:"\u225a",vellip:"\u22ee",verbar:"|",Verbar:"\u2016",vert:"|",Vert:"\u2016",VerticalBar:"\u2223",VerticalLine:"|",VerticalSeparator:"\u2758",VerticalTilde:"\u2240",VeryThinSpace:"\u200a",Vfr:"\ud835\udd19",vfr:"\ud835\udd33",vltri:"\u22b2",vnsub:"\u2282\u20d2",vnsup:"\u2283\u20d2",Vopf:"\ud835\udd4d",vopf:"\ud835\udd67",vprop:"\u221d",vrtri:"\u22b3",Vscr:"\ud835\udcb1",vscr:"\ud835\udccb",vsubnE:"\u2acb\ufe00",vsubne:"\u228a\ufe00",vsupnE:"\u2acc\ufe00",vsupne:"\u228b\ufe00",Vvdash:"\u22aa",vzigzag:"\u299a",Wcirc:"\u0174",wcirc:"\u0175",wedbar:"\u2a5f",wedge:"\u2227",Wedge:"\u22c0",wedgeq:"\u2259",weierp:"\u2118",Wfr:"\ud835\udd1a",wfr:"\ud835\udd34",Wopf:"\ud835\udd4e",wopf:"\ud835\udd68",wp:"\u2118",wr:"\u2240",wreath:"\u2240",Wscr:"\ud835\udcb2",wscr:"\ud835\udccc",xcap:"\u22c2",xcirc:"\u25ef",xcup:"\u22c3",xdtri:"\u25bd",Xfr:"\ud835\udd1b",xfr:"\ud835\udd35",xharr:"\u27f7",xhArr:"\u27fa",Xi:"\u039e",xi:"\u03be",xlarr:"\u27f5",xlArr:"\u27f8",xmap:"\u27fc",xnis:"\u22fb",xodot:"\u2a00",Xopf:"\ud835\udd4f",xopf:"\ud835\udd69",xoplus:"\u2a01",xotime:"\u2a02",xrarr:"\u27f6",xrArr:"\u27f9",Xscr:"\ud835\udcb3",xscr:"\ud835\udccd",xsqcup:"\u2a06",xuplus:"\u2a04",xutri:"\u25b3",xvee:"\u22c1",xwedge:"\u22c0",Yacute:"\xdd",yacute:"\xfd",YAcy:"\u042f",yacy:"\u044f",Ycirc:"\u0176",ycirc:"\u0177",Ycy:"\u042b",ycy:"\u044b",yen:"\xa5",Yfr:"\ud835\udd1c",yfr:"\ud835\udd36",YIcy:"\u0407",yicy:"\u0457",Yopf:"\ud835\udd50",yopf:"\ud835\udd6a",Yscr:"\ud835\udcb4",yscr:"\ud835\udcce",YUcy:"\u042e",yucy:"\u044e",yuml:"\xff",Yuml:"\u0178",Zacute:"\u0179",zacute:"\u017a",Zcaron:"\u017d",zcaron:"\u017e",Zcy:"\u0417",zcy:"\u0437",Zdot:"\u017b",zdot:"\u017c",zeetrf:"\u2128",ZeroWidthSpace:"\u200b",Zeta:"\u0396",zeta:"\u03b6",zfr:"\ud835\udd37",Zfr:"\u2128",ZHcy:"\u0416",zhcy:"\u0436",zigrarr:"\u21dd",zopf:"\ud835\udd6b",Zopf:"\u2124",Zscr:"\ud835\udcb5",zscr:"\ud835\udccf",zwj:"\u200d",zwnj:"\u200c"},t=/[!-#%-\*,-\/:;\?@\[-\]_\{\}\xA1\xA7\xAB\xB6\xB7\xBB\xBF\u037E\u0387\u055A-\u055F\u0589\u058A\u05BE\u05C0\u05C3\u05C6\u05F3\u05F4\u0609\u060A\u060C\u060D\u061B\u061E\u061F\u066A-\u066D\u06D4\u0700-\u070D\u07F7-\u07F9\u0830-\u083E\u085E\u0964\u0965\u0970\u09FD\u0A76\u0AF0\u0C84\u0DF4\u0E4F\u0E5A\u0E5B\u0F04-\u0F12\u0F14\u0F3A-\u0F3D\u0F85\u0FD0-\u0FD4\u0FD9\u0FDA\u104A-\u104F\u10FB\u1360-\u1368\u1400\u166D\u166E\u169B\u169C\u16EB-\u16ED\u1735\u1736\u17D4-\u17D6\u17D8-\u17DA\u1800-\u180A\u1944\u1945\u1A1E\u1A1F\u1AA0-\u1AA6\u1AA8-\u1AAD\u1B5A-\u1B60\u1BFC-\u1BFF\u1C3B-\u1C3F\u1C7E\u1C7F\u1CC0-\u1CC7\u1CD3\u2010-\u2027\u2030-\u2043\u2045-\u2051\u2053-\u205E\u207D\u207E\u208D\u208E\u2308-\u230B\u2329\u232A\u2768-\u2775\u27C5\u27C6\u27E6-\u27EF\u2983-\u2998\u29D8-\u29DB\u29FC\u29FD\u2CF9-\u2CFC\u2CFE\u2CFF\u2D70\u2E00-\u2E2E\u2E30-\u2E4E\u3001-\u3003\u3008-\u3011\u3014-\u301F\u3030\u303D\u30A0\u30FB\uA4FE\uA4FF\uA60D-\uA60F\uA673\uA67E\uA6F2-\uA6F7\uA874-\uA877\uA8CE\uA8CF\uA8F8-\uA8FA\uA8FC\uA92E\uA92F\uA95F\uA9C1-\uA9CD\uA9DE\uA9DF\uAA5C-\uAA5F\uAADE\uAADF\uAAF0\uAAF1\uABEB\uFD3E\uFD3F\uFE10-\uFE19\uFE30-\uFE52\uFE54-\uFE61\uFE63\uFE68\uFE6A\uFE6B\uFF01-\uFF03\uFF05-\uFF0A\uFF0C-\uFF0F\uFF1A\uFF1B\uFF1F\uFF20\uFF3B-\uFF3D\uFF3F\uFF5B\uFF5D\uFF5F-\uFF65]|\uD800[\uDD00-\uDD02\uDF9F\uDFD0]|\uD801\uDD6F|\uD802[\uDC57\uDD1F\uDD3F\uDE50-\uDE58\uDE7F\uDEF0-\uDEF6\uDF39-\uDF3F\uDF99-\uDF9C]|\uD803[\uDF55-\uDF59]|\uD804[\uDC47-\uDC4D\uDCBB\uDCBC\uDCBE-\uDCC1\uDD40-\uDD43\uDD74\uDD75\uDDC5-\uDDC8\uDDCD\uDDDB\uDDDD-\uDDDF\uDE38-\uDE3D\uDEA9]|\uD805[\uDC4B-\uDC4F\uDC5B\uDC5D\uDCC6\uDDC1-\uDDD7\uDE41-\uDE43\uDE60-\uDE6C\uDF3C-\uDF3E]|\uD806[\uDC3B\uDE3F-\uDE46\uDE9A-\uDE9C\uDE9E-\uDEA2]|\uD807[\uDC41-\uDC45\uDC70\uDC71\uDEF7\uDEF8]|\uD809[\uDC70-\uDC74]|\uD81A[\uDE6E\uDE6F\uDEF5\uDF37-\uDF3B\uDF44]|\uD81B[\uDE97-\uDE9A]|\uD82F\uDC9F|\uD836[\uDE87-\uDE8B]|\uD83A[\uDD5E\uDD5F]/,n={};function s(e,r,t){var o,i,a,c,l,u="";for("string"!=typeof r&&(t=r,r=s.defaultChars),void 0===t&&(t=!0),l=function(e){var r,t,s=n[e];if(s)return s;for(s=n[e]=[],r=0;r<128;r++)t=String.fromCharCode(r),/^[0-9a-z]$/i.test(t)?s.push(t):s.push("%"+("0"+r.toString(16).toUpperCase()).slice(-2));for(r=0;r<e.length;r++)s[e.charCodeAt(r)]=e[r];return s}(r),o=0,i=e.length;o<i;o++)if(a=e.charCodeAt(o),t&&37===a&&o+2<i&&/^[0-9a-f]{2}$/i.test(e.slice(o+1,o+3)))u+=e.slice(o,o+3),o+=2;else if(a<128)u+=l[a];else if(a>=55296&&a<=57343){if(a>=55296&&a<=56319&&o+1<i&&(c=e.charCodeAt(o+1))>=56320&&c<=57343){u+=encodeURIComponent(e[o]+e[o+1]),o++;continue}u+="%EF%BF%BD"}else u+=encodeURIComponent(e[o]);return u}s.defaultChars=";/?:@&=+$,-_.!~*'()#",s.componentChars="-_.!~*'()";var o=s,i={};function a(e,r){var t;return"string"!=typeof r&&(r=a.defaultChars),t=function(e){var r,t,n=i[e];if(n)return n;for(n=i[e]=[],r=0;r<128;r++)t=String.fromCharCode(r),n.push(t);for(r=0;r<e.length;r++)n[t=e.charCodeAt(r)]="%"+("0"+t.toString(16).toUpperCase()).slice(-2);return n}(r),e.replace(/(%[a-f0-9]{2})+/gi,(function(e){var r,n,s,o,i,a,c,l="";for(r=0,n=e.length;r<n;r+=3)(s=parseInt(e.slice(r+1,r+3),16))<128?l+=t[s]:192==(224&s)&&r+3<n&&128==(192&(o=parseInt(e.slice(r+4,r+6),16)))?(l+=(c=s<<6&1984|63&o)<128?"\ufffd\ufffd":String.fromCharCode(c),r+=3):224==(240&s)&&r+6<n&&(o=parseInt(e.slice(r+4,r+6),16),i=parseInt(e.slice(r+7,r+9),16),128==(192&o)&&128==(192&i))?(l+=(c=s<<12&61440|o<<6&4032|63&i)<2048||c>=55296&&c<=57343?"\ufffd\ufffd\ufffd":String.fromCharCode(c),r+=6):240==(248&s)&&r+9<n&&(o=parseInt(e.slice(r+4,r+6),16),i=parseInt(e.slice(r+7,r+9),16),a=parseInt(e.slice(r+10,r+12),16),128==(192&o)&&128==(192&i)&&128==(192&a))?((c=s<<18&1835008|o<<12&258048|i<<6&4032|63&a)<65536||c>1114111?l+="\ufffd\ufffd\ufffd\ufffd":(c-=65536,l+=String.fromCharCode(55296+(c>>10),56320+(1023&c))),r+=9):l+="\ufffd";return l}))}a.defaultChars=";/?:@&=+$,#",a.componentChars="";var c=a;function l(){this.protocol=null,this.slashes=null,this.auth=null,this.port=null,this.hostname=null,this.hash=null,this.search=null,this.pathname=null}var u=/^([a-z0-9.+-]+:)/i,p=/:[0-9]*$/,h=/^(\/\/?(?!\/)[^\?\s]*)(\?[^\s]*)?$/,f=["{","}","|","\\","^","`"].concat(["<",">",'"',"`"," ","\r","\n","\t"]),d=["'"].concat(f),m=["%","/","?",";","#"].concat(d),g=["/","?","#"],_=/^[+a-z0-9A-Z_-]{0,63}$/,b=/^([+a-z0-9A-Z_-]{0,63})(.*)$/,k={javascript:!0,"javascript:":!0},v={http:!0,https:!0,ftp:!0,gopher:!0,file:!0,"http:":!0,"https:":!0,"ftp:":!0,"gopher:":!0,"file:":!0};l.prototype.parse=function(e,r){var t,n,s,o,i,a=e;if(a=a.trim(),!r&&1===e.split("#").length){var c=h.exec(a);if(c)return this.pathname=c[1],c[2]&&(this.search=c[2]),this}var l=u.exec(a);if(l&&(s=(l=l[0]).toLowerCase(),this.protocol=l,a=a.substr(l.length)),(r||l||a.match(/^\/\/[^@\/]+@[^@\/]+/))&&(!(i="//"===a.substr(0,2))||l&&k[l]||(a=a.substr(2),this.slashes=!0)),!k[l]&&(i||l&&!v[l])){var p,f,d=-1;for(t=0;t<g.length;t++)-1!==(o=a.indexOf(g[t]))&&(-1===d||o<d)&&(d=o);for(-1!==(f=-1===d?a.lastIndexOf("@"):a.lastIndexOf("@",d))&&(p=a.slice(0,f),a=a.slice(f+1),this.auth=p),d=-1,t=0;t<m.length;t++)-1!==(o=a.indexOf(m[t]))&&(-1===d||o<d)&&(d=o);-1===d&&(d=a.length),":"===a[d-1]&&d--;var C=a.slice(0,d);a=a.slice(d),this.parseHost(C),this.hostname=this.hostname||"";var y="["===this.hostname[0]&&"]"===this.hostname[this.hostname.length-1];if(!y){var A=this.hostname.split(/\./);for(t=0,n=A.length;t<n;t++){var x=A[t];if(x&&!x.match(_)){for(var D="",w=0,E=x.length;w<E;w++)x.charCodeAt(w)>127?D+="x":D+=x[w];if(!D.match(_)){var q=A.slice(0,t),S=A.slice(t+1),F=x.match(b);F&&(q.push(F[1]),S.unshift(F[2])),S.length&&(a=S.join(".")+a),this.hostname=q.join(".");break}}}}this.hostname.length>255&&(this.hostname=""),y&&(this.hostname=this.hostname.substr(1,this.hostname.length-2))}var L=a.indexOf("#");-1!==L&&(this.hash=a.substr(L),a=a.slice(0,L));var z=a.indexOf("?");return-1!==z&&(this.search=a.substr(z),a=a.slice(0,z)),a&&(this.pathname=a),v[s]&&this.hostname&&!this.pathname&&(this.pathname=""),this},l.prototype.parseHost=function(e){var r=p.exec(e);r&&(":"!==(r=r[0])&&(this.port=r.substr(1)),e=e.substr(0,e.length-r.length)),e&&(this.hostname=e)};var C={encode:o,decode:c,format:function(e){var r="";return r+=e.protocol||"",r+=e.slashes?"//":"",r+=e.auth?e.auth+"@":"",e.hostname&&-1!==e.hostname.indexOf(":")?r+="["+e.hostname+"]":r+=e.hostname||"",r+=e.port?":"+e.port:"",r+=e.pathname||"",r+=e.search||"",r+=e.hash||""},parse:function(e,r){if(e&&e instanceof l)return e;var t=new l;return t.parse(e,r),t}},y=/[\0-\uD7FF\uE000-\uFFFF]|[\uD800-\uDBFF][\uDC00-\uDFFF]|[\uD800-\uDBFF](?![\uDC00-\uDFFF])|(?:[^\uD800-\uDBFF]|^)[\uDC00-\uDFFF]/,A=/[\0-\x1F\x7F-\x9F]/,x=/[ \xA0\u1680\u2000-\u200A\u2028\u2029\u202F\u205F\u3000]/,D={Any:y,Cc:A,Cf:/[\xAD\u0600-\u0605\u061C\u06DD\u070F\u08E2\u180E\u200B-\u200F\u202A-\u202E\u2060-\u2064\u2066-\u206F\uFEFF\uFFF9-\uFFFB]|\uD804[\uDCBD\uDCCD]|\uD82F[\uDCA0-\uDCA3]|\uD834[\uDD73-\uDD7A]|\uDB40[\uDC01\uDC20-\uDC7F]/,P:t,Z:x},w=function(e,r,t){return e(t={path:r,exports:{},require:function(e,r){return function(){throw new Error("Dynamic requires are not currently supported by @rollup/plugin-commonjs")}(null==r&&t.path)}},t.exports),t.exports}((function(e,n){var s=Object.prototype.hasOwnProperty;function o(e,r){return s.call(e,r)}function i(e){return!(e>=55296&&e<=57343)&&(!(e>=64976&&e<=65007)&&(65535!=(65535&e)&&65534!=(65535&e)&&(!(e>=0&&e<=8)&&(11!==e&&(!(e>=14&&e<=31)&&(!(e>=127&&e<=159)&&!(e>1114111)))))))}function a(e){if(e>65535){var r=55296+((e-=65536)>>10),t=56320+(1023&e);return String.fromCharCode(r,t)}return String.fromCharCode(e)}var c=/\\([!"#$%&'()*+,\-.\/:;<=>?@[\\\]^_`{|}~])/g,l=new RegExp(c.source+"|"+/&([a-z#][a-z0-9]{1,31});/gi.source,"gi"),u=/^#((?:x[a-f0-9]{1,8}|[0-9]{1,8}))/i;var p=/[&<>"]/,h=/[&<>"]/g,f={"&":"&amp;","<":"&lt;",">":"&gt;",'"':"&quot;"};function d(e){return f[e]}var m=/[.?*+^$[\]\\(){}|-]/g;n.lib={},n.lib.mdurl=C,n.lib.ucmicro=D,n.assign=function(e){var r=Array.prototype.slice.call(arguments,1);return r.forEach((function(r){if(r){if("object"!=typeof r)throw new TypeError(r+"must be object");Object.keys(r).forEach((function(t){e[t]=r[t]}))}})),e},n.isString=function(e){return"[object String]"===function(e){return Object.prototype.toString.call(e)}(e)},n.has=o,n.unescapeMd=function(e){return e.indexOf("\\")<0?e:e.replace(c,"$1")},n.unescapeAll=function(e){return e.indexOf("\\")<0&&e.indexOf("&")<0?e:e.replace(l,(function(e,t,n){return t||function(e,t){var n=0;return o(r,t)?r[t]:35===t.charCodeAt(0)&&u.test(t)&&i(n="x"===t[1].toLowerCase()?parseInt(t.slice(2),16):parseInt(t.slice(1),10))?a(n):e}(e,n)}))},n.isValidEntityCode=i,n.fromCodePoint=a,n.escapeHtml=function(e){return p.test(e)?e.replace(h,d):e},n.arrayReplaceAt=function(e,r,t){return[].concat(e.slice(0,r),t,e.slice(r+1))},n.isSpace=function(e){switch(e){case 9:case 32:return!0}return!1},n.isWhiteSpace=function(e){if(e>=8192&&e<=8202)return!0;switch(e){case 9:case 10:case 11:case 12:case 13:case 32:case 160:case 5760:case 8239:case 8287:case 12288:return!0}return!1},n.isMdAsciiPunct=function(e){switch(e){case 33:case 34:case 35:case 36:case 37:case 38:case 39:case 40:case 41:case 42:case 43:case 44:case 45:case 46:case 47:case 58:case 59:case 60:case 61:case 62:case 63:case 64:case 91:case 92:case 93:case 94:case 95:case 96:case 123:case 124:case 125:case 126:return!0;default:return!1}},n.isPunctChar=function(e){return t.test(e)},n.escapeRE=function(e){return e.replace(m,"\\$&")},n.normalizeReference=function(e){return e=e.trim().replace(/\s+/g," "),"\u1e7e"==="\u1e9e".toLowerCase()&&(e=e.replace(/\u1e9e/g,"\xdf")),e.toLowerCase().toUpperCase()}})),E=w.unescapeAll,q=w.unescapeAll,S={parseLinkLabel:function(e,r,t){var n,s,o,i,a=-1,c=e.posMax,l=e.pos;for(e.pos=r+1,n=1;e.pos<c;){if(93===(o=e.src.charCodeAt(e.pos))&&0===--n){s=!0;break}if(i=e.pos,e.md.inline.skipToken(e),91===o)if(i===e.pos-1)n++;else if(t)return e.pos=l,-1}return s&&(a=e.pos),e.pos=l,a},parseLinkDestination:function(e,r,t){var n,s,o=r,i={ok:!1,pos:0,lines:0,str:""};if(60===e.charCodeAt(r)){for(r++;r<t;){if(10===(n=e.charCodeAt(r)))return i;if(60===n)return i;if(62===n)return i.pos=r+1,i.str=E(e.slice(o+1,r)),i.ok=!0,i;92===n&&r+1<t?r+=2:r++}return i}for(s=0;r<t&&32!==(n=e.charCodeAt(r))&&!(n<32||127===n);)if(92===n&&r+1<t){if(32===e.charCodeAt(r+1))break;r+=2}else{if(40===n&&++s>32)return i;if(41===n){if(0===s)break;s--}r++}return o===r||0!==s||(i.str=E(e.slice(o,r)),i.lines=0,i.pos=r,i.ok=!0),i},parseLinkTitle:function(e,r,t){var n,s,o=0,i=r,a={ok:!1,pos:0,lines:0,str:""};if(r>=t)return a;if(34!==(s=e.charCodeAt(r))&&39!==s&&40!==s)return a;for(r++,40===s&&(s=41);r<t;){if((n=e.charCodeAt(r))===s)return a.pos=r+1,a.lines=o,a.str=q(e.slice(i+1,r)),a.ok=!0,a;if(40===n&&41===s)return a;10===n?o++:92===n&&r+1<t&&(r++,10===e.charCodeAt(r)&&o++),r++}return a}},F=w.assign,L=w.unescapeAll,z=w.escapeHtml,T={};function I(){this.rules=F({},T)}T.code_inline=function(e,r,t,n,s){var o=e[r];return"<code"+s.renderAttrs(o)+">"+z(e[r].content)+"</code>"},T.code_block=function(e,r,t,n,s){var o=e[r];return"<pre"+s.renderAttrs(o)+"><code>"+z(e[r].content)+"</code></pre>\n"},T.fence=function(e,r,t,n,s){var o,i,a,c,l,u=e[r],p=u.info?L(u.info).trim():"",h="",f="";return p&&(h=(a=p.split(/(\s+)/g))[0],f=a.slice(2).join("")),0===(o=t.highlight&&t.highlight(u.content,h,f)||z(u.content)).indexOf("<pre")?o+"\n":p?(i=u.attrIndex("class"),c=u.attrs?u.attrs.slice():[],i<0?c.push(["class",t.langPrefix+h]):(c[i]=c[i].slice(),c[i][1]+=" "+t.langPrefix+h),l={attrs:c},"<pre><code"+s.renderAttrs(l)+">"+o+"</code></pre>\n"):"<pre><code"+s.renderAttrs(u)+">"+o+"</code></pre>\n"},T.image=function(e,r,t,n,s){var o=e[r];return o.attrs[o.attrIndex("alt")][1]=s.renderInlineAsText(o.children,t,n),s.renderToken(e,r,t)},T.hardbreak=function(e,r,t){return t.xhtmlOut?"<br />\n":"<br>\n"},T.softbreak=function(e,r,t){return t.breaks?t.xhtmlOut?"<br />\n":"<br>\n":"\n"},T.text=function(e,r){return z(e[r].content)},T.html_block=function(e,r){return e[r].content},T.html_inline=function(e,r){return e[r].content},I.prototype.renderAttrs=function(e){var r,t,n;if(!e.attrs)return"";for(n="",r=0,t=e.attrs.length;r<t;r++)n+=" "+z(e.attrs[r][0])+'="'+z(e.attrs[r][1])+'"';return n},I.prototype.renderToken=function(e,r,t){var n,s="",o=!1,i=e[r];return i.hidden?"":(i.block&&-1!==i.nesting&&r&&e[r-1].hidden&&(s+="\n"),s+=(-1===i.nesting?"</":"<")+i.tag,s+=this.renderAttrs(i),0===i.nesting&&t.xhtmlOut&&(s+=" /"),i.block&&(o=!0,1===i.nesting&&r+1<e.length&&("inline"===(n=e[r+1]).type||n.hidden||-1===n.nesting&&n.tag===i.tag)&&(o=!1)),s+=o?">\n":">")},I.prototype.renderInline=function(e,r,t){for(var n,s="",o=this.rules,i=0,a=e.length;i<a;i++)void 0!==o[n=e[i].type]?s+=o[n](e,i,r,t,this):s+=this.renderToken(e,i,r);return s},I.prototype.renderInlineAsText=function(e,r,t){for(var n="",s=0,o=e.length;s<o;s++)"text"===e[s].type?n+=e[s].content:"image"===e[s].type?n+=this.renderInlineAsText(e[s].children,r,t):"softbreak"===e[s].type&&(n+="\n");return n},I.prototype.render=function(e,r,t){var n,s,o,i="",a=this.rules;for(n=0,s=e.length;n<s;n++)"inline"===(o=e[n].type)?i+=this.renderInline(e[n].children,r,t):void 0!==a[o]?i+=a[e[n].type](e,n,r,t,this):i+=this.renderToken(e,n,r,t);return i};var M=I;function R(){this.__rules__=[],this.__cache__=null}R.prototype.__find__=function(e){for(var r=0;r<this.__rules__.length;r++)if(this.__rules__[r].name===e)return r;return-1},R.prototype.__compile__=function(){var e=this,r=[""];e.__rules__.forEach((function(e){e.enabled&&e.alt.forEach((function(e){r.indexOf(e)<0&&r.push(e)}))})),e.__cache__={},r.forEach((function(r){e.__cache__[r]=[],e.__rules__.forEach((function(t){t.enabled&&(r&&t.alt.indexOf(r)<0||e.__cache__[r].push(t.fn))}))}))},R.prototype.at=function(e,r,t){var n=this.__find__(e),s=t||{};if(-1===n)throw new Error("Parser rule not found: "+e);this.__rules__[n].fn=r,this.__rules__[n].alt=s.alt||[],this.__cache__=null},R.prototype.before=function(e,r,t,n){var s=this.__find__(e),o=n||{};if(-1===s)throw new Error("Parser rule not found: "+e);this.__rules__.splice(s,0,{name:r,enabled:!0,fn:t,alt:o.alt||[]}),this.__cache__=null},R.prototype.after=function(e,r,t,n){var s=this.__find__(e),o=n||{};if(-1===s)throw new Error("Parser rule not found: "+e);this.__rules__.splice(s+1,0,{name:r,enabled:!0,fn:t,alt:o.alt||[]}),this.__cache__=null},R.prototype.push=function(e,r,t){var n=t||{};this.__rules__.push({name:e,enabled:!0,fn:r,alt:n.alt||[]}),this.__cache__=null},R.prototype.enable=function(e,r){Array.isArray(e)||(e=[e]);var t=[];return e.forEach((function(e){var n=this.__find__(e);if(n<0){if(r)return;throw new Error("Rules manager: invalid rule name "+e)}this.__rules__[n].enabled=!0,t.push(e)}),this),this.__cache__=null,t},R.prototype.enableOnly=function(e,r){Array.isArray(e)||(e=[e]),this.__rules__.forEach((function(e){e.enabled=!1})),this.enable(e,r)},R.prototype.disable=function(e,r){Array.isArray(e)||(e=[e]);var t=[];return e.forEach((function(e){var n=this.__find__(e);if(n<0){if(r)return;throw new Error("Rules manager: invalid rule name "+e)}this.__rules__[n].enabled=!1,t.push(e)}),this),this.__cache__=null,t},R.prototype.getRules=function(e){return null===this.__cache__&&this.__compile__(),this.__cache__[e]||[]};var B=R,N=/\r\n?|\n/g,O=/\0/g,P=w.arrayReplaceAt;function j(e){return/^<\/a\s*>/i.test(e)}var U=/\+-|\.\.|\?\?\?\?|!!!!|,,|--/,V=/\((c|tm|r|p)\)/i,Z=/\((c|tm|r|p)\)/gi,G={c:"\xa9",r:"\xae",p:"\xa7",tm:"\u2122"};function $(e,r){return G[r.toLowerCase()]}function H(e){var r,t,n=0;for(r=e.length-1;r>=0;r--)"text"!==(t=e[r]).type||n||(t.content=t.content.replace(Z,$)),"link_open"===t.type&&"auto"===t.info&&n--,"link_close"===t.type&&"auto"===t.info&&n++}function J(e){var r,t,n=0;for(r=e.length-1;r>=0;r--)"text"!==(t=e[r]).type||n||U.test(t.content)&&(t.content=t.content.replace(/\+-/g,"\xb1").replace(/\.{2,}/g,"\u2026").replace(/([?!])\u2026/g,"$1..").replace(/([?!]){4,}/g,"$1$1$1").replace(/,{2,}/g,",").replace(/(^|[^-])---(?=[^-]|$)/gm,"$1\u2014").replace(/(^|\s)--(?=\s|$)/gm,"$1\u2013").replace(/(^|[^-\s])--(?=[^-\s]|$)/gm,"$1\u2013")),"link_open"===t.type&&"auto"===t.info&&n--,"link_close"===t.type&&"auto"===t.info&&n++}var W=w.isWhiteSpace,Y=w.isPunctChar,K=w.isMdAsciiPunct,Q=/['"]/,X=/['"]/g;function ee(e,r,t){return e.substr(0,r)+t+e.substr(r+1)}function re(e,r){var t,n,s,o,i,a,c,l,u,p,h,f,d,m,g,_,b,k,v,C,y;for(v=[],t=0;t<e.length;t++){for(n=e[t],c=e[t].level,b=v.length-1;b>=0&&!(v[b].level<=c);b--);if(v.length=b+1,"text"===n.type){i=0,a=(s=n.content).length;e:for(;i<a&&(X.lastIndex=i,o=X.exec(s));){if(g=_=!0,i=o.index+1,k="'"===o[0],u=32,o.index-1>=0)u=s.charCodeAt(o.index-1);else for(b=t-1;b>=0&&("softbreak"!==e[b].type&&"hardbreak"!==e[b].type);b--)if(e[b].content){u=e[b].content.charCodeAt(e[b].content.length-1);break}if(p=32,i<a)p=s.charCodeAt(i);else for(b=t+1;b<e.length&&("softbreak"!==e[b].type&&"hardbreak"!==e[b].type);b++)if(e[b].content){p=e[b].content.charCodeAt(0);break}if(h=K(u)||Y(String.fromCharCode(u)),f=K(p)||Y(String.fromCharCode(p)),d=W(u),(m=W(p))?g=!1:f&&(d||h||(g=!1)),d?_=!1:h&&(m||f||(_=!1)),34===p&&'"'===o[0]&&u>=48&&u<=57&&(_=g=!1),g&&_&&(g=h,_=f),g||_){if(_)for(b=v.length-1;b>=0&&(l=v[b],!(v[b].level<c));b--)if(l.single===k&&v[b].level===c){l=v[b],k?(C=r.md.options.quotes[2],y=r.md.options.quotes[3]):(C=r.md.options.quotes[0],y=r.md.options.quotes[1]),n.content=ee(n.content,o.index,y),e[l.token].content=ee(e[l.token].content,l.pos,C),i+=y.length-1,l.token===t&&(i+=C.length-1),a=(s=n.content).length,v.length=b;continue e}g?v.push({token:t,pos:o.index,single:k,level:c}):_&&k&&(n.content=ee(n.content,o.index,"\u2019"))}else k&&(n.content=ee(n.content,o.index,"\u2019"))}}}}function te(e,r,t){this.type=e,this.tag=r,this.attrs=null,this.map=null,this.nesting=t,this.level=0,this.children=null,this.content="",this.markup="",this.info="",this.meta=null,this.block=!1,this.hidden=!1}te.prototype.attrIndex=function(e){var r,t,n;if(!this.attrs)return-1;for(t=0,n=(r=this.attrs).length;t<n;t++)if(r[t][0]===e)return t;return-1},te.prototype.attrPush=function(e){this.attrs?this.attrs.push(e):this.attrs=[e]},te.prototype.attrSet=function(e,r){var t=this.attrIndex(e),n=[e,r];t<0?this.attrPush(n):this.attrs[t]=n},te.prototype.attrGet=function(e){var r=this.attrIndex(e),t=null;return r>=0&&(t=this.attrs[r][1]),t},te.prototype.attrJoin=function(e,r){var t=this.attrIndex(e);t<0?this.attrPush([e,r]):this.attrs[t][1]=this.attrs[t][1]+" "+r};var ne=te;function se(e,r,t){this.src=e,this.env=t,this.tokens=[],this.inlineMode=!1,this.md=r}se.prototype.Token=ne;var oe=se,ie=[["normalize",function(e){var r;r=(r=e.src.replace(N,"\n")).replace(O,"\ufffd"),e.src=r}],["block",function(e){var r;e.inlineMode?((r=new e.Token("inline","",0)).content=e.src,r.map=[0,1],r.children=[],e.tokens.push(r)):e.md.block.parse(e.src,e.md,e.env,e.tokens)}],["inline",function(e){var r,t,n,s=e.tokens;for(t=0,n=s.length;t<n;t++)"inline"===(r=s[t]).type&&e.md.inline.parse(r.content,e.md,e.env,r.children)}],["linkify",function(e){var r,t,n,s,o,i,a,c,l,u,p,h,f,d,m,g,_,b,k=e.tokens;if(e.md.options.linkify)for(t=0,n=k.length;t<n;t++)if("inline"===k[t].type&&e.md.linkify.pretest(k[t].content))for(f=0,r=(s=k[t].children).length-1;r>=0;r--)if("link_close"!==(i=s[r]).type){if("html_inline"===i.type&&(b=i.content,/^<a[>\s]/i.test(b)&&f>0&&f--,j(i.content)&&f++),!(f>0)&&"text"===i.type&&e.md.linkify.test(i.content)){for(l=i.content,_=e.md.linkify.match(l),a=[],h=i.level,p=0,c=0;c<_.length;c++)d=_[c].url,m=e.md.normalizeLink(d),e.md.validateLink(m)&&(g=_[c].text,g=_[c].schema?"mailto:"!==_[c].schema||/^mailto:/i.test(g)?e.md.normalizeLinkText(g):e.md.normalizeLinkText("mailto:"+g).replace(/^mailto:/,""):e.md.normalizeLinkText("http://"+g).replace(/^http:\/\//,""),(u=_[c].index)>p&&((o=new e.Token("text","",0)).content=l.slice(p,u),o.level=h,a.push(o)),(o=new e.Token("link_open","a",1)).attrs=[["href",m]],o.level=h++,o.markup="linkify",o.info="auto",a.push(o),(o=new e.Token("text","",0)).content=g,o.level=h,a.push(o),(o=new e.Token("link_close","a",-1)).level=--h,o.markup="linkify",o.info="auto",a.push(o),p=_[c].lastIndex);p<l.length&&((o=new e.Token("text","",0)).content=l.slice(p),o.level=h,a.push(o)),k[t].children=s=P(s,r,a)}}else for(r--;s[r].level!==i.level&&"link_open"!==s[r].type;)r--}],["replacements",function(e){var r;if(e.md.options.typographer)for(r=e.tokens.length-1;r>=0;r--)"inline"===e.tokens[r].type&&(V.test(e.tokens[r].content)&&H(e.tokens[r].children),U.test(e.tokens[r].content)&&J(e.tokens[r].children))}],["smartquotes",function(e){var r;if(e.md.options.typographer)for(r=e.tokens.length-1;r>=0;r--)"inline"===e.tokens[r].type&&Q.test(e.tokens[r].content)&&re(e.tokens[r].children,e)}]];function ae(){this.ruler=new B;for(var e=0;e<ie.length;e++)this.ruler.push(ie[e][0],ie[e][1])}ae.prototype.process=function(e){var r,t,n;for(r=0,t=(n=this.ruler.getRules("")).length;r<t;r++)n[r](e)},ae.prototype.State=oe;var ce=ae,le=w.isSpace;function ue(e,r){var t=e.bMarks[r]+e.tShift[r],n=e.eMarks[r];return e.src.substr(t,n-t)}function pe(e){var r,t=[],n=0,s=e.length,o=!1,i=0,a="";for(r=e.charCodeAt(n);n<s;)124===r&&(o?(a+=e.substring(i,n-1),i=n):(t.push(a+e.substring(i,n)),a="",i=n+1)),o=92===r,n++,r=e.charCodeAt(n);return t.push(a+e.substring(i)),t}var he=w.isSpace,fe=w.isSpace,de=w.isSpace;function me(e,r){var t,n,s,o;return n=e.bMarks[r]+e.tShift[r],s=e.eMarks[r],42!==(t=e.src.charCodeAt(n++))&&45!==t&&43!==t||n<s&&(o=e.src.charCodeAt(n),!de(o))?-1:n}function ge(e,r){var t,n=e.bMarks[r]+e.tShift[r],s=n,o=e.eMarks[r];if(s+1>=o)return-1;if((t=e.src.charCodeAt(s++))<48||t>57)return-1;for(;;){if(s>=o)return-1;if(!((t=e.src.charCodeAt(s++))>=48&&t<=57)){if(41===t||46===t)break;return-1}if(s-n>=10)return-1}return s<o&&(t=e.src.charCodeAt(s),!de(t))?-1:s}var _e=w.normalizeReference,be=w.isSpace,ke="<[A-Za-z][A-Za-z0-9\\-]*(?:\\s+[a-zA-Z_:][a-zA-Z0-9:._-]*(?:\\s*=\\s*(?:[^\"'=<>`\\x00-\\x20]+|'[^']*'|\"[^\"]*\"))?)*\\s*\\/?>",ve="<\\/[A-Za-z][A-Za-z0-9\\-]*\\s*>",Ce={HTML_TAG_RE:new RegExp("^(?:"+ke+"|"+ve+"|\x3c!----\x3e|\x3c!--(?:-?[^>-])(?:-?[^-])*--\x3e|<[?][\\s\\S]*?[?]>|<![A-Z]+\\s+[^>]*>|<!\\[CDATA\\[[\\s\\S]*?\\]\\]>)"),HTML_OPEN_CLOSE_TAG_RE:new RegExp("^(?:"+ke+"|"+ve+")")},ye=Ce.HTML_OPEN_CLOSE_TAG_RE,Ae=[[/^<(script|pre|style|textarea)(?=(\s|>|$))/i,/<\/(script|pre|style|textarea)>/i,!0],[/^<!--/,/-->/,!0],[/^<\?/,/\?>/,!0],[/^<![A-Z]/,/>/,!0],[/^<!\[CDATA\[/,/\]\]>/,!0],[new RegExp("^</?("+["address","article","aside","base","basefont","blockquote","body","caption","center","col","colgroup","dd","details","dialog","dir","div","dl","dt","fieldset","figcaption","figure","footer","form","frame","frameset","h1","h2","h3","h4","h5","h6","head","header","hr","html","iframe","legend","li","link","main","menu","menuitem","nav","noframes","ol","optgroup","option","p","param","section","source","summary","table","tbody","td","tfoot","th","thead","title","tr","track","ul"].join("|")+")(?=(\\s|/?>|$))","i"),/^$/,!0],[new RegExp(ye.source+"\\s*$"),/^$/,!1]],xe=w.isSpace,De=w.isSpace;function we(e,r,t,n){var s,o,i,a,c,l,u,p;for(this.src=e,this.md=r,this.env=t,this.tokens=n,this.bMarks=[],this.eMarks=[],this.tShift=[],this.sCount=[],this.bsCount=[],this.blkIndent=0,this.line=0,this.lineMax=0,this.tight=!1,this.ddIndent=-1,this.listIndent=-1,this.parentType="root",this.level=0,this.result="",p=!1,i=a=l=u=0,c=(o=this.src).length;a<c;a++){if(s=o.charCodeAt(a),!p){if(De(s)){l++,9===s?u+=4-u%4:u++;continue}p=!0}10!==s&&a!==c-1||(10!==s&&a++,this.bMarks.push(i),this.eMarks.push(a),this.tShift.push(l),this.sCount.push(u),this.bsCount.push(0),p=!1,l=0,u=0,i=a+1)}this.bMarks.push(o.length),this.eMarks.push(o.length),this.tShift.push(0),this.sCount.push(0),this.bsCount.push(0),this.lineMax=this.bMarks.length-1}we.prototype.push=function(e,r,t){var n=new ne(e,r,t);return n.block=!0,t<0&&this.level--,n.level=this.level,t>0&&this.level++,this.tokens.push(n),n},we.prototype.isEmpty=function(e){return this.bMarks[e]+this.tShift[e]>=this.eMarks[e]},we.prototype.skipEmptyLines=function(e){for(var r=this.lineMax;e<r&&!(this.bMarks[e]+this.tShift[e]<this.eMarks[e]);e++);return e},we.prototype.skipSpaces=function(e){for(var r,t=this.src.length;e<t&&(r=this.src.charCodeAt(e),De(r));e++);return e},we.prototype.skipSpacesBack=function(e,r){if(e<=r)return e;for(;e>r;)if(!De(this.src.charCodeAt(--e)))return e+1;return e},we.prototype.skipChars=function(e,r){for(var t=this.src.length;e<t&&this.src.charCodeAt(e)===r;e++);return e},we.prototype.skipCharsBack=function(e,r,t){if(e<=t)return e;for(;e>t;)if(r!==this.src.charCodeAt(--e))return e+1;return e},we.prototype.getLines=function(e,r,t,n){var s,o,i,a,c,l,u,p=e;if(e>=r)return"";for(l=new Array(r-e),s=0;p<r;p++,s++){for(o=0,u=a=this.bMarks[p],c=p+1<r||n?this.eMarks[p]+1:this.eMarks[p];a<c&&o<t;){if(i=this.src.charCodeAt(a),De(i))9===i?o+=4-(o+this.bsCount[p])%4:o++;else{if(!(a-u<this.tShift[p]))break;o++}a++}l[s]=o>t?new Array(o-t+1).join(" ")+this.src.slice(a,c):this.src.slice(a,c)}return l.join("")},we.prototype.Token=ne;var Ee=we,qe=[["table",function(e,r,t,n){var s,o,i,a,c,l,u,p,h,f,d,m,g,_,b,k,v,C;if(r+2>t)return!1;if(l=r+1,e.sCount[l]<e.blkIndent)return!1;if(e.sCount[l]-e.blkIndent>=4)return!1;if((i=e.bMarks[l]+e.tShift[l])>=e.eMarks[l])return!1;if(124!==(v=e.src.charCodeAt(i++))&&45!==v&&58!==v)return!1;if(i>=e.eMarks[l])return!1;if(124!==(C=e.src.charCodeAt(i++))&&45!==C&&58!==C&&!le(C))return!1;if(45===v&&le(C))return!1;for(;i<e.eMarks[l];){if(124!==(s=e.src.charCodeAt(i))&&45!==s&&58!==s&&!le(s))return!1;i++}for(u=(o=ue(e,r+1)).split("|"),f=[],a=0;a<u.length;a++){if(!(d=u[a].trim())){if(0===a||a===u.length-1)continue;return!1}if(!/^:?-+:?$/.test(d))return!1;58===d.charCodeAt(d.length-1)?f.push(58===d.charCodeAt(0)?"center":"right"):58===d.charCodeAt(0)?f.push("left"):f.push("")}if(-1===(o=ue(e,r).trim()).indexOf("|"))return!1;if(e.sCount[r]-e.blkIndent>=4)return!1;if((u=pe(o)).length&&""===u[0]&&u.shift(),u.length&&""===u[u.length-1]&&u.pop(),0===(p=u.length)||p!==f.length)return!1;if(n)return!0;for(_=e.parentType,e.parentType="table",k=e.md.block.ruler.getRules("blockquote"),(h=e.push("table_open","table",1)).map=m=[r,0],(h=e.push("thead_open","thead",1)).map=[r,r+1],(h=e.push("tr_open","tr",1)).map=[r,r+1],a=0;a<u.length;a++)h=e.push("th_open","th",1),f[a]&&(h.attrs=[["style","text-align:"+f[a]]]),(h=e.push("inline","",0)).content=u[a].trim(),h.children=[],h=e.push("th_close","th",-1);for(h=e.push("tr_close","tr",-1),h=e.push("thead_close","thead",-1),l=r+2;l<t&&!(e.sCount[l]<e.blkIndent);l++){for(b=!1,a=0,c=k.length;a<c;a++)if(k[a](e,l,t,!0)){b=!0;break}if(b)break;if(!(o=ue(e,l).trim()))break;if(e.sCount[l]-e.blkIndent>=4)break;for((u=pe(o)).length&&""===u[0]&&u.shift(),u.length&&""===u[u.length-1]&&u.pop(),l===r+2&&((h=e.push("tbody_open","tbody",1)).map=g=[r+2,0]),(h=e.push("tr_open","tr",1)).map=[l,l+1],a=0;a<p;a++)h=e.push("td_open","td",1),f[a]&&(h.attrs=[["style","text-align:"+f[a]]]),(h=e.push("inline","",0)).content=u[a]?u[a].trim():"",h.children=[],h=e.push("td_close","td",-1);h=e.push("tr_close","tr",-1)}return g&&(h=e.push("tbody_close","tbody",-1),g[1]=l),h=e.push("table_close","table",-1),m[1]=l,e.parentType=_,e.line=l,!0},["paragraph","reference"]],["code",function(e,r,t){var n,s,o;if(e.sCount[r]-e.blkIndent<4)return!1;for(s=n=r+1;n<t;)if(e.isEmpty(n))n++;else{if(!(e.sCount[n]-e.blkIndent>=4))break;s=++n}return e.line=s,(o=e.push("code_block","code",0)).content=e.getLines(r,s,4+e.blkIndent,!1)+"\n",o.map=[r,e.line],!0}],["fence",function(e,r,t,n){var s,o,i,a,c,l,u,p=!1,h=e.bMarks[r]+e.tShift[r],f=e.eMarks[r];if(e.sCount[r]-e.blkIndent>=4)return!1;if(h+3>f)return!1;if(126!==(s=e.src.charCodeAt(h))&&96!==s)return!1;if(c=h,(o=(h=e.skipChars(h,s))-c)<3)return!1;if(u=e.src.slice(c,h),i=e.src.slice(h,f),96===s&&i.indexOf(String.fromCharCode(s))>=0)return!1;if(n)return!0;for(a=r;!(++a>=t)&&!((h=c=e.bMarks[a]+e.tShift[a])<(f=e.eMarks[a])&&e.sCount[a]<e.blkIndent);)if(e.src.charCodeAt(h)===s&&!(e.sCount[a]-e.blkIndent>=4||(h=e.skipChars(h,s))-c<o||(h=e.skipSpaces(h))<f)){p=!0;break}return o=e.sCount[r],e.line=a+(p?1:0),(l=e.push("fence","code",0)).info=i,l.content=e.getLines(r+1,a,o,!0),l.markup=u,l.map=[r,e.line],!0},["paragraph","reference","blockquote","list"]],["blockquote",function(e,r,t,n){var s,o,i,a,c,l,u,p,h,f,d,m,g,_,b,k,v,C,y,A,x=e.lineMax,D=e.bMarks[r]+e.tShift[r],w=e.eMarks[r];if(e.sCount[r]-e.blkIndent>=4)return!1;if(62!==e.src.charCodeAt(D++))return!1;if(n)return!0;for(a=h=e.sCount[r]+1,32===e.src.charCodeAt(D)?(D++,a++,h++,s=!1,k=!0):9===e.src.charCodeAt(D)?(k=!0,(e.bsCount[r]+h)%4==3?(D++,a++,h++,s=!1):s=!0):k=!1,f=[e.bMarks[r]],e.bMarks[r]=D;D<w&&(o=e.src.charCodeAt(D),he(o));)9===o?h+=4-(h+e.bsCount[r]+(s?1:0))%4:h++,D++;for(d=[e.bsCount[r]],e.bsCount[r]=e.sCount[r]+1+(k?1:0),l=D>=w,_=[e.sCount[r]],e.sCount[r]=h-a,b=[e.tShift[r]],e.tShift[r]=D-e.bMarks[r],C=e.md.block.ruler.getRules("blockquote"),g=e.parentType,e.parentType="blockquote",p=r+1;p<t&&(A=e.sCount[p]<e.blkIndent,!((D=e.bMarks[p]+e.tShift[p])>=(w=e.eMarks[p])));p++)if(62!==e.src.charCodeAt(D++)||A){if(l)break;for(v=!1,i=0,c=C.length;i<c;i++)if(C[i](e,p,t,!0)){v=!0;break}if(v){e.lineMax=p,0!==e.blkIndent&&(f.push(e.bMarks[p]),d.push(e.bsCount[p]),b.push(e.tShift[p]),_.push(e.sCount[p]),e.sCount[p]-=e.blkIndent);break}f.push(e.bMarks[p]),d.push(e.bsCount[p]),b.push(e.tShift[p]),_.push(e.sCount[p]),e.sCount[p]=-1}else{for(a=h=e.sCount[p]+1,32===e.src.charCodeAt(D)?(D++,a++,h++,s=!1,k=!0):9===e.src.charCodeAt(D)?(k=!0,(e.bsCount[p]+h)%4==3?(D++,a++,h++,s=!1):s=!0):k=!1,f.push(e.bMarks[p]),e.bMarks[p]=D;D<w&&(o=e.src.charCodeAt(D),he(o));)9===o?h+=4-(h+e.bsCount[p]+(s?1:0))%4:h++,D++;l=D>=w,d.push(e.bsCount[p]),e.bsCount[p]=e.sCount[p]+1+(k?1:0),_.push(e.sCount[p]),e.sCount[p]=h-a,b.push(e.tShift[p]),e.tShift[p]=D-e.bMarks[p]}for(m=e.blkIndent,e.blkIndent=0,(y=e.push("blockquote_open","blockquote",1)).markup=">",y.map=u=[r,0],e.md.block.tokenize(e,r,p),(y=e.push("blockquote_close","blockquote",-1)).markup=">",e.lineMax=x,e.parentType=g,u[1]=e.line,i=0;i<b.length;i++)e.bMarks[i+r]=f[i],e.tShift[i+r]=b[i],e.sCount[i+r]=_[i],e.bsCount[i+r]=d[i];return e.blkIndent=m,!0},["paragraph","reference","blockquote","list"]],["hr",function(e,r,t,n){var s,o,i,a,c=e.bMarks[r]+e.tShift[r],l=e.eMarks[r];if(e.sCount[r]-e.blkIndent>=4)return!1;if(42!==(s=e.src.charCodeAt(c++))&&45!==s&&95!==s)return!1;for(o=1;c<l;){if((i=e.src.charCodeAt(c++))!==s&&!fe(i))return!1;i===s&&o++}return!(o<3)&&(n||(e.line=r+1,(a=e.push("hr","hr",0)).map=[r,e.line],a.markup=Array(o+1).join(String.fromCharCode(s))),!0)},["paragraph","reference","blockquote","list"]],["list",function(e,r,t,n){var s,o,i,a,c,l,u,p,h,f,d,m,g,_,b,k,v,C,y,A,x,D,w,E,q,S,F,L,z=!1,T=!0;if(e.sCount[r]-e.blkIndent>=4)return!1;if(e.listIndent>=0&&e.sCount[r]-e.listIndent>=4&&e.sCount[r]<e.blkIndent)return!1;if(n&&"paragraph"===e.parentType&&e.tShift[r]>=e.blkIndent&&(z=!0),(w=ge(e,r))>=0){if(u=!0,q=e.bMarks[r]+e.tShift[r],g=Number(e.src.slice(q,w-1)),z&&1!==g)return!1}else{if(!((w=me(e,r))>=0))return!1;u=!1}if(z&&e.skipSpaces(w)>=e.eMarks[r])return!1;if(m=e.src.charCodeAt(w-1),n)return!0;for(d=e.tokens.length,u?(L=e.push("ordered_list_open","ol",1),1!==g&&(L.attrs=[["start",g]])):L=e.push("bullet_list_open","ul",1),L.map=f=[r,0],L.markup=String.fromCharCode(m),b=r,E=!1,F=e.md.block.ruler.getRules("list"),C=e.parentType,e.parentType="list";b<t;){for(D=w,_=e.eMarks[b],l=k=e.sCount[b]+w-(e.bMarks[r]+e.tShift[r]);D<_;){if(9===(s=e.src.charCodeAt(D)))k+=4-(k+e.bsCount[b])%4;else{if(32!==s)break;k++}D++}if((c=(o=D)>=_?1:k-l)>4&&(c=1),a=l+c,(L=e.push("list_item_open","li",1)).markup=String.fromCharCode(m),L.map=p=[r,0],u&&(L.info=e.src.slice(q,w-1)),x=e.tight,A=e.tShift[r],y=e.sCount[r],v=e.listIndent,e.listIndent=e.blkIndent,e.blkIndent=a,e.tight=!0,e.tShift[r]=o-e.bMarks[r],e.sCount[r]=k,o>=_&&e.isEmpty(r+1)?e.line=Math.min(e.line+2,t):e.md.block.tokenize(e,r,t,!0),e.tight&&!E||(T=!1),E=e.line-r>1&&e.isEmpty(e.line-1),e.blkIndent=e.listIndent,e.listIndent=v,e.tShift[r]=A,e.sCount[r]=y,e.tight=x,(L=e.push("list_item_close","li",-1)).markup=String.fromCharCode(m),b=r=e.line,p[1]=b,o=e.bMarks[r],b>=t)break;if(e.sCount[b]<e.blkIndent)break;if(e.sCount[r]-e.blkIndent>=4)break;for(S=!1,i=0,h=F.length;i<h;i++)if(F[i](e,b,t,!0)){S=!0;break}if(S)break;if(u){if((w=ge(e,b))<0)break;q=e.bMarks[b]+e.tShift[b]}else if((w=me(e,b))<0)break;if(m!==e.src.charCodeAt(w-1))break}return(L=u?e.push("ordered_list_close","ol",-1):e.push("bullet_list_close","ul",-1)).markup=String.fromCharCode(m),f[1]=b,e.line=b,e.parentType=C,T&&function(e,r){var t,n,s=e.level+2;for(t=r+2,n=e.tokens.length-2;t<n;t++)e.tokens[t].level===s&&"paragraph_open"===e.tokens[t].type&&(e.tokens[t+2].hidden=!0,e.tokens[t].hidden=!0,t+=2)}(e,d),!0},["paragraph","reference","blockquote"]],["reference",function(e,r,t,n){var s,o,i,a,c,l,u,p,h,f,d,m,g,_,b,k,v=0,C=e.bMarks[r]+e.tShift[r],y=e.eMarks[r],A=r+1;if(e.sCount[r]-e.blkIndent>=4)return!1;if(91!==e.src.charCodeAt(C))return!1;for(;++C<y;)if(93===e.src.charCodeAt(C)&&92!==e.src.charCodeAt(C-1)){if(C+1===y)return!1;if(58!==e.src.charCodeAt(C+1))return!1;break}for(a=e.lineMax,b=e.md.block.ruler.getRules("reference"),f=e.parentType,e.parentType="reference";A<a&&!e.isEmpty(A);A++)if(!(e.sCount[A]-e.blkIndent>3||e.sCount[A]<0)){for(_=!1,l=0,u=b.length;l<u;l++)if(b[l](e,A,a,!0)){_=!0;break}if(_)break}for(y=(g=e.getLines(r,A,e.blkIndent,!1).trim()).length,C=1;C<y;C++){if(91===(s=g.charCodeAt(C)))return!1;if(93===s){h=C;break}(10===s||92===s&&++C<y&&10===g.charCodeAt(C))&&v++}if(h<0||58!==g.charCodeAt(h+1))return!1;for(C=h+2;C<y;C++)if(10===(s=g.charCodeAt(C)))v++;else if(!be(s))break;if(!(d=e.md.helpers.parseLinkDestination(g,C,y)).ok)return!1;if(c=e.md.normalizeLink(d.str),!e.md.validateLink(c))return!1;for(o=C=d.pos,i=v+=d.lines,m=C;C<y;C++)if(10===(s=g.charCodeAt(C)))v++;else if(!be(s))break;for(d=e.md.helpers.parseLinkTitle(g,C,y),C<y&&m!==C&&d.ok?(k=d.str,C=d.pos,v+=d.lines):(k="",C=o,v=i);C<y&&(s=g.charCodeAt(C),be(s));)C++;if(C<y&&10!==g.charCodeAt(C)&&k)for(k="",C=o,v=i;C<y&&(s=g.charCodeAt(C),be(s));)C++;return!(C<y&&10!==g.charCodeAt(C))&&(!!(p=_e(g.slice(1,h)))&&(n||(void 0===e.env.references&&(e.env.references={}),void 0===e.env.references[p]&&(e.env.references[p]={title:k,href:c}),e.parentType=f,e.line=r+v+1),!0))}],["html_block",function(e,r,t,n){var s,o,i,a,c=e.bMarks[r]+e.tShift[r],l=e.eMarks[r];if(e.sCount[r]-e.blkIndent>=4)return!1;if(!e.md.options.html)return!1;if(60!==e.src.charCodeAt(c))return!1;for(a=e.src.slice(c,l),s=0;s<Ae.length&&!Ae[s][0].test(a);s++);if(s===Ae.length)return!1;if(n)return Ae[s][2];if(o=r+1,!Ae[s][1].test(a))for(;o<t&&!(e.sCount[o]<e.blkIndent);o++)if(c=e.bMarks[o]+e.tShift[o],l=e.eMarks[o],a=e.src.slice(c,l),Ae[s][1].test(a)){0!==a.length&&o++;break}return e.line=o,(i=e.push("html_block","",0)).map=[r,o],i.content=e.getLines(r,o,e.blkIndent,!0),!0},["paragraph","reference","blockquote"]],["heading",function(e,r,t,n){var s,o,i,a,c=e.bMarks[r]+e.tShift[r],l=e.eMarks[r];if(e.sCount[r]-e.blkIndent>=4)return!1;if(35!==(s=e.src.charCodeAt(c))||c>=l)return!1;for(o=1,s=e.src.charCodeAt(++c);35===s&&c<l&&o<=6;)o++,s=e.src.charCodeAt(++c);return!(o>6||c<l&&!xe(s))&&(n||(l=e.skipSpacesBack(l,c),(i=e.skipCharsBack(l,35,c))>c&&xe(e.src.charCodeAt(i-1))&&(l=i),e.line=r+1,(a=e.push("heading_open","h"+String(o),1)).markup="########".slice(0,o),a.map=[r,e.line],(a=e.push("inline","",0)).content=e.src.slice(c,l).trim(),a.map=[r,e.line],a.children=[],(a=e.push("heading_close","h"+String(o),-1)).markup="########".slice(0,o)),!0)},["paragraph","reference","blockquote"]],["lheading",function(e,r,t){var n,s,o,i,a,c,l,u,p,h,f=r+1,d=e.md.block.ruler.getRules("paragraph");if(e.sCount[r]-e.blkIndent>=4)return!1;for(h=e.parentType,e.parentType="paragraph";f<t&&!e.isEmpty(f);f++)if(!(e.sCount[f]-e.blkIndent>3)){if(e.sCount[f]>=e.blkIndent&&(c=e.bMarks[f]+e.tShift[f])<(l=e.eMarks[f])&&(45===(p=e.src.charCodeAt(c))||61===p)&&(c=e.skipChars(c,p),(c=e.skipSpaces(c))>=l)){u=61===p?1:2;break}if(!(e.sCount[f]<0)){for(s=!1,o=0,i=d.length;o<i;o++)if(d[o](e,f,t,!0)){s=!0;break}if(s)break}}return!!u&&(n=e.getLines(r,f,e.blkIndent,!1).trim(),e.line=f+1,(a=e.push("heading_open","h"+String(u),1)).markup=String.fromCharCode(p),a.map=[r,e.line],(a=e.push("inline","",0)).content=n,a.map=[r,e.line-1],a.children=[],(a=e.push("heading_close","h"+String(u),-1)).markup=String.fromCharCode(p),e.parentType=h,!0)}],["paragraph",function(e,r){var t,n,s,o,i,a,c=r+1,l=e.md.block.ruler.getRules("paragraph"),u=e.lineMax;for(a=e.parentType,e.parentType="paragraph";c<u&&!e.isEmpty(c);c++)if(!(e.sCount[c]-e.blkIndent>3||e.sCount[c]<0)){for(n=!1,s=0,o=l.length;s<o;s++)if(l[s](e,c,u,!0)){n=!0;break}if(n)break}return t=e.getLines(r,c,e.blkIndent,!1).trim(),e.line=c,(i=e.push("paragraph_open","p",1)).map=[r,e.line],(i=e.push("inline","",0)).content=t,i.map=[r,e.line],i.children=[],i=e.push("paragraph_close","p",-1),e.parentType=a,!0}]];function Se(){this.ruler=new B;for(var e=0;e<qe.length;e++)this.ruler.push(qe[e][0],qe[e][1],{alt:(qe[e][2]||[]).slice()})}Se.prototype.tokenize=function(e,r,t){for(var n,s=this.ruler.getRules(""),o=s.length,i=r,a=!1,c=e.md.options.maxNesting;i<t&&(e.line=i=e.skipEmptyLines(i),!(i>=t))&&!(e.sCount[i]<e.blkIndent);){if(e.level>=c){e.line=t;break}for(n=0;n<o&&!s[n](e,i,t,!1);n++);e.tight=!a,e.isEmpty(e.line-1)&&(a=!0),(i=e.line)<t&&e.isEmpty(i)&&(a=!0,i++,e.line=i)}},Se.prototype.parse=function(e,r,t,n){var s;e&&(s=new this.State(e,r,t,n),this.tokenize(s,s.line,s.lineMax))},Se.prototype.State=Ee;var Fe=Se;function Le(e){switch(e){case 10:case 33:case 35:case 36:case 37:case 38:case 42:case 43:case 45:case 58:case 60:case 61:case 62:case 64:case 91:case 92:case 93:case 94:case 95:case 96:case 123:case 125:case 126:return!0;default:return!1}}for(var ze=w.isSpace,Te=w.isSpace,Ie=[],Me=0;Me<256;Me++)Ie.push(0);"\\!\"#$%&'()*+,./:;<=>?@[]^_`{|}~-".split("").forEach((function(e){Ie[e.charCodeAt(0)]=1}));function Re(e,r){var t,n,s,o,i,a=[],c=r.length;for(t=0;t<c;t++)126===(s=r[t]).marker&&-1!==s.end&&(o=r[s.end],(i=e.tokens[s.token]).type="s_open",i.tag="s",i.nesting=1,i.markup="~~",i.content="",(i=e.tokens[o.token]).type="s_close",i.tag="s",i.nesting=-1,i.markup="~~",i.content="","text"===e.tokens[o.token-1].type&&"~"===e.tokens[o.token-1].content&&a.push(o.token-1));for(;a.length;){for(n=(t=a.pop())+1;n<e.tokens.length&&"s_close"===e.tokens[n].type;)n++;t!==--n&&(i=e.tokens[n],e.tokens[n]=e.tokens[t],e.tokens[t]=i)}}var Be={tokenize:function(e,r){var t,n,s,o,i=e.pos,a=e.src.charCodeAt(i);if(r)return!1;if(126!==a)return!1;if(s=(n=e.scanDelims(e.pos,!0)).length,o=String.fromCharCode(a),s<2)return!1;for(s%2&&(e.push("text","",0).content=o,s--),t=0;t<s;t+=2)e.push("text","",0).content=o+o,e.delimiters.push({marker:a,length:0,jump:t/2,token:e.tokens.length-1,end:-1,open:n.can_open,close:n.can_close});return e.pos+=n.length,!0},postProcess:function(e){var r,t=e.tokens_meta,n=e.tokens_meta.length;for(Re(e,e.delimiters),r=0;r<n;r++)t[r]&&t[r].delimiters&&Re(e,t[r].delimiters)}};function Ne(e,r){var t,n,s,o,i,a;for(t=r.length-1;t>=0;t--)95!==(n=r[t]).marker&&42!==n.marker||-1!==n.end&&(s=r[n.end],a=t>0&&r[t-1].end===n.end+1&&r[t-1].token===n.token-1&&r[n.end+1].token===s.token+1&&r[t-1].marker===n.marker,i=String.fromCharCode(n.marker),(o=e.tokens[n.token]).type=a?"strong_open":"em_open",o.tag=a?"strong":"em",o.nesting=1,o.markup=a?i+i:i,o.content="",(o=e.tokens[s.token]).type=a?"strong_close":"em_close",o.tag=a?"strong":"em",o.nesting=-1,o.markup=a?i+i:i,o.content="",a&&(e.tokens[r[t-1].token].content="",e.tokens[r[n.end+1].token].content="",t--))}var Oe={tokenize:function(e,r){var t,n,s=e.pos,o=e.src.charCodeAt(s);if(r)return!1;if(95!==o&&42!==o)return!1;for(n=e.scanDelims(e.pos,42===o),t=0;t<n.length;t++)e.push("text","",0).content=String.fromCharCode(o),e.delimiters.push({marker:o,length:n.length,jump:t,token:e.tokens.length-1,end:-1,open:n.can_open,close:n.can_close});return e.pos+=n.length,!0},postProcess:function(e){var r,t=e.tokens_meta,n=e.tokens_meta.length;for(Ne(e,e.delimiters),r=0;r<n;r++)t[r]&&t[r].delimiters&&Ne(e,t[r].delimiters)}},Pe=w.normalizeReference,je=w.isSpace,Ue=w.normalizeReference,Ve=w.isSpace,Ze=/^([a-zA-Z0-9.!#$%&'*+\/=?^_`{|}~-]+@[a-zA-Z0-9](?:[a-zA-Z0-9-]{0,61}[a-zA-Z0-9])?(?:\.[a-zA-Z0-9](?:[a-zA-Z0-9-]{0,61}[a-zA-Z0-9])?)*)$/,Ge=/^([a-zA-Z][a-zA-Z0-9+.\-]{1,31}):([^<>\x00-\x20]*)$/,$e=Ce.HTML_TAG_RE;var He=w.has,Je=w.isValidEntityCode,We=w.fromCodePoint,Ye=/^&#((?:x[a-f0-9]{1,6}|[0-9]{1,7}));/i,Ke=/^&([a-z][a-z0-9]{1,31});/i;function Qe(e,r){var t,n,s,o,i,a,c,l,u={},p=r.length;for(t=0;t<p;t++)if((s=r[t]).length=s.length||0,s.close){for(u.hasOwnProperty(s.marker)||(u[s.marker]=[-1,-1,-1,-1,-1,-1]),i=u[s.marker][(s.open?3:0)+s.length%3],(n=t-s.jump-1)<-1&&(n=-1),a=n;n>i;n-=o.jump+1)if((o=r[n]).marker===s.marker&&o.open&&o.end<0&&(c=!1,(o.close||s.open)&&(o.length+s.length)%3==0&&(o.length%3==0&&s.length%3==0||(c=!0)),!c)){l=n>0&&!r[n-1].open?r[n-1].jump+1:0,s.jump=t-n+l,s.open=!1,o.end=t,o.jump=l,o.close=!1,a=-1;break}-1!==a&&(u[s.marker][(s.open?3:0)+(s.length||0)%3]=a)}}var Xe=w.isWhiteSpace,er=w.isPunctChar,rr=w.isMdAsciiPunct;function tr(e,r,t,n){this.src=e,this.env=t,this.md=r,this.tokens=n,this.tokens_meta=Array(n.length),this.pos=0,this.posMax=this.src.length,this.level=0,this.pending="",this.pendingLevel=0,this.cache={},this.delimiters=[],this._prev_delimiters=[],this.backticks={},this.backticksScanned=!1}tr.prototype.pushPending=function(){var e=new ne("text","",0);return e.content=this.pending,e.level=this.pendingLevel,this.tokens.push(e),this.pending="",e},tr.prototype.push=function(e,r,t){this.pending&&this.pushPending();var n=new ne(e,r,t),s=null;return t<0&&(this.level--,this.delimiters=this._prev_delimiters.pop()),n.level=this.level,t>0&&(this.level++,this._prev_delimiters.push(this.delimiters),this.delimiters=[],s={delimiters:this.delimiters}),this.pendingLevel=this.level,this.tokens.push(n),this.tokens_meta.push(s),n},tr.prototype.scanDelims=function(e,r){var t,n,s,o,i,a,c,l,u,p=e,h=!0,f=!0,d=this.posMax,m=this.src.charCodeAt(e);for(t=e>0?this.src.charCodeAt(e-1):32;p<d&&this.src.charCodeAt(p)===m;)p++;return s=p-e,n=p<d?this.src.charCodeAt(p):32,c=rr(t)||er(String.fromCharCode(t)),u=rr(n)||er(String.fromCharCode(n)),a=Xe(t),(l=Xe(n))?h=!1:u&&(a||c||(h=!1)),a?f=!1:c&&(l||u||(f=!1)),r?(o=h,i=f):(o=h&&(!f||c),i=f&&(!h||u)),{can_open:o,can_close:i,length:s}},tr.prototype.Token=ne;var nr=tr,sr=[["text",function(e,r){for(var t=e.pos;t<e.posMax&&!Le(e.src.charCodeAt(t));)t++;return t!==e.pos&&(r||(e.pending+=e.src.slice(e.pos,t)),e.pos=t,!0)}],["newline",function(e,r){var t,n,s=e.pos;if(10!==e.src.charCodeAt(s))return!1;for(t=e.pending.length-1,n=e.posMax,r||(t>=0&&32===e.pending.charCodeAt(t)?t>=1&&32===e.pending.charCodeAt(t-1)?(e.pending=e.pending.replace(/ +$/,""),e.push("hardbreak","br",0)):(e.pending=e.pending.slice(0,-1),e.push("softbreak","br",0)):e.push("softbreak","br",0)),s++;s<n&&ze(e.src.charCodeAt(s));)s++;return e.pos=s,!0}],["escape",function(e,r){var t,n=e.pos,s=e.posMax;if(92!==e.src.charCodeAt(n))return!1;if(++n<s){if((t=e.src.charCodeAt(n))<256&&0!==Ie[t])return r||(e.pending+=e.src[n]),e.pos+=2,!0;if(10===t){for(r||e.push("hardbreak","br",0),n++;n<s&&(t=e.src.charCodeAt(n),Te(t));)n++;return e.pos=n,!0}}return r||(e.pending+="\\"),e.pos++,!0}],["backticks",function(e,r){var t,n,s,o,i,a,c,l,u=e.pos;if(96!==e.src.charCodeAt(u))return!1;for(t=u,u++,n=e.posMax;u<n&&96===e.src.charCodeAt(u);)u++;if(c=(s=e.src.slice(t,u)).length,e.backticksScanned&&(e.backticks[c]||0)<=t)return r||(e.pending+=s),e.pos+=c,!0;for(i=a=u;-1!==(i=e.src.indexOf("`",a));){for(a=i+1;a<n&&96===e.src.charCodeAt(a);)a++;if((l=a-i)===c)return r||((o=e.push("code_inline","code",0)).markup=s,o.content=e.src.slice(u,i).replace(/\n/g," ").replace(/^ (.+) $/,"$1")),e.pos=a,!0;e.backticks[l]=i}return e.backticksScanned=!0,r||(e.pending+=s),e.pos+=c,!0}],["strikethrough",Be.tokenize],["emphasis",Oe.tokenize],["link",function(e,r){var t,n,s,o,i,a,c,l,u="",p="",h=e.pos,f=e.posMax,d=e.pos,m=!0;if(91!==e.src.charCodeAt(e.pos))return!1;if(i=e.pos+1,(o=e.md.helpers.parseLinkLabel(e,e.pos,!0))<0)return!1;if((a=o+1)<f&&40===e.src.charCodeAt(a)){for(m=!1,a++;a<f&&(n=e.src.charCodeAt(a),je(n)||10===n);a++);if(a>=f)return!1;if(d=a,(c=e.md.helpers.parseLinkDestination(e.src,a,e.posMax)).ok){for(u=e.md.normalizeLink(c.str),e.md.validateLink(u)?a=c.pos:u="",d=a;a<f&&(n=e.src.charCodeAt(a),je(n)||10===n);a++);if(c=e.md.helpers.parseLinkTitle(e.src,a,e.posMax),a<f&&d!==a&&c.ok)for(p=c.str,a=c.pos;a<f&&(n=e.src.charCodeAt(a),je(n)||10===n);a++);}(a>=f||41!==e.src.charCodeAt(a))&&(m=!0),a++}if(m){if(void 0===e.env.references)return!1;if(a<f&&91===e.src.charCodeAt(a)?(d=a+1,(a=e.md.helpers.parseLinkLabel(e,a))>=0?s=e.src.slice(d,a++):a=o+1):a=o+1,s||(s=e.src.slice(i,o)),!(l=e.env.references[Pe(s)]))return e.pos=h,!1;u=l.href,p=l.title}return r||(e.pos=i,e.posMax=o,e.push("link_open","a",1).attrs=t=[["href",u]],p&&t.push(["title",p]),e.md.inline.tokenize(e),e.push("link_close","a",-1)),e.pos=a,e.posMax=f,!0}],["image",function(e,r){var t,n,s,o,i,a,c,l,u,p,h,f,d,m="",g=e.pos,_=e.posMax;if(33!==e.src.charCodeAt(e.pos))return!1;if(91!==e.src.charCodeAt(e.pos+1))return!1;if(a=e.pos+2,(i=e.md.helpers.parseLinkLabel(e,e.pos+1,!1))<0)return!1;if((c=i+1)<_&&40===e.src.charCodeAt(c)){for(c++;c<_&&(n=e.src.charCodeAt(c),Ve(n)||10===n);c++);if(c>=_)return!1;for(d=c,(u=e.md.helpers.parseLinkDestination(e.src,c,e.posMax)).ok&&(m=e.md.normalizeLink(u.str),e.md.validateLink(m)?c=u.pos:m=""),d=c;c<_&&(n=e.src.charCodeAt(c),Ve(n)||10===n);c++);if(u=e.md.helpers.parseLinkTitle(e.src,c,e.posMax),c<_&&d!==c&&u.ok)for(p=u.str,c=u.pos;c<_&&(n=e.src.charCodeAt(c),Ve(n)||10===n);c++);else p="";if(c>=_||41!==e.src.charCodeAt(c))return e.pos=g,!1;c++}else{if(void 0===e.env.references)return!1;if(c<_&&91===e.src.charCodeAt(c)?(d=c+1,(c=e.md.helpers.parseLinkLabel(e,c))>=0?o=e.src.slice(d,c++):c=i+1):c=i+1,o||(o=e.src.slice(a,i)),!(l=e.env.references[Ue(o)]))return e.pos=g,!1;m=l.href,p=l.title}return r||(s=e.src.slice(a,i),e.md.inline.parse(s,e.md,e.env,f=[]),(h=e.push("image","img",0)).attrs=t=[["src",m],["alt",""]],h.children=f,h.content=s,p&&t.push(["title",p])),e.pos=c,e.posMax=_,!0}],["autolink",function(e,r){var t,n,s,o,i,a,c=e.pos;if(60!==e.src.charCodeAt(c))return!1;for(i=e.pos,a=e.posMax;;){if(++c>=a)return!1;if(60===(o=e.src.charCodeAt(c)))return!1;if(62===o)break}return t=e.src.slice(i+1,c),Ge.test(t)?(n=e.md.normalizeLink(t),!!e.md.validateLink(n)&&(r||((s=e.push("link_open","a",1)).attrs=[["href",n]],s.markup="autolink",s.info="auto",(s=e.push("text","",0)).content=e.md.normalizeLinkText(t),(s=e.push("link_close","a",-1)).markup="autolink",s.info="auto"),e.pos+=t.length+2,!0)):!!Ze.test(t)&&(n=e.md.normalizeLink("mailto:"+t),!!e.md.validateLink(n)&&(r||((s=e.push("link_open","a",1)).attrs=[["href",n]],s.markup="autolink",s.info="auto",(s=e.push("text","",0)).content=e.md.normalizeLinkText(t),(s=e.push("link_close","a",-1)).markup="autolink",s.info="auto"),e.pos+=t.length+2,!0))}],["html_inline",function(e,r){var t,n,s,o=e.pos;return!!e.md.options.html&&(s=e.posMax,!(60!==e.src.charCodeAt(o)||o+2>=s)&&(!(33!==(t=e.src.charCodeAt(o+1))&&63!==t&&47!==t&&!function(e){var r=32|e;return r>=97&&r<=122}(t))&&(!!(n=e.src.slice(o).match($e))&&(r||(e.push("html_inline","",0).content=e.src.slice(o,o+n[0].length)),e.pos+=n[0].length,!0))))}],["entity",function(e,t){var n,s,o=e.pos,i=e.posMax;if(38!==e.src.charCodeAt(o))return!1;if(o+1<i)if(35===e.src.charCodeAt(o+1)){if(s=e.src.slice(o).match(Ye))return t||(n="x"===s[1][0].toLowerCase()?parseInt(s[1].slice(1),16):parseInt(s[1],10),e.pending+=Je(n)?We(n):We(65533)),e.pos+=s[0].length,!0}else if((s=e.src.slice(o).match(Ke))&&He(r,s[1]))return t||(e.pending+=r[s[1]]),e.pos+=s[0].length,!0;return t||(e.pending+="&"),e.pos++,!0}]],or=[["balance_pairs",function(e){var r,t=e.tokens_meta,n=e.tokens_meta.length;for(Qe(0,e.delimiters),r=0;r<n;r++)t[r]&&t[r].delimiters&&Qe(0,t[r].delimiters)}],["strikethrough",Be.postProcess],["emphasis",Oe.postProcess],["text_collapse",function(e){var r,t,n=0,s=e.tokens,o=e.tokens.length;for(r=t=0;r<o;r++)s[r].nesting<0&&n--,s[r].level=n,s[r].nesting>0&&n++,"text"===s[r].type&&r+1<o&&"text"===s[r+1].type?s[r+1].content=s[r].content+s[r+1].content:(r!==t&&(s[t]=s[r]),t++);r!==t&&(s.length=t)}]];function ir(){var e;for(this.ruler=new B,e=0;e<sr.length;e++)this.ruler.push(sr[e][0],sr[e][1]);for(this.ruler2=new B,e=0;e<or.length;e++)this.ruler2.push(or[e][0],or[e][1])}ir.prototype.skipToken=function(e){var r,t,n=e.pos,s=this.ruler.getRules(""),o=s.length,i=e.md.options.maxNesting,a=e.cache;if(void 0===a[n]){if(e.level<i)for(t=0;t<o&&(e.level++,r=s[t](e,!0),e.level--,!r);t++);else e.pos=e.posMax;r||e.pos++,a[n]=e.pos}else e.pos=a[n]},ir.prototype.tokenize=function(e){for(var r,t,n=this.ruler.getRules(""),s=n.length,o=e.posMax,i=e.md.options.maxNesting;e.pos<o;){if(e.level<i)for(t=0;t<s&&!(r=n[t](e,!1));t++);if(r){if(e.pos>=o)break}else e.pending+=e.src[e.pos++]}e.pending&&e.pushPending()},ir.prototype.parse=function(e,r,t,n){var s,o,i,a=new this.State(e,r,t,n);for(this.tokenize(a),i=(o=this.ruler2.getRules("")).length,s=0;s<i;s++)o[s](a)},ir.prototype.State=nr;var ar=ir;function cr(e){var r=Array.prototype.slice.call(arguments,1);return r.forEach((function(r){r&&Object.keys(r).forEach((function(t){e[t]=r[t]}))})),e}function lr(e){return Object.prototype.toString.call(e)}function ur(e){return"[object Function]"===lr(e)}function pr(e){return e.replace(/[.?*+^$[\]\\(){}|-]/g,"\\$&")}var hr={fuzzyLink:!0,fuzzyEmail:!0,fuzzyIP:!1};var fr={"http:":{validate:function(e,r,t){var n=e.slice(r);return t.re.http||(t.re.http=new RegExp("^\\/\\/"+t.re.src_auth+t.re.src_host_port_strict+t.re.src_path,"i")),t.re.http.test(n)?n.match(t.re.http)[0].length:0}},"https:":"http:","ftp:":"http:","//":{validate:function(e,r,t){var n=e.slice(r);return t.re.no_http||(t.re.no_http=new RegExp("^"+t.re.src_auth+"(?:localhost|(?:(?:"+t.re.src_domain+")\\.)+"+t.re.src_domain_root+")"+t.re.src_port+t.re.src_host_terminator+t.re.src_path,"i")),t.re.no_http.test(n)?r>=3&&":"===e[r-3]||r>=3&&"/"===e[r-3]?0:n.match(t.re.no_http)[0].length:0}},"mailto:":{validate:function(e,r,t){var n=e.slice(r);return t.re.mailto||(t.re.mailto=new RegExp("^"+t.re.src_email_name+"@"+t.re.src_host_strict,"i")),t.re.mailto.test(n)?n.match(t.re.mailto)[0].length:0}}},dr="biz|com|edu|gov|net|org|pro|web|xxx|aero|asia|coop|info|museum|name|shop|\u0440\u0444".split("|");function mr(e){var r=e.re=function(e){var r={};return r.src_Any=y.source,r.src_Cc=A.source,r.src_Z=x.source,r.src_P=t.source,r.src_ZPCc=[r.src_Z,r.src_P,r.src_Cc].join("|"),r.src_ZCc=[r.src_Z,r.src_Cc].join("|"),r.src_pseudo_letter="(?:(?![><\uff5c]|"+r.src_ZPCc+")"+r.src_Any+")",r.src_ip4="(?:(25[0-5]|2[0-4][0-9]|[01]?[0-9][0-9]?)\\.){3}(25[0-5]|2[0-4][0-9]|[01]?[0-9][0-9]?)",r.src_auth="(?:(?:(?!"+r.src_ZCc+"|[@/\\[\\]()]).)+@)?",r.src_port="(?::(?:6(?:[0-4]\\d{3}|5(?:[0-4]\\d{2}|5(?:[0-2]\\d|3[0-5])))|[1-5]?\\d{1,4}))?",r.src_host_terminator="(?=$|[><\uff5c]|"+r.src_ZPCc+")(?!-|_|:\\d|\\.-|\\.(?!$|"+r.src_ZPCc+"))",r.src_path="(?:[/?#](?:(?!"+r.src_ZCc+"|[><\uff5c]|[()[\\]{}.,\"'?!\\-]).|\\[(?:(?!"+r.src_ZCc+"|\\]).)*\\]|\\((?:(?!"+r.src_ZCc+"|[)]).)*\\)|\\{(?:(?!"+r.src_ZCc+'|[}]).)*\\}|\\"(?:(?!'+r.src_ZCc+'|["]).)+\\"|\\\'(?:(?!'+r.src_ZCc+"|[']).)+\\'|\\'(?="+r.src_pseudo_letter+"|[-]).|\\.{2,}[a-zA-Z0-9%/&]|\\.(?!"+r.src_ZCc+"|[.]).|"+(e&&e["---"]?"\\-(?!--(?:[^-]|$))(?:-*)|":"\\-+|")+"\\,(?!"+r.src_ZCc+").|\\!+(?!"+r.src_ZCc+"|[!]).|\\?(?!"+r.src_ZCc+"|[?]).)+|\\/)?",r.src_email_name='[\\-;:&=\\+\\$,\\.a-zA-Z0-9_][\\-;:&=\\+\\$,\\"\\.a-zA-Z0-9_]*',r.src_xn="xn--[a-z0-9\\-]{1,59}",r.src_domain_root="(?:"+r.src_xn+"|"+r.src_pseudo_letter+"{1,63})",r.src_domain="(?:"+r.src_xn+"|(?:"+r.src_pseudo_letter+")|(?:"+r.src_pseudo_letter+"(?:-|"+r.src_pseudo_letter+"){0,61}"+r.src_pseudo_letter+"))",r.src_host="(?:(?:(?:(?:"+r.src_domain+")\\.)*"+r.src_domain+"))",r.tpl_host_fuzzy="(?:"+r.src_ip4+"|(?:(?:(?:"+r.src_domain+")\\.)+(?:%TLDS%)))",r.tpl_host_no_ip_fuzzy="(?:(?:(?:"+r.src_domain+")\\.)+(?:%TLDS%))",r.src_host_strict=r.src_host+r.src_host_terminator,r.tpl_host_fuzzy_strict=r.tpl_host_fuzzy+r.src_host_terminator,r.src_host_port_strict=r.src_host+r.src_port+r.src_host_terminator,r.tpl_host_port_fuzzy_strict=r.tpl_host_fuzzy+r.src_port+r.src_host_terminator,r.tpl_host_port_no_ip_fuzzy_strict=r.tpl_host_no_ip_fuzzy+r.src_port+r.src_host_terminator,r.tpl_host_fuzzy_test="localhost|www\\.|\\.\\d{1,3}\\.|(?:\\.(?:%TLDS%)(?:"+r.src_ZPCc+"|>|$))",r.tpl_email_fuzzy='(^|[><\uff5c]|"|\\(|'+r.src_ZCc+")("+r.src_email_name+"@"+r.tpl_host_fuzzy_strict+")",r.tpl_link_fuzzy="(^|(?![.:/\\-_@])(?:[$+<=>^`|\uff5c]|"+r.src_ZPCc+"))((?![$+<=>^`|\uff5c])"+r.tpl_host_port_fuzzy_strict+r.src_path+")",r.tpl_link_no_ip_fuzzy="(^|(?![.:/\\-_@])(?:[$+<=>^`|\uff5c]|"+r.src_ZPCc+"))((?![$+<=>^`|\uff5c])"+r.tpl_host_port_no_ip_fuzzy_strict+r.src_path+")",r}(e.__opts__),n=e.__tlds__.slice();function s(e){return e.replace("%TLDS%",r.src_tlds)}e.onCompile(),e.__tlds_replaced__||n.push("a[cdefgilmnoqrstuwxz]|b[abdefghijmnorstvwyz]|c[acdfghiklmnoruvwxyz]|d[ejkmoz]|e[cegrstu]|f[ijkmor]|g[abdefghilmnpqrstuwy]|h[kmnrtu]|i[delmnoqrst]|j[emop]|k[eghimnprwyz]|l[abcikrstuvy]|m[acdeghklmnopqrstuvwxyz]|n[acefgilopruz]|om|p[aefghklmnrstwy]|qa|r[eosuw]|s[abcdeghijklmnortuvxyz]|t[cdfghjklmnortvwz]|u[agksyz]|v[aceginu]|w[fs]|y[et]|z[amw]"),n.push(r.src_xn),r.src_tlds=n.join("|"),r.email_fuzzy=RegExp(s(r.tpl_email_fuzzy),"i"),r.link_fuzzy=RegExp(s(r.tpl_link_fuzzy),"i"),r.link_no_ip_fuzzy=RegExp(s(r.tpl_link_no_ip_fuzzy),"i"),r.host_fuzzy_test=RegExp(s(r.tpl_host_fuzzy_test),"i");var o=[];function i(e,r){throw new Error('(LinkifyIt) Invalid schema "'+e+'": '+r)}e.__compiled__={},Object.keys(e.__schemas__).forEach((function(r){var t=e.__schemas__[r];if(null!==t){var n={validate:null,link:null};if(e.__compiled__[r]=n,"[object Object]"===lr(t))return!function(e){return"[object RegExp]"===lr(e)}(t.validate)?ur(t.validate)?n.validate=t.validate:i(r,t):n.validate=function(e){return function(r,t){var n=r.slice(t);return e.test(n)?n.match(e)[0].length:0}}(t.validate),void(ur(t.normalize)?n.normalize=t.normalize:t.normalize?i(r,t):n.normalize=function(e,r){r.normalize(e)});!function(e){return"[object String]"===lr(e)}(t)?i(r,t):o.push(r)}})),o.forEach((function(r){e.__compiled__[e.__schemas__[r]]&&(e.__compiled__[r].validate=e.__compiled__[e.__schemas__[r]].validate,e.__compiled__[r].normalize=e.__compiled__[e.__schemas__[r]].normalize)})),e.__compiled__[""]={validate:null,normalize:function(e,r){r.normalize(e)}};var a=Object.keys(e.__compiled__).filter((function(r){return r.length>0&&e.__compiled__[r]})).map(pr).join("|");e.re.schema_test=RegExp("(^|(?!_)(?:[><\uff5c]|"+r.src_ZPCc+"))("+a+")","i"),e.re.schema_search=RegExp("(^|(?!_)(?:[><\uff5c]|"+r.src_ZPCc+"))("+a+")","ig"),e.re.pretest=RegExp("("+e.re.schema_test.source+")|("+e.re.host_fuzzy_test.source+")|@","i"),function(e){e.__index__=-1,e.__text_cache__=""}(e)}function gr(e,r){var t=e.__index__,n=e.__last_index__,s=e.__text_cache__.slice(t,n);this.schema=e.__schema__.toLowerCase(),this.index=t+r,this.lastIndex=n+r,this.raw=s,this.text=s,this.url=s}function _r(e,r){var t=new gr(e,r);return e.__compiled__[t.schema].normalize(t,e),t}function br(e,r){if(!(this instanceof br))return new br(e,r);var t;r||(t=e,Object.keys(t||{}).reduce((function(e,r){return e||hr.hasOwnProperty(r)}),!1)&&(r=e,e={})),this.__opts__=cr({},hr,r),this.__index__=-1,this.__last_index__=-1,this.__schema__="",this.__text_cache__="",this.__schemas__=cr({},fr,e),this.__compiled__={},this.__tlds__=dr,this.__tlds_replaced__=!1,this.re={},mr(this)}br.prototype.add=function(e,r){return this.__schemas__[e]=r,mr(this),this},br.prototype.set=function(e){return this.__opts__=cr(this.__opts__,e),this},br.prototype.test=function(e){if(this.__text_cache__=e,this.__index__=-1,!e.length)return!1;var r,t,n,s,o,i,a,c;if(this.re.schema_test.test(e))for((a=this.re.schema_search).lastIndex=0;null!==(r=a.exec(e));)if(s=this.testSchemaAt(e,r[2],a.lastIndex)){this.__schema__=r[2],this.__index__=r.index+r[1].length,this.__last_index__=r.index+r[0].length+s;break}return this.__opts__.fuzzyLink&&this.__compiled__["http:"]&&(c=e.search(this.re.host_fuzzy_test))>=0&&(this.__index__<0||c<this.__index__)&&null!==(t=e.match(this.__opts__.fuzzyIP?this.re.link_fuzzy:this.re.link_no_ip_fuzzy))&&(o=t.index+t[1].length,(this.__index__<0||o<this.__index__)&&(this.__schema__="",this.__index__=o,this.__last_index__=t.index+t[0].length)),this.__opts__.fuzzyEmail&&this.__compiled__["mailto:"]&&e.indexOf("@")>=0&&null!==(n=e.match(this.re.email_fuzzy))&&(o=n.index+n[1].length,i=n.index+n[0].length,(this.__index__<0||o<this.__index__||o===this.__index__&&i>this.__last_index__)&&(this.__schema__="mailto:",this.__index__=o,this.__last_index__=i)),this.__index__>=0},br.prototype.pretest=function(e){return this.re.pretest.test(e)},br.prototype.testSchemaAt=function(e,r,t){return this.__compiled__[r.toLowerCase()]?this.__compiled__[r.toLowerCase()].validate(e,t,this):0},br.prototype.match=function(e){var r=0,t=[];this.__index__>=0&&this.__text_cache__===e&&(t.push(_r(this,r)),r=this.__last_index__);for(var n=r?e.slice(r):e;this.test(n);)t.push(_r(this,r)),n=n.slice(this.__last_index__),r+=this.__last_index__;return t.length?t:null},br.prototype.tlds=function(e,r){return e=Array.isArray(e)?e:[e],r?(this.__tlds__=this.__tlds__.concat(e).sort().filter((function(e,r,t){return e!==t[r-1]})).reverse(),mr(this),this):(this.__tlds__=e.slice(),this.__tlds_replaced__=!0,mr(this),this)},br.prototype.normalize=function(e){e.schema||(e.url="http://"+e.url),"mailto:"!==e.schema||/^mailto:/i.test(e.url)||(e.url="mailto:"+e.url)},br.prototype.onCompile=function(){};var kr=br,vr=2147483647,Cr=36,yr=/^xn--/,Ar=/[^\x20-\x7E]/,xr=/[\x2E\u3002\uFF0E\uFF61]/g,Dr={overflow:"Overflow: input needs wider integers to process","not-basic":"Illegal input >= 0x80 (not a basic code point)","invalid-input":"Invalid input"},wr=Math.floor,Er=String.fromCharCode;
+/**
+ * Punycode v1.4.1
+ * @license MIT
+ * @source https://mths.be/punycode
+ */
+function qr(e){throw new RangeError(Dr[e])}function Sr(e,r){for(var t=e.length,n=[];t--;)n[t]=r(e[t]);return n}function Fr(e,r){var t=e.split("@"),n="";return t.length>1&&(n=t[0]+"@",e=t[1]),n+Sr((e=e.replace(xr,".")).split("."),r).join(".")}function Lr(e){for(var r,t,n=[],s=0,o=e.length;s<o;)(r=e.charCodeAt(s++))>=55296&&r<=56319&&s<o?56320==(64512&(t=e.charCodeAt(s++)))?n.push(((1023&r)<<10)+(1023&t)+65536):(n.push(r),s--):n.push(r);return n}function zr(e){return Sr(e,(function(e){var r="";return e>65535&&(r+=Er((e-=65536)>>>10&1023|55296),e=56320|1023&e),r+=Er(e)})).join("")}function Tr(e,r){return e+22+75*(e<26)-((0!=r)<<5)}function Ir(e,r,t){var n=0;for(e=t?wr(e/700):e>>1,e+=wr(e/r);e>455;n+=Cr)e=wr(e/35);return wr(n+36*e/(e+38))}function Mr(e){var r,t,n,s,o,i,a,c,l,u,p,h=[],f=e.length,d=0,m=128,g=72;for((t=e.lastIndexOf("-"))<0&&(t=0),n=0;n<t;++n)e.charCodeAt(n)>=128&&qr("not-basic"),h.push(e.charCodeAt(n));for(s=t>0?t+1:0;s<f;){for(o=d,i=1,a=Cr;s>=f&&qr("invalid-input"),((c=(p=e.charCodeAt(s++))-48<10?p-22:p-65<26?p-65:p-97<26?p-97:Cr)>=Cr||c>wr((vr-d)/i))&&qr("overflow"),d+=c*i,!(c<(l=a<=g?1:a>=g+26?26:a-g));a+=Cr)i>wr(vr/(u=Cr-l))&&qr("overflow"),i*=u;g=Ir(d-o,r=h.length+1,0==o),wr(d/r)>vr-m&&qr("overflow"),m+=wr(d/r),d%=r,h.splice(d++,0,m)}return zr(h)}function Rr(e){var r,t,n,s,o,i,a,c,l,u,p,h,f,d,m,g=[];for(h=(e=Lr(e)).length,r=128,t=0,o=72,i=0;i<h;++i)(p=e[i])<128&&g.push(Er(p));for(n=s=g.length,s&&g.push("-");n<h;){for(a=vr,i=0;i<h;++i)(p=e[i])>=r&&p<a&&(a=p);for(a-r>wr((vr-t)/(f=n+1))&&qr("overflow"),t+=(a-r)*f,r=a,i=0;i<h;++i)if((p=e[i])<r&&++t>vr&&qr("overflow"),p==r){for(c=t,l=Cr;!(c<(u=l<=o?1:l>=o+26?26:l-o));l+=Cr)m=c-u,d=Cr-u,g.push(Er(Tr(u+m%d,0))),c=wr(m/d);g.push(Er(Tr(c,0))),o=Ir(t,f,n==s),t=0,++n}++t,++r}return g.join("")}function Br(e){return Fr(e,(function(e){return yr.test(e)?Mr(e.slice(4).toLowerCase()):e}))}function Nr(e){return Fr(e,(function(e){return Ar.test(e)?"xn--"+Rr(e):e}))}var Or="1.4.1",Pr={decode:Lr,encode:zr},jr={version:Or,ucs2:Pr,toASCII:Nr,toUnicode:Br,encode:Rr,decode:Mr},Ur=e(Object.freeze({__proto__:null,decode:Mr,encode:Rr,toUnicode:Br,toASCII:Nr,version:Or,ucs2:Pr,default:jr})),Vr={default:{options:{html:!1,xhtmlOut:!1,breaks:!1,langPrefix:"language-",linkify:!1,typographer:!1,quotes:"\u201c\u201d\u2018\u2019",highlight:null,maxNesting:100},components:{core:{},block:{},inline:{}}},zero:{options:{html:!1,xhtmlOut:!1,breaks:!1,langPrefix:"language-",linkify:!1,typographer:!1,quotes:"\u201c\u201d\u2018\u2019",highlight:null,maxNesting:20},components:{core:{rules:["normalize","block","inline"]},block:{rules:["paragraph"]},inline:{rules:["text"],rules2:["balance_pairs","text_collapse"]}}},commonmark:{options:{html:!0,xhtmlOut:!0,breaks:!1,langPrefix:"language-",linkify:!1,typographer:!1,quotes:"\u201c\u201d\u2018\u2019",highlight:null,maxNesting:20},components:{core:{rules:["normalize","block","inline"]},block:{rules:["blockquote","code","fence","heading","hr","html_block","lheading","list","reference","paragraph"]},inline:{rules:["autolink","backticks","emphasis","entity","escape","html_inline","image","link","newline","text"],rules2:["balance_pairs","emphasis","text_collapse"]}}}},Zr=/^(vbscript|javascript|file|data):/,Gr=/^data:image\/(gif|png|jpeg|webp);/;function $r(e){var r=e.trim().toLowerCase();return!Zr.test(r)||!!Gr.test(r)}var Hr=["http:","https:","mailto:"];function Jr(e){var r=C.parse(e,!0);if(r.hostname&&(!r.protocol||Hr.indexOf(r.protocol)>=0))try{r.hostname=Ur.toASCII(r.hostname)}catch(e){}return C.encode(C.format(r))}function Wr(e){var r=C.parse(e,!0);if(r.hostname&&(!r.protocol||Hr.indexOf(r.protocol)>=0))try{r.hostname=Ur.toUnicode(r.hostname)}catch(e){}return C.decode(C.format(r),C.decode.defaultChars+"%")}function Yr(e,r){if(!(this instanceof Yr))return new Yr(e,r);r||w.isString(e)||(r=e||{},e="default"),this.inline=new ar,this.block=new Fe,this.core=new ce,this.renderer=new M,this.linkify=new kr,this.validateLink=$r,this.normalizeLink=Jr,this.normalizeLinkText=Wr,this.utils=w,this.helpers=w.assign({},S),this.options={},this.configure(e),r&&this.set(r)}return Yr.prototype.set=function(e){return w.assign(this.options,e),this},Yr.prototype.configure=function(e){var r,t=this;if(w.isString(e)&&!(e=Vr[r=e]))throw new Error('Wrong `markdown-it` preset "'+r+'", check name');if(!e)throw new Error("Wrong `markdown-it` preset, can't be empty");return e.options&&t.set(e.options),e.components&&Object.keys(e.components).forEach((function(r){e.components[r].rules&&t[r].ruler.enableOnly(e.components[r].rules),e.components[r].rules2&&t[r].ruler2.enableOnly(e.components[r].rules2)})),this},Yr.prototype.enable=function(e,r){var t=[];Array.isArray(e)||(e=[e]),["core","block","inline"].forEach((function(r){t=t.concat(this[r].ruler.enable(e,!0))}),this),t=t.concat(this.inline.ruler2.enable(e,!0));var n=e.filter((function(e){return t.indexOf(e)<0}));if(n.length&&!r)throw new Error("MarkdownIt. Failed to enable unknown rule(s): "+n);return this},Yr.prototype.disable=function(e,r){var t=[];Array.isArray(e)||(e=[e]),["core","block","inline"].forEach((function(r){t=t.concat(this[r].ruler.disable(e,!0))}),this),t=t.concat(this.inline.ruler2.disable(e,!0));var n=e.filter((function(e){return t.indexOf(e)<0}));if(n.length&&!r)throw new Error("MarkdownIt. Failed to disable unknown rule(s): "+n);return this},Yr.prototype.use=function(e){var r=[this].concat(Array.prototype.slice.call(arguments,1));return e.apply(e,r),this},Yr.prototype.parse=function(e,r){if("string"!=typeof e)throw new Error("Input data should be a String");var t=new this.core.State(e,this,r);return this.core.process(t),t.tokens},Yr.prototype.render=function(e,r){return r=r||{},this.renderer.render(this.parse(e,r),this.options,r)},Yr.prototype.parseInline=function(e,r){var t=new this.core.State(e,this,r);return t.inlineMode=!0,this.core.process(t),t.tokens},Yr.prototype.renderInline=function(e,r){return r=r||{},this.renderer.render(this.parseInline(e,r),this.options,r)},Yr}));
\ No newline at end of file
diff --git a/src/dep/mime-db.json b/src/dep/mime-db.json
new file mode 100644
index 0000000..29786a7
--- /dev/null
+++ b/src/dep/mime-db.json
@@ -0,0 +1,8453 @@
+{
+  "application/1d-interleaved-parityfec": {
+    "source": "iana"
+  },
+  "application/3gpdash-qoe-report+xml": {
+    "source": "iana",
+    "charset": "UTF-8",
+    "compressible": true
+  },
+  "application/3gpp-ims+xml": {
+    "source": "iana",
+    "compressible": true
+  },
+  "application/3gpphal+json": {
+    "source": "iana",
+    "compressible": true
+  },
+  "application/3gpphalforms+json": {
+    "source": "iana",
+    "compressible": true
+  },
+  "application/a2l": {
+    "source": "iana"
+  },
+  "application/ace+cbor": {
+    "source": "iana"
+  },
+  "application/activemessage": {
+    "source": "iana"
+  },
+  "application/activity+json": {
+    "source": "iana",
+    "compressible": true
+  },
+  "application/alto-costmap+json": {
+    "source": "iana",
+    "compressible": true
+  },
+  "application/alto-costmapfilter+json": {
+    "source": "iana",
+    "compressible": true
+  },
+  "application/alto-directory+json": {
+    "source": "iana",
+    "compressible": true
+  },
+  "application/alto-endpointcost+json": {
+    "source": "iana",
+    "compressible": true
+  },
+  "application/alto-endpointcostparams+json": {
+    "source": "iana",
+    "compressible": true
+  },
+  "application/alto-endpointprop+json": {
+    "source": "iana",
+    "compressible": true
+  },
+  "application/alto-endpointpropparams+json": {
+    "source": "iana",
+    "compressible": true
+  },
+  "application/alto-error+json": {
+    "source": "iana",
+    "compressible": true
+  },
+  "application/alto-networkmap+json": {
+    "source": "iana",
+    "compressible": true
+  },
+  "application/alto-networkmapfilter+json": {
+    "source": "iana",
+    "compressible": true
+  },
+  "application/alto-updatestreamcontrol+json": {
+    "source": "iana",
+    "compressible": true
+  },
+  "application/alto-updatestreamparams+json": {
+    "source": "iana",
+    "compressible": true
+  },
+  "application/aml": {
+    "source": "iana"
+  },
+  "application/andrew-inset": {
+    "source": "iana",
+    "extensions": ["ez"]
+  },
+  "application/applefile": {
+    "source": "iana"
+  },
+  "application/applixware": {
+    "source": "apache",
+    "extensions": ["aw"]
+  },
+  "application/at+jwt": {
+    "source": "iana"
+  },
+  "application/atf": {
+    "source": "iana"
+  },
+  "application/atfx": {
+    "source": "iana"
+  },
+  "application/atom+xml": {
+    "source": "iana",
+    "compressible": true,
+    "extensions": ["atom"]
+  },
+  "application/atomcat+xml": {
+    "source": "iana",
+    "compressible": true,
+    "extensions": ["atomcat"]
+  },
+  "application/atomdeleted+xml": {
+    "source": "iana",
+    "compressible": true,
+    "extensions": ["atomdeleted"]
+  },
+  "application/atomicmail": {
+    "source": "iana"
+  },
+  "application/atomsvc+xml": {
+    "source": "iana",
+    "compressible": true,
+    "extensions": ["atomsvc"]
+  },
+  "application/atsc-dwd+xml": {
+    "source": "iana",
+    "compressible": true,
+    "extensions": ["dwd"]
+  },
+  "application/atsc-dynamic-event-message": {
+    "source": "iana"
+  },
+  "application/atsc-held+xml": {
+    "source": "iana",
+    "compressible": true,
+    "extensions": ["held"]
+  },
+  "application/atsc-rdt+json": {
+    "source": "iana",
+    "compressible": true
+  },
+  "application/atsc-rsat+xml": {
+    "source": "iana",
+    "compressible": true,
+    "extensions": ["rsat"]
+  },
+  "application/atxml": {
+    "source": "iana"
+  },
+  "application/auth-policy+xml": {
+    "source": "iana",
+    "compressible": true
+  },
+  "application/bacnet-xdd+zip": {
+    "source": "iana",
+    "compressible": false
+  },
+  "application/batch-smtp": {
+    "source": "iana"
+  },
+  "application/bdoc": {
+    "compressible": false,
+    "extensions": ["bdoc"]
+  },
+  "application/beep+xml": {
+    "source": "iana",
+    "charset": "UTF-8",
+    "compressible": true
+  },
+  "application/calendar+json": {
+    "source": "iana",
+    "compressible": true
+  },
+  "application/calendar+xml": {
+    "source": "iana",
+    "compressible": true,
+    "extensions": ["xcs"]
+  },
+  "application/call-completion": {
+    "source": "iana"
+  },
+  "application/cals-1840": {
+    "source": "iana"
+  },
+  "application/captive+json": {
+    "source": "iana",
+    "compressible": true
+  },
+  "application/cbor": {
+    "source": "iana"
+  },
+  "application/cbor-seq": {
+    "source": "iana"
+  },
+  "application/cccex": {
+    "source": "iana"
+  },
+  "application/ccmp+xml": {
+    "source": "iana",
+    "compressible": true
+  },
+  "application/ccxml+xml": {
+    "source": "iana",
+    "compressible": true,
+    "extensions": ["ccxml"]
+  },
+  "application/cdfx+xml": {
+    "source": "iana",
+    "compressible": true,
+    "extensions": ["cdfx"]
+  },
+  "application/cdmi-capability": {
+    "source": "iana",
+    "extensions": ["cdmia"]
+  },
+  "application/cdmi-container": {
+    "source": "iana",
+    "extensions": ["cdmic"]
+  },
+  "application/cdmi-domain": {
+    "source": "iana",
+    "extensions": ["cdmid"]
+  },
+  "application/cdmi-object": {
+    "source": "iana",
+    "extensions": ["cdmio"]
+  },
+  "application/cdmi-queue": {
+    "source": "iana",
+    "extensions": ["cdmiq"]
+  },
+  "application/cdni": {
+    "source": "iana"
+  },
+  "application/cea": {
+    "source": "iana"
+  },
+  "application/cea-2018+xml": {
+    "source": "iana",
+    "compressible": true
+  },
+  "application/cellml+xml": {
+    "source": "iana",
+    "compressible": true
+  },
+  "application/cfw": {
+    "source": "iana"
+  },
+  "application/clr": {
+    "source": "iana"
+  },
+  "application/clue+xml": {
+    "source": "iana",
+    "compressible": true
+  },
+  "application/clue_info+xml": {
+    "source": "iana",
+    "compressible": true
+  },
+  "application/cms": {
+    "source": "iana"
+  },
+  "application/cnrp+xml": {
+    "source": "iana",
+    "compressible": true
+  },
+  "application/coap-group+json": {
+    "source": "iana",
+    "compressible": true
+  },
+  "application/coap-payload": {
+    "source": "iana"
+  },
+  "application/commonground": {
+    "source": "iana"
+  },
+  "application/conference-info+xml": {
+    "source": "iana",
+    "compressible": true
+  },
+  "application/cose": {
+    "source": "iana"
+  },
+  "application/cose-key": {
+    "source": "iana"
+  },
+  "application/cose-key-set": {
+    "source": "iana"
+  },
+  "application/cpl+xml": {
+    "source": "iana",
+    "compressible": true
+  },
+  "application/csrattrs": {
+    "source": "iana"
+  },
+  "application/csta+xml": {
+    "source": "iana",
+    "compressible": true
+  },
+  "application/cstadata+xml": {
+    "source": "iana",
+    "compressible": true
+  },
+  "application/csvm+json": {
+    "source": "iana",
+    "compressible": true
+  },
+  "application/cu-seeme": {
+    "source": "apache",
+    "extensions": ["cu"]
+  },
+  "application/cwt": {
+    "source": "iana"
+  },
+  "application/cybercash": {
+    "source": "iana"
+  },
+  "application/dart": {
+    "compressible": true
+  },
+  "application/dash+xml": {
+    "source": "iana",
+    "compressible": true,
+    "extensions": ["mpd"]
+  },
+  "application/dashdelta": {
+    "source": "iana"
+  },
+  "application/davmount+xml": {
+    "source": "iana",
+    "compressible": true,
+    "extensions": ["davmount"]
+  },
+  "application/dca-rft": {
+    "source": "iana"
+  },
+  "application/dcd": {
+    "source": "iana"
+  },
+  "application/dec-dx": {
+    "source": "iana"
+  },
+  "application/dialog-info+xml": {
+    "source": "iana",
+    "compressible": true
+  },
+  "application/dicom": {
+    "source": "iana"
+  },
+  "application/dicom+json": {
+    "source": "iana",
+    "compressible": true
+  },
+  "application/dicom+xml": {
+    "source": "iana",
+    "compressible": true
+  },
+  "application/dii": {
+    "source": "iana"
+  },
+  "application/dit": {
+    "source": "iana"
+  },
+  "application/dns": {
+    "source": "iana"
+  },
+  "application/dns+json": {
+    "source": "iana",
+    "compressible": true
+  },
+  "application/dns-message": {
+    "source": "iana"
+  },
+  "application/docbook+xml": {
+    "source": "apache",
+    "compressible": true,
+    "extensions": ["dbk"]
+  },
+  "application/dots+cbor": {
+    "source": "iana"
+  },
+  "application/dskpp+xml": {
+    "source": "iana",
+    "compressible": true
+  },
+  "application/dssc+der": {
+    "source": "iana",
+    "extensions": ["dssc"]
+  },
+  "application/dssc+xml": {
+    "source": "iana",
+    "compressible": true,
+    "extensions": ["xdssc"]
+  },
+  "application/dvcs": {
+    "source": "iana"
+  },
+  "application/ecmascript": {
+    "source": "iana",
+    "compressible": true,
+    "extensions": ["es","ecma"]
+  },
+  "application/edi-consent": {
+    "source": "iana"
+  },
+  "application/edi-x12": {
+    "source": "iana",
+    "compressible": false
+  },
+  "application/edifact": {
+    "source": "iana",
+    "compressible": false
+  },
+  "application/efi": {
+    "source": "iana"
+  },
+  "application/elm+json": {
+    "source": "iana",
+    "charset": "UTF-8",
+    "compressible": true
+  },
+  "application/elm+xml": {
+    "source": "iana",
+    "compressible": true
+  },
+  "application/emergencycalldata.cap+xml": {
+    "source": "iana",
+    "charset": "UTF-8",
+    "compressible": true
+  },
+  "application/emergencycalldata.comment+xml": {
+    "source": "iana",
+    "compressible": true
+  },
+  "application/emergencycalldata.control+xml": {
+    "source": "iana",
+    "compressible": true
+  },
+  "application/emergencycalldata.deviceinfo+xml": {
+    "source": "iana",
+    "compressible": true
+  },
+  "application/emergencycalldata.ecall.msd": {
+    "source": "iana"
+  },
+  "application/emergencycalldata.providerinfo+xml": {
+    "source": "iana",
+    "compressible": true
+  },
+  "application/emergencycalldata.serviceinfo+xml": {
+    "source": "iana",
+    "compressible": true
+  },
+  "application/emergencycalldata.subscriberinfo+xml": {
+    "source": "iana",
+    "compressible": true
+  },
+  "application/emergencycalldata.veds+xml": {
+    "source": "iana",
+    "compressible": true
+  },
+  "application/emma+xml": {
+    "source": "iana",
+    "compressible": true,
+    "extensions": ["emma"]
+  },
+  "application/emotionml+xml": {
+    "source": "iana",
+    "compressible": true,
+    "extensions": ["emotionml"]
+  },
+  "application/encaprtp": {
+    "source": "iana"
+  },
+  "application/epp+xml": {
+    "source": "iana",
+    "compressible": true
+  },
+  "application/epub+zip": {
+    "source": "iana",
+    "compressible": false,
+    "extensions": ["epub"]
+  },
+  "application/eshop": {
+    "source": "iana"
+  },
+  "application/exi": {
+    "source": "iana",
+    "extensions": ["exi"]
+  },
+  "application/expect-ct-report+json": {
+    "source": "iana",
+    "compressible": true
+  },
+  "application/express": {
+    "source": "iana",
+    "extensions": ["exp"]
+  },
+  "application/fastinfoset": {
+    "source": "iana"
+  },
+  "application/fastsoap": {
+    "source": "iana"
+  },
+  "application/fdt+xml": {
+    "source": "iana",
+    "compressible": true,
+    "extensions": ["fdt"]
+  },
+  "application/fhir+json": {
+    "source": "iana",
+    "charset": "UTF-8",
+    "compressible": true
+  },
+  "application/fhir+xml": {
+    "source": "iana",
+    "charset": "UTF-8",
+    "compressible": true
+  },
+  "application/fido.trusted-apps+json": {
+    "compressible": true
+  },
+  "application/fits": {
+    "source": "iana"
+  },
+  "application/flexfec": {
+    "source": "iana"
+  },
+  "application/font-sfnt": {
+    "source": "iana"
+  },
+  "application/font-tdpfr": {
+    "source": "iana",
+    "extensions": ["pfr"]
+  },
+  "application/font-woff": {
+    "source": "iana",
+    "compressible": false
+  },
+  "application/framework-attributes+xml": {
+    "source": "iana",
+    "compressible": true
+  },
+  "application/geo+json": {
+    "source": "iana",
+    "compressible": true,
+    "extensions": ["geojson"]
+  },
+  "application/geo+json-seq": {
+    "source": "iana"
+  },
+  "application/geopackage+sqlite3": {
+    "source": "iana"
+  },
+  "application/geoxacml+xml": {
+    "source": "iana",
+    "compressible": true
+  },
+  "application/gltf-buffer": {
+    "source": "iana"
+  },
+  "application/gml+xml": {
+    "source": "iana",
+    "compressible": true,
+    "extensions": ["gml"]
+  },
+  "application/gpx+xml": {
+    "source": "apache",
+    "compressible": true,
+    "extensions": ["gpx"]
+  },
+  "application/gxf": {
+    "source": "apache",
+    "extensions": ["gxf"]
+  },
+  "application/gzip": {
+    "source": "iana",
+    "compressible": false,
+    "extensions": ["gz"]
+  },
+  "application/h224": {
+    "source": "iana"
+  },
+  "application/held+xml": {
+    "source": "iana",
+    "compressible": true
+  },
+  "application/hjson": {
+    "extensions": ["hjson"]
+  },
+  "application/http": {
+    "source": "iana"
+  },
+  "application/hyperstudio": {
+    "source": "iana",
+    "extensions": ["stk"]
+  },
+  "application/ibe-key-request+xml": {
+    "source": "iana",
+    "compressible": true
+  },
+  "application/ibe-pkg-reply+xml": {
+    "source": "iana",
+    "compressible": true
+  },
+  "application/ibe-pp-data": {
+    "source": "iana"
+  },
+  "application/iges": {
+    "source": "iana"
+  },
+  "application/im-iscomposing+xml": {
+    "source": "iana",
+    "charset": "UTF-8",
+    "compressible": true
+  },
+  "application/index": {
+    "source": "iana"
+  },
+  "application/index.cmd": {
+    "source": "iana"
+  },
+  "application/index.obj": {
+    "source": "iana"
+  },
+  "application/index.response": {
+    "source": "iana"
+  },
+  "application/index.vnd": {
+    "source": "iana"
+  },
+  "application/inkml+xml": {
+    "source": "iana",
+    "compressible": true,
+    "extensions": ["ink","inkml"]
+  },
+  "application/iotp": {
+    "source": "iana"
+  },
+  "application/ipfix": {
+    "source": "iana",
+    "extensions": ["ipfix"]
+  },
+  "application/ipp": {
+    "source": "iana"
+  },
+  "application/isup": {
+    "source": "iana"
+  },
+  "application/its+xml": {
+    "source": "iana",
+    "compressible": true,
+    "extensions": ["its"]
+  },
+  "application/java-archive": {
+    "source": "apache",
+    "compressible": false,
+    "extensions": ["jar","war","ear"]
+  },
+  "application/java-serialized-object": {
+    "source": "apache",
+    "compressible": false,
+    "extensions": ["ser"]
+  },
+  "application/java-vm": {
+    "source": "apache",
+    "compressible": false,
+    "extensions": ["class"]
+  },
+  "application/javascript": {
+    "source": "iana",
+    "charset": "UTF-8",
+    "compressible": true,
+    "extensions": ["js","mjs"]
+  },
+  "application/jf2feed+json": {
+    "source": "iana",
+    "compressible": true
+  },
+  "application/jose": {
+    "source": "iana"
+  },
+  "application/jose+json": {
+    "source": "iana",
+    "compressible": true
+  },
+  "application/jrd+json": {
+    "source": "iana",
+    "compressible": true
+  },
+  "application/jscalendar+json": {
+    "source": "iana",
+    "compressible": true
+  },
+  "application/json": {
+    "source": "iana",
+    "charset": "UTF-8",
+    "compressible": true,
+    "extensions": ["json","map"]
+  },
+  "application/json-patch+json": {
+    "source": "iana",
+    "compressible": true
+  },
+  "application/json-seq": {
+    "source": "iana"
+  },
+  "application/json5": {
+    "extensions": ["json5"]
+  },
+  "application/jsonml+json": {
+    "source": "apache",
+    "compressible": true,
+    "extensions": ["jsonml"]
+  },
+  "application/jwk+json": {
+    "source": "iana",
+    "compressible": true
+  },
+  "application/jwk-set+json": {
+    "source": "iana",
+    "compressible": true
+  },
+  "application/jwt": {
+    "source": "iana"
+  },
+  "application/kpml-request+xml": {
+    "source": "iana",
+    "compressible": true
+  },
+  "application/kpml-response+xml": {
+    "source": "iana",
+    "compressible": true
+  },
+  "application/ld+json": {
+    "source": "iana",
+    "compressible": true,
+    "extensions": ["jsonld"]
+  },
+  "application/lgr+xml": {
+    "source": "iana",
+    "compressible": true,
+    "extensions": ["lgr"]
+  },
+  "application/link-format": {
+    "source": "iana"
+  },
+  "application/load-control+xml": {
+    "source": "iana",
+    "compressible": true
+  },
+  "application/lost+xml": {
+    "source": "iana",
+    "compressible": true,
+    "extensions": ["lostxml"]
+  },
+  "application/lostsync+xml": {
+    "source": "iana",
+    "compressible": true
+  },
+  "application/lpf+zip": {
+    "source": "iana",
+    "compressible": false
+  },
+  "application/lxf": {
+    "source": "iana"
+  },
+  "application/mac-binhex40": {
+    "source": "iana",
+    "extensions": ["hqx"]
+  },
+  "application/mac-compactpro": {
+    "source": "apache",
+    "extensions": ["cpt"]
+  },
+  "application/macwriteii": {
+    "source": "iana"
+  },
+  "application/mads+xml": {
+    "source": "iana",
+    "compressible": true,
+    "extensions": ["mads"]
+  },
+  "application/manifest+json": {
+    "source": "iana",
+    "charset": "UTF-8",
+    "compressible": true,
+    "extensions": ["webmanifest"]
+  },
+  "application/marc": {
+    "source": "iana",
+    "extensions": ["mrc"]
+  },
+  "application/marcxml+xml": {
+    "source": "iana",
+    "compressible": true,
+    "extensions": ["mrcx"]
+  },
+  "application/mathematica": {
+    "source": "iana",
+    "extensions": ["ma","nb","mb"]
+  },
+  "application/mathml+xml": {
+    "source": "iana",
+    "compressible": true,
+    "extensions": ["mathml"]
+  },
+  "application/mathml-content+xml": {
+    "source": "iana",
+    "compressible": true
+  },
+  "application/mathml-presentation+xml": {
+    "source": "iana",
+    "compressible": true
+  },
+  "application/mbms-associated-procedure-description+xml": {
+    "source": "iana",
+    "compressible": true
+  },
+  "application/mbms-deregister+xml": {
+    "source": "iana",
+    "compressible": true
+  },
+  "application/mbms-envelope+xml": {
+    "source": "iana",
+    "compressible": true
+  },
+  "application/mbms-msk+xml": {
+    "source": "iana",
+    "compressible": true
+  },
+  "application/mbms-msk-response+xml": {
+    "source": "iana",
+    "compressible": true
+  },
+  "application/mbms-protection-description+xml": {
+    "source": "iana",
+    "compressible": true
+  },
+  "application/mbms-reception-report+xml": {
+    "source": "iana",
+    "compressible": true
+  },
+  "application/mbms-register+xml": {
+    "source": "iana",
+    "compressible": true
+  },
+  "application/mbms-register-response+xml": {
+    "source": "iana",
+    "compressible": true
+  },
+  "application/mbms-schedule+xml": {
+    "source": "iana",
+    "compressible": true
+  },
+  "application/mbms-user-service-description+xml": {
+    "source": "iana",
+    "compressible": true
+  },
+  "application/mbox": {
+    "source": "iana",
+    "extensions": ["mbox"]
+  },
+  "application/media-policy-dataset+xml": {
+    "source": "iana",
+    "compressible": true
+  },
+  "application/media_control+xml": {
+    "source": "iana",
+    "compressible": true
+  },
+  "application/mediaservercontrol+xml": {
+    "source": "iana",
+    "compressible": true,
+    "extensions": ["mscml"]
+  },
+  "application/merge-patch+json": {
+    "source": "iana",
+    "compressible": true
+  },
+  "application/metalink+xml": {
+    "source": "apache",
+    "compressible": true,
+    "extensions": ["metalink"]
+  },
+  "application/metalink4+xml": {
+    "source": "iana",
+    "compressible": true,
+    "extensions": ["meta4"]
+  },
+  "application/mets+xml": {
+    "source": "iana",
+    "compressible": true,
+    "extensions": ["mets"]
+  },
+  "application/mf4": {
+    "source": "iana"
+  },
+  "application/mikey": {
+    "source": "iana"
+  },
+  "application/mipc": {
+    "source": "iana"
+  },
+  "application/missing-blocks+cbor-seq": {
+    "source": "iana"
+  },
+  "application/mmt-aei+xml": {
+    "source": "iana",
+    "compressible": true,
+    "extensions": ["maei"]
+  },
+  "application/mmt-usd+xml": {
+    "source": "iana",
+    "compressible": true,
+    "extensions": ["musd"]
+  },
+  "application/mods+xml": {
+    "source": "iana",
+    "compressible": true,
+    "extensions": ["mods"]
+  },
+  "application/moss-keys": {
+    "source": "iana"
+  },
+  "application/moss-signature": {
+    "source": "iana"
+  },
+  "application/mosskey-data": {
+    "source": "iana"
+  },
+  "application/mosskey-request": {
+    "source": "iana"
+  },
+  "application/mp21": {
+    "source": "iana",
+    "extensions": ["m21","mp21"]
+  },
+  "application/mp4": {
+    "source": "iana",
+    "extensions": ["mp4s","m4p"]
+  },
+  "application/mpeg4-generic": {
+    "source": "iana"
+  },
+  "application/mpeg4-iod": {
+    "source": "iana"
+  },
+  "application/mpeg4-iod-xmt": {
+    "source": "iana"
+  },
+  "application/mrb-consumer+xml": {
+    "source": "iana",
+    "compressible": true
+  },
+  "application/mrb-publish+xml": {
+    "source": "iana",
+    "compressible": true
+  },
+  "application/msc-ivr+xml": {
+    "source": "iana",
+    "charset": "UTF-8",
+    "compressible": true
+  },
+  "application/msc-mixer+xml": {
+    "source": "iana",
+    "charset": "UTF-8",
+    "compressible": true
+  },
+  "application/msword": {
+    "source": "iana",
+    "compressible": false,
+    "extensions": ["doc","dot"]
+  },
+  "application/mud+json": {
+    "source": "iana",
+    "compressible": true
+  },
+  "application/multipart-core": {
+    "source": "iana"
+  },
+  "application/mxf": {
+    "source": "iana",
+    "extensions": ["mxf"]
+  },
+  "application/n-quads": {
+    "source": "iana",
+    "extensions": ["nq"]
+  },
+  "application/n-triples": {
+    "source": "iana",
+    "extensions": ["nt"]
+  },
+  "application/nasdata": {
+    "source": "iana"
+  },
+  "application/news-checkgroups": {
+    "source": "iana",
+    "charset": "US-ASCII"
+  },
+  "application/news-groupinfo": {
+    "source": "iana",
+    "charset": "US-ASCII"
+  },
+  "application/news-transmission": {
+    "source": "iana"
+  },
+  "application/nlsml+xml": {
+    "source": "iana",
+    "compressible": true
+  },
+  "application/node": {
+    "source": "iana",
+    "extensions": ["cjs"]
+  },
+  "application/nss": {
+    "source": "iana"
+  },
+  "application/oauth-authz-req+jwt": {
+    "source": "iana"
+  },
+  "application/ocsp-request": {
+    "source": "iana"
+  },
+  "application/ocsp-response": {
+    "source": "iana"
+  },
+  "application/octet-stream": {
+    "source": "iana",
+    "compressible": false,
+    "extensions": ["bin","dms","lrf","mar","so","dist","distz","pkg","bpk","dump","elc","deploy","exe","dll","deb","dmg","iso","img","msi","msp","msm","buffer"]
+  },
+  "application/oda": {
+    "source": "iana",
+    "extensions": ["oda"]
+  },
+  "application/odm+xml": {
+    "source": "iana",
+    "compressible": true
+  },
+  "application/odx": {
+    "source": "iana"
+  },
+  "application/oebps-package+xml": {
+    "source": "iana",
+    "compressible": true,
+    "extensions": ["opf"]
+  },
+  "application/ogg": {
+    "source": "iana",
+    "compressible": false,
+    "extensions": ["ogx"]
+  },
+  "application/omdoc+xml": {
+    "source": "apache",
+    "compressible": true,
+    "extensions": ["omdoc"]
+  },
+  "application/onenote": {
+    "source": "apache",
+    "extensions": ["onetoc","onetoc2","onetmp","onepkg"]
+  },
+  "application/opc-nodeset+xml": {
+    "source": "iana",
+    "compressible": true
+  },
+  "application/oscore": {
+    "source": "iana"
+  },
+  "application/oxps": {
+    "source": "iana",
+    "extensions": ["oxps"]
+  },
+  "application/p21": {
+    "source": "iana"
+  },
+  "application/p21+zip": {
+    "source": "iana",
+    "compressible": false
+  },
+  "application/p2p-overlay+xml": {
+    "source": "iana",
+    "compressible": true,
+    "extensions": ["relo"]
+  },
+  "application/parityfec": {
+    "source": "iana"
+  },
+  "application/passport": {
+    "source": "iana"
+  },
+  "application/patch-ops-error+xml": {
+    "source": "iana",
+    "compressible": true,
+    "extensions": ["xer"]
+  },
+  "application/pdf": {
+    "source": "iana",
+    "compressible": false,
+    "extensions": ["pdf"]
+  },
+  "application/pdx": {
+    "source": "iana"
+  },
+  "application/pem-certificate-chain": {
+    "source": "iana"
+  },
+  "application/pgp-encrypted": {
+    "source": "iana",
+    "compressible": false,
+    "extensions": ["pgp"]
+  },
+  "application/pgp-keys": {
+    "source": "iana"
+  },
+  "application/pgp-signature": {
+    "source": "iana",
+    "extensions": ["asc","sig"]
+  },
+  "application/pics-rules": {
+    "source": "apache",
+    "extensions": ["prf"]
+  },
+  "application/pidf+xml": {
+    "source": "iana",
+    "charset": "UTF-8",
+    "compressible": true
+  },
+  "application/pidf-diff+xml": {
+    "source": "iana",
+    "charset": "UTF-8",
+    "compressible": true
+  },
+  "application/pkcs10": {
+    "source": "iana",
+    "extensions": ["p10"]
+  },
+  "application/pkcs12": {
+    "source": "iana"
+  },
+  "application/pkcs7-mime": {
+    "source": "iana",
+    "extensions": ["p7m","p7c"]
+  },
+  "application/pkcs7-signature": {
+    "source": "iana",
+    "extensions": ["p7s"]
+  },
+  "application/pkcs8": {
+    "source": "iana",
+    "extensions": ["p8"]
+  },
+  "application/pkcs8-encrypted": {
+    "source": "iana"
+  },
+  "application/pkix-attr-cert": {
+    "source": "iana",
+    "extensions": ["ac"]
+  },
+  "application/pkix-cert": {
+    "source": "iana",
+    "extensions": ["cer"]
+  },
+  "application/pkix-crl": {
+    "source": "iana",
+    "extensions": ["crl"]
+  },
+  "application/pkix-pkipath": {
+    "source": "iana",
+    "extensions": ["pkipath"]
+  },
+  "application/pkixcmp": {
+    "source": "iana",
+    "extensions": ["pki"]
+  },
+  "application/pls+xml": {
+    "source": "iana",
+    "compressible": true,
+    "extensions": ["pls"]
+  },
+  "application/poc-settings+xml": {
+    "source": "iana",
+    "charset": "UTF-8",
+    "compressible": true
+  },
+  "application/postscript": {
+    "source": "iana",
+    "compressible": true,
+    "extensions": ["ai","eps","ps"]
+  },
+  "application/ppsp-tracker+json": {
+    "source": "iana",
+    "compressible": true
+  },
+  "application/problem+json": {
+    "source": "iana",
+    "compressible": true
+  },
+  "application/problem+xml": {
+    "source": "iana",
+    "compressible": true
+  },
+  "application/provenance+xml": {
+    "source": "iana",
+    "compressible": true,
+    "extensions": ["provx"]
+  },
+  "application/prs.alvestrand.titrax-sheet": {
+    "source": "iana"
+  },
+  "application/prs.cww": {
+    "source": "iana",
+    "extensions": ["cww"]
+  },
+  "application/prs.cyn": {
+    "source": "iana",
+    "charset": "7-BIT"
+  },
+  "application/prs.hpub+zip": {
+    "source": "iana",
+    "compressible": false
+  },
+  "application/prs.nprend": {
+    "source": "iana"
+  },
+  "application/prs.plucker": {
+    "source": "iana"
+  },
+  "application/prs.rdf-xml-crypt": {
+    "source": "iana"
+  },
+  "application/prs.xsf+xml": {
+    "source": "iana",
+    "compressible": true
+  },
+  "application/pskc+xml": {
+    "source": "iana",
+    "compressible": true,
+    "extensions": ["pskcxml"]
+  },
+  "application/pvd+json": {
+    "source": "iana",
+    "compressible": true
+  },
+  "application/qsig": {
+    "source": "iana"
+  },
+  "application/raml+yaml": {
+    "compressible": true,
+    "extensions": ["raml"]
+  },
+  "application/raptorfec": {
+    "source": "iana"
+  },
+  "application/rdap+json": {
+    "source": "iana",
+    "compressible": true
+  },
+  "application/rdf+xml": {
+    "source": "iana",
+    "compressible": true,
+    "extensions": ["rdf","owl"]
+  },
+  "application/reginfo+xml": {
+    "source": "iana",
+    "compressible": true,
+    "extensions": ["rif"]
+  },
+  "application/relax-ng-compact-syntax": {
+    "source": "iana",
+    "extensions": ["rnc"]
+  },
+  "application/remote-printing": {
+    "source": "iana"
+  },
+  "application/reputon+json": {
+    "source": "iana",
+    "compressible": true
+  },
+  "application/resource-lists+xml": {
+    "source": "iana",
+    "compressible": true,
+    "extensions": ["rl"]
+  },
+  "application/resource-lists-diff+xml": {
+    "source": "iana",
+    "compressible": true,
+    "extensions": ["rld"]
+  },
+  "application/rfc+xml": {
+    "source": "iana",
+    "compressible": true
+  },
+  "application/riscos": {
+    "source": "iana"
+  },
+  "application/rlmi+xml": {
+    "source": "iana",
+    "compressible": true
+  },
+  "application/rls-services+xml": {
+    "source": "iana",
+    "compressible": true,
+    "extensions": ["rs"]
+  },
+  "application/route-apd+xml": {
+    "source": "iana",
+    "compressible": true,
+    "extensions": ["rapd"]
+  },
+  "application/route-s-tsid+xml": {
+    "source": "iana",
+    "compressible": true,
+    "extensions": ["sls"]
+  },
+  "application/route-usd+xml": {
+    "source": "iana",
+    "compressible": true,
+    "extensions": ["rusd"]
+  },
+  "application/rpki-ghostbusters": {
+    "source": "iana",
+    "extensions": ["gbr"]
+  },
+  "application/rpki-manifest": {
+    "source": "iana",
+    "extensions": ["mft"]
+  },
+  "application/rpki-publication": {
+    "source": "iana"
+  },
+  "application/rpki-roa": {
+    "source": "iana",
+    "extensions": ["roa"]
+  },
+  "application/rpki-updown": {
+    "source": "iana"
+  },
+  "application/rsd+xml": {
+    "source": "apache",
+    "compressible": true,
+    "extensions": ["rsd"]
+  },
+  "application/rss+xml": {
+    "source": "apache",
+    "compressible": true,
+    "extensions": ["rss"]
+  },
+  "application/rtf": {
+    "source": "iana",
+    "compressible": true,
+    "extensions": ["rtf"]
+  },
+  "application/rtploopback": {
+    "source": "iana"
+  },
+  "application/rtx": {
+    "source": "iana"
+  },
+  "application/samlassertion+xml": {
+    "source": "iana",
+    "compressible": true
+  },
+  "application/samlmetadata+xml": {
+    "source": "iana",
+    "compressible": true
+  },
+  "application/sarif+json": {
+    "source": "iana",
+    "compressible": true
+  },
+  "application/sarif-external-properties+json": {
+    "source": "iana",
+    "compressible": true
+  },
+  "application/sbe": {
+    "source": "iana"
+  },
+  "application/sbml+xml": {
+    "source": "iana",
+    "compressible": true,
+    "extensions": ["sbml"]
+  },
+  "application/scaip+xml": {
+    "source": "iana",
+    "compressible": true
+  },
+  "application/scim+json": {
+    "source": "iana",
+    "compressible": true
+  },
+  "application/scvp-cv-request": {
+    "source": "iana",
+    "extensions": ["scq"]
+  },
+  "application/scvp-cv-response": {
+    "source": "iana",
+    "extensions": ["scs"]
+  },
+  "application/scvp-vp-request": {
+    "source": "iana",
+    "extensions": ["spq"]
+  },
+  "application/scvp-vp-response": {
+    "source": "iana",
+    "extensions": ["spp"]
+  },
+  "application/sdp": {
+    "source": "iana",
+    "extensions": ["sdp"]
+  },
+  "application/secevent+jwt": {
+    "source": "iana"
+  },
+  "application/senml+cbor": {
+    "source": "iana"
+  },
+  "application/senml+json": {
+    "source": "iana",
+    "compressible": true
+  },
+  "application/senml+xml": {
+    "source": "iana",
+    "compressible": true,
+    "extensions": ["senmlx"]
+  },
+  "application/senml-etch+cbor": {
+    "source": "iana"
+  },
+  "application/senml-etch+json": {
+    "source": "iana",
+    "compressible": true
+  },
+  "application/senml-exi": {
+    "source": "iana"
+  },
+  "application/sensml+cbor": {
+    "source": "iana"
+  },
+  "application/sensml+json": {
+    "source": "iana",
+    "compressible": true
+  },
+  "application/sensml+xml": {
+    "source": "iana",
+    "compressible": true,
+    "extensions": ["sensmlx"]
+  },
+  "application/sensml-exi": {
+    "source": "iana"
+  },
+  "application/sep+xml": {
+    "source": "iana",
+    "compressible": true
+  },
+  "application/sep-exi": {
+    "source": "iana"
+  },
+  "application/session-info": {
+    "source": "iana"
+  },
+  "application/set-payment": {
+    "source": "iana"
+  },
+  "application/set-payment-initiation": {
+    "source": "iana",
+    "extensions": ["setpay"]
+  },
+  "application/set-registration": {
+    "source": "iana"
+  },
+  "application/set-registration-initiation": {
+    "source": "iana",
+    "extensions": ["setreg"]
+  },
+  "application/sgml": {
+    "source": "iana"
+  },
+  "application/sgml-open-catalog": {
+    "source": "iana"
+  },
+  "application/shf+xml": {
+    "source": "iana",
+    "compressible": true,
+    "extensions": ["shf"]
+  },
+  "application/sieve": {
+    "source": "iana",
+    "extensions": ["siv","sieve"]
+  },
+  "application/simple-filter+xml": {
+    "source": "iana",
+    "compressible": true
+  },
+  "application/simple-message-summary": {
+    "source": "iana"
+  },
+  "application/simplesymbolcontainer": {
+    "source": "iana"
+  },
+  "application/sipc": {
+    "source": "iana"
+  },
+  "application/slate": {
+    "source": "iana"
+  },
+  "application/smil": {
+    "source": "iana"
+  },
+  "application/smil+xml": {
+    "source": "iana",
+    "compressible": true,
+    "extensions": ["smi","smil"]
+  },
+  "application/smpte336m": {
+    "source": "iana"
+  },
+  "application/soap+fastinfoset": {
+    "source": "iana"
+  },
+  "application/soap+xml": {
+    "source": "iana",
+    "compressible": true
+  },
+  "application/sparql-query": {
+    "source": "iana",
+    "extensions": ["rq"]
+  },
+  "application/sparql-results+xml": {
+    "source": "iana",
+    "compressible": true,
+    "extensions": ["srx"]
+  },
+  "application/spirits-event+xml": {
+    "source": "iana",
+    "compressible": true
+  },
+  "application/sql": {
+    "source": "iana"
+  },
+  "application/srgs": {
+    "source": "iana",
+    "extensions": ["gram"]
+  },
+  "application/srgs+xml": {
+    "source": "iana",
+    "compressible": true,
+    "extensions": ["grxml"]
+  },
+  "application/sru+xml": {
+    "source": "iana",
+    "compressible": true,
+    "extensions": ["sru"]
+  },
+  "application/ssdl+xml": {
+    "source": "apache",
+    "compressible": true,
+    "extensions": ["ssdl"]
+  },
+  "application/ssml+xml": {
+    "source": "iana",
+    "compressible": true,
+    "extensions": ["ssml"]
+  },
+  "application/stix+json": {
+    "source": "iana",
+    "compressible": true
+  },
+  "application/swid+xml": {
+    "source": "iana",
+    "compressible": true,
+    "extensions": ["swidtag"]
+  },
+  "application/tamp-apex-update": {
+    "source": "iana"
+  },
+  "application/tamp-apex-update-confirm": {
+    "source": "iana"
+  },
+  "application/tamp-community-update": {
+    "source": "iana"
+  },
+  "application/tamp-community-update-confirm": {
+    "source": "iana"
+  },
+  "application/tamp-error": {
+    "source": "iana"
+  },
+  "application/tamp-sequence-adjust": {
+    "source": "iana"
+  },
+  "application/tamp-sequence-adjust-confirm": {
+    "source": "iana"
+  },
+  "application/tamp-status-query": {
+    "source": "iana"
+  },
+  "application/tamp-status-response": {
+    "source": "iana"
+  },
+  "application/tamp-update": {
+    "source": "iana"
+  },
+  "application/tamp-update-confirm": {
+    "source": "iana"
+  },
+  "application/tar": {
+    "compressible": true
+  },
+  "application/taxii+json": {
+    "source": "iana",
+    "compressible": true
+  },
+  "application/td+json": {
+    "source": "iana",
+    "compressible": true
+  },
+  "application/tei+xml": {
+    "source": "iana",
+    "compressible": true,
+    "extensions": ["tei","teicorpus"]
+  },
+  "application/tetra_isi": {
+    "source": "iana"
+  },
+  "application/thraud+xml": {
+    "source": "iana",
+    "compressible": true,
+    "extensions": ["tfi"]
+  },
+  "application/timestamp-query": {
+    "source": "iana"
+  },
+  "application/timestamp-reply": {
+    "source": "iana"
+  },
+  "application/timestamped-data": {
+    "source": "iana",
+    "extensions": ["tsd"]
+  },
+  "application/tlsrpt+gzip": {
+    "source": "iana"
+  },
+  "application/tlsrpt+json": {
+    "source": "iana",
+    "compressible": true
+  },
+  "application/tnauthlist": {
+    "source": "iana"
+  },
+  "application/token-introspection+jwt": {
+    "source": "iana"
+  },
+  "application/toml": {
+    "compressible": true,
+    "extensions": ["toml"]
+  },
+  "application/trickle-ice-sdpfrag": {
+    "source": "iana"
+  },
+  "application/trig": {
+    "source": "iana",
+    "extensions": ["trig"]
+  },
+  "application/ttml+xml": {
+    "source": "iana",
+    "compressible": true,
+    "extensions": ["ttml"]
+  },
+  "application/tve-trigger": {
+    "source": "iana"
+  },
+  "application/tzif": {
+    "source": "iana"
+  },
+  "application/tzif-leap": {
+    "source": "iana"
+  },
+  "application/ubjson": {
+    "compressible": false,
+    "extensions": ["ubj"]
+  },
+  "application/ulpfec": {
+    "source": "iana"
+  },
+  "application/urc-grpsheet+xml": {
+    "source": "iana",
+    "compressible": true
+  },
+  "application/urc-ressheet+xml": {
+    "source": "iana",
+    "compressible": true,
+    "extensions": ["rsheet"]
+  },
+  "application/urc-targetdesc+xml": {
+    "source": "iana",
+    "compressible": true,
+    "extensions": ["td"]
+  },
+  "application/urc-uisocketdesc+xml": {
+    "source": "iana",
+    "compressible": true
+  },
+  "application/vcard+json": {
+    "source": "iana",
+    "compressible": true
+  },
+  "application/vcard+xml": {
+    "source": "iana",
+    "compressible": true
+  },
+  "application/vemmi": {
+    "source": "iana"
+  },
+  "application/vividence.scriptfile": {
+    "source": "apache"
+  },
+  "application/vnd.1000minds.decision-model+xml": {
+    "source": "iana",
+    "compressible": true,
+    "extensions": ["1km"]
+  },
+  "application/vnd.3gpp-prose+xml": {
+    "source": "iana",
+    "compressible": true
+  },
+  "application/vnd.3gpp-prose-pc3ch+xml": {
+    "source": "iana",
+    "compressible": true
+  },
+  "application/vnd.3gpp-v2x-local-service-information": {
+    "source": "iana"
+  },
+  "application/vnd.3gpp.5gnas": {
+    "source": "iana"
+  },
+  "application/vnd.3gpp.access-transfer-events+xml": {
+    "source": "iana",
+    "compressible": true
+  },
+  "application/vnd.3gpp.bsf+xml": {
+    "source": "iana",
+    "compressible": true
+  },
+  "application/vnd.3gpp.gmop+xml": {
+    "source": "iana",
+    "compressible": true
+  },
+  "application/vnd.3gpp.gtpc": {
+    "source": "iana"
+  },
+  "application/vnd.3gpp.interworking-data": {
+    "source": "iana"
+  },
+  "application/vnd.3gpp.lpp": {
+    "source": "iana"
+  },
+  "application/vnd.3gpp.mc-signalling-ear": {
+    "source": "iana"
+  },
+  "application/vnd.3gpp.mcdata-affiliation-command+xml": {
+    "source": "iana",
+    "compressible": true
+  },
+  "application/vnd.3gpp.mcdata-info+xml": {
+    "source": "iana",
+    "compressible": true
+  },
+  "application/vnd.3gpp.mcdata-payload": {
+    "source": "iana"
+  },
+  "application/vnd.3gpp.mcdata-service-config+xml": {
+    "source": "iana",
+    "compressible": true
+  },
+  "application/vnd.3gpp.mcdata-signalling": {
+    "source": "iana"
+  },
+  "application/vnd.3gpp.mcdata-ue-config+xml": {
+    "source": "iana",
+    "compressible": true
+  },
+  "application/vnd.3gpp.mcdata-user-profile+xml": {
+    "source": "iana",
+    "compressible": true
+  },
+  "application/vnd.3gpp.mcptt-affiliation-command+xml": {
+    "source": "iana",
+    "compressible": true
+  },
+  "application/vnd.3gpp.mcptt-floor-request+xml": {
+    "source": "iana",
+    "compressible": true
+  },
+  "application/vnd.3gpp.mcptt-info+xml": {
+    "source": "iana",
+    "compressible": true
+  },
+  "application/vnd.3gpp.mcptt-location-info+xml": {
+    "source": "iana",
+    "compressible": true
+  },
+  "application/vnd.3gpp.mcptt-mbms-usage-info+xml": {
+    "source": "iana",
+    "compressible": true
+  },
+  "application/vnd.3gpp.mcptt-service-config+xml": {
+    "source": "iana",
+    "compressible": true
+  },
+  "application/vnd.3gpp.mcptt-signed+xml": {
+    "source": "iana",
+    "compressible": true
+  },
+  "application/vnd.3gpp.mcptt-ue-config+xml": {
+    "source": "iana",
+    "compressible": true
+  },
+  "application/vnd.3gpp.mcptt-ue-init-config+xml": {
+    "source": "iana",
+    "compressible": true
+  },
+  "application/vnd.3gpp.mcptt-user-profile+xml": {
+    "source": "iana",
+    "compressible": true
+  },
+  "application/vnd.3gpp.mcvideo-affiliation-command+xml": {
+    "source": "iana",
+    "compressible": true
+  },
+  "application/vnd.3gpp.mcvideo-affiliation-info+xml": {
+    "source": "iana",
+    "compressible": true
+  },
+  "application/vnd.3gpp.mcvideo-info+xml": {
+    "source": "iana",
+    "compressible": true
+  },
+  "application/vnd.3gpp.mcvideo-location-info+xml": {
+    "source": "iana",
+    "compressible": true
+  },
+  "application/vnd.3gpp.mcvideo-mbms-usage-info+xml": {
+    "source": "iana",
+    "compressible": true
+  },
+  "application/vnd.3gpp.mcvideo-service-config+xml": {
+    "source": "iana",
+    "compressible": true
+  },
+  "application/vnd.3gpp.mcvideo-transmission-request+xml": {
+    "source": "iana",
+    "compressible": true
+  },
+  "application/vnd.3gpp.mcvideo-ue-config+xml": {
+    "source": "iana",
+    "compressible": true
+  },
+  "application/vnd.3gpp.mcvideo-user-profile+xml": {
+    "source": "iana",
+    "compressible": true
+  },
+  "application/vnd.3gpp.mid-call+xml": {
+    "source": "iana",
+    "compressible": true
+  },
+  "application/vnd.3gpp.ngap": {
+    "source": "iana"
+  },
+  "application/vnd.3gpp.pfcp": {
+    "source": "iana"
+  },
+  "application/vnd.3gpp.pic-bw-large": {
+    "source": "iana",
+    "extensions": ["plb"]
+  },
+  "application/vnd.3gpp.pic-bw-small": {
+    "source": "iana",
+    "extensions": ["psb"]
+  },
+  "application/vnd.3gpp.pic-bw-var": {
+    "source": "iana",
+    "extensions": ["pvb"]
+  },
+  "application/vnd.3gpp.s1ap": {
+    "source": "iana"
+  },
+  "application/vnd.3gpp.sms": {
+    "source": "iana"
+  },
+  "application/vnd.3gpp.sms+xml": {
+    "source": "iana",
+    "compressible": true
+  },
+  "application/vnd.3gpp.srvcc-ext+xml": {
+    "source": "iana",
+    "compressible": true
+  },
+  "application/vnd.3gpp.srvcc-info+xml": {
+    "source": "iana",
+    "compressible": true
+  },
+  "application/vnd.3gpp.state-and-event-info+xml": {
+    "source": "iana",
+    "compressible": true
+  },
+  "application/vnd.3gpp.ussd+xml": {
+    "source": "iana",
+    "compressible": true
+  },
+  "application/vnd.3gpp2.bcmcsinfo+xml": {
+    "source": "iana",
+    "compressible": true
+  },
+  "application/vnd.3gpp2.sms": {
+    "source": "iana"
+  },
+  "application/vnd.3gpp2.tcap": {
+    "source": "iana",
+    "extensions": ["tcap"]
+  },
+  "application/vnd.3lightssoftware.imagescal": {
+    "source": "iana"
+  },
+  "application/vnd.3m.post-it-notes": {
+    "source": "iana",
+    "extensions": ["pwn"]
+  },
+  "application/vnd.accpac.simply.aso": {
+    "source": "iana",
+    "extensions": ["aso"]
+  },
+  "application/vnd.accpac.simply.imp": {
+    "source": "iana",
+    "extensions": ["imp"]
+  },
+  "application/vnd.acucobol": {
+    "source": "iana",
+    "extensions": ["acu"]
+  },
+  "application/vnd.acucorp": {
+    "source": "iana",
+    "extensions": ["atc","acutc"]
+  },
+  "application/vnd.adobe.air-application-installer-package+zip": {
+    "source": "apache",
+    "compressible": false,
+    "extensions": ["air"]
+  },
+  "application/vnd.adobe.flash.movie": {
+    "source": "iana"
+  },
+  "application/vnd.adobe.formscentral.fcdt": {
+    "source": "iana",
+    "extensions": ["fcdt"]
+  },
+  "application/vnd.adobe.fxp": {
+    "source": "iana",
+    "extensions": ["fxp","fxpl"]
+  },
+  "application/vnd.adobe.partial-upload": {
+    "source": "iana"
+  },
+  "application/vnd.adobe.xdp+xml": {
+    "source": "iana",
+    "compressible": true,
+    "extensions": ["xdp"]
+  },
+  "application/vnd.adobe.xfdf": {
+    "source": "iana",
+    "extensions": ["xfdf"]
+  },
+  "application/vnd.aether.imp": {
+    "source": "iana"
+  },
+  "application/vnd.afpc.afplinedata": {
+    "source": "iana"
+  },
+  "application/vnd.afpc.afplinedata-pagedef": {
+    "source": "iana"
+  },
+  "application/vnd.afpc.cmoca-cmresource": {
+    "source": "iana"
+  },
+  "application/vnd.afpc.foca-charset": {
+    "source": "iana"
+  },
+  "application/vnd.afpc.foca-codedfont": {
+    "source": "iana"
+  },
+  "application/vnd.afpc.foca-codepage": {
+    "source": "iana"
+  },
+  "application/vnd.afpc.modca": {
+    "source": "iana"
+  },
+  "application/vnd.afpc.modca-cmtable": {
+    "source": "iana"
+  },
+  "application/vnd.afpc.modca-formdef": {
+    "source": "iana"
+  },
+  "application/vnd.afpc.modca-mediummap": {
+    "source": "iana"
+  },
+  "application/vnd.afpc.modca-objectcontainer": {
+    "source": "iana"
+  },
+  "application/vnd.afpc.modca-overlay": {
+    "source": "iana"
+  },
+  "application/vnd.afpc.modca-pagesegment": {
+    "source": "iana"
+  },
+  "application/vnd.ah-barcode": {
+    "source": "iana"
+  },
+  "application/vnd.ahead.space": {
+    "source": "iana",
+    "extensions": ["ahead"]
+  },
+  "application/vnd.airzip.filesecure.azf": {
+    "source": "iana",
+    "extensions": ["azf"]
+  },
+  "application/vnd.airzip.filesecure.azs": {
+    "source": "iana",
+    "extensions": ["azs"]
+  },
+  "application/vnd.amadeus+json": {
+    "source": "iana",
+    "compressible": true
+  },
+  "application/vnd.amazon.ebook": {
+    "source": "apache",
+    "extensions": ["azw"]
+  },
+  "application/vnd.amazon.mobi8-ebook": {
+    "source": "iana"
+  },
+  "application/vnd.americandynamics.acc": {
+    "source": "iana",
+    "extensions": ["acc"]
+  },
+  "application/vnd.amiga.ami": {
+    "source": "iana",
+    "extensions": ["ami"]
+  },
+  "application/vnd.amundsen.maze+xml": {
+    "source": "iana",
+    "compressible": true
+  },
+  "application/vnd.android.ota": {
+    "source": "iana"
+  },
+  "application/vnd.android.package-archive": {
+    "source": "apache",
+    "compressible": false,
+    "extensions": ["apk"]
+  },
+  "application/vnd.anki": {
+    "source": "iana"
+  },
+  "application/vnd.anser-web-certificate-issue-initiation": {
+    "source": "iana",
+    "extensions": ["cii"]
+  },
+  "application/vnd.anser-web-funds-transfer-initiation": {
+    "source": "apache",
+    "extensions": ["fti"]
+  },
+  "application/vnd.antix.game-component": {
+    "source": "iana",
+    "extensions": ["atx"]
+  },
+  "application/vnd.apache.arrow.file": {
+    "source": "iana"
+  },
+  "application/vnd.apache.arrow.stream": {
+    "source": "iana"
+  },
+  "application/vnd.apache.thrift.binary": {
+    "source": "iana"
+  },
+  "application/vnd.apache.thrift.compact": {
+    "source": "iana"
+  },
+  "application/vnd.apache.thrift.json": {
+    "source": "iana"
+  },
+  "application/vnd.api+json": {
+    "source": "iana",
+    "compressible": true
+  },
+  "application/vnd.aplextor.warrp+json": {
+    "source": "iana",
+    "compressible": true
+  },
+  "application/vnd.apothekende.reservation+json": {
+    "source": "iana",
+    "compressible": true
+  },
+  "application/vnd.apple.installer+xml": {
+    "source": "iana",
+    "compressible": true,
+    "extensions": ["mpkg"]
+  },
+  "application/vnd.apple.keynote": {
+    "source": "iana",
+    "extensions": ["key"]
+  },
+  "application/vnd.apple.mpegurl": {
+    "source": "iana",
+    "extensions": ["m3u8"]
+  },
+  "application/vnd.apple.numbers": {
+    "source": "iana",
+    "extensions": ["numbers"]
+  },
+  "application/vnd.apple.pages": {
+    "source": "iana",
+    "extensions": ["pages"]
+  },
+  "application/vnd.apple.pkpass": {
+    "compressible": false,
+    "extensions": ["pkpass"]
+  },
+  "application/vnd.arastra.swi": {
+    "source": "iana"
+  },
+  "application/vnd.aristanetworks.swi": {
+    "source": "iana",
+    "extensions": ["swi"]
+  },
+  "application/vnd.artisan+json": {
+    "source": "iana",
+    "compressible": true
+  },
+  "application/vnd.artsquare": {
+    "source": "iana"
+  },
+  "application/vnd.astraea-software.iota": {
+    "source": "iana",
+    "extensions": ["iota"]
+  },
+  "application/vnd.audiograph": {
+    "source": "iana",
+    "extensions": ["aep"]
+  },
+  "application/vnd.autopackage": {
+    "source": "iana"
+  },
+  "application/vnd.avalon+json": {
+    "source": "iana",
+    "compressible": true
+  },
+  "application/vnd.avistar+xml": {
+    "source": "iana",
+    "compressible": true
+  },
+  "application/vnd.balsamiq.bmml+xml": {
+    "source": "iana",
+    "compressible": true,
+    "extensions": ["bmml"]
+  },
+  "application/vnd.balsamiq.bmpr": {
+    "source": "iana"
+  },
+  "application/vnd.banana-accounting": {
+    "source": "iana"
+  },
+  "application/vnd.bbf.usp.error": {
+    "source": "iana"
+  },
+  "application/vnd.bbf.usp.msg": {
+    "source": "iana"
+  },
+  "application/vnd.bbf.usp.msg+json": {
+    "source": "iana",
+    "compressible": true
+  },
+  "application/vnd.bekitzur-stech+json": {
+    "source": "iana",
+    "compressible": true
+  },
+  "application/vnd.bint.med-content": {
+    "source": "iana"
+  },
+  "application/vnd.biopax.rdf+xml": {
+    "source": "iana",
+    "compressible": true
+  },
+  "application/vnd.blink-idb-value-wrapper": {
+    "source": "iana"
+  },
+  "application/vnd.blueice.multipass": {
+    "source": "iana",
+    "extensions": ["mpm"]
+  },
+  "application/vnd.bluetooth.ep.oob": {
+    "source": "iana"
+  },
+  "application/vnd.bluetooth.le.oob": {
+    "source": "iana"
+  },
+  "application/vnd.bmi": {
+    "source": "iana",
+    "extensions": ["bmi"]
+  },
+  "application/vnd.bpf": {
+    "source": "iana"
+  },
+  "application/vnd.bpf3": {
+    "source": "iana"
+  },
+  "application/vnd.businessobjects": {
+    "source": "iana",
+    "extensions": ["rep"]
+  },
+  "application/vnd.byu.uapi+json": {
+    "source": "iana",
+    "compressible": true
+  },
+  "application/vnd.cab-jscript": {
+    "source": "iana"
+  },
+  "application/vnd.canon-cpdl": {
+    "source": "iana"
+  },
+  "application/vnd.canon-lips": {
+    "source": "iana"
+  },
+  "application/vnd.capasystems-pg+json": {
+    "source": "iana",
+    "compressible": true
+  },
+  "application/vnd.cendio.thinlinc.clientconf": {
+    "source": "iana"
+  },
+  "application/vnd.century-systems.tcp_stream": {
+    "source": "iana"
+  },
+  "application/vnd.chemdraw+xml": {
+    "source": "iana",
+    "compressible": true,
+    "extensions": ["cdxml"]
+  },
+  "application/vnd.chess-pgn": {
+    "source": "iana"
+  },
+  "application/vnd.chipnuts.karaoke-mmd": {
+    "source": "iana",
+    "extensions": ["mmd"]
+  },
+  "application/vnd.ciedi": {
+    "source": "iana"
+  },
+  "application/vnd.cinderella": {
+    "source": "iana",
+    "extensions": ["cdy"]
+  },
+  "application/vnd.cirpack.isdn-ext": {
+    "source": "iana"
+  },
+  "application/vnd.citationstyles.style+xml": {
+    "source": "iana",
+    "compressible": true,
+    "extensions": ["csl"]
+  },
+  "application/vnd.claymore": {
+    "source": "iana",
+    "extensions": ["cla"]
+  },
+  "application/vnd.cloanto.rp9": {
+    "source": "iana",
+    "extensions": ["rp9"]
+  },
+  "application/vnd.clonk.c4group": {
+    "source": "iana",
+    "extensions": ["c4g","c4d","c4f","c4p","c4u"]
+  },
+  "application/vnd.cluetrust.cartomobile-config": {
+    "source": "iana",
+    "extensions": ["c11amc"]
+  },
+  "application/vnd.cluetrust.cartomobile-config-pkg": {
+    "source": "iana",
+    "extensions": ["c11amz"]
+  },
+  "application/vnd.coffeescript": {
+    "source": "iana"
+  },
+  "application/vnd.collabio.xodocuments.document": {
+    "source": "iana"
+  },
+  "application/vnd.collabio.xodocuments.document-template": {
+    "source": "iana"
+  },
+  "application/vnd.collabio.xodocuments.presentation": {
+    "source": "iana"
+  },
+  "application/vnd.collabio.xodocuments.presentation-template": {
+    "source": "iana"
+  },
+  "application/vnd.collabio.xodocuments.spreadsheet": {
+    "source": "iana"
+  },
+  "application/vnd.collabio.xodocuments.spreadsheet-template": {
+    "source": "iana"
+  },
+  "application/vnd.collection+json": {
+    "source": "iana",
+    "compressible": true
+  },
+  "application/vnd.collection.doc+json": {
+    "source": "iana",
+    "compressible": true
+  },
+  "application/vnd.collection.next+json": {
+    "source": "iana",
+    "compressible": true
+  },
+  "application/vnd.comicbook+zip": {
+    "source": "iana",
+    "compressible": false
+  },
+  "application/vnd.comicbook-rar": {
+    "source": "iana"
+  },
+  "application/vnd.commerce-battelle": {
+    "source": "iana"
+  },
+  "application/vnd.commonspace": {
+    "source": "iana",
+    "extensions": ["csp"]
+  },
+  "application/vnd.contact.cmsg": {
+    "source": "iana",
+    "extensions": ["cdbcmsg"]
+  },
+  "application/vnd.coreos.ignition+json": {
+    "source": "iana",
+    "compressible": true
+  },
+  "application/vnd.cosmocaller": {
+    "source": "iana",
+    "extensions": ["cmc"]
+  },
+  "application/vnd.crick.clicker": {
+    "source": "iana",
+    "extensions": ["clkx"]
+  },
+  "application/vnd.crick.clicker.keyboard": {
+    "source": "iana",
+    "extensions": ["clkk"]
+  },
+  "application/vnd.crick.clicker.palette": {
+    "source": "iana",
+    "extensions": ["clkp"]
+  },
+  "application/vnd.crick.clicker.template": {
+    "source": "iana",
+    "extensions": ["clkt"]
+  },
+  "application/vnd.crick.clicker.wordbank": {
+    "source": "iana",
+    "extensions": ["clkw"]
+  },
+  "application/vnd.criticaltools.wbs+xml": {
+    "source": "iana",
+    "compressible": true,
+    "extensions": ["wbs"]
+  },
+  "application/vnd.cryptii.pipe+json": {
+    "source": "iana",
+    "compressible": true
+  },
+  "application/vnd.crypto-shade-file": {
+    "source": "iana"
+  },
+  "application/vnd.cryptomator.encrypted": {
+    "source": "iana"
+  },
+  "application/vnd.cryptomator.vault": {
+    "source": "iana"
+  },
+  "application/vnd.ctc-posml": {
+    "source": "iana",
+    "extensions": ["pml"]
+  },
+  "application/vnd.ctct.ws+xml": {
+    "source": "iana",
+    "compressible": true
+  },
+  "application/vnd.cups-pdf": {
+    "source": "iana"
+  },
+  "application/vnd.cups-postscript": {
+    "source": "iana"
+  },
+  "application/vnd.cups-ppd": {
+    "source": "iana",
+    "extensions": ["ppd"]
+  },
+  "application/vnd.cups-raster": {
+    "source": "iana"
+  },
+  "application/vnd.cups-raw": {
+    "source": "iana"
+  },
+  "application/vnd.curl": {
+    "source": "iana"
+  },
+  "application/vnd.curl.car": {
+    "source": "apache",
+    "extensions": ["car"]
+  },
+  "application/vnd.curl.pcurl": {
+    "source": "apache",
+    "extensions": ["pcurl"]
+  },
+  "application/vnd.cyan.dean.root+xml": {
+    "source": "iana",
+    "compressible": true
+  },
+  "application/vnd.cybank": {
+    "source": "iana"
+  },
+  "application/vnd.cyclonedx+json": {
+    "source": "iana",
+    "compressible": true
+  },
+  "application/vnd.cyclonedx+xml": {
+    "source": "iana",
+    "compressible": true
+  },
+  "application/vnd.d2l.coursepackage1p0+zip": {
+    "source": "iana",
+    "compressible": false
+  },
+  "application/vnd.d3m-dataset": {
+    "source": "iana"
+  },
+  "application/vnd.d3m-problem": {
+    "source": "iana"
+  },
+  "application/vnd.dart": {
+    "source": "iana",
+    "compressible": true,
+    "extensions": ["dart"]
+  },
+  "application/vnd.data-vision.rdz": {
+    "source": "iana",
+    "extensions": ["rdz"]
+  },
+  "application/vnd.datapackage+json": {
+    "source": "iana",
+    "compressible": true
+  },
+  "application/vnd.dataresource+json": {
+    "source": "iana",
+    "compressible": true
+  },
+  "application/vnd.dbf": {
+    "source": "iana",
+    "extensions": ["dbf"]
+  },
+  "application/vnd.debian.binary-package": {
+    "source": "iana"
+  },
+  "application/vnd.dece.data": {
+    "source": "iana",
+    "extensions": ["uvf","uvvf","uvd","uvvd"]
+  },
+  "application/vnd.dece.ttml+xml": {
+    "source": "iana",
+    "compressible": true,
+    "extensions": ["uvt","uvvt"]
+  },
+  "application/vnd.dece.unspecified": {
+    "source": "iana",
+    "extensions": ["uvx","uvvx"]
+  },
+  "application/vnd.dece.zip": {
+    "source": "iana",
+    "extensions": ["uvz","uvvz"]
+  },
+  "application/vnd.denovo.fcselayout-link": {
+    "source": "iana",
+    "extensions": ["fe_launch"]
+  },
+  "application/vnd.desmume.movie": {
+    "source": "iana"
+  },
+  "application/vnd.dir-bi.plate-dl-nosuffix": {
+    "source": "iana"
+  },
+  "application/vnd.dm.delegation+xml": {
+    "source": "iana",
+    "compressible": true
+  },
+  "application/vnd.dna": {
+    "source": "iana",
+    "extensions": ["dna"]
+  },
+  "application/vnd.document+json": {
+    "source": "iana",
+    "compressible": true
+  },
+  "application/vnd.dolby.mlp": {
+    "source": "apache",
+    "extensions": ["mlp"]
+  },
+  "application/vnd.dolby.mobile.1": {
+    "source": "iana"
+  },
+  "application/vnd.dolby.mobile.2": {
+    "source": "iana"
+  },
+  "application/vnd.doremir.scorecloud-binary-document": {
+    "source": "iana"
+  },
+  "application/vnd.dpgraph": {
+    "source": "iana",
+    "extensions": ["dpg"]
+  },
+  "application/vnd.dreamfactory": {
+    "source": "iana",
+    "extensions": ["dfac"]
+  },
+  "application/vnd.drive+json": {
+    "source": "iana",
+    "compressible": true
+  },
+  "application/vnd.ds-keypoint": {
+    "source": "apache",
+    "extensions": ["kpxx"]
+  },
+  "application/vnd.dtg.local": {
+    "source": "iana"
+  },
+  "application/vnd.dtg.local.flash": {
+    "source": "iana"
+  },
+  "application/vnd.dtg.local.html": {
+    "source": "iana"
+  },
+  "application/vnd.dvb.ait": {
+    "source": "iana",
+    "extensions": ["ait"]
+  },
+  "application/vnd.dvb.dvbisl+xml": {
+    "source": "iana",
+    "compressible": true
+  },
+  "application/vnd.dvb.dvbj": {
+    "source": "iana"
+  },
+  "application/vnd.dvb.esgcontainer": {
+    "source": "iana"
+  },
+  "application/vnd.dvb.ipdcdftnotifaccess": {
+    "source": "iana"
+  },
+  "application/vnd.dvb.ipdcesgaccess": {
+    "source": "iana"
+  },
+  "application/vnd.dvb.ipdcesgaccess2": {
+    "source": "iana"
+  },
+  "application/vnd.dvb.ipdcesgpdd": {
+    "source": "iana"
+  },
+  "application/vnd.dvb.ipdcroaming": {
+    "source": "iana"
+  },
+  "application/vnd.dvb.iptv.alfec-base": {
+    "source": "iana"
+  },
+  "application/vnd.dvb.iptv.alfec-enhancement": {
+    "source": "iana"
+  },
+  "application/vnd.dvb.notif-aggregate-root+xml": {
+    "source": "iana",
+    "compressible": true
+  },
+  "application/vnd.dvb.notif-container+xml": {
+    "source": "iana",
+    "compressible": true
+  },
+  "application/vnd.dvb.notif-generic+xml": {
+    "source": "iana",
+    "compressible": true
+  },
+  "application/vnd.dvb.notif-ia-msglist+xml": {
+    "source": "iana",
+    "compressible": true
+  },
+  "application/vnd.dvb.notif-ia-registration-request+xml": {
+    "source": "iana",
+    "compressible": true
+  },
+  "application/vnd.dvb.notif-ia-registration-response+xml": {
+    "source": "iana",
+    "compressible": true
+  },
+  "application/vnd.dvb.notif-init+xml": {
+    "source": "iana",
+    "compressible": true
+  },
+  "application/vnd.dvb.pfr": {
+    "source": "iana"
+  },
+  "application/vnd.dvb.service": {
+    "source": "iana",
+    "extensions": ["svc"]
+  },
+  "application/vnd.dxr": {
+    "source": "iana"
+  },
+  "application/vnd.dynageo": {
+    "source": "iana",
+    "extensions": ["geo"]
+  },
+  "application/vnd.dzr": {
+    "source": "iana"
+  },
+  "application/vnd.easykaraoke.cdgdownload": {
+    "source": "iana"
+  },
+  "application/vnd.ecdis-update": {
+    "source": "iana"
+  },
+  "application/vnd.ecip.rlp": {
+    "source": "iana"
+  },
+  "application/vnd.ecowin.chart": {
+    "source": "iana",
+    "extensions": ["mag"]
+  },
+  "application/vnd.ecowin.filerequest": {
+    "source": "iana"
+  },
+  "application/vnd.ecowin.fileupdate": {
+    "source": "iana"
+  },
+  "application/vnd.ecowin.series": {
+    "source": "iana"
+  },
+  "application/vnd.ecowin.seriesrequest": {
+    "source": "iana"
+  },
+  "application/vnd.ecowin.seriesupdate": {
+    "source": "iana"
+  },
+  "application/vnd.efi.img": {
+    "source": "iana"
+  },
+  "application/vnd.efi.iso": {
+    "source": "iana"
+  },
+  "application/vnd.emclient.accessrequest+xml": {
+    "source": "iana",
+    "compressible": true
+  },
+  "application/vnd.enliven": {
+    "source": "iana",
+    "extensions": ["nml"]
+  },
+  "application/vnd.enphase.envoy": {
+    "source": "iana"
+  },
+  "application/vnd.eprints.data+xml": {
+    "source": "iana",
+    "compressible": true
+  },
+  "application/vnd.epson.esf": {
+    "source": "iana",
+    "extensions": ["esf"]
+  },
+  "application/vnd.epson.msf": {
+    "source": "iana",
+    "extensions": ["msf"]
+  },
+  "application/vnd.epson.quickanime": {
+    "source": "iana",
+    "extensions": ["qam"]
+  },
+  "application/vnd.epson.salt": {
+    "source": "iana",
+    "extensions": ["slt"]
+  },
+  "application/vnd.epson.ssf": {
+    "source": "iana",
+    "extensions": ["ssf"]
+  },
+  "application/vnd.ericsson.quickcall": {
+    "source": "iana"
+  },
+  "application/vnd.espass-espass+zip": {
+    "source": "iana",
+    "compressible": false
+  },
+  "application/vnd.eszigno3+xml": {
+    "source": "iana",
+    "compressible": true,
+    "extensions": ["es3","et3"]
+  },
+  "application/vnd.etsi.aoc+xml": {
+    "source": "iana",
+    "compressible": true
+  },
+  "application/vnd.etsi.asic-e+zip": {
+    "source": "iana",
+    "compressible": false
+  },
+  "application/vnd.etsi.asic-s+zip": {
+    "source": "iana",
+    "compressible": false
+  },
+  "application/vnd.etsi.cug+xml": {
+    "source": "iana",
+    "compressible": true
+  },
+  "application/vnd.etsi.iptvcommand+xml": {
+    "source": "iana",
+    "compressible": true
+  },
+  "application/vnd.etsi.iptvdiscovery+xml": {
+    "source": "iana",
+    "compressible": true
+  },
+  "application/vnd.etsi.iptvprofile+xml": {
+    "source": "iana",
+    "compressible": true
+  },
+  "application/vnd.etsi.iptvsad-bc+xml": {
+    "source": "iana",
+    "compressible": true
+  },
+  "application/vnd.etsi.iptvsad-cod+xml": {
+    "source": "iana",
+    "compressible": true
+  },
+  "application/vnd.etsi.iptvsad-npvr+xml": {
+    "source": "iana",
+    "compressible": true
+  },
+  "application/vnd.etsi.iptvservice+xml": {
+    "source": "iana",
+    "compressible": true
+  },
+  "application/vnd.etsi.iptvsync+xml": {
+    "source": "iana",
+    "compressible": true
+  },
+  "application/vnd.etsi.iptvueprofile+xml": {
+    "source": "iana",
+    "compressible": true
+  },
+  "application/vnd.etsi.mcid+xml": {
+    "source": "iana",
+    "compressible": true
+  },
+  "application/vnd.etsi.mheg5": {
+    "source": "iana"
+  },
+  "application/vnd.etsi.overload-control-policy-dataset+xml": {
+    "source": "iana",
+    "compressible": true
+  },
+  "application/vnd.etsi.pstn+xml": {
+    "source": "iana",
+    "compressible": true
+  },
+  "application/vnd.etsi.sci+xml": {
+    "source": "iana",
+    "compressible": true
+  },
+  "application/vnd.etsi.simservs+xml": {
+    "source": "iana",
+    "compressible": true
+  },
+  "application/vnd.etsi.timestamp-token": {
+    "source": "iana"
+  },
+  "application/vnd.etsi.tsl+xml": {
+    "source": "iana",
+    "compressible": true
+  },
+  "application/vnd.etsi.tsl.der": {
+    "source": "iana"
+  },
+  "application/vnd.eudora.data": {
+    "source": "iana"
+  },
+  "application/vnd.evolv.ecig.profile": {
+    "source": "iana"
+  },
+  "application/vnd.evolv.ecig.settings": {
+    "source": "iana"
+  },
+  "application/vnd.evolv.ecig.theme": {
+    "source": "iana"
+  },
+  "application/vnd.exstream-empower+zip": {
+    "source": "iana",
+    "compressible": false
+  },
+  "application/vnd.exstream-package": {
+    "source": "iana"
+  },
+  "application/vnd.ezpix-album": {
+    "source": "iana",
+    "extensions": ["ez2"]
+  },
+  "application/vnd.ezpix-package": {
+    "source": "iana",
+    "extensions": ["ez3"]
+  },
+  "application/vnd.f-secure.mobile": {
+    "source": "iana"
+  },
+  "application/vnd.fastcopy-disk-image": {
+    "source": "iana"
+  },
+  "application/vnd.fdf": {
+    "source": "iana",
+    "extensions": ["fdf"]
+  },
+  "application/vnd.fdsn.mseed": {
+    "source": "iana",
+    "extensions": ["mseed"]
+  },
+  "application/vnd.fdsn.seed": {
+    "source": "iana",
+    "extensions": ["seed","dataless"]
+  },
+  "application/vnd.ffsns": {
+    "source": "iana"
+  },
+  "application/vnd.ficlab.flb+zip": {
+    "source": "iana",
+    "compressible": false
+  },
+  "application/vnd.filmit.zfc": {
+    "source": "iana"
+  },
+  "application/vnd.fints": {
+    "source": "iana"
+  },
+  "application/vnd.firemonkeys.cloudcell": {
+    "source": "iana"
+  },
+  "application/vnd.flographit": {
+    "source": "iana",
+    "extensions": ["gph"]
+  },
+  "application/vnd.fluxtime.clip": {
+    "source": "iana",
+    "extensions": ["ftc"]
+  },
+  "application/vnd.font-fontforge-sfd": {
+    "source": "iana"
+  },
+  "application/vnd.framemaker": {
+    "source": "iana",
+    "extensions": ["fm","frame","maker","book"]
+  },
+  "application/vnd.frogans.fnc": {
+    "source": "iana",
+    "extensions": ["fnc"]
+  },
+  "application/vnd.frogans.ltf": {
+    "source": "iana",
+    "extensions": ["ltf"]
+  },
+  "application/vnd.fsc.weblaunch": {
+    "source": "iana",
+    "extensions": ["fsc"]
+  },
+  "application/vnd.fujifilm.fb.docuworks": {
+    "source": "iana"
+  },
+  "application/vnd.fujifilm.fb.docuworks.binder": {
+    "source": "iana"
+  },
+  "application/vnd.fujifilm.fb.docuworks.container": {
+    "source": "iana"
+  },
+  "application/vnd.fujifilm.fb.jfi+xml": {
+    "source": "iana",
+    "compressible": true
+  },
+  "application/vnd.fujitsu.oasys": {
+    "source": "iana",
+    "extensions": ["oas"]
+  },
+  "application/vnd.fujitsu.oasys2": {
+    "source": "iana",
+    "extensions": ["oa2"]
+  },
+  "application/vnd.fujitsu.oasys3": {
+    "source": "iana",
+    "extensions": ["oa3"]
+  },
+  "application/vnd.fujitsu.oasysgp": {
+    "source": "iana",
+    "extensions": ["fg5"]
+  },
+  "application/vnd.fujitsu.oasysprs": {
+    "source": "iana",
+    "extensions": ["bh2"]
+  },
+  "application/vnd.fujixerox.art-ex": {
+    "source": "iana"
+  },
+  "application/vnd.fujixerox.art4": {
+    "source": "iana"
+  },
+  "application/vnd.fujixerox.ddd": {
+    "source": "iana",
+    "extensions": ["ddd"]
+  },
+  "application/vnd.fujixerox.docuworks": {
+    "source": "iana",
+    "extensions": ["xdw"]
+  },
+  "application/vnd.fujixerox.docuworks.binder": {
+    "source": "iana",
+    "extensions": ["xbd"]
+  },
+  "application/vnd.fujixerox.docuworks.container": {
+    "source": "iana"
+  },
+  "application/vnd.fujixerox.hbpl": {
+    "source": "iana"
+  },
+  "application/vnd.fut-misnet": {
+    "source": "iana"
+  },
+  "application/vnd.futoin+cbor": {
+    "source": "iana"
+  },
+  "application/vnd.futoin+json": {
+    "source": "iana",
+    "compressible": true
+  },
+  "application/vnd.fuzzysheet": {
+    "source": "iana",
+    "extensions": ["fzs"]
+  },
+  "application/vnd.genomatix.tuxedo": {
+    "source": "iana",
+    "extensions": ["txd"]
+  },
+  "application/vnd.gentics.grd+json": {
+    "source": "iana",
+    "compressible": true
+  },
+  "application/vnd.geo+json": {
+    "source": "iana",
+    "compressible": true
+  },
+  "application/vnd.geocube+xml": {
+    "source": "iana",
+    "compressible": true
+  },
+  "application/vnd.geogebra.file": {
+    "source": "iana",
+    "extensions": ["ggb"]
+  },
+  "application/vnd.geogebra.slides": {
+    "source": "iana"
+  },
+  "application/vnd.geogebra.tool": {
+    "source": "iana",
+    "extensions": ["ggt"]
+  },
+  "application/vnd.geometry-explorer": {
+    "source": "iana",
+    "extensions": ["gex","gre"]
+  },
+  "application/vnd.geonext": {
+    "source": "iana",
+    "extensions": ["gxt"]
+  },
+  "application/vnd.geoplan": {
+    "source": "iana",
+    "extensions": ["g2w"]
+  },
+  "application/vnd.geospace": {
+    "source": "iana",
+    "extensions": ["g3w"]
+  },
+  "application/vnd.gerber": {
+    "source": "iana"
+  },
+  "application/vnd.globalplatform.card-content-mgt": {
+    "source": "iana"
+  },
+  "application/vnd.globalplatform.card-content-mgt-response": {
+    "source": "iana"
+  },
+  "application/vnd.gmx": {
+    "source": "iana",
+    "extensions": ["gmx"]
+  },
+  "application/vnd.google-apps.document": {
+    "compressible": false,
+    "extensions": ["gdoc"]
+  },
+  "application/vnd.google-apps.presentation": {
+    "compressible": false,
+    "extensions": ["gslides"]
+  },
+  "application/vnd.google-apps.spreadsheet": {
+    "compressible": false,
+    "extensions": ["gsheet"]
+  },
+  "application/vnd.google-earth.kml+xml": {
+    "source": "iana",
+    "compressible": true,
+    "extensions": ["kml"]
+  },
+  "application/vnd.google-earth.kmz": {
+    "source": "iana",
+    "compressible": false,
+    "extensions": ["kmz"]
+  },
+  "application/vnd.gov.sk.e-form+xml": {
+    "source": "iana",
+    "compressible": true
+  },
+  "application/vnd.gov.sk.e-form+zip": {
+    "source": "iana",
+    "compressible": false
+  },
+  "application/vnd.gov.sk.xmldatacontainer+xml": {
+    "source": "iana",
+    "compressible": true
+  },
+  "application/vnd.grafeq": {
+    "source": "iana",
+    "extensions": ["gqf","gqs"]
+  },
+  "application/vnd.gridmp": {
+    "source": "iana"
+  },
+  "application/vnd.groove-account": {
+    "source": "iana",
+    "extensions": ["gac"]
+  },
+  "application/vnd.groove-help": {
+    "source": "iana",
+    "extensions": ["ghf"]
+  },
+  "application/vnd.groove-identity-message": {
+    "source": "iana",
+    "extensions": ["gim"]
+  },
+  "application/vnd.groove-injector": {
+    "source": "iana",
+    "extensions": ["grv"]
+  },
+  "application/vnd.groove-tool-message": {
+    "source": "iana",
+    "extensions": ["gtm"]
+  },
+  "application/vnd.groove-tool-template": {
+    "source": "iana",
+    "extensions": ["tpl"]
+  },
+  "application/vnd.groove-vcard": {
+    "source": "iana",
+    "extensions": ["vcg"]
+  },
+  "application/vnd.hal+json": {
+    "source": "iana",
+    "compressible": true
+  },
+  "application/vnd.hal+xml": {
+    "source": "iana",
+    "compressible": true,
+    "extensions": ["hal"]
+  },
+  "application/vnd.handheld-entertainment+xml": {
+    "source": "iana",
+    "compressible": true,
+    "extensions": ["zmm"]
+  },
+  "application/vnd.hbci": {
+    "source": "iana",
+    "extensions": ["hbci"]
+  },
+  "application/vnd.hc+json": {
+    "source": "iana",
+    "compressible": true
+  },
+  "application/vnd.hcl-bireports": {
+    "source": "iana"
+  },
+  "application/vnd.hdt": {
+    "source": "iana"
+  },
+  "application/vnd.heroku+json": {
+    "source": "iana",
+    "compressible": true
+  },
+  "application/vnd.hhe.lesson-player": {
+    "source": "iana",
+    "extensions": ["les"]
+  },
+  "application/vnd.hp-hpgl": {
+    "source": "iana",
+    "extensions": ["hpgl"]
+  },
+  "application/vnd.hp-hpid": {
+    "source": "iana",
+    "extensions": ["hpid"]
+  },
+  "application/vnd.hp-hps": {
+    "source": "iana",
+    "extensions": ["hps"]
+  },
+  "application/vnd.hp-jlyt": {
+    "source": "iana",
+    "extensions": ["jlt"]
+  },
+  "application/vnd.hp-pcl": {
+    "source": "iana",
+    "extensions": ["pcl"]
+  },
+  "application/vnd.hp-pclxl": {
+    "source": "iana",
+    "extensions": ["pclxl"]
+  },
+  "application/vnd.httphone": {
+    "source": "iana"
+  },
+  "application/vnd.hydrostatix.sof-data": {
+    "source": "iana",
+    "extensions": ["sfd-hdstx"]
+  },
+  "application/vnd.hyper+json": {
+    "source": "iana",
+    "compressible": true
+  },
+  "application/vnd.hyper-item+json": {
+    "source": "iana",
+    "compressible": true
+  },
+  "application/vnd.hyperdrive+json": {
+    "source": "iana",
+    "compressible": true
+  },
+  "application/vnd.hzn-3d-crossword": {
+    "source": "iana"
+  },
+  "application/vnd.ibm.afplinedata": {
+    "source": "iana"
+  },
+  "application/vnd.ibm.electronic-media": {
+    "source": "iana"
+  },
+  "application/vnd.ibm.minipay": {
+    "source": "iana",
+    "extensions": ["mpy"]
+  },
+  "application/vnd.ibm.modcap": {
+    "source": "iana",
+    "extensions": ["afp","listafp","list3820"]
+  },
+  "application/vnd.ibm.rights-management": {
+    "source": "iana",
+    "extensions": ["irm"]
+  },
+  "application/vnd.ibm.secure-container": {
+    "source": "iana",
+    "extensions": ["sc"]
+  },
+  "application/vnd.iccprofile": {
+    "source": "iana",
+    "extensions": ["icc","icm"]
+  },
+  "application/vnd.ieee.1905": {
+    "source": "iana"
+  },
+  "application/vnd.igloader": {
+    "source": "iana",
+    "extensions": ["igl"]
+  },
+  "application/vnd.imagemeter.folder+zip": {
+    "source": "iana",
+    "compressible": false
+  },
+  "application/vnd.imagemeter.image+zip": {
+    "source": "iana",
+    "compressible": false
+  },
+  "application/vnd.immervision-ivp": {
+    "source": "iana",
+    "extensions": ["ivp"]
+  },
+  "application/vnd.immervision-ivu": {
+    "source": "iana",
+    "extensions": ["ivu"]
+  },
+  "application/vnd.ims.imsccv1p1": {
+    "source": "iana"
+  },
+  "application/vnd.ims.imsccv1p2": {
+    "source": "iana"
+  },
+  "application/vnd.ims.imsccv1p3": {
+    "source": "iana"
+  },
+  "application/vnd.ims.lis.v2.result+json": {
+    "source": "iana",
+    "compressible": true
+  },
+  "application/vnd.ims.lti.v2.toolconsumerprofile+json": {
+    "source": "iana",
+    "compressible": true
+  },
+  "application/vnd.ims.lti.v2.toolproxy+json": {
+    "source": "iana",
+    "compressible": true
+  },
+  "application/vnd.ims.lti.v2.toolproxy.id+json": {
+    "source": "iana",
+    "compressible": true
+  },
+  "application/vnd.ims.lti.v2.toolsettings+json": {
+    "source": "iana",
+    "compressible": true
+  },
+  "application/vnd.ims.lti.v2.toolsettings.simple+json": {
+    "source": "iana",
+    "compressible": true
+  },
+  "application/vnd.informedcontrol.rms+xml": {
+    "source": "iana",
+    "compressible": true
+  },
+  "application/vnd.informix-visionary": {
+    "source": "iana"
+  },
+  "application/vnd.infotech.project": {
+    "source": "iana"
+  },
+  "application/vnd.infotech.project+xml": {
+    "source": "iana",
+    "compressible": true
+  },
+  "application/vnd.innopath.wamp.notification": {
+    "source": "iana"
+  },
+  "application/vnd.insors.igm": {
+    "source": "iana",
+    "extensions": ["igm"]
+  },
+  "application/vnd.intercon.formnet": {
+    "source": "iana",
+    "extensions": ["xpw","xpx"]
+  },
+  "application/vnd.intergeo": {
+    "source": "iana",
+    "extensions": ["i2g"]
+  },
+  "application/vnd.intertrust.digibox": {
+    "source": "iana"
+  },
+  "application/vnd.intertrust.nncp": {
+    "source": "iana"
+  },
+  "application/vnd.intu.qbo": {
+    "source": "iana",
+    "extensions": ["qbo"]
+  },
+  "application/vnd.intu.qfx": {
+    "source": "iana",
+    "extensions": ["qfx"]
+  },
+  "application/vnd.iptc.g2.catalogitem+xml": {
+    "source": "iana",
+    "compressible": true
+  },
+  "application/vnd.iptc.g2.conceptitem+xml": {
+    "source": "iana",
+    "compressible": true
+  },
+  "application/vnd.iptc.g2.knowledgeitem+xml": {
+    "source": "iana",
+    "compressible": true
+  },
+  "application/vnd.iptc.g2.newsitem+xml": {
+    "source": "iana",
+    "compressible": true
+  },
+  "application/vnd.iptc.g2.newsmessage+xml": {
+    "source": "iana",
+    "compressible": true
+  },
+  "application/vnd.iptc.g2.packageitem+xml": {
+    "source": "iana",
+    "compressible": true
+  },
+  "application/vnd.iptc.g2.planningitem+xml": {
+    "source": "iana",
+    "compressible": true
+  },
+  "application/vnd.ipunplugged.rcprofile": {
+    "source": "iana",
+    "extensions": ["rcprofile"]
+  },
+  "application/vnd.irepository.package+xml": {
+    "source": "iana",
+    "compressible": true,
+    "extensions": ["irp"]
+  },
+  "application/vnd.is-xpr": {
+    "source": "iana",
+    "extensions": ["xpr"]
+  },
+  "application/vnd.isac.fcs": {
+    "source": "iana",
+    "extensions": ["fcs"]
+  },
+  "application/vnd.iso11783-10+zip": {
+    "source": "iana",
+    "compressible": false
+  },
+  "application/vnd.jam": {
+    "source": "iana",
+    "extensions": ["jam"]
+  },
+  "application/vnd.japannet-directory-service": {
+    "source": "iana"
+  },
+  "application/vnd.japannet-jpnstore-wakeup": {
+    "source": "iana"
+  },
+  "application/vnd.japannet-payment-wakeup": {
+    "source": "iana"
+  },
+  "application/vnd.japannet-registration": {
+    "source": "iana"
+  },
+  "application/vnd.japannet-registration-wakeup": {
+    "source": "iana"
+  },
+  "application/vnd.japannet-setstore-wakeup": {
+    "source": "iana"
+  },
+  "application/vnd.japannet-verification": {
+    "source": "iana"
+  },
+  "application/vnd.japannet-verification-wakeup": {
+    "source": "iana"
+  },
+  "application/vnd.jcp.javame.midlet-rms": {
+    "source": "iana",
+    "extensions": ["rms"]
+  },
+  "application/vnd.jisp": {
+    "source": "iana",
+    "extensions": ["jisp"]
+  },
+  "application/vnd.joost.joda-archive": {
+    "source": "iana",
+    "extensions": ["joda"]
+  },
+  "application/vnd.jsk.isdn-ngn": {
+    "source": "iana"
+  },
+  "application/vnd.kahootz": {
+    "source": "iana",
+    "extensions": ["ktz","ktr"]
+  },
+  "application/vnd.kde.karbon": {
+    "source": "iana",
+    "extensions": ["karbon"]
+  },
+  "application/vnd.kde.kchart": {
+    "source": "iana",
+    "extensions": ["chrt"]
+  },
+  "application/vnd.kde.kformula": {
+    "source": "iana",
+    "extensions": ["kfo"]
+  },
+  "application/vnd.kde.kivio": {
+    "source": "iana",
+    "extensions": ["flw"]
+  },
+  "application/vnd.kde.kontour": {
+    "source": "iana",
+    "extensions": ["kon"]
+  },
+  "application/vnd.kde.kpresenter": {
+    "source": "iana",
+    "extensions": ["kpr","kpt"]
+  },
+  "application/vnd.kde.kspread": {
+    "source": "iana",
+    "extensions": ["ksp"]
+  },
+  "application/vnd.kde.kword": {
+    "source": "iana",
+    "extensions": ["kwd","kwt"]
+  },
+  "application/vnd.kenameaapp": {
+    "source": "iana",
+    "extensions": ["htke"]
+  },
+  "application/vnd.kidspiration": {
+    "source": "iana",
+    "extensions": ["kia"]
+  },
+  "application/vnd.kinar": {
+    "source": "iana",
+    "extensions": ["kne","knp"]
+  },
+  "application/vnd.koan": {
+    "source": "iana",
+    "extensions": ["skp","skd","skt","skm"]
+  },
+  "application/vnd.kodak-descriptor": {
+    "source": "iana",
+    "extensions": ["sse"]
+  },
+  "application/vnd.las": {
+    "source": "iana"
+  },
+  "application/vnd.las.las+json": {
+    "source": "iana",
+    "compressible": true
+  },
+  "application/vnd.las.las+xml": {
+    "source": "iana",
+    "compressible": true,
+    "extensions": ["lasxml"]
+  },
+  "application/vnd.laszip": {
+    "source": "iana"
+  },
+  "application/vnd.leap+json": {
+    "source": "iana",
+    "compressible": true
+  },
+  "application/vnd.liberty-request+xml": {
+    "source": "iana",
+    "compressible": true
+  },
+  "application/vnd.llamagraphics.life-balance.desktop": {
+    "source": "iana",
+    "extensions": ["lbd"]
+  },
+  "application/vnd.llamagraphics.life-balance.exchange+xml": {
+    "source": "iana",
+    "compressible": true,
+    "extensions": ["lbe"]
+  },
+  "application/vnd.logipipe.circuit+zip": {
+    "source": "iana",
+    "compressible": false
+  },
+  "application/vnd.loom": {
+    "source": "iana"
+  },
+  "application/vnd.lotus-1-2-3": {
+    "source": "iana",
+    "extensions": ["123"]
+  },
+  "application/vnd.lotus-approach": {
+    "source": "iana",
+    "extensions": ["apr"]
+  },
+  "application/vnd.lotus-freelance": {
+    "source": "iana",
+    "extensions": ["pre"]
+  },
+  "application/vnd.lotus-notes": {
+    "source": "iana",
+    "extensions": ["nsf"]
+  },
+  "application/vnd.lotus-organizer": {
+    "source": "iana",
+    "extensions": ["org"]
+  },
+  "application/vnd.lotus-screencam": {
+    "source": "iana",
+    "extensions": ["scm"]
+  },
+  "application/vnd.lotus-wordpro": {
+    "source": "iana",
+    "extensions": ["lwp"]
+  },
+  "application/vnd.macports.portpkg": {
+    "source": "iana",
+    "extensions": ["portpkg"]
+  },
+  "application/vnd.mapbox-vector-tile": {
+    "source": "iana",
+    "extensions": ["mvt"]
+  },
+  "application/vnd.marlin.drm.actiontoken+xml": {
+    "source": "iana",
+    "compressible": true
+  },
+  "application/vnd.marlin.drm.conftoken+xml": {
+    "source": "iana",
+    "compressible": true
+  },
+  "application/vnd.marlin.drm.license+xml": {
+    "source": "iana",
+    "compressible": true
+  },
+  "application/vnd.marlin.drm.mdcf": {
+    "source": "iana"
+  },
+  "application/vnd.mason+json": {
+    "source": "iana",
+    "compressible": true
+  },
+  "application/vnd.maxmind.maxmind-db": {
+    "source": "iana"
+  },
+  "application/vnd.mcd": {
+    "source": "iana",
+    "extensions": ["mcd"]
+  },
+  "application/vnd.medcalcdata": {
+    "source": "iana",
+    "extensions": ["mc1"]
+  },
+  "application/vnd.mediastation.cdkey": {
+    "source": "iana",
+    "extensions": ["cdkey"]
+  },
+  "application/vnd.meridian-slingshot": {
+    "source": "iana"
+  },
+  "application/vnd.mfer": {
+    "source": "iana",
+    "extensions": ["mwf"]
+  },
+  "application/vnd.mfmp": {
+    "source": "iana",
+    "extensions": ["mfm"]
+  },
+  "application/vnd.micro+json": {
+    "source": "iana",
+    "compressible": true
+  },
+  "application/vnd.micrografx.flo": {
+    "source": "iana",
+    "extensions": ["flo"]
+  },
+  "application/vnd.micrografx.igx": {
+    "source": "iana",
+    "extensions": ["igx"]
+  },
+  "application/vnd.microsoft.portable-executable": {
+    "source": "iana"
+  },
+  "application/vnd.microsoft.windows.thumbnail-cache": {
+    "source": "iana"
+  },
+  "application/vnd.miele+json": {
+    "source": "iana",
+    "compressible": true
+  },
+  "application/vnd.mif": {
+    "source": "iana",
+    "extensions": ["mif"]
+  },
+  "application/vnd.minisoft-hp3000-save": {
+    "source": "iana"
+  },
+  "application/vnd.mitsubishi.misty-guard.trustweb": {
+    "source": "iana"
+  },
+  "application/vnd.mobius.daf": {
+    "source": "iana",
+    "extensions": ["daf"]
+  },
+  "application/vnd.mobius.dis": {
+    "source": "iana",
+    "extensions": ["dis"]
+  },
+  "application/vnd.mobius.mbk": {
+    "source": "iana",
+    "extensions": ["mbk"]
+  },
+  "application/vnd.mobius.mqy": {
+    "source": "iana",
+    "extensions": ["mqy"]
+  },
+  "application/vnd.mobius.msl": {
+    "source": "iana",
+    "extensions": ["msl"]
+  },
+  "application/vnd.mobius.plc": {
+    "source": "iana",
+    "extensions": ["plc"]
+  },
+  "application/vnd.mobius.txf": {
+    "source": "iana",
+    "extensions": ["txf"]
+  },
+  "application/vnd.mophun.application": {
+    "source": "iana",
+    "extensions": ["mpn"]
+  },
+  "application/vnd.mophun.certificate": {
+    "source": "iana",
+    "extensions": ["mpc"]
+  },
+  "application/vnd.motorola.flexsuite": {
+    "source": "iana"
+  },
+  "application/vnd.motorola.flexsuite.adsi": {
+    "source": "iana"
+  },
+  "application/vnd.motorola.flexsuite.fis": {
+    "source": "iana"
+  },
+  "application/vnd.motorola.flexsuite.gotap": {
+    "source": "iana"
+  },
+  "application/vnd.motorola.flexsuite.kmr": {
+    "source": "iana"
+  },
+  "application/vnd.motorola.flexsuite.ttc": {
+    "source": "iana"
+  },
+  "application/vnd.motorola.flexsuite.wem": {
+    "source": "iana"
+  },
+  "application/vnd.motorola.iprm": {
+    "source": "iana"
+  },
+  "application/vnd.mozilla.xul+xml": {
+    "source": "iana",
+    "compressible": true,
+    "extensions": ["xul"]
+  },
+  "application/vnd.ms-3mfdocument": {
+    "source": "iana"
+  },
+  "application/vnd.ms-artgalry": {
+    "source": "iana",
+    "extensions": ["cil"]
+  },
+  "application/vnd.ms-asf": {
+    "source": "iana"
+  },
+  "application/vnd.ms-cab-compressed": {
+    "source": "iana",
+    "extensions": ["cab"]
+  },
+  "application/vnd.ms-color.iccprofile": {
+    "source": "apache"
+  },
+  "application/vnd.ms-excel": {
+    "source": "iana",
+    "compressible": false,
+    "extensions": ["xls","xlm","xla","xlc","xlt","xlw"]
+  },
+  "application/vnd.ms-excel.addin.macroenabled.12": {
+    "source": "iana",
+    "extensions": ["xlam"]
+  },
+  "application/vnd.ms-excel.sheet.binary.macroenabled.12": {
+    "source": "iana",
+    "extensions": ["xlsb"]
+  },
+  "application/vnd.ms-excel.sheet.macroenabled.12": {
+    "source": "iana",
+    "extensions": ["xlsm"]
+  },
+  "application/vnd.ms-excel.template.macroenabled.12": {
+    "source": "iana",
+    "extensions": ["xltm"]
+  },
+  "application/vnd.ms-fontobject": {
+    "source": "iana",
+    "compressible": true,
+    "extensions": ["eot"]
+  },
+  "application/vnd.ms-htmlhelp": {
+    "source": "iana",
+    "extensions": ["chm"]
+  },
+  "application/vnd.ms-ims": {
+    "source": "iana",
+    "extensions": ["ims"]
+  },
+  "application/vnd.ms-lrm": {
+    "source": "iana",
+    "extensions": ["lrm"]
+  },
+  "application/vnd.ms-office.activex+xml": {
+    "source": "iana",
+    "compressible": true
+  },
+  "application/vnd.ms-officetheme": {
+    "source": "iana",
+    "extensions": ["thmx"]
+  },
+  "application/vnd.ms-opentype": {
+    "source": "apache",
+    "compressible": true
+  },
+  "application/vnd.ms-outlook": {
+    "compressible": false,
+    "extensions": ["msg"]
+  },
+  "application/vnd.ms-package.obfuscated-opentype": {
+    "source": "apache"
+  },
+  "application/vnd.ms-pki.seccat": {
+    "source": "apache",
+    "extensions": ["cat"]
+  },
+  "application/vnd.ms-pki.stl": {
+    "source": "apache",
+    "extensions": ["stl"]
+  },
+  "application/vnd.ms-playready.initiator+xml": {
+    "source": "iana",
+    "compressible": true
+  },
+  "application/vnd.ms-powerpoint": {
+    "source": "iana",
+    "compressible": false,
+    "extensions": ["ppt","pps","pot"]
+  },
+  "application/vnd.ms-powerpoint.addin.macroenabled.12": {
+    "source": "iana",
+    "extensions": ["ppam"]
+  },
+  "application/vnd.ms-powerpoint.presentation.macroenabled.12": {
+    "source": "iana",
+    "extensions": ["pptm"]
+  },
+  "application/vnd.ms-powerpoint.slide.macroenabled.12": {
+    "source": "iana",
+    "extensions": ["sldm"]
+  },
+  "application/vnd.ms-powerpoint.slideshow.macroenabled.12": {
+    "source": "iana",
+    "extensions": ["ppsm"]
+  },
+  "application/vnd.ms-powerpoint.template.macroenabled.12": {
+    "source": "iana",
+    "extensions": ["potm"]
+  },
+  "application/vnd.ms-printdevicecapabilities+xml": {
+    "source": "iana",
+    "compressible": true
+  },
+  "application/vnd.ms-printing.printticket+xml": {
+    "source": "apache",
+    "compressible": true
+  },
+  "application/vnd.ms-printschematicket+xml": {
+    "source": "iana",
+    "compressible": true
+  },
+  "application/vnd.ms-project": {
+    "source": "iana",
+    "extensions": ["mpp","mpt"]
+  },
+  "application/vnd.ms-tnef": {
+    "source": "iana"
+  },
+  "application/vnd.ms-windows.devicepairing": {
+    "source": "iana"
+  },
+  "application/vnd.ms-windows.nwprinting.oob": {
+    "source": "iana"
+  },
+  "application/vnd.ms-windows.printerpairing": {
+    "source": "iana"
+  },
+  "application/vnd.ms-windows.wsd.oob": {
+    "source": "iana"
+  },
+  "application/vnd.ms-wmdrm.lic-chlg-req": {
+    "source": "iana"
+  },
+  "application/vnd.ms-wmdrm.lic-resp": {
+    "source": "iana"
+  },
+  "application/vnd.ms-wmdrm.meter-chlg-req": {
+    "source": "iana"
+  },
+  "application/vnd.ms-wmdrm.meter-resp": {
+    "source": "iana"
+  },
+  "application/vnd.ms-word.document.macroenabled.12": {
+    "source": "iana",
+    "extensions": ["docm"]
+  },
+  "application/vnd.ms-word.template.macroenabled.12": {
+    "source": "iana",
+    "extensions": ["dotm"]
+  },
+  "application/vnd.ms-works": {
+    "source": "iana",
+    "extensions": ["wps","wks","wcm","wdb"]
+  },
+  "application/vnd.ms-wpl": {
+    "source": "iana",
+    "extensions": ["wpl"]
+  },
+  "application/vnd.ms-xpsdocument": {
+    "source": "iana",
+    "compressible": false,
+    "extensions": ["xps"]
+  },
+  "application/vnd.msa-disk-image": {
+    "source": "iana"
+  },
+  "application/vnd.mseq": {
+    "source": "iana",
+    "extensions": ["mseq"]
+  },
+  "application/vnd.msign": {
+    "source": "iana"
+  },
+  "application/vnd.multiad.creator": {
+    "source": "iana"
+  },
+  "application/vnd.multiad.creator.cif": {
+    "source": "iana"
+  },
+  "application/vnd.music-niff": {
+    "source": "iana"
+  },
+  "application/vnd.musician": {
+    "source": "iana",
+    "extensions": ["mus"]
+  },
+  "application/vnd.muvee.style": {
+    "source": "iana",
+    "extensions": ["msty"]
+  },
+  "application/vnd.mynfc": {
+    "source": "iana",
+    "extensions": ["taglet"]
+  },
+  "application/vnd.ncd.control": {
+    "source": "iana"
+  },
+  "application/vnd.ncd.reference": {
+    "source": "iana"
+  },
+  "application/vnd.nearst.inv+json": {
+    "source": "iana",
+    "compressible": true
+  },
+  "application/vnd.nebumind.line": {
+    "source": "iana"
+  },
+  "application/vnd.nervana": {
+    "source": "iana"
+  },
+  "application/vnd.netfpx": {
+    "source": "iana"
+  },
+  "application/vnd.neurolanguage.nlu": {
+    "source": "iana",
+    "extensions": ["nlu"]
+  },
+  "application/vnd.nimn": {
+    "source": "iana"
+  },
+  "application/vnd.nintendo.nitro.rom": {
+    "source": "iana"
+  },
+  "application/vnd.nintendo.snes.rom": {
+    "source": "iana"
+  },
+  "application/vnd.nitf": {
+    "source": "iana",
+    "extensions": ["ntf","nitf"]
+  },
+  "application/vnd.noblenet-directory": {
+    "source": "iana",
+    "extensions": ["nnd"]
+  },
+  "application/vnd.noblenet-sealer": {
+    "source": "iana",
+    "extensions": ["nns"]
+  },
+  "application/vnd.noblenet-web": {
+    "source": "iana",
+    "extensions": ["nnw"]
+  },
+  "application/vnd.nokia.catalogs": {
+    "source": "iana"
+  },
+  "application/vnd.nokia.conml+wbxml": {
+    "source": "iana"
+  },
+  "application/vnd.nokia.conml+xml": {
+    "source": "iana",
+    "compressible": true
+  },
+  "application/vnd.nokia.iptv.config+xml": {
+    "source": "iana",
+    "compressible": true
+  },
+  "application/vnd.nokia.isds-radio-presets": {
+    "source": "iana"
+  },
+  "application/vnd.nokia.landmark+wbxml": {
+    "source": "iana"
+  },
+  "application/vnd.nokia.landmark+xml": {
+    "source": "iana",
+    "compressible": true
+  },
+  "application/vnd.nokia.landmarkcollection+xml": {
+    "source": "iana",
+    "compressible": true
+  },
+  "application/vnd.nokia.n-gage.ac+xml": {
+    "source": "iana",
+    "compressible": true,
+    "extensions": ["ac"]
+  },
+  "application/vnd.nokia.n-gage.data": {
+    "source": "iana",
+    "extensions": ["ngdat"]
+  },
+  "application/vnd.nokia.n-gage.symbian.install": {
+    "source": "iana",
+    "extensions": ["n-gage"]
+  },
+  "application/vnd.nokia.ncd": {
+    "source": "iana"
+  },
+  "application/vnd.nokia.pcd+wbxml": {
+    "source": "iana"
+  },
+  "application/vnd.nokia.pcd+xml": {
+    "source": "iana",
+    "compressible": true
+  },
+  "application/vnd.nokia.radio-preset": {
+    "source": "iana",
+    "extensions": ["rpst"]
+  },
+  "application/vnd.nokia.radio-presets": {
+    "source": "iana",
+    "extensions": ["rpss"]
+  },
+  "application/vnd.novadigm.edm": {
+    "source": "iana",
+    "extensions": ["edm"]
+  },
+  "application/vnd.novadigm.edx": {
+    "source": "iana",
+    "extensions": ["edx"]
+  },
+  "application/vnd.novadigm.ext": {
+    "source": "iana",
+    "extensions": ["ext"]
+  },
+  "application/vnd.ntt-local.content-share": {
+    "source": "iana"
+  },
+  "application/vnd.ntt-local.file-transfer": {
+    "source": "iana"
+  },
+  "application/vnd.ntt-local.ogw_remote-access": {
+    "source": "iana"
+  },
+  "application/vnd.ntt-local.sip-ta_remote": {
+    "source": "iana"
+  },
+  "application/vnd.ntt-local.sip-ta_tcp_stream": {
+    "source": "iana"
+  },
+  "application/vnd.oasis.opendocument.chart": {
+    "source": "iana",
+    "extensions": ["odc"]
+  },
+  "application/vnd.oasis.opendocument.chart-template": {
+    "source": "iana",
+    "extensions": ["otc"]
+  },
+  "application/vnd.oasis.opendocument.database": {
+    "source": "iana",
+    "extensions": ["odb"]
+  },
+  "application/vnd.oasis.opendocument.formula": {
+    "source": "iana",
+    "extensions": ["odf"]
+  },
+  "application/vnd.oasis.opendocument.formula-template": {
+    "source": "iana",
+    "extensions": ["odft"]
+  },
+  "application/vnd.oasis.opendocument.graphics": {
+    "source": "iana",
+    "compressible": false,
+    "extensions": ["odg"]
+  },
+  "application/vnd.oasis.opendocument.graphics-template": {
+    "source": "iana",
+    "extensions": ["otg"]
+  },
+  "application/vnd.oasis.opendocument.image": {
+    "source": "iana",
+    "extensions": ["odi"]
+  },
+  "application/vnd.oasis.opendocument.image-template": {
+    "source": "iana",
+    "extensions": ["oti"]
+  },
+  "application/vnd.oasis.opendocument.presentation": {
+    "source": "iana",
+    "compressible": false,
+    "extensions": ["odp"]
+  },
+  "application/vnd.oasis.opendocument.presentation-template": {
+    "source": "iana",
+    "extensions": ["otp"]
+  },
+  "application/vnd.oasis.opendocument.spreadsheet": {
+    "source": "iana",
+    "compressible": false,
+    "extensions": ["ods"]
+  },
+  "application/vnd.oasis.opendocument.spreadsheet-template": {
+    "source": "iana",
+    "extensions": ["ots"]
+  },
+  "application/vnd.oasis.opendocument.text": {
+    "source": "iana",
+    "compressible": false,
+    "extensions": ["odt"]
+  },
+  "application/vnd.oasis.opendocument.text-master": {
+    "source": "iana",
+    "extensions": ["odm"]
+  },
+  "application/vnd.oasis.opendocument.text-template": {
+    "source": "iana",
+    "extensions": ["ott"]
+  },
+  "application/vnd.oasis.opendocument.text-web": {
+    "source": "iana",
+    "extensions": ["oth"]
+  },
+  "application/vnd.obn": {
+    "source": "iana"
+  },
+  "application/vnd.ocf+cbor": {
+    "source": "iana"
+  },
+  "application/vnd.oci.image.manifest.v1+json": {
+    "source": "iana",
+    "compressible": true
+  },
+  "application/vnd.oftn.l10n+json": {
+    "source": "iana",
+    "compressible": true
+  },
+  "application/vnd.oipf.contentaccessdownload+xml": {
+    "source": "iana",
+    "compressible": true
+  },
+  "application/vnd.oipf.contentaccessstreaming+xml": {
+    "source": "iana",
+    "compressible": true
+  },
+  "application/vnd.oipf.cspg-hexbinary": {
+    "source": "iana"
+  },
+  "application/vnd.oipf.dae.svg+xml": {
+    "source": "iana",
+    "compressible": true
+  },
+  "application/vnd.oipf.dae.xhtml+xml": {
+    "source": "iana",
+    "compressible": true
+  },
+  "application/vnd.oipf.mippvcontrolmessage+xml": {
+    "source": "iana",
+    "compressible": true
+  },
+  "application/vnd.oipf.pae.gem": {
+    "source": "iana"
+  },
+  "application/vnd.oipf.spdiscovery+xml": {
+    "source": "iana",
+    "compressible": true
+  },
+  "application/vnd.oipf.spdlist+xml": {
+    "source": "iana",
+    "compressible": true
+  },
+  "application/vnd.oipf.ueprofile+xml": {
+    "source": "iana",
+    "compressible": true
+  },
+  "application/vnd.oipf.userprofile+xml": {
+    "source": "iana",
+    "compressible": true
+  },
+  "application/vnd.olpc-sugar": {
+    "source": "iana",
+    "extensions": ["xo"]
+  },
+  "application/vnd.oma-scws-config": {
+    "source": "iana"
+  },
+  "application/vnd.oma-scws-http-request": {
+    "source": "iana"
+  },
+  "application/vnd.oma-scws-http-response": {
+    "source": "iana"
+  },
+  "application/vnd.oma.bcast.associated-procedure-parameter+xml": {
+    "source": "iana",
+    "compressible": true
+  },
+  "application/vnd.oma.bcast.drm-trigger+xml": {
+    "source": "iana",
+    "compressible": true
+  },
+  "application/vnd.oma.bcast.imd+xml": {
+    "source": "iana",
+    "compressible": true
+  },
+  "application/vnd.oma.bcast.ltkm": {
+    "source": "iana"
+  },
+  "application/vnd.oma.bcast.notification+xml": {
+    "source": "iana",
+    "compressible": true
+  },
+  "application/vnd.oma.bcast.provisioningtrigger": {
+    "source": "iana"
+  },
+  "application/vnd.oma.bcast.sgboot": {
+    "source": "iana"
+  },
+  "application/vnd.oma.bcast.sgdd+xml": {
+    "source": "iana",
+    "compressible": true
+  },
+  "application/vnd.oma.bcast.sgdu": {
+    "source": "iana"
+  },
+  "application/vnd.oma.bcast.simple-symbol-container": {
+    "source": "iana"
+  },
+  "application/vnd.oma.bcast.smartcard-trigger+xml": {
+    "source": "iana",
+    "compressible": true
+  },
+  "application/vnd.oma.bcast.sprov+xml": {
+    "source": "iana",
+    "compressible": true
+  },
+  "application/vnd.oma.bcast.stkm": {
+    "source": "iana"
+  },
+  "application/vnd.oma.cab-address-book+xml": {
+    "source": "iana",
+    "compressible": true
+  },
+  "application/vnd.oma.cab-feature-handler+xml": {
+    "source": "iana",
+    "compressible": true
+  },
+  "application/vnd.oma.cab-pcc+xml": {
+    "source": "iana",
+    "compressible": true
+  },
+  "application/vnd.oma.cab-subs-invite+xml": {
+    "source": "iana",
+    "compressible": true
+  },
+  "application/vnd.oma.cab-user-prefs+xml": {
+    "source": "iana",
+    "compressible": true
+  },
+  "application/vnd.oma.dcd": {
+    "source": "iana"
+  },
+  "application/vnd.oma.dcdc": {
+    "source": "iana"
+  },
+  "application/vnd.oma.dd2+xml": {
+    "source": "iana",
+    "compressible": true,
+    "extensions": ["dd2"]
+  },
+  "application/vnd.oma.drm.risd+xml": {
+    "source": "iana",
+    "compressible": true
+  },
+  "application/vnd.oma.group-usage-list+xml": {
+    "source": "iana",
+    "compressible": true
+  },
+  "application/vnd.oma.lwm2m+cbor": {
+    "source": "iana"
+  },
+  "application/vnd.oma.lwm2m+json": {
+    "source": "iana",
+    "compressible": true
+  },
+  "application/vnd.oma.lwm2m+tlv": {
+    "source": "iana"
+  },
+  "application/vnd.oma.pal+xml": {
+    "source": "iana",
+    "compressible": true
+  },
+  "application/vnd.oma.poc.detailed-progress-report+xml": {
+    "source": "iana",
+    "compressible": true
+  },
+  "application/vnd.oma.poc.final-report+xml": {
+    "source": "iana",
+    "compressible": true
+  },
+  "application/vnd.oma.poc.groups+xml": {
+    "source": "iana",
+    "compressible": true
+  },
+  "application/vnd.oma.poc.invocation-descriptor+xml": {
+    "source": "iana",
+    "compressible": true
+  },
+  "application/vnd.oma.poc.optimized-progress-report+xml": {
+    "source": "iana",
+    "compressible": true
+  },
+  "application/vnd.oma.push": {
+    "source": "iana"
+  },
+  "application/vnd.oma.scidm.messages+xml": {
+    "source": "iana",
+    "compressible": true
+  },
+  "application/vnd.oma.xcap-directory+xml": {
+    "source": "iana",
+    "compressible": true
+  },
+  "application/vnd.omads-email+xml": {
+    "source": "iana",
+    "charset": "UTF-8",
+    "compressible": true
+  },
+  "application/vnd.omads-file+xml": {
+    "source": "iana",
+    "charset": "UTF-8",
+    "compressible": true
+  },
+  "application/vnd.omads-folder+xml": {
+    "source": "iana",
+    "charset": "UTF-8",
+    "compressible": true
+  },
+  "application/vnd.omaloc-supl-init": {
+    "source": "iana"
+  },
+  "application/vnd.onepager": {
+    "source": "iana"
+  },
+  "application/vnd.onepagertamp": {
+    "source": "iana"
+  },
+  "application/vnd.onepagertamx": {
+    "source": "iana"
+  },
+  "application/vnd.onepagertat": {
+    "source": "iana"
+  },
+  "application/vnd.onepagertatp": {
+    "source": "iana"
+  },
+  "application/vnd.onepagertatx": {
+    "source": "iana"
+  },
+  "application/vnd.openblox.game+xml": {
+    "source": "iana",
+    "compressible": true,
+    "extensions": ["obgx"]
+  },
+  "application/vnd.openblox.game-binary": {
+    "source": "iana"
+  },
+  "application/vnd.openeye.oeb": {
+    "source": "iana"
+  },
+  "application/vnd.openofficeorg.extension": {
+    "source": "apache",
+    "extensions": ["oxt"]
+  },
+  "application/vnd.openstreetmap.data+xml": {
+    "source": "iana",
+    "compressible": true,
+    "extensions": ["osm"]
+  },
+  "application/vnd.opentimestamps.ots": {
+    "source": "iana"
+  },
+  "application/vnd.openxmlformats-officedocument.custom-properties+xml": {
+    "source": "iana",
+    "compressible": true
+  },
+  "application/vnd.openxmlformats-officedocument.customxmlproperties+xml": {
+    "source": "iana",
+    "compressible": true
+  },
+  "application/vnd.openxmlformats-officedocument.drawing+xml": {
+    "source": "iana",
+    "compressible": true
+  },
+  "application/vnd.openxmlformats-officedocument.drawingml.chart+xml": {
+    "source": "iana",
+    "compressible": true
+  },
+  "application/vnd.openxmlformats-officedocument.drawingml.chartshapes+xml": {
+    "source": "iana",
+    "compressible": true
+  },
+  "application/vnd.openxmlformats-officedocument.drawingml.diagramcolors+xml": {
+    "source": "iana",
+    "compressible": true
+  },
+  "application/vnd.openxmlformats-officedocument.drawingml.diagramdata+xml": {
+    "source": "iana",
+    "compressible": true
+  },
+  "application/vnd.openxmlformats-officedocument.drawingml.diagramlayout+xml": {
+    "source": "iana",
+    "compressible": true
+  },
+  "application/vnd.openxmlformats-officedocument.drawingml.diagramstyle+xml": {
+    "source": "iana",
+    "compressible": true
+  },
+  "application/vnd.openxmlformats-officedocument.extended-properties+xml": {
+    "source": "iana",
+    "compressible": true
+  },
+  "application/vnd.openxmlformats-officedocument.presentationml.commentauthors+xml": {
+    "source": "iana",
+    "compressible": true
+  },
+  "application/vnd.openxmlformats-officedocument.presentationml.comments+xml": {
+    "source": "iana",
+    "compressible": true
+  },
+  "application/vnd.openxmlformats-officedocument.presentationml.handoutmaster+xml": {
+    "source": "iana",
+    "compressible": true
+  },
+  "application/vnd.openxmlformats-officedocument.presentationml.notesmaster+xml": {
+    "source": "iana",
+    "compressible": true
+  },
+  "application/vnd.openxmlformats-officedocument.presentationml.notesslide+xml": {
+    "source": "iana",
+    "compressible": true
+  },
+  "application/vnd.openxmlformats-officedocument.presentationml.presentation": {
+    "source": "iana",
+    "compressible": false,
+    "extensions": ["pptx"]
+  },
+  "application/vnd.openxmlformats-officedocument.presentationml.presentation.main+xml": {
+    "source": "iana",
+    "compressible": true
+  },
+  "application/vnd.openxmlformats-officedocument.presentationml.presprops+xml": {
+    "source": "iana",
+    "compressible": true
+  },
+  "application/vnd.openxmlformats-officedocument.presentationml.slide": {
+    "source": "iana",
+    "extensions": ["sldx"]
+  },
+  "application/vnd.openxmlformats-officedocument.presentationml.slide+xml": {
+    "source": "iana",
+    "compressible": true
+  },
+  "application/vnd.openxmlformats-officedocument.presentationml.slidelayout+xml": {
+    "source": "iana",
+    "compressible": true
+  },
+  "application/vnd.openxmlformats-officedocument.presentationml.slidemaster+xml": {
+    "source": "iana",
+    "compressible": true
+  },
+  "application/vnd.openxmlformats-officedocument.presentationml.slideshow": {
+    "source": "iana",
+    "extensions": ["ppsx"]
+  },
+  "application/vnd.openxmlformats-officedocument.presentationml.slideshow.main+xml": {
+    "source": "iana",
+    "compressible": true
+  },
+  "application/vnd.openxmlformats-officedocument.presentationml.slideupdateinfo+xml": {
+    "source": "iana",
+    "compressible": true
+  },
+  "application/vnd.openxmlformats-officedocument.presentationml.tablestyles+xml": {
+    "source": "iana",
+    "compressible": true
+  },
+  "application/vnd.openxmlformats-officedocument.presentationml.tags+xml": {
+    "source": "iana",
+    "compressible": true
+  },
+  "application/vnd.openxmlformats-officedocument.presentationml.template": {
+    "source": "iana",
+    "extensions": ["potx"]
+  },
+  "application/vnd.openxmlformats-officedocument.presentationml.template.main+xml": {
+    "source": "iana",
+    "compressible": true
+  },
+  "application/vnd.openxmlformats-officedocument.presentationml.viewprops+xml": {
+    "source": "iana",
+    "compressible": true
+  },
+  "application/vnd.openxmlformats-officedocument.spreadsheetml.calcchain+xml": {
+    "source": "iana",
+    "compressible": true
+  },
+  "application/vnd.openxmlformats-officedocument.spreadsheetml.chartsheet+xml": {
+    "source": "iana",
+    "compressible": true
+  },
+  "application/vnd.openxmlformats-officedocument.spreadsheetml.comments+xml": {
+    "source": "iana",
+    "compressible": true
+  },
+  "application/vnd.openxmlformats-officedocument.spreadsheetml.connections+xml": {
+    "source": "iana",
+    "compressible": true
+  },
+  "application/vnd.openxmlformats-officedocument.spreadsheetml.dialogsheet+xml": {
+    "source": "iana",
+    "compressible": true
+  },
+  "application/vnd.openxmlformats-officedocument.spreadsheetml.externallink+xml": {
+    "source": "iana",
+    "compressible": true
+  },
+  "application/vnd.openxmlformats-officedocument.spreadsheetml.pivotcachedefinition+xml": {
+    "source": "iana",
+    "compressible": true
+  },
+  "application/vnd.openxmlformats-officedocument.spreadsheetml.pivotcacherecords+xml": {
+    "source": "iana",
+    "compressible": true
+  },
+  "application/vnd.openxmlformats-officedocument.spreadsheetml.pivottable+xml": {
+    "source": "iana",
+    "compressible": true
+  },
+  "application/vnd.openxmlformats-officedocument.spreadsheetml.querytable+xml": {
+    "source": "iana",
+    "compressible": true
+  },
+  "application/vnd.openxmlformats-officedocument.spreadsheetml.revisionheaders+xml": {
+    "source": "iana",
+    "compressible": true
+  },
+  "application/vnd.openxmlformats-officedocument.spreadsheetml.revisionlog+xml": {
+    "source": "iana",
+    "compressible": true
+  },
+  "application/vnd.openxmlformats-officedocument.spreadsheetml.sharedstrings+xml": {
+    "source": "iana",
+    "compressible": true
+  },
+  "application/vnd.openxmlformats-officedocument.spreadsheetml.sheet": {
+    "source": "iana",
+    "compressible": false,
+    "extensions": ["xlsx"]
+  },
+  "application/vnd.openxmlformats-officedocument.spreadsheetml.sheet.main+xml": {
+    "source": "iana",
+    "compressible": true
+  },
+  "application/vnd.openxmlformats-officedocument.spreadsheetml.sheetmetadata+xml": {
+    "source": "iana",
+    "compressible": true
+  },
+  "application/vnd.openxmlformats-officedocument.spreadsheetml.styles+xml": {
+    "source": "iana",
+    "compressible": true
+  },
+  "application/vnd.openxmlformats-officedocument.spreadsheetml.table+xml": {
+    "source": "iana",
+    "compressible": true
+  },
+  "application/vnd.openxmlformats-officedocument.spreadsheetml.tablesinglecells+xml": {
+    "source": "iana",
+    "compressible": true
+  },
+  "application/vnd.openxmlformats-officedocument.spreadsheetml.template": {
+    "source": "iana",
+    "extensions": ["xltx"]
+  },
+  "application/vnd.openxmlformats-officedocument.spreadsheetml.template.main+xml": {
+    "source": "iana",
+    "compressible": true
+  },
+  "application/vnd.openxmlformats-officedocument.spreadsheetml.usernames+xml": {
+    "source": "iana",
+    "compressible": true
+  },
+  "application/vnd.openxmlformats-officedocument.spreadsheetml.volatiledependencies+xml": {
+    "source": "iana",
+    "compressible": true
+  },
+  "application/vnd.openxmlformats-officedocument.spreadsheetml.worksheet+xml": {
+    "source": "iana",
+    "compressible": true
+  },
+  "application/vnd.openxmlformats-officedocument.theme+xml": {
+    "source": "iana",
+    "compressible": true
+  },
+  "application/vnd.openxmlformats-officedocument.themeoverride+xml": {
+    "source": "iana",
+    "compressible": true
+  },
+  "application/vnd.openxmlformats-officedocument.vmldrawing": {
+    "source": "iana"
+  },
+  "application/vnd.openxmlformats-officedocument.wordprocessingml.comments+xml": {
+    "source": "iana",
+    "compressible": true
+  },
+  "application/vnd.openxmlformats-officedocument.wordprocessingml.document": {
+    "source": "iana",
+    "compressible": false,
+    "extensions": ["docx"]
+  },
+  "application/vnd.openxmlformats-officedocument.wordprocessingml.document.glossary+xml": {
+    "source": "iana",
+    "compressible": true
+  },
+  "application/vnd.openxmlformats-officedocument.wordprocessingml.document.main+xml": {
+    "source": "iana",
+    "compressible": true
+  },
+  "application/vnd.openxmlformats-officedocument.wordprocessingml.endnotes+xml": {
+    "source": "iana",
+    "compressible": true
+  },
+  "application/vnd.openxmlformats-officedocument.wordprocessingml.fonttable+xml": {
+    "source": "iana",
+    "compressible": true
+  },
+  "application/vnd.openxmlformats-officedocument.wordprocessingml.footer+xml": {
+    "source": "iana",
+    "compressible": true
+  },
+  "application/vnd.openxmlformats-officedocument.wordprocessingml.footnotes+xml": {
+    "source": "iana",
+    "compressible": true
+  },
+  "application/vnd.openxmlformats-officedocument.wordprocessingml.numbering+xml": {
+    "source": "iana",
+    "compressible": true
+  },
+  "application/vnd.openxmlformats-officedocument.wordprocessingml.settings+xml": {
+    "source": "iana",
+    "compressible": true
+  },
+  "application/vnd.openxmlformats-officedocument.wordprocessingml.styles+xml": {
+    "source": "iana",
+    "compressible": true
+  },
+  "application/vnd.openxmlformats-officedocument.wordprocessingml.template": {
+    "source": "iana",
+    "extensions": ["dotx"]
+  },
+  "application/vnd.openxmlformats-officedocument.wordprocessingml.template.main+xml": {
+    "source": "iana",
+    "compressible": true
+  },
+  "application/vnd.openxmlformats-officedocument.wordprocessingml.websettings+xml": {
+    "source": "iana",
+    "compressible": true
+  },
+  "application/vnd.openxmlformats-package.core-properties+xml": {
+    "source": "iana",
+    "compressible": true
+  },
+  "application/vnd.openxmlformats-package.digital-signature-xmlsignature+xml": {
+    "source": "iana",
+    "compressible": true
+  },
+  "application/vnd.openxmlformats-package.relationships+xml": {
+    "source": "iana",
+    "compressible": true
+  },
+  "application/vnd.oracle.resource+json": {
+    "source": "iana",
+    "compressible": true
+  },
+  "application/vnd.orange.indata": {
+    "source": "iana"
+  },
+  "application/vnd.osa.netdeploy": {
+    "source": "iana"
+  },
+  "application/vnd.osgeo.mapguide.package": {
+    "source": "iana",
+    "extensions": ["mgp"]
+  },
+  "application/vnd.osgi.bundle": {
+    "source": "iana"
+  },
+  "application/vnd.osgi.dp": {
+    "source": "iana",
+    "extensions": ["dp"]
+  },
+  "application/vnd.osgi.subsystem": {
+    "source": "iana",
+    "extensions": ["esa"]
+  },
+  "application/vnd.otps.ct-kip+xml": {
+    "source": "iana",
+    "compressible": true
+  },
+  "application/vnd.oxli.countgraph": {
+    "source": "iana"
+  },
+  "application/vnd.pagerduty+json": {
+    "source": "iana",
+    "compressible": true
+  },
+  "application/vnd.palm": {
+    "source": "iana",
+    "extensions": ["pdb","pqa","oprc"]
+  },
+  "application/vnd.panoply": {
+    "source": "iana"
+  },
+  "application/vnd.paos.xml": {
+    "source": "iana"
+  },
+  "application/vnd.patentdive": {
+    "source": "iana"
+  },
+  "application/vnd.patientecommsdoc": {
+    "source": "iana"
+  },
+  "application/vnd.pawaafile": {
+    "source": "iana",
+    "extensions": ["paw"]
+  },
+  "application/vnd.pcos": {
+    "source": "iana"
+  },
+  "application/vnd.pg.format": {
+    "source": "iana",
+    "extensions": ["str"]
+  },
+  "application/vnd.pg.osasli": {
+    "source": "iana",
+    "extensions": ["ei6"]
+  },
+  "application/vnd.piaccess.application-licence": {
+    "source": "iana"
+  },
+  "application/vnd.picsel": {
+    "source": "iana",
+    "extensions": ["efif"]
+  },
+  "application/vnd.pmi.widget": {
+    "source": "iana",
+    "extensions": ["wg"]
+  },
+  "application/vnd.poc.group-advertisement+xml": {
+    "source": "iana",
+    "compressible": true
+  },
+  "application/vnd.pocketlearn": {
+    "source": "iana",
+    "extensions": ["plf"]
+  },
+  "application/vnd.powerbuilder6": {
+    "source": "iana",
+    "extensions": ["pbd"]
+  },
+  "application/vnd.powerbuilder6-s": {
+    "source": "iana"
+  },
+  "application/vnd.powerbuilder7": {
+    "source": "iana"
+  },
+  "application/vnd.powerbuilder7-s": {
+    "source": "iana"
+  },
+  "application/vnd.powerbuilder75": {
+    "source": "iana"
+  },
+  "application/vnd.powerbuilder75-s": {
+    "source": "iana"
+  },
+  "application/vnd.preminet": {
+    "source": "iana"
+  },
+  "application/vnd.previewsystems.box": {
+    "source": "iana",
+    "extensions": ["box"]
+  },
+  "application/vnd.proteus.magazine": {
+    "source": "iana",
+    "extensions": ["mgz"]
+  },
+  "application/vnd.psfs": {
+    "source": "iana"
+  },
+  "application/vnd.publishare-delta-tree": {
+    "source": "iana",
+    "extensions": ["qps"]
+  },
+  "application/vnd.pvi.ptid1": {
+    "source": "iana",
+    "extensions": ["ptid"]
+  },
+  "application/vnd.pwg-multiplexed": {
+    "source": "iana"
+  },
+  "application/vnd.pwg-xhtml-print+xml": {
+    "source": "iana",
+    "compressible": true
+  },
+  "application/vnd.qualcomm.brew-app-res": {
+    "source": "iana"
+  },
+  "application/vnd.quarantainenet": {
+    "source": "iana"
+  },
+  "application/vnd.quark.quarkxpress": {
+    "source": "iana",
+    "extensions": ["qxd","qxt","qwd","qwt","qxl","qxb"]
+  },
+  "application/vnd.quobject-quoxdocument": {
+    "source": "iana"
+  },
+  "application/vnd.radisys.moml+xml": {
+    "source": "iana",
+    "compressible": true
+  },
+  "application/vnd.radisys.msml+xml": {
+    "source": "iana",
+    "compressible": true
+  },
+  "application/vnd.radisys.msml-audit+xml": {
+    "source": "iana",
+    "compressible": true
+  },
+  "application/vnd.radisys.msml-audit-conf+xml": {
+    "source": "iana",
+    "compressible": true
+  },
+  "application/vnd.radisys.msml-audit-conn+xml": {
+    "source": "iana",
+    "compressible": true
+  },
+  "application/vnd.radisys.msml-audit-dialog+xml": {
+    "source": "iana",
+    "compressible": true
+  },
+  "application/vnd.radisys.msml-audit-stream+xml": {
+    "source": "iana",
+    "compressible": true
+  },
+  "application/vnd.radisys.msml-conf+xml": {
+    "source": "iana",
+    "compressible": true
+  },
+  "application/vnd.radisys.msml-dialog+xml": {
+    "source": "iana",
+    "compressible": true
+  },
+  "application/vnd.radisys.msml-dialog-base+xml": {
+    "source": "iana",
+    "compressible": true
+  },
+  "application/vnd.radisys.msml-dialog-fax-detect+xml": {
+    "source": "iana",
+    "compressible": true
+  },
+  "application/vnd.radisys.msml-dialog-fax-sendrecv+xml": {
+    "source": "iana",
+    "compressible": true
+  },
+  "application/vnd.radisys.msml-dialog-group+xml": {
+    "source": "iana",
+    "compressible": true
+  },
+  "application/vnd.radisys.msml-dialog-speech+xml": {
+    "source": "iana",
+    "compressible": true
+  },
+  "application/vnd.radisys.msml-dialog-transform+xml": {
+    "source": "iana",
+    "compressible": true
+  },
+  "application/vnd.rainstor.data": {
+    "source": "iana"
+  },
+  "application/vnd.rapid": {
+    "source": "iana"
+  },
+  "application/vnd.rar": {
+    "source": "iana",
+    "extensions": ["rar"]
+  },
+  "application/vnd.realvnc.bed": {
+    "source": "iana",
+    "extensions": ["bed"]
+  },
+  "application/vnd.recordare.musicxml": {
+    "source": "iana",
+    "extensions": ["mxl"]
+  },
+  "application/vnd.recordare.musicxml+xml": {
+    "source": "iana",
+    "compressible": true,
+    "extensions": ["musicxml"]
+  },
+  "application/vnd.renlearn.rlprint": {
+    "source": "iana"
+  },
+  "application/vnd.resilient.logic": {
+    "source": "iana"
+  },
+  "application/vnd.restful+json": {
+    "source": "iana",
+    "compressible": true
+  },
+  "application/vnd.rig.cryptonote": {
+    "source": "iana",
+    "extensions": ["cryptonote"]
+  },
+  "application/vnd.rim.cod": {
+    "source": "apache",
+    "extensions": ["cod"]
+  },
+  "application/vnd.rn-realmedia": {
+    "source": "apache",
+    "extensions": ["rm"]
+  },
+  "application/vnd.rn-realmedia-vbr": {
+    "source": "apache",
+    "extensions": ["rmvb"]
+  },
+  "application/vnd.route66.link66+xml": {
+    "source": "iana",
+    "compressible": true,
+    "extensions": ["link66"]
+  },
+  "application/vnd.rs-274x": {
+    "source": "iana"
+  },
+  "application/vnd.ruckus.download": {
+    "source": "iana"
+  },
+  "application/vnd.s3sms": {
+    "source": "iana"
+  },
+  "application/vnd.sailingtracker.track": {
+    "source": "iana",
+    "extensions": ["st"]
+  },
+  "application/vnd.sar": {
+    "source": "iana"
+  },
+  "application/vnd.sbm.cid": {
+    "source": "iana"
+  },
+  "application/vnd.sbm.mid2": {
+    "source": "iana"
+  },
+  "application/vnd.scribus": {
+    "source": "iana"
+  },
+  "application/vnd.sealed.3df": {
+    "source": "iana"
+  },
+  "application/vnd.sealed.csf": {
+    "source": "iana"
+  },
+  "application/vnd.sealed.doc": {
+    "source": "iana"
+  },
+  "application/vnd.sealed.eml": {
+    "source": "iana"
+  },
+  "application/vnd.sealed.mht": {
+    "source": "iana"
+  },
+  "application/vnd.sealed.net": {
+    "source": "iana"
+  },
+  "application/vnd.sealed.ppt": {
+    "source": "iana"
+  },
+  "application/vnd.sealed.tiff": {
+    "source": "iana"
+  },
+  "application/vnd.sealed.xls": {
+    "source": "iana"
+  },
+  "application/vnd.sealedmedia.softseal.html": {
+    "source": "iana"
+  },
+  "application/vnd.sealedmedia.softseal.pdf": {
+    "source": "iana"
+  },
+  "application/vnd.seemail": {
+    "source": "iana",
+    "extensions": ["see"]
+  },
+  "application/vnd.seis+json": {
+    "source": "iana",
+    "compressible": true
+  },
+  "application/vnd.sema": {
+    "source": "iana",
+    "extensions": ["sema"]
+  },
+  "application/vnd.semd": {
+    "source": "iana",
+    "extensions": ["semd"]
+  },
+  "application/vnd.semf": {
+    "source": "iana",
+    "extensions": ["semf"]
+  },
+  "application/vnd.shade-save-file": {
+    "source": "iana"
+  },
+  "application/vnd.shana.informed.formdata": {
+    "source": "iana",
+    "extensions": ["ifm"]
+  },
+  "application/vnd.shana.informed.formtemplate": {
+    "source": "iana",
+    "extensions": ["itp"]
+  },
+  "application/vnd.shana.informed.interchange": {
+    "source": "iana",
+    "extensions": ["iif"]
+  },
+  "application/vnd.shana.informed.package": {
+    "source": "iana",
+    "extensions": ["ipk"]
+  },
+  "application/vnd.shootproof+json": {
+    "source": "iana",
+    "compressible": true
+  },
+  "application/vnd.shopkick+json": {
+    "source": "iana",
+    "compressible": true
+  },
+  "application/vnd.shp": {
+    "source": "iana"
+  },
+  "application/vnd.shx": {
+    "source": "iana"
+  },
+  "application/vnd.sigrok.session": {
+    "source": "iana"
+  },
+  "application/vnd.simtech-mindmapper": {
+    "source": "iana",
+    "extensions": ["twd","twds"]
+  },
+  "application/vnd.siren+json": {
+    "source": "iana",
+    "compressible": true
+  },
+  "application/vnd.smaf": {
+    "source": "iana",
+    "extensions": ["mmf"]
+  },
+  "application/vnd.smart.notebook": {
+    "source": "iana"
+  },
+  "application/vnd.smart.teacher": {
+    "source": "iana",
+    "extensions": ["teacher"]
+  },
+  "application/vnd.snesdev-page-table": {
+    "source": "iana"
+  },
+  "application/vnd.software602.filler.form+xml": {
+    "source": "iana",
+    "compressible": true,
+    "extensions": ["fo"]
+  },
+  "application/vnd.software602.filler.form-xml-zip": {
+    "source": "iana"
+  },
+  "application/vnd.solent.sdkm+xml": {
+    "source": "iana",
+    "compressible": true,
+    "extensions": ["sdkm","sdkd"]
+  },
+  "application/vnd.spotfire.dxp": {
+    "source": "iana",
+    "extensions": ["dxp"]
+  },
+  "application/vnd.spotfire.sfs": {
+    "source": "iana",
+    "extensions": ["sfs"]
+  },
+  "application/vnd.sqlite3": {
+    "source": "iana"
+  },
+  "application/vnd.sss-cod": {
+    "source": "iana"
+  },
+  "application/vnd.sss-dtf": {
+    "source": "iana"
+  },
+  "application/vnd.sss-ntf": {
+    "source": "iana"
+  },
+  "application/vnd.stardivision.calc": {
+    "source": "apache",
+    "extensions": ["sdc"]
+  },
+  "application/vnd.stardivision.draw": {
+    "source": "apache",
+    "extensions": ["sda"]
+  },
+  "application/vnd.stardivision.impress": {
+    "source": "apache",
+    "extensions": ["sdd"]
+  },
+  "application/vnd.stardivision.math": {
+    "source": "apache",
+    "extensions": ["smf"]
+  },
+  "application/vnd.stardivision.writer": {
+    "source": "apache",
+    "extensions": ["sdw","vor"]
+  },
+  "application/vnd.stardivision.writer-global": {
+    "source": "apache",
+    "extensions": ["sgl"]
+  },
+  "application/vnd.stepmania.package": {
+    "source": "iana",
+    "extensions": ["smzip"]
+  },
+  "application/vnd.stepmania.stepchart": {
+    "source": "iana",
+    "extensions": ["sm"]
+  },
+  "application/vnd.street-stream": {
+    "source": "iana"
+  },
+  "application/vnd.sun.wadl+xml": {
+    "source": "iana",
+    "compressible": true,
+    "extensions": ["wadl"]
+  },
+  "application/vnd.sun.xml.calc": {
+    "source": "apache",
+    "extensions": ["sxc"]
+  },
+  "application/vnd.sun.xml.calc.template": {
+    "source": "apache",
+    "extensions": ["stc"]
+  },
+  "application/vnd.sun.xml.draw": {
+    "source": "apache",
+    "extensions": ["sxd"]
+  },
+  "application/vnd.sun.xml.draw.template": {
+    "source": "apache",
+    "extensions": ["std"]
+  },
+  "application/vnd.sun.xml.impress": {
+    "source": "apache",
+    "extensions": ["sxi"]
+  },
+  "application/vnd.sun.xml.impress.template": {
+    "source": "apache",
+    "extensions": ["sti"]
+  },
+  "application/vnd.sun.xml.math": {
+    "source": "apache",
+    "extensions": ["sxm"]
+  },
+  "application/vnd.sun.xml.writer": {
+    "source": "apache",
+    "extensions": ["sxw"]
+  },
+  "application/vnd.sun.xml.writer.global": {
+    "source": "apache",
+    "extensions": ["sxg"]
+  },
+  "application/vnd.sun.xml.writer.template": {
+    "source": "apache",
+    "extensions": ["stw"]
+  },
+  "application/vnd.sus-calendar": {
+    "source": "iana",
+    "extensions": ["sus","susp"]
+  },
+  "application/vnd.svd": {
+    "source": "iana",
+    "extensions": ["svd"]
+  },
+  "application/vnd.swiftview-ics": {
+    "source": "iana"
+  },
+  "application/vnd.sycle+xml": {
+    "source": "iana",
+    "compressible": true
+  },
+  "application/vnd.symbian.install": {
+    "source": "apache",
+    "extensions": ["sis","sisx"]
+  },
+  "application/vnd.syncml+xml": {
+    "source": "iana",
+    "charset": "UTF-8",
+    "compressible": true,
+    "extensions": ["xsm"]
+  },
+  "application/vnd.syncml.dm+wbxml": {
+    "source": "iana",
+    "charset": "UTF-8",
+    "extensions": ["bdm"]
+  },
+  "application/vnd.syncml.dm+xml": {
+    "source": "iana",
+    "charset": "UTF-8",
+    "compressible": true,
+    "extensions": ["xdm"]
+  },
+  "application/vnd.syncml.dm.notification": {
+    "source": "iana"
+  },
+  "application/vnd.syncml.dmddf+wbxml": {
+    "source": "iana"
+  },
+  "application/vnd.syncml.dmddf+xml": {
+    "source": "iana",
+    "charset": "UTF-8",
+    "compressible": true,
+    "extensions": ["ddf"]
+  },
+  "application/vnd.syncml.dmtnds+wbxml": {
+    "source": "iana"
+  },
+  "application/vnd.syncml.dmtnds+xml": {
+    "source": "iana",
+    "charset": "UTF-8",
+    "compressible": true
+  },
+  "application/vnd.syncml.ds.notification": {
+    "source": "iana"
+  },
+  "application/vnd.tableschema+json": {
+    "source": "iana",
+    "compressible": true
+  },
+  "application/vnd.tao.intent-module-archive": {
+    "source": "iana",
+    "extensions": ["tao"]
+  },
+  "application/vnd.tcpdump.pcap": {
+    "source": "iana",
+    "extensions": ["pcap","cap","dmp"]
+  },
+  "application/vnd.think-cell.ppttc+json": {
+    "source": "iana",
+    "compressible": true
+  },
+  "application/vnd.tmd.mediaflex.api+xml": {
+    "source": "iana",
+    "compressible": true
+  },
+  "application/vnd.tml": {
+    "source": "iana"
+  },
+  "application/vnd.tmobile-livetv": {
+    "source": "iana",
+    "extensions": ["tmo"]
+  },
+  "application/vnd.tri.onesource": {
+    "source": "iana"
+  },
+  "application/vnd.trid.tpt": {
+    "source": "iana",
+    "extensions": ["tpt"]
+  },
+  "application/vnd.triscape.mxs": {
+    "source": "iana",
+    "extensions": ["mxs"]
+  },
+  "application/vnd.trueapp": {
+    "source": "iana",
+    "extensions": ["tra"]
+  },
+  "application/vnd.truedoc": {
+    "source": "iana"
+  },
+  "application/vnd.ubisoft.webplayer": {
+    "source": "iana"
+  },
+  "application/vnd.ufdl": {
+    "source": "iana",
+    "extensions": ["ufd","ufdl"]
+  },
+  "application/vnd.uiq.theme": {
+    "source": "iana",
+    "extensions": ["utz"]
+  },
+  "application/vnd.umajin": {
+    "source": "iana",
+    "extensions": ["umj"]
+  },
+  "application/vnd.unity": {
+    "source": "iana",
+    "extensions": ["unityweb"]
+  },
+  "application/vnd.uoml+xml": {
+    "source": "iana",
+    "compressible": true,
+    "extensions": ["uoml"]
+  },
+  "application/vnd.uplanet.alert": {
+    "source": "iana"
+  },
+  "application/vnd.uplanet.alert-wbxml": {
+    "source": "iana"
+  },
+  "application/vnd.uplanet.bearer-choice": {
+    "source": "iana"
+  },
+  "application/vnd.uplanet.bearer-choice-wbxml": {
+    "source": "iana"
+  },
+  "application/vnd.uplanet.cacheop": {
+    "source": "iana"
+  },
+  "application/vnd.uplanet.cacheop-wbxml": {
+    "source": "iana"
+  },
+  "application/vnd.uplanet.channel": {
+    "source": "iana"
+  },
+  "application/vnd.uplanet.channel-wbxml": {
+    "source": "iana"
+  },
+  "application/vnd.uplanet.list": {
+    "source": "iana"
+  },
+  "application/vnd.uplanet.list-wbxml": {
+    "source": "iana"
+  },
+  "application/vnd.uplanet.listcmd": {
+    "source": "iana"
+  },
+  "application/vnd.uplanet.listcmd-wbxml": {
+    "source": "iana"
+  },
+  "application/vnd.uplanet.signal": {
+    "source": "iana"
+  },
+  "application/vnd.uri-map": {
+    "source": "iana"
+  },
+  "application/vnd.valve.source.material": {
+    "source": "iana"
+  },
+  "application/vnd.vcx": {
+    "source": "iana",
+    "extensions": ["vcx"]
+  },
+  "application/vnd.vd-study": {
+    "source": "iana"
+  },
+  "application/vnd.vectorworks": {
+    "source": "iana"
+  },
+  "application/vnd.vel+json": {
+    "source": "iana",
+    "compressible": true
+  },
+  "application/vnd.verimatrix.vcas": {
+    "source": "iana"
+  },
+  "application/vnd.veritone.aion+json": {
+    "source": "iana",
+    "compressible": true
+  },
+  "application/vnd.veryant.thin": {
+    "source": "iana"
+  },
+  "application/vnd.ves.encrypted": {
+    "source": "iana"
+  },
+  "application/vnd.vidsoft.vidconference": {
+    "source": "iana"
+  },
+  "application/vnd.visio": {
+    "source": "iana",
+    "extensions": ["vsd","vst","vss","vsw"]
+  },
+  "application/vnd.visionary": {
+    "source": "iana",
+    "extensions": ["vis"]
+  },
+  "application/vnd.vividence.scriptfile": {
+    "source": "iana"
+  },
+  "application/vnd.vsf": {
+    "source": "iana",
+    "extensions": ["vsf"]
+  },
+  "application/vnd.wap.sic": {
+    "source": "iana"
+  },
+  "application/vnd.wap.slc": {
+    "source": "iana"
+  },
+  "application/vnd.wap.wbxml": {
+    "source": "iana",
+    "charset": "UTF-8",
+    "extensions": ["wbxml"]
+  },
+  "application/vnd.wap.wmlc": {
+    "source": "iana",
+    "extensions": ["wmlc"]
+  },
+  "application/vnd.wap.wmlscriptc": {
+    "source": "iana",
+    "extensions": ["wmlsc"]
+  },
+  "application/vnd.webturbo": {
+    "source": "iana",
+    "extensions": ["wtb"]
+  },
+  "application/vnd.wfa.dpp": {
+    "source": "iana"
+  },
+  "application/vnd.wfa.p2p": {
+    "source": "iana"
+  },
+  "application/vnd.wfa.wsc": {
+    "source": "iana"
+  },
+  "application/vnd.windows.devicepairing": {
+    "source": "iana"
+  },
+  "application/vnd.wmc": {
+    "source": "iana"
+  },
+  "application/vnd.wmf.bootstrap": {
+    "source": "iana"
+  },
+  "application/vnd.wolfram.mathematica": {
+    "source": "iana"
+  },
+  "application/vnd.wolfram.mathematica.package": {
+    "source": "iana"
+  },
+  "application/vnd.wolfram.player": {
+    "source": "iana",
+    "extensions": ["nbp"]
+  },
+  "application/vnd.wordperfect": {
+    "source": "iana",
+    "extensions": ["wpd"]
+  },
+  "application/vnd.wqd": {
+    "source": "iana",
+    "extensions": ["wqd"]
+  },
+  "application/vnd.wrq-hp3000-labelled": {
+    "source": "iana"
+  },
+  "application/vnd.wt.stf": {
+    "source": "iana",
+    "extensions": ["stf"]
+  },
+  "application/vnd.wv.csp+wbxml": {
+    "source": "iana"
+  },
+  "application/vnd.wv.csp+xml": {
+    "source": "iana",
+    "compressible": true
+  },
+  "application/vnd.wv.ssp+xml": {
+    "source": "iana",
+    "compressible": true
+  },
+  "application/vnd.xacml+json": {
+    "source": "iana",
+    "compressible": true
+  },
+  "application/vnd.xara": {
+    "source": "iana",
+    "extensions": ["xar"]
+  },
+  "application/vnd.xfdl": {
+    "source": "iana",
+    "extensions": ["xfdl"]
+  },
+  "application/vnd.xfdl.webform": {
+    "source": "iana"
+  },
+  "application/vnd.xmi+xml": {
+    "source": "iana",
+    "compressible": true
+  },
+  "application/vnd.xmpie.cpkg": {
+    "source": "iana"
+  },
+  "application/vnd.xmpie.dpkg": {
+    "source": "iana"
+  },
+  "application/vnd.xmpie.plan": {
+    "source": "iana"
+  },
+  "application/vnd.xmpie.ppkg": {
+    "source": "iana"
+  },
+  "application/vnd.xmpie.xlim": {
+    "source": "iana"
+  },
+  "application/vnd.yamaha.hv-dic": {
+    "source": "iana",
+    "extensions": ["hvd"]
+  },
+  "application/vnd.yamaha.hv-script": {
+    "source": "iana",
+    "extensions": ["hvs"]
+  },
+  "application/vnd.yamaha.hv-voice": {
+    "source": "iana",
+    "extensions": ["hvp"]
+  },
+  "application/vnd.yamaha.openscoreformat": {
+    "source": "iana",
+    "extensions": ["osf"]
+  },
+  "application/vnd.yamaha.openscoreformat.osfpvg+xml": {
+    "source": "iana",
+    "compressible": true,
+    "extensions": ["osfpvg"]
+  },
+  "application/vnd.yamaha.remote-setup": {
+    "source": "iana"
+  },
+  "application/vnd.yamaha.smaf-audio": {
+    "source": "iana",
+    "extensions": ["saf"]
+  },
+  "application/vnd.yamaha.smaf-phrase": {
+    "source": "iana",
+    "extensions": ["spf"]
+  },
+  "application/vnd.yamaha.through-ngn": {
+    "source": "iana"
+  },
+  "application/vnd.yamaha.tunnel-udpencap": {
+    "source": "iana"
+  },
+  "application/vnd.yaoweme": {
+    "source": "iana"
+  },
+  "application/vnd.yellowriver-custom-menu": {
+    "source": "iana",
+    "extensions": ["cmp"]
+  },
+  "application/vnd.youtube.yt": {
+    "source": "iana"
+  },
+  "application/vnd.zul": {
+    "source": "iana",
+    "extensions": ["zir","zirz"]
+  },
+  "application/vnd.zzazz.deck+xml": {
+    "source": "iana",
+    "compressible": true,
+    "extensions": ["zaz"]
+  },
+  "application/voicexml+xml": {
+    "source": "iana",
+    "compressible": true,
+    "extensions": ["vxml"]
+  },
+  "application/voucher-cms+json": {
+    "source": "iana",
+    "compressible": true
+  },
+  "application/vq-rtcpxr": {
+    "source": "iana"
+  },
+  "application/wasm": {
+    "source": "iana",
+    "compressible": true,
+    "extensions": ["wasm"]
+  },
+  "application/watcherinfo+xml": {
+    "source": "iana",
+    "compressible": true
+  },
+  "application/webpush-options+json": {
+    "source": "iana",
+    "compressible": true
+  },
+  "application/whoispp-query": {
+    "source": "iana"
+  },
+  "application/whoispp-response": {
+    "source": "iana"
+  },
+  "application/widget": {
+    "source": "iana",
+    "extensions": ["wgt"]
+  },
+  "application/winhlp": {
+    "source": "apache",
+    "extensions": ["hlp"]
+  },
+  "application/wita": {
+    "source": "iana"
+  },
+  "application/wordperfect5.1": {
+    "source": "iana"
+  },
+  "application/wsdl+xml": {
+    "source": "iana",
+    "compressible": true,
+    "extensions": ["wsdl"]
+  },
+  "application/wspolicy+xml": {
+    "source": "iana",
+    "compressible": true,
+    "extensions": ["wspolicy"]
+  },
+  "application/x-7z-compressed": {
+    "source": "apache",
+    "compressible": false,
+    "extensions": ["7z"]
+  },
+  "application/x-abiword": {
+    "source": "apache",
+    "extensions": ["abw"]
+  },
+  "application/x-ace-compressed": {
+    "source": "apache",
+    "extensions": ["ace"]
+  },
+  "application/x-amf": {
+    "source": "apache"
+  },
+  "application/x-apple-diskimage": {
+    "source": "apache",
+    "extensions": ["dmg"]
+  },
+  "application/x-arj": {
+    "compressible": false,
+    "extensions": ["arj"]
+  },
+  "application/x-authorware-bin": {
+    "source": "apache",
+    "extensions": ["aab","x32","u32","vox"]
+  },
+  "application/x-authorware-map": {
+    "source": "apache",
+    "extensions": ["aam"]
+  },
+  "application/x-authorware-seg": {
+    "source": "apache",
+    "extensions": ["aas"]
+  },
+  "application/x-bcpio": {
+    "source": "apache",
+    "extensions": ["bcpio"]
+  },
+  "application/x-bdoc": {
+    "compressible": false,
+    "extensions": ["bdoc"]
+  },
+  "application/x-bittorrent": {
+    "source": "apache",
+    "extensions": ["torrent"]
+  },
+  "application/x-blorb": {
+    "source": "apache",
+    "extensions": ["blb","blorb"]
+  },
+  "application/x-bzip": {
+    "source": "apache",
+    "compressible": false,
+    "extensions": ["bz"]
+  },
+  "application/x-bzip2": {
+    "source": "apache",
+    "compressible": false,
+    "extensions": ["bz2","boz"]
+  },
+  "application/x-cbr": {
+    "source": "apache",
+    "extensions": ["cbr","cba","cbt","cbz","cb7"]
+  },
+  "application/x-cdlink": {
+    "source": "apache",
+    "extensions": ["vcd"]
+  },
+  "application/x-cfs-compressed": {
+    "source": "apache",
+    "extensions": ["cfs"]
+  },
+  "application/x-chat": {
+    "source": "apache",
+    "extensions": ["chat"]
+  },
+  "application/x-chess-pgn": {
+    "source": "apache",
+    "extensions": ["pgn"]
+  },
+  "application/x-chrome-extension": {
+    "extensions": ["crx"]
+  },
+  "application/x-cocoa": {
+    "source": "nginx",
+    "extensions": ["cco"]
+  },
+  "application/x-compress": {
+    "source": "apache"
+  },
+  "application/x-conference": {
+    "source": "apache",
+    "extensions": ["nsc"]
+  },
+  "application/x-cpio": {
+    "source": "apache",
+    "extensions": ["cpio"]
+  },
+  "application/x-csh": {
+    "source": "apache",
+    "extensions": ["csh"]
+  },
+  "application/x-deb": {
+    "compressible": false
+  },
+  "application/x-debian-package": {
+    "source": "apache",
+    "extensions": ["deb","udeb"]
+  },
+  "application/x-dgc-compressed": {
+    "source": "apache",
+    "extensions": ["dgc"]
+  },
+  "application/x-director": {
+    "source": "apache",
+    "extensions": ["dir","dcr","dxr","cst","cct","cxt","w3d","fgd","swa"]
+  },
+  "application/x-doom": {
+    "source": "apache",
+    "extensions": ["wad"]
+  },
+  "application/x-dtbncx+xml": {
+    "source": "apache",
+    "compressible": true,
+    "extensions": ["ncx"]
+  },
+  "application/x-dtbook+xml": {
+    "source": "apache",
+    "compressible": true,
+    "extensions": ["dtb"]
+  },
+  "application/x-dtbresource+xml": {
+    "source": "apache",
+    "compressible": true,
+    "extensions": ["res"]
+  },
+  "application/x-dvi": {
+    "source": "apache",
+    "compressible": false,
+    "extensions": ["dvi"]
+  },
+  "application/x-envoy": {
+    "source": "apache",
+    "extensions": ["evy"]
+  },
+  "application/x-eva": {
+    "source": "apache",
+    "extensions": ["eva"]
+  },
+  "application/x-font-bdf": {
+    "source": "apache",
+    "extensions": ["bdf"]
+  },
+  "application/x-font-dos": {
+    "source": "apache"
+  },
+  "application/x-font-framemaker": {
+    "source": "apache"
+  },
+  "application/x-font-ghostscript": {
+    "source": "apache",
+    "extensions": ["gsf"]
+  },
+  "application/x-font-libgrx": {
+    "source": "apache"
+  },
+  "application/x-font-linux-psf": {
+    "source": "apache",
+    "extensions": ["psf"]
+  },
+  "application/x-font-pcf": {
+    "source": "apache",
+    "extensions": ["pcf"]
+  },
+  "application/x-font-snf": {
+    "source": "apache",
+    "extensions": ["snf"]
+  },
+  "application/x-font-speedo": {
+    "source": "apache"
+  },
+  "application/x-font-sunos-news": {
+    "source": "apache"
+  },
+  "application/x-font-type1": {
+    "source": "apache",
+    "extensions": ["pfa","pfb","pfm","afm"]
+  },
+  "application/x-font-vfont": {
+    "source": "apache"
+  },
+  "application/x-freearc": {
+    "source": "apache",
+    "extensions": ["arc"]
+  },
+  "application/x-futuresplash": {
+    "source": "apache",
+    "extensions": ["spl"]
+  },
+  "application/x-gca-compressed": {
+    "source": "apache",
+    "extensions": ["gca"]
+  },
+  "application/x-glulx": {
+    "source": "apache",
+    "extensions": ["ulx"]
+  },
+  "application/x-gnumeric": {
+    "source": "apache",
+    "extensions": ["gnumeric"]
+  },
+  "application/x-gramps-xml": {
+    "source": "apache",
+    "extensions": ["gramps"]
+  },
+  "application/x-gtar": {
+    "source": "apache",
+    "extensions": ["gtar"]
+  },
+  "application/x-gzip": {
+    "source": "apache"
+  },
+  "application/x-hdf": {
+    "source": "apache",
+    "extensions": ["hdf"]
+  },
+  "application/x-httpd-php": {
+    "compressible": true,
+    "extensions": ["php"]
+  },
+  "application/x-install-instructions": {
+    "source": "apache",
+    "extensions": ["install"]
+  },
+  "application/x-iso9660-image": {
+    "source": "apache",
+    "extensions": ["iso"]
+  },
+  "application/x-iwork-keynote-sffkey": {
+    "extensions": ["key"]
+  },
+  "application/x-iwork-numbers-sffnumbers": {
+    "extensions": ["numbers"]
+  },
+  "application/x-iwork-pages-sffpages": {
+    "extensions": ["pages"]
+  },
+  "application/x-java-archive-diff": {
+    "source": "nginx",
+    "extensions": ["jardiff"]
+  },
+  "application/x-java-jnlp-file": {
+    "source": "apache",
+    "compressible": false,
+    "extensions": ["jnlp"]
+  },
+  "application/x-javascript": {
+    "compressible": true
+  },
+  "application/x-keepass2": {
+    "extensions": ["kdbx"]
+  },
+  "application/x-latex": {
+    "source": "apache",
+    "compressible": false,
+    "extensions": ["latex"]
+  },
+  "application/x-lua-bytecode": {
+    "extensions": ["luac"]
+  },
+  "application/x-lzh-compressed": {
+    "source": "apache",
+    "extensions": ["lzh","lha"]
+  },
+  "application/x-makeself": {
+    "source": "nginx",
+    "extensions": ["run"]
+  },
+  "application/x-mie": {
+    "source": "apache",
+    "extensions": ["mie"]
+  },
+  "application/x-mobipocket-ebook": {
+    "source": "apache",
+    "extensions": ["prc","mobi"]
+  },
+  "application/x-mpegurl": {
+    "compressible": false
+  },
+  "application/x-ms-application": {
+    "source": "apache",
+    "extensions": ["application"]
+  },
+  "application/x-ms-shortcut": {
+    "source": "apache",
+    "extensions": ["lnk"]
+  },
+  "application/x-ms-wmd": {
+    "source": "apache",
+    "extensions": ["wmd"]
+  },
+  "application/x-ms-wmz": {
+    "source": "apache",
+    "extensions": ["wmz"]
+  },
+  "application/x-ms-xbap": {
+    "source": "apache",
+    "extensions": ["xbap"]
+  },
+  "application/x-msaccess": {
+    "source": "apache",
+    "extensions": ["mdb"]
+  },
+  "application/x-msbinder": {
+    "source": "apache",
+    "extensions": ["obd"]
+  },
+  "application/x-mscardfile": {
+    "source": "apache",
+    "extensions": ["crd"]
+  },
+  "application/x-msclip": {
+    "source": "apache",
+    "extensions": ["clp"]
+  },
+  "application/x-msdos-program": {
+    "extensions": ["exe"]
+  },
+  "application/x-msdownload": {
+    "source": "apache",
+    "extensions": ["exe","dll","com","bat","msi"]
+  },
+  "application/x-msmediaview": {
+    "source": "apache",
+    "extensions": ["mvb","m13","m14"]
+  },
+  "application/x-msmetafile": {
+    "source": "apache",
+    "extensions": ["wmf","wmz","emf","emz"]
+  },
+  "application/x-msmoney": {
+    "source": "apache",
+    "extensions": ["mny"]
+  },
+  "application/x-mspublisher": {
+    "source": "apache",
+    "extensions": ["pub"]
+  },
+  "application/x-msschedule": {
+    "source": "apache",
+    "extensions": ["scd"]
+  },
+  "application/x-msterminal": {
+    "source": "apache",
+    "extensions": ["trm"]
+  },
+  "application/x-mswrite": {
+    "source": "apache",
+    "extensions": ["wri"]
+  },
+  "application/x-netcdf": {
+    "source": "apache",
+    "extensions": ["nc","cdf"]
+  },
+  "application/x-ns-proxy-autoconfig": {
+    "compressible": true,
+    "extensions": ["pac"]
+  },
+  "application/x-nzb": {
+    "source": "apache",
+    "extensions": ["nzb"]
+  },
+  "application/x-perl": {
+    "source": "nginx",
+    "extensions": ["pl","pm"]
+  },
+  "application/x-pilot": {
+    "source": "nginx",
+    "extensions": ["prc","pdb"]
+  },
+  "application/x-pkcs12": {
+    "source": "apache",
+    "compressible": false,
+    "extensions": ["p12","pfx"]
+  },
+  "application/x-pkcs7-certificates": {
+    "source": "apache",
+    "extensions": ["p7b","spc"]
+  },
+  "application/x-pkcs7-certreqresp": {
+    "source": "apache",
+    "extensions": ["p7r"]
+  },
+  "application/x-pki-message": {
+    "source": "iana"
+  },
+  "application/x-rar-compressed": {
+    "source": "apache",
+    "compressible": false,
+    "extensions": ["rar"]
+  },
+  "application/x-redhat-package-manager": {
+    "source": "nginx",
+    "extensions": ["rpm"]
+  },
+  "application/x-research-info-systems": {
+    "source": "apache",
+    "extensions": ["ris"]
+  },
+  "application/x-sea": {
+    "source": "nginx",
+    "extensions": ["sea"]
+  },
+  "application/x-sh": {
+    "source": "apache",
+    "compressible": true,
+    "extensions": ["sh"]
+  },
+  "application/x-shar": {
+    "source": "apache",
+    "extensions": ["shar"]
+  },
+  "application/x-shockwave-flash": {
+    "source": "apache",
+    "compressible": false,
+    "extensions": ["swf"]
+  },
+  "application/x-silverlight-app": {
+    "source": "apache",
+    "extensions": ["xap"]
+  },
+  "application/x-sql": {
+    "source": "apache",
+    "extensions": ["sql"]
+  },
+  "application/x-stuffit": {
+    "source": "apache",
+    "compressible": false,
+    "extensions": ["sit"]
+  },
+  "application/x-stuffitx": {
+    "source": "apache",
+    "extensions": ["sitx"]
+  },
+  "application/x-subrip": {
+    "source": "apache",
+    "extensions": ["srt"]
+  },
+  "application/x-sv4cpio": {
+    "source": "apache",
+    "extensions": ["sv4cpio"]
+  },
+  "application/x-sv4crc": {
+    "source": "apache",
+    "extensions": ["sv4crc"]
+  },
+  "application/x-t3vm-image": {
+    "source": "apache",
+    "extensions": ["t3"]
+  },
+  "application/x-tads": {
+    "source": "apache",
+    "extensions": ["gam"]
+  },
+  "application/x-tar": {
+    "source": "apache",
+    "compressible": true,
+    "extensions": ["tar"]
+  },
+  "application/x-tcl": {
+    "source": "apache",
+    "extensions": ["tcl","tk"]
+  },
+  "application/x-tex": {
+    "source": "apache",
+    "extensions": ["tex"]
+  },
+  "application/x-tex-tfm": {
+    "source": "apache",
+    "extensions": ["tfm"]
+  },
+  "application/x-texinfo": {
+    "source": "apache",
+    "extensions": ["texinfo","texi"]
+  },
+  "application/x-tgif": {
+    "source": "apache",
+    "extensions": ["obj"]
+  },
+  "application/x-ustar": {
+    "source": "apache",
+    "extensions": ["ustar"]
+  },
+  "application/x-virtualbox-hdd": {
+    "compressible": true,
+    "extensions": ["hdd"]
+  },
+  "application/x-virtualbox-ova": {
+    "compressible": true,
+    "extensions": ["ova"]
+  },
+  "application/x-virtualbox-ovf": {
+    "compressible": true,
+    "extensions": ["ovf"]
+  },
+  "application/x-virtualbox-vbox": {
+    "compressible": true,
+    "extensions": ["vbox"]
+  },
+  "application/x-virtualbox-vbox-extpack": {
+    "compressible": false,
+    "extensions": ["vbox-extpack"]
+  },
+  "application/x-virtualbox-vdi": {
+    "compressible": true,
+    "extensions": ["vdi"]
+  },
+  "application/x-virtualbox-vhd": {
+    "compressible": true,
+    "extensions": ["vhd"]
+  },
+  "application/x-virtualbox-vmdk": {
+    "compressible": true,
+    "extensions": ["vmdk"]
+  },
+  "application/x-wais-source": {
+    "source": "apache",
+    "extensions": ["src"]
+  },
+  "application/x-web-app-manifest+json": {
+    "compressible": true,
+    "extensions": ["webapp"]
+  },
+  "application/x-www-form-urlencoded": {
+    "source": "iana",
+    "compressible": true
+  },
+  "application/x-x509-ca-cert": {
+    "source": "iana",
+    "extensions": ["der","crt","pem"]
+  },
+  "application/x-x509-ca-ra-cert": {
+    "source": "iana"
+  },
+  "application/x-x509-next-ca-cert": {
+    "source": "iana"
+  },
+  "application/x-xfig": {
+    "source": "apache",
+    "extensions": ["fig"]
+  },
+  "application/x-xliff+xml": {
+    "source": "apache",
+    "compressible": true,
+    "extensions": ["xlf"]
+  },
+  "application/x-xpinstall": {
+    "source": "apache",
+    "compressible": false,
+    "extensions": ["xpi"]
+  },
+  "application/x-xz": {
+    "source": "apache",
+    "extensions": ["xz"]
+  },
+  "application/x-zmachine": {
+    "source": "apache",
+    "extensions": ["z1","z2","z3","z4","z5","z6","z7","z8"]
+  },
+  "application/x400-bp": {
+    "source": "iana"
+  },
+  "application/xacml+xml": {
+    "source": "iana",
+    "compressible": true
+  },
+  "application/xaml+xml": {
+    "source": "apache",
+    "compressible": true,
+    "extensions": ["xaml"]
+  },
+  "application/xcap-att+xml": {
+    "source": "iana",
+    "compressible": true,
+    "extensions": ["xav"]
+  },
+  "application/xcap-caps+xml": {
+    "source": "iana",
+    "compressible": true,
+    "extensions": ["xca"]
+  },
+  "application/xcap-diff+xml": {
+    "source": "iana",
+    "compressible": true,
+    "extensions": ["xdf"]
+  },
+  "application/xcap-el+xml": {
+    "source": "iana",
+    "compressible": true,
+    "extensions": ["xel"]
+  },
+  "application/xcap-error+xml": {
+    "source": "iana",
+    "compressible": true
+  },
+  "application/xcap-ns+xml": {
+    "source": "iana",
+    "compressible": true,
+    "extensions": ["xns"]
+  },
+  "application/xcon-conference-info+xml": {
+    "source": "iana",
+    "compressible": true
+  },
+  "application/xcon-conference-info-diff+xml": {
+    "source": "iana",
+    "compressible": true
+  },
+  "application/xenc+xml": {
+    "source": "iana",
+    "compressible": true,
+    "extensions": ["xenc"]
+  },
+  "application/xhtml+xml": {
+    "source": "iana",
+    "compressible": true,
+    "extensions": ["xhtml","xht"]
+  },
+  "application/xhtml-voice+xml": {
+    "source": "apache",
+    "compressible": true
+  },
+  "application/xliff+xml": {
+    "source": "iana",
+    "compressible": true,
+    "extensions": ["xlf"]
+  },
+  "application/xml": {
+    "source": "iana",
+    "compressible": true,
+    "extensions": ["xml","xsl","xsd","rng"]
+  },
+  "application/xml-dtd": {
+    "source": "iana",
+    "compressible": true,
+    "extensions": ["dtd"]
+  },
+  "application/xml-external-parsed-entity": {
+    "source": "iana"
+  },
+  "application/xml-patch+xml": {
+    "source": "iana",
+    "compressible": true
+  },
+  "application/xmpp+xml": {
+    "source": "iana",
+    "compressible": true
+  },
+  "application/xop+xml": {
+    "source": "iana",
+    "compressible": true,
+    "extensions": ["xop"]
+  },
+  "application/xproc+xml": {
+    "source": "apache",
+    "compressible": true,
+    "extensions": ["xpl"]
+  },
+  "application/xslt+xml": {
+    "source": "iana",
+    "compressible": true,
+    "extensions": ["xsl","xslt"]
+  },
+  "application/xspf+xml": {
+    "source": "apache",
+    "compressible": true,
+    "extensions": ["xspf"]
+  },
+  "application/xv+xml": {
+    "source": "iana",
+    "compressible": true,
+    "extensions": ["mxml","xhvml","xvml","xvm"]
+  },
+  "application/yang": {
+    "source": "iana",
+    "extensions": ["yang"]
+  },
+  "application/yang-data+json": {
+    "source": "iana",
+    "compressible": true
+  },
+  "application/yang-data+xml": {
+    "source": "iana",
+    "compressible": true
+  },
+  "application/yang-patch+json": {
+    "source": "iana",
+    "compressible": true
+  },
+  "application/yang-patch+xml": {
+    "source": "iana",
+    "compressible": true
+  },
+  "application/yin+xml": {
+    "source": "iana",
+    "compressible": true,
+    "extensions": ["yin"]
+  },
+  "application/zip": {
+    "source": "iana",
+    "compressible": false,
+    "extensions": ["zip"]
+  },
+  "application/zlib": {
+    "source": "iana"
+  },
+  "application/zstd": {
+    "source": "iana"
+  },
+  "audio/1d-interleaved-parityfec": {
+    "source": "iana"
+  },
+  "audio/32kadpcm": {
+    "source": "iana"
+  },
+  "audio/3gpp": {
+    "source": "iana",
+    "compressible": false,
+    "extensions": ["3gpp"]
+  },
+  "audio/3gpp2": {
+    "source": "iana"
+  },
+  "audio/aac": {
+    "source": "iana"
+  },
+  "audio/ac3": {
+    "source": "iana"
+  },
+  "audio/adpcm": {
+    "source": "apache",
+    "extensions": ["adp"]
+  },
+  "audio/amr": {
+    "source": "iana",
+    "extensions": ["amr"]
+  },
+  "audio/amr-wb": {
+    "source": "iana"
+  },
+  "audio/amr-wb+": {
+    "source": "iana"
+  },
+  "audio/aptx": {
+    "source": "iana"
+  },
+  "audio/asc": {
+    "source": "iana"
+  },
+  "audio/atrac-advanced-lossless": {
+    "source": "iana"
+  },
+  "audio/atrac-x": {
+    "source": "iana"
+  },
+  "audio/atrac3": {
+    "source": "iana"
+  },
+  "audio/basic": {
+    "source": "iana",
+    "compressible": false,
+    "extensions": ["au","snd"]
+  },
+  "audio/bv16": {
+    "source": "iana"
+  },
+  "audio/bv32": {
+    "source": "iana"
+  },
+  "audio/clearmode": {
+    "source": "iana"
+  },
+  "audio/cn": {
+    "source": "iana"
+  },
+  "audio/dat12": {
+    "source": "iana"
+  },
+  "audio/dls": {
+    "source": "iana"
+  },
+  "audio/dsr-es201108": {
+    "source": "iana"
+  },
+  "audio/dsr-es202050": {
+    "source": "iana"
+  },
+  "audio/dsr-es202211": {
+    "source": "iana"
+  },
+  "audio/dsr-es202212": {
+    "source": "iana"
+  },
+  "audio/dv": {
+    "source": "iana"
+  },
+  "audio/dvi4": {
+    "source": "iana"
+  },
+  "audio/eac3": {
+    "source": "iana"
+  },
+  "audio/encaprtp": {
+    "source": "iana"
+  },
+  "audio/evrc": {
+    "source": "iana"
+  },
+  "audio/evrc-qcp": {
+    "source": "iana"
+  },
+  "audio/evrc0": {
+    "source": "iana"
+  },
+  "audio/evrc1": {
+    "source": "iana"
+  },
+  "audio/evrcb": {
+    "source": "iana"
+  },
+  "audio/evrcb0": {
+    "source": "iana"
+  },
+  "audio/evrcb1": {
+    "source": "iana"
+  },
+  "audio/evrcnw": {
+    "source": "iana"
+  },
+  "audio/evrcnw0": {
+    "source": "iana"
+  },
+  "audio/evrcnw1": {
+    "source": "iana"
+  },
+  "audio/evrcwb": {
+    "source": "iana"
+  },
+  "audio/evrcwb0": {
+    "source": "iana"
+  },
+  "audio/evrcwb1": {
+    "source": "iana"
+  },
+  "audio/evs": {
+    "source": "iana"
+  },
+  "audio/flexfec": {
+    "source": "iana"
+  },
+  "audio/fwdred": {
+    "source": "iana"
+  },
+  "audio/g711-0": {
+    "source": "iana"
+  },
+  "audio/g719": {
+    "source": "iana"
+  },
+  "audio/g722": {
+    "source": "iana"
+  },
+  "audio/g7221": {
+    "source": "iana"
+  },
+  "audio/g723": {
+    "source": "iana"
+  },
+  "audio/g726-16": {
+    "source": "iana"
+  },
+  "audio/g726-24": {
+    "source": "iana"
+  },
+  "audio/g726-32": {
+    "source": "iana"
+  },
+  "audio/g726-40": {
+    "source": "iana"
+  },
+  "audio/g728": {
+    "source": "iana"
+  },
+  "audio/g729": {
+    "source": "iana"
+  },
+  "audio/g7291": {
+    "source": "iana"
+  },
+  "audio/g729d": {
+    "source": "iana"
+  },
+  "audio/g729e": {
+    "source": "iana"
+  },
+  "audio/gsm": {
+    "source": "iana"
+  },
+  "audio/gsm-efr": {
+    "source": "iana"
+  },
+  "audio/gsm-hr-08": {
+    "source": "iana"
+  },
+  "audio/ilbc": {
+    "source": "iana"
+  },
+  "audio/ip-mr_v2.5": {
+    "source": "iana"
+  },
+  "audio/isac": {
+    "source": "apache"
+  },
+  "audio/l16": {
+    "source": "iana"
+  },
+  "audio/l20": {
+    "source": "iana"
+  },
+  "audio/l24": {
+    "source": "iana",
+    "compressible": false
+  },
+  "audio/l8": {
+    "source": "iana"
+  },
+  "audio/lpc": {
+    "source": "iana"
+  },
+  "audio/melp": {
+    "source": "iana"
+  },
+  "audio/melp1200": {
+    "source": "iana"
+  },
+  "audio/melp2400": {
+    "source": "iana"
+  },
+  "audio/melp600": {
+    "source": "iana"
+  },
+  "audio/mhas": {
+    "source": "iana"
+  },
+  "audio/midi": {
+    "source": "apache",
+    "extensions": ["mid","midi","kar","rmi"]
+  },
+  "audio/mobile-xmf": {
+    "source": "iana",
+    "extensions": ["mxmf"]
+  },
+  "audio/mp3": {
+    "compressible": false,
+    "extensions": ["mp3"]
+  },
+  "audio/mp4": {
+    "source": "iana",
+    "compressible": false,
+    "extensions": ["m4a","mp4a"]
+  },
+  "audio/mp4a-latm": {
+    "source": "iana"
+  },
+  "audio/mpa": {
+    "source": "iana"
+  },
+  "audio/mpa-robust": {
+    "source": "iana"
+  },
+  "audio/mpeg": {
+    "source": "iana",
+    "compressible": false,
+    "extensions": ["mpga","mp2","mp2a","mp3","m2a","m3a"]
+  },
+  "audio/mpeg4-generic": {
+    "source": "iana"
+  },
+  "audio/musepack": {
+    "source": "apache"
+  },
+  "audio/ogg": {
+    "source": "iana",
+    "compressible": false,
+    "extensions": ["oga","ogg","spx","opus"]
+  },
+  "audio/opus": {
+    "source": "iana"
+  },
+  "audio/parityfec": {
+    "source": "iana"
+  },
+  "audio/pcma": {
+    "source": "iana"
+  },
+  "audio/pcma-wb": {
+    "source": "iana"
+  },
+  "audio/pcmu": {
+    "source": "iana"
+  },
+  "audio/pcmu-wb": {
+    "source": "iana"
+  },
+  "audio/prs.sid": {
+    "source": "iana"
+  },
+  "audio/qcelp": {
+    "source": "iana"
+  },
+  "audio/raptorfec": {
+    "source": "iana"
+  },
+  "audio/red": {
+    "source": "iana"
+  },
+  "audio/rtp-enc-aescm128": {
+    "source": "iana"
+  },
+  "audio/rtp-midi": {
+    "source": "iana"
+  },
+  "audio/rtploopback": {
+    "source": "iana"
+  },
+  "audio/rtx": {
+    "source": "iana"
+  },
+  "audio/s3m": {
+    "source": "apache",
+    "extensions": ["s3m"]
+  },
+  "audio/scip": {
+    "source": "iana"
+  },
+  "audio/silk": {
+    "source": "apache",
+    "extensions": ["sil"]
+  },
+  "audio/smv": {
+    "source": "iana"
+  },
+  "audio/smv-qcp": {
+    "source": "iana"
+  },
+  "audio/smv0": {
+    "source": "iana"
+  },
+  "audio/sofa": {
+    "source": "iana"
+  },
+  "audio/sp-midi": {
+    "source": "iana"
+  },
+  "audio/speex": {
+    "source": "iana"
+  },
+  "audio/t140c": {
+    "source": "iana"
+  },
+  "audio/t38": {
+    "source": "iana"
+  },
+  "audio/telephone-event": {
+    "source": "iana"
+  },
+  "audio/tetra_acelp": {
+    "source": "iana"
+  },
+  "audio/tetra_acelp_bb": {
+    "source": "iana"
+  },
+  "audio/tone": {
+    "source": "iana"
+  },
+  "audio/tsvcis": {
+    "source": "iana"
+  },
+  "audio/uemclip": {
+    "source": "iana"
+  },
+  "audio/ulpfec": {
+    "source": "iana"
+  },
+  "audio/usac": {
+    "source": "iana"
+  },
+  "audio/vdvi": {
+    "source": "iana"
+  },
+  "audio/vmr-wb": {
+    "source": "iana"
+  },
+  "audio/vnd.3gpp.iufp": {
+    "source": "iana"
+  },
+  "audio/vnd.4sb": {
+    "source": "iana"
+  },
+  "audio/vnd.audiokoz": {
+    "source": "iana"
+  },
+  "audio/vnd.celp": {
+    "source": "iana"
+  },
+  "audio/vnd.cisco.nse": {
+    "source": "iana"
+  },
+  "audio/vnd.cmles.radio-events": {
+    "source": "iana"
+  },
+  "audio/vnd.cns.anp1": {
+    "source": "iana"
+  },
+  "audio/vnd.cns.inf1": {
+    "source": "iana"
+  },
+  "audio/vnd.dece.audio": {
+    "source": "iana",
+    "extensions": ["uva","uvva"]
+  },
+  "audio/vnd.digital-winds": {
+    "source": "iana",
+    "extensions": ["eol"]
+  },
+  "audio/vnd.dlna.adts": {
+    "source": "iana"
+  },
+  "audio/vnd.dolby.heaac.1": {
+    "source": "iana"
+  },
+  "audio/vnd.dolby.heaac.2": {
+    "source": "iana"
+  },
+  "audio/vnd.dolby.mlp": {
+    "source": "iana"
+  },
+  "audio/vnd.dolby.mps": {
+    "source": "iana"
+  },
+  "audio/vnd.dolby.pl2": {
+    "source": "iana"
+  },
+  "audio/vnd.dolby.pl2x": {
+    "source": "iana"
+  },
+  "audio/vnd.dolby.pl2z": {
+    "source": "iana"
+  },
+  "audio/vnd.dolby.pulse.1": {
+    "source": "iana"
+  },
+  "audio/vnd.dra": {
+    "source": "iana",
+    "extensions": ["dra"]
+  },
+  "audio/vnd.dts": {
+    "source": "iana",
+    "extensions": ["dts"]
+  },
+  "audio/vnd.dts.hd": {
+    "source": "iana",
+    "extensions": ["dtshd"]
+  },
+  "audio/vnd.dts.uhd": {
+    "source": "iana"
+  },
+  "audio/vnd.dvb.file": {
+    "source": "iana"
+  },
+  "audio/vnd.everad.plj": {
+    "source": "iana"
+  },
+  "audio/vnd.hns.audio": {
+    "source": "iana"
+  },
+  "audio/vnd.lucent.voice": {
+    "source": "iana",
+    "extensions": ["lvp"]
+  },
+  "audio/vnd.ms-playready.media.pya": {
+    "source": "iana",
+    "extensions": ["pya"]
+  },
+  "audio/vnd.nokia.mobile-xmf": {
+    "source": "iana"
+  },
+  "audio/vnd.nortel.vbk": {
+    "source": "iana"
+  },
+  "audio/vnd.nuera.ecelp4800": {
+    "source": "iana",
+    "extensions": ["ecelp4800"]
+  },
+  "audio/vnd.nuera.ecelp7470": {
+    "source": "iana",
+    "extensions": ["ecelp7470"]
+  },
+  "audio/vnd.nuera.ecelp9600": {
+    "source": "iana",
+    "extensions": ["ecelp9600"]
+  },
+  "audio/vnd.octel.sbc": {
+    "source": "iana"
+  },
+  "audio/vnd.presonus.multitrack": {
+    "source": "iana"
+  },
+  "audio/vnd.qcelp": {
+    "source": "iana"
+  },
+  "audio/vnd.rhetorex.32kadpcm": {
+    "source": "iana"
+  },
+  "audio/vnd.rip": {
+    "source": "iana",
+    "extensions": ["rip"]
+  },
+  "audio/vnd.rn-realaudio": {
+    "compressible": false
+  },
+  "audio/vnd.sealedmedia.softseal.mpeg": {
+    "source": "iana"
+  },
+  "audio/vnd.vmx.cvsd": {
+    "source": "iana"
+  },
+  "audio/vnd.wave": {
+    "compressible": false
+  },
+  "audio/vorbis": {
+    "source": "iana",
+    "compressible": false
+  },
+  "audio/vorbis-config": {
+    "source": "iana"
+  },
+  "audio/wav": {
+    "compressible": false,
+    "extensions": ["wav"]
+  },
+  "audio/wave": {
+    "compressible": false,
+    "extensions": ["wav"]
+  },
+  "audio/webm": {
+    "source": "apache",
+    "compressible": false,
+    "extensions": ["weba"]
+  },
+  "audio/x-aac": {
+    "source": "apache",
+    "compressible": false,
+    "extensions": ["aac"]
+  },
+  "audio/x-aiff": {
+    "source": "apache",
+    "extensions": ["aif","aiff","aifc"]
+  },
+  "audio/x-caf": {
+    "source": "apache",
+    "compressible": false,
+    "extensions": ["caf"]
+  },
+  "audio/x-flac": {
+    "source": "apache",
+    "extensions": ["flac"]
+  },
+  "audio/x-m4a": {
+    "source": "nginx",
+    "extensions": ["m4a"]
+  },
+  "audio/x-matroska": {
+    "source": "apache",
+    "extensions": ["mka"]
+  },
+  "audio/x-mpegurl": {
+    "source": "apache",
+    "extensions": ["m3u"]
+  },
+  "audio/x-ms-wax": {
+    "source": "apache",
+    "extensions": ["wax"]
+  },
+  "audio/x-ms-wma": {
+    "source": "apache",
+    "extensions": ["wma"]
+  },
+  "audio/x-pn-realaudio": {
+    "source": "apache",
+    "extensions": ["ram","ra"]
+  },
+  "audio/x-pn-realaudio-plugin": {
+    "source": "apache",
+    "extensions": ["rmp"]
+  },
+  "audio/x-realaudio": {
+    "source": "nginx",
+    "extensions": ["ra"]
+  },
+  "audio/x-tta": {
+    "source": "apache"
+  },
+  "audio/x-wav": {
+    "source": "apache",
+    "extensions": ["wav"]
+  },
+  "audio/xm": {
+    "source": "apache",
+    "extensions": ["xm"]
+  },
+  "chemical/x-cdx": {
+    "source": "apache",
+    "extensions": ["cdx"]
+  },
+  "chemical/x-cif": {
+    "source": "apache",
+    "extensions": ["cif"]
+  },
+  "chemical/x-cmdf": {
+    "source": "apache",
+    "extensions": ["cmdf"]
+  },
+  "chemical/x-cml": {
+    "source": "apache",
+    "extensions": ["cml"]
+  },
+  "chemical/x-csml": {
+    "source": "apache",
+    "extensions": ["csml"]
+  },
+  "chemical/x-pdb": {
+    "source": "apache"
+  },
+  "chemical/x-xyz": {
+    "source": "apache",
+    "extensions": ["xyz"]
+  },
+  "font/collection": {
+    "source": "iana",
+    "extensions": ["ttc"]
+  },
+  "font/otf": {
+    "source": "iana",
+    "compressible": true,
+    "extensions": ["otf"]
+  },
+  "font/sfnt": {
+    "source": "iana"
+  },
+  "font/ttf": {
+    "source": "iana",
+    "compressible": true,
+    "extensions": ["ttf"]
+  },
+  "font/woff": {
+    "source": "iana",
+    "extensions": ["woff"]
+  },
+  "font/woff2": {
+    "source": "iana",
+    "extensions": ["woff2"]
+  },
+  "image/aces": {
+    "source": "iana",
+    "extensions": ["exr"]
+  },
+  "image/apng": {
+    "compressible": false,
+    "extensions": ["apng"]
+  },
+  "image/avci": {
+    "source": "iana"
+  },
+  "image/avcs": {
+    "source": "iana"
+  },
+  "image/avif": {
+    "source": "iana",
+    "compressible": false,
+    "extensions": ["avif"]
+  },
+  "image/bmp": {
+    "source": "iana",
+    "compressible": true,
+    "extensions": ["bmp"]
+  },
+  "image/cgm": {
+    "source": "iana",
+    "extensions": ["cgm"]
+  },
+  "image/dicom-rle": {
+    "source": "iana",
+    "extensions": ["drle"]
+  },
+  "image/emf": {
+    "source": "iana",
+    "extensions": ["emf"]
+  },
+  "image/fits": {
+    "source": "iana",
+    "extensions": ["fits"]
+  },
+  "image/g3fax": {
+    "source": "iana",
+    "extensions": ["g3"]
+  },
+  "image/gif": {
+    "source": "iana",
+    "compressible": false,
+    "extensions": ["gif"]
+  },
+  "image/heic": {
+    "source": "iana",
+    "extensions": ["heic"]
+  },
+  "image/heic-sequence": {
+    "source": "iana",
+    "extensions": ["heics"]
+  },
+  "image/heif": {
+    "source": "iana",
+    "extensions": ["heif"]
+  },
+  "image/heif-sequence": {
+    "source": "iana",
+    "extensions": ["heifs"]
+  },
+  "image/hej2k": {
+    "source": "iana",
+    "extensions": ["hej2"]
+  },
+  "image/hsj2": {
+    "source": "iana",
+    "extensions": ["hsj2"]
+  },
+  "image/ief": {
+    "source": "iana",
+    "extensions": ["ief"]
+  },
+  "image/jls": {
+    "source": "iana",
+    "extensions": ["jls"]
+  },
+  "image/jp2": {
+    "source": "iana",
+    "compressible": false,
+    "extensions": ["jp2","jpg2"]
+  },
+  "image/jpeg": {
+    "source": "iana",
+    "compressible": false,
+    "extensions": ["jpeg","jpg","jpe"]
+  },
+  "image/jph": {
+    "source": "iana",
+    "extensions": ["jph"]
+  },
+  "image/jphc": {
+    "source": "iana",
+    "extensions": ["jhc"]
+  },
+  "image/jpm": {
+    "source": "iana",
+    "compressible": false,
+    "extensions": ["jpm"]
+  },
+  "image/jpx": {
+    "source": "iana",
+    "compressible": false,
+    "extensions": ["jpx","jpf"]
+  },
+  "image/jxr": {
+    "source": "iana",
+    "extensions": ["jxr"]
+  },
+  "image/jxra": {
+    "source": "iana",
+    "extensions": ["jxra"]
+  },
+  "image/jxrs": {
+    "source": "iana",
+    "extensions": ["jxrs"]
+  },
+  "image/jxs": {
+    "source": "iana",
+    "extensions": ["jxs"]
+  },
+  "image/jxsc": {
+    "source": "iana",
+    "extensions": ["jxsc"]
+  },
+  "image/jxsi": {
+    "source": "iana",
+    "extensions": ["jxsi"]
+  },
+  "image/jxss": {
+    "source": "iana",
+    "extensions": ["jxss"]
+  },
+  "image/ktx": {
+    "source": "iana",
+    "extensions": ["ktx"]
+  },
+  "image/ktx2": {
+    "source": "iana",
+    "extensions": ["ktx2"]
+  },
+  "image/naplps": {
+    "source": "iana"
+  },
+  "image/pjpeg": {
+    "compressible": false
+  },
+  "image/png": {
+    "source": "iana",
+    "compressible": false,
+    "extensions": ["png"]
+  },
+  "image/prs.btif": {
+    "source": "iana",
+    "extensions": ["btif"]
+  },
+  "image/prs.pti": {
+    "source": "iana",
+    "extensions": ["pti"]
+  },
+  "image/pwg-raster": {
+    "source": "iana"
+  },
+  "image/sgi": {
+    "source": "apache",
+    "extensions": ["sgi"]
+  },
+  "image/svg+xml": {
+    "source": "iana",
+    "compressible": true,
+    "extensions": ["svg","svgz"]
+  },
+  "image/t38": {
+    "source": "iana",
+    "extensions": ["t38"]
+  },
+  "image/tiff": {
+    "source": "iana",
+    "compressible": false,
+    "extensions": ["tif","tiff"]
+  },
+  "image/tiff-fx": {
+    "source": "iana",
+    "extensions": ["tfx"]
+  },
+  "image/vnd.adobe.photoshop": {
+    "source": "iana",
+    "compressible": true,
+    "extensions": ["psd"]
+  },
+  "image/vnd.airzip.accelerator.azv": {
+    "source": "iana",
+    "extensions": ["azv"]
+  },
+  "image/vnd.cns.inf2": {
+    "source": "iana"
+  },
+  "image/vnd.dece.graphic": {
+    "source": "iana",
+    "extensions": ["uvi","uvvi","uvg","uvvg"]
+  },
+  "image/vnd.djvu": {
+    "source": "iana",
+    "extensions": ["djvu","djv"]
+  },
+  "image/vnd.dvb.subtitle": {
+    "source": "iana",
+    "extensions": ["sub"]
+  },
+  "image/vnd.dwg": {
+    "source": "iana",
+    "extensions": ["dwg"]
+  },
+  "image/vnd.dxf": {
+    "source": "iana",
+    "extensions": ["dxf"]
+  },
+  "image/vnd.fastbidsheet": {
+    "source": "iana",
+    "extensions": ["fbs"]
+  },
+  "image/vnd.fpx": {
+    "source": "iana",
+    "extensions": ["fpx"]
+  },
+  "image/vnd.fst": {
+    "source": "iana",
+    "extensions": ["fst"]
+  },
+  "image/vnd.fujixerox.edmics-mmr": {
+    "source": "iana",
+    "extensions": ["mmr"]
+  },
+  "image/vnd.fujixerox.edmics-rlc": {
+    "source": "iana",
+    "extensions": ["rlc"]
+  },
+  "image/vnd.globalgraphics.pgb": {
+    "source": "iana"
+  },
+  "image/vnd.microsoft.icon": {
+    "source": "iana",
+    "extensions": ["ico"]
+  },
+  "image/vnd.mix": {
+    "source": "iana"
+  },
+  "image/vnd.mozilla.apng": {
+    "source": "iana"
+  },
+  "image/vnd.ms-dds": {
+    "extensions": ["dds"]
+  },
+  "image/vnd.ms-modi": {
+    "source": "iana",
+    "extensions": ["mdi"]
+  },
+  "image/vnd.ms-photo": {
+    "source": "apache",
+    "extensions": ["wdp"]
+  },
+  "image/vnd.net-fpx": {
+    "source": "iana",
+    "extensions": ["npx"]
+  },
+  "image/vnd.pco.b16": {
+    "source": "iana",
+    "extensions": ["b16"]
+  },
+  "image/vnd.radiance": {
+    "source": "iana"
+  },
+  "image/vnd.sealed.png": {
+    "source": "iana"
+  },
+  "image/vnd.sealedmedia.softseal.gif": {
+    "source": "iana"
+  },
+  "image/vnd.sealedmedia.softseal.jpg": {
+    "source": "iana"
+  },
+  "image/vnd.svf": {
+    "source": "iana"
+  },
+  "image/vnd.tencent.tap": {
+    "source": "iana",
+    "extensions": ["tap"]
+  },
+  "image/vnd.valve.source.texture": {
+    "source": "iana",
+    "extensions": ["vtf"]
+  },
+  "image/vnd.wap.wbmp": {
+    "source": "iana",
+    "extensions": ["wbmp"]
+  },
+  "image/vnd.xiff": {
+    "source": "iana",
+    "extensions": ["xif"]
+  },
+  "image/vnd.zbrush.pcx": {
+    "source": "iana",
+    "extensions": ["pcx"]
+  },
+  "image/webp": {
+    "source": "apache",
+    "extensions": ["webp"]
+  },
+  "image/wmf": {
+    "source": "iana",
+    "extensions": ["wmf"]
+  },
+  "image/x-3ds": {
+    "source": "apache",
+    "extensions": ["3ds"]
+  },
+  "image/x-cmu-raster": {
+    "source": "apache",
+    "extensions": ["ras"]
+  },
+  "image/x-cmx": {
+    "source": "apache",
+    "extensions": ["cmx"]
+  },
+  "image/x-freehand": {
+    "source": "apache",
+    "extensions": ["fh","fhc","fh4","fh5","fh7"]
+  },
+  "image/x-icon": {
+    "source": "apache",
+    "compressible": true,
+    "extensions": ["ico"]
+  },
+  "image/x-jng": {
+    "source": "nginx",
+    "extensions": ["jng"]
+  },
+  "image/x-mrsid-image": {
+    "source": "apache",
+    "extensions": ["sid"]
+  },
+  "image/x-ms-bmp": {
+    "source": "nginx",
+    "compressible": true,
+    "extensions": ["bmp"]
+  },
+  "image/x-pcx": {
+    "source": "apache",
+    "extensions": ["pcx"]
+  },
+  "image/x-pict": {
+    "source": "apache",
+    "extensions": ["pic","pct"]
+  },
+  "image/x-portable-anymap": {
+    "source": "apache",
+    "extensions": ["pnm"]
+  },
+  "image/x-portable-bitmap": {
+    "source": "apache",
+    "extensions": ["pbm"]
+  },
+  "image/x-portable-graymap": {
+    "source": "apache",
+    "extensions": ["pgm"]
+  },
+  "image/x-portable-pixmap": {
+    "source": "apache",
+    "extensions": ["ppm"]
+  },
+  "image/x-rgb": {
+    "source": "apache",
+    "extensions": ["rgb"]
+  },
+  "image/x-tga": {
+    "source": "apache",
+    "extensions": ["tga"]
+  },
+  "image/x-xbitmap": {
+    "source": "apache",
+    "extensions": ["xbm"]
+  },
+  "image/x-xcf": {
+    "compressible": false
+  },
+  "image/x-xpixmap": {
+    "source": "apache",
+    "extensions": ["xpm"]
+  },
+  "image/x-xwindowdump": {
+    "source": "apache",
+    "extensions": ["xwd"]
+  },
+  "message/cpim": {
+    "source": "iana"
+  },
+  "message/delivery-status": {
+    "source": "iana"
+  },
+  "message/disposition-notification": {
+    "source": "iana",
+    "extensions": [
+      "disposition-notification"
+    ]
+  },
+  "message/external-body": {
+    "source": "iana"
+  },
+  "message/feedback-report": {
+    "source": "iana"
+  },
+  "message/global": {
+    "source": "iana",
+    "extensions": ["u8msg"]
+  },
+  "message/global-delivery-status": {
+    "source": "iana",
+    "extensions": ["u8dsn"]
+  },
+  "message/global-disposition-notification": {
+    "source": "iana",
+    "extensions": ["u8mdn"]
+  },
+  "message/global-headers": {
+    "source": "iana",
+    "extensions": ["u8hdr"]
+  },
+  "message/http": {
+    "source": "iana",
+    "compressible": false
+  },
+  "message/imdn+xml": {
+    "source": "iana",
+    "compressible": true
+  },
+  "message/news": {
+    "source": "iana"
+  },
+  "message/partial": {
+    "source": "iana",
+    "compressible": false
+  },
+  "message/rfc822": {
+    "source": "iana",
+    "compressible": true,
+    "extensions": ["eml","mime"]
+  },
+  "message/s-http": {
+    "source": "iana"
+  },
+  "message/sip": {
+    "source": "iana"
+  },
+  "message/sipfrag": {
+    "source": "iana"
+  },
+  "message/tracking-status": {
+    "source": "iana"
+  },
+  "message/vnd.si.simp": {
+    "source": "iana"
+  },
+  "message/vnd.wfa.wsc": {
+    "source": "iana",
+    "extensions": ["wsc"]
+  },
+  "model/3mf": {
+    "source": "iana",
+    "extensions": ["3mf"]
+  },
+  "model/e57": {
+    "source": "iana"
+  },
+  "model/gltf+json": {
+    "source": "iana",
+    "compressible": true,
+    "extensions": ["gltf"]
+  },
+  "model/gltf-binary": {
+    "source": "iana",
+    "compressible": true,
+    "extensions": ["glb"]
+  },
+  "model/iges": {
+    "source": "iana",
+    "compressible": false,
+    "extensions": ["igs","iges"]
+  },
+  "model/mesh": {
+    "source": "iana",
+    "compressible": false,
+    "extensions": ["msh","mesh","silo"]
+  },
+  "model/mtl": {
+    "source": "iana",
+    "extensions": ["mtl"]
+  },
+  "model/obj": {
+    "source": "iana",
+    "extensions": ["obj"]
+  },
+  "model/step": {
+    "source": "iana"
+  },
+  "model/step+xml": {
+    "source": "iana",
+    "compressible": true,
+    "extensions": ["stpx"]
+  },
+  "model/step+zip": {
+    "source": "iana",
+    "compressible": false,
+    "extensions": ["stpz"]
+  },
+  "model/step-xml+zip": {
+    "source": "iana",
+    "compressible": false,
+    "extensions": ["stpxz"]
+  },
+  "model/stl": {
+    "source": "iana",
+    "extensions": ["stl"]
+  },
+  "model/vnd.collada+xml": {
+    "source": "iana",
+    "compressible": true,
+    "extensions": ["dae"]
+  },
+  "model/vnd.dwf": {
+    "source": "iana",
+    "extensions": ["dwf"]
+  },
+  "model/vnd.flatland.3dml": {
+    "source": "iana"
+  },
+  "model/vnd.gdl": {
+    "source": "iana",
+    "extensions": ["gdl"]
+  },
+  "model/vnd.gs-gdl": {
+    "source": "apache"
+  },
+  "model/vnd.gs.gdl": {
+    "source": "iana"
+  },
+  "model/vnd.gtw": {
+    "source": "iana",
+    "extensions": ["gtw"]
+  },
+  "model/vnd.moml+xml": {
+    "source": "iana",
+    "compressible": true
+  },
+  "model/vnd.mts": {
+    "source": "iana",
+    "extensions": ["mts"]
+  },
+  "model/vnd.opengex": {
+    "source": "iana",
+    "extensions": ["ogex"]
+  },
+  "model/vnd.parasolid.transmit.binary": {
+    "source": "iana",
+    "extensions": ["x_b"]
+  },
+  "model/vnd.parasolid.transmit.text": {
+    "source": "iana",
+    "extensions": ["x_t"]
+  },
+  "model/vnd.pytha.pyox": {
+    "source": "iana"
+  },
+  "model/vnd.rosette.annotated-data-model": {
+    "source": "iana"
+  },
+  "model/vnd.sap.vds": {
+    "source": "iana",
+    "extensions": ["vds"]
+  },
+  "model/vnd.usdz+zip": {
+    "source": "iana",
+    "compressible": false,
+    "extensions": ["usdz"]
+  },
+  "model/vnd.valve.source.compiled-map": {
+    "source": "iana",
+    "extensions": ["bsp"]
+  },
+  "model/vnd.vtu": {
+    "source": "iana",
+    "extensions": ["vtu"]
+  },
+  "model/vrml": {
+    "source": "iana",
+    "compressible": false,
+    "extensions": ["wrl","vrml"]
+  },
+  "model/x3d+binary": {
+    "source": "apache",
+    "compressible": false,
+    "extensions": ["x3db","x3dbz"]
+  },
+  "model/x3d+fastinfoset": {
+    "source": "iana",
+    "extensions": ["x3db"]
+  },
+  "model/x3d+vrml": {
+    "source": "apache",
+    "compressible": false,
+    "extensions": ["x3dv","x3dvz"]
+  },
+  "model/x3d+xml": {
+    "source": "iana",
+    "compressible": true,
+    "extensions": ["x3d","x3dz"]
+  },
+  "model/x3d-vrml": {
+    "source": "iana",
+    "extensions": ["x3dv"]
+  },
+  "multipart/alternative": {
+    "source": "iana",
+    "compressible": false
+  },
+  "multipart/appledouble": {
+    "source": "iana"
+  },
+  "multipart/byteranges": {
+    "source": "iana"
+  },
+  "multipart/digest": {
+    "source": "iana"
+  },
+  "multipart/encrypted": {
+    "source": "iana",
+    "compressible": false
+  },
+  "multipart/form-data": {
+    "source": "iana",
+    "compressible": false
+  },
+  "multipart/header-set": {
+    "source": "iana"
+  },
+  "multipart/mixed": {
+    "source": "iana"
+  },
+  "multipart/multilingual": {
+    "source": "iana"
+  },
+  "multipart/parallel": {
+    "source": "iana"
+  },
+  "multipart/related": {
+    "source": "iana",
+    "compressible": false
+  },
+  "multipart/report": {
+    "source": "iana"
+  },
+  "multipart/signed": {
+    "source": "iana",
+    "compressible": false
+  },
+  "multipart/vnd.bint.med-plus": {
+    "source": "iana"
+  },
+  "multipart/voice-message": {
+    "source": "iana"
+  },
+  "multipart/x-mixed-replace": {
+    "source": "iana"
+  },
+  "text/1d-interleaved-parityfec": {
+    "source": "iana"
+  },
+  "text/cache-manifest": {
+    "source": "iana",
+    "compressible": true,
+    "extensions": ["appcache","manifest"]
+  },
+  "text/calendar": {
+    "source": "iana",
+    "extensions": ["ics","ifb"]
+  },
+  "text/calender": {
+    "compressible": true
+  },
+  "text/cmd": {
+    "compressible": true
+  },
+  "text/coffeescript": {
+    "extensions": ["coffee","litcoffee"]
+  },
+  "text/cql": {
+    "source": "iana"
+  },
+  "text/cql-expression": {
+    "source": "iana"
+  },
+  "text/cql-identifier": {
+    "source": "iana"
+  },
+  "text/css": {
+    "source": "iana",
+    "charset": "UTF-8",
+    "compressible": true,
+    "extensions": ["css"]
+  },
+  "text/csv": {
+    "source": "iana",
+    "compressible": true,
+    "extensions": ["csv"]
+  },
+  "text/csv-schema": {
+    "source": "iana"
+  },
+  "text/directory": {
+    "source": "iana"
+  },
+  "text/dns": {
+    "source": "iana"
+  },
+  "text/ecmascript": {
+    "source": "iana"
+  },
+  "text/encaprtp": {
+    "source": "iana"
+  },
+  "text/enriched": {
+    "source": "iana"
+  },
+  "text/fhirpath": {
+    "source": "iana"
+  },
+  "text/flexfec": {
+    "source": "iana"
+  },
+  "text/fwdred": {
+    "source": "iana"
+  },
+  "text/gff3": {
+    "source": "iana"
+  },
+  "text/grammar-ref-list": {
+    "source": "iana"
+  },
+  "text/html": {
+    "source": "iana",
+    "compressible": true,
+    "extensions": ["html","htm","shtml"]
+  },
+  "text/jade": {
+    "extensions": ["jade"]
+  },
+  "text/javascript": {
+    "source": "iana",
+    "compressible": true
+  },
+  "text/jcr-cnd": {
+    "source": "iana"
+  },
+  "text/jsx": {
+    "compressible": true,
+    "extensions": ["jsx"]
+  },
+  "text/less": {
+    "compressible": true,
+    "extensions": ["less"]
+  },
+  "text/markdown": {
+    "source": "iana",
+    "compressible": true,
+    "extensions": ["markdown","md"]
+  },
+  "text/mathml": {
+    "source": "nginx",
+    "extensions": ["mml"]
+  },
+  "text/mdx": {
+    "compressible": true,
+    "extensions": ["mdx"]
+  },
+  "text/mizar": {
+    "source": "iana"
+  },
+  "text/n3": {
+    "source": "iana",
+    "charset": "UTF-8",
+    "compressible": true,
+    "extensions": ["n3"]
+  },
+  "text/parameters": {
+    "source": "iana",
+    "charset": "UTF-8"
+  },
+  "text/parityfec": {
+    "source": "iana"
+  },
+  "text/plain": {
+    "source": "iana",
+    "compressible": true,
+    "extensions": ["txt","text","conf","def","list","log","in","ini"]
+  },
+  "text/provenance-notation": {
+    "source": "iana",
+    "charset": "UTF-8"
+  },
+  "text/prs.fallenstein.rst": {
+    "source": "iana"
+  },
+  "text/prs.lines.tag": {
+    "source": "iana",
+    "extensions": ["dsc"]
+  },
+  "text/prs.prop.logic": {
+    "source": "iana"
+  },
+  "text/raptorfec": {
+    "source": "iana"
+  },
+  "text/red": {
+    "source": "iana"
+  },
+  "text/rfc822-headers": {
+    "source": "iana"
+  },
+  "text/richtext": {
+    "source": "iana",
+    "compressible": true,
+    "extensions": ["rtx"]
+  },
+  "text/rtf": {
+    "source": "iana",
+    "compressible": true,
+    "extensions": ["rtf"]
+  },
+  "text/rtp-enc-aescm128": {
+    "source": "iana"
+  },
+  "text/rtploopback": {
+    "source": "iana"
+  },
+  "text/rtx": {
+    "source": "iana"
+  },
+  "text/sgml": {
+    "source": "iana",
+    "extensions": ["sgml","sgm"]
+  },
+  "text/shaclc": {
+    "source": "iana"
+  },
+  "text/shex": {
+    "source": "iana",
+    "extensions": ["shex"]
+  },
+  "text/slim": {
+    "extensions": ["slim","slm"]
+  },
+  "text/spdx": {
+    "source": "iana",
+    "extensions": ["spdx"]
+  },
+  "text/strings": {
+    "source": "iana"
+  },
+  "text/stylus": {
+    "extensions": ["stylus","styl"]
+  },
+  "text/t140": {
+    "source": "iana"
+  },
+  "text/tab-separated-values": {
+    "source": "iana",
+    "compressible": true,
+    "extensions": ["tsv"]
+  },
+  "text/troff": {
+    "source": "iana",
+    "extensions": ["t","tr","roff","man","me","ms"]
+  },
+  "text/turtle": {
+    "source": "iana",
+    "charset": "UTF-8",
+    "extensions": ["ttl"]
+  },
+  "text/ulpfec": {
+    "source": "iana"
+  },
+  "text/uri-list": {
+    "source": "iana",
+    "compressible": true,
+    "extensions": ["uri","uris","urls"]
+  },
+  "text/vcard": {
+    "source": "iana",
+    "compressible": true,
+    "extensions": ["vcard"]
+  },
+  "text/vnd.a": {
+    "source": "iana"
+  },
+  "text/vnd.abc": {
+    "source": "iana"
+  },
+  "text/vnd.ascii-art": {
+    "source": "iana"
+  },
+  "text/vnd.curl": {
+    "source": "iana",
+    "extensions": ["curl"]
+  },
+  "text/vnd.curl.dcurl": {
+    "source": "apache",
+    "extensions": ["dcurl"]
+  },
+  "text/vnd.curl.mcurl": {
+    "source": "apache",
+    "extensions": ["mcurl"]
+  },
+  "text/vnd.curl.scurl": {
+    "source": "apache",
+    "extensions": ["scurl"]
+  },
+  "text/vnd.debian.copyright": {
+    "source": "iana",
+    "charset": "UTF-8"
+  },
+  "text/vnd.dmclientscript": {
+    "source": "iana"
+  },
+  "text/vnd.dvb.subtitle": {
+    "source": "iana",
+    "extensions": ["sub"]
+  },
+  "text/vnd.esmertec.theme-descriptor": {
+    "source": "iana",
+    "charset": "UTF-8"
+  },
+  "text/vnd.ficlab.flt": {
+    "source": "iana"
+  },
+  "text/vnd.fly": {
+    "source": "iana",
+    "extensions": ["fly"]
+  },
+  "text/vnd.fmi.flexstor": {
+    "source": "iana",
+    "extensions": ["flx"]
+  },
+  "text/vnd.gml": {
+    "source": "iana"
+  },
+  "text/vnd.graphviz": {
+    "source": "iana",
+    "extensions": ["gv"]
+  },
+  "text/vnd.hans": {
+    "source": "iana"
+  },
+  "text/vnd.hgl": {
+    "source": "iana"
+  },
+  "text/vnd.in3d.3dml": {
+    "source": "iana",
+    "extensions": ["3dml"]
+  },
+  "text/vnd.in3d.spot": {
+    "source": "iana",
+    "extensions": ["spot"]
+  },
+  "text/vnd.iptc.newsml": {
+    "source": "iana"
+  },
+  "text/vnd.iptc.nitf": {
+    "source": "iana"
+  },
+  "text/vnd.latex-z": {
+    "source": "iana"
+  },
+  "text/vnd.motorola.reflex": {
+    "source": "iana"
+  },
+  "text/vnd.ms-mediapackage": {
+    "source": "iana"
+  },
+  "text/vnd.net2phone.commcenter.command": {
+    "source": "iana"
+  },
+  "text/vnd.radisys.msml-basic-layout": {
+    "source": "iana"
+  },
+  "text/vnd.senx.warpscript": {
+    "source": "iana"
+  },
+  "text/vnd.si.uricatalogue": {
+    "source": "iana"
+  },
+  "text/vnd.sosi": {
+    "source": "iana"
+  },
+  "text/vnd.sun.j2me.app-descriptor": {
+    "source": "iana",
+    "charset": "UTF-8",
+    "extensions": ["jad"]
+  },
+  "text/vnd.trolltech.linguist": {
+    "source": "iana",
+    "charset": "UTF-8"
+  },
+  "text/vnd.wap.si": {
+    "source": "iana"
+  },
+  "text/vnd.wap.sl": {
+    "source": "iana"
+  },
+  "text/vnd.wap.wml": {
+    "source": "iana",
+    "extensions": ["wml"]
+  },
+  "text/vnd.wap.wmlscript": {
+    "source": "iana",
+    "extensions": ["wmls"]
+  },
+  "text/vtt": {
+    "source": "iana",
+    "charset": "UTF-8",
+    "compressible": true,
+    "extensions": ["vtt"]
+  },
+  "text/x-asm": {
+    "source": "apache",
+    "extensions": ["s","asm"]
+  },
+  "text/x-c": {
+    "source": "apache",
+    "extensions": ["c","cc","cxx","cpp","h","hh","dic"]
+  },
+  "text/x-component": {
+    "source": "nginx",
+    "extensions": ["htc"]
+  },
+  "text/x-fortran": {
+    "source": "apache",
+    "extensions": ["f","for","f77","f90"]
+  },
+  "text/x-gwt-rpc": {
+    "compressible": true
+  },
+  "text/x-handlebars-template": {
+    "extensions": ["hbs"]
+  },
+  "text/x-java-source": {
+    "source": "apache",
+    "extensions": ["java"]
+  },
+  "text/x-jquery-tmpl": {
+    "compressible": true
+  },
+  "text/x-lua": {
+    "extensions": ["lua"]
+  },
+  "text/x-markdown": {
+    "compressible": true,
+    "extensions": ["mkd"]
+  },
+  "text/x-nfo": {
+    "source": "apache",
+    "extensions": ["nfo"]
+  },
+  "text/x-opml": {
+    "source": "apache",
+    "extensions": ["opml"]
+  },
+  "text/x-org": {
+    "compressible": true,
+    "extensions": ["org"]
+  },
+  "text/x-pascal": {
+    "source": "apache",
+    "extensions": ["p","pas"]
+  },
+  "text/x-processing": {
+    "compressible": true,
+    "extensions": ["pde"]
+  },
+  "text/x-sass": {
+    "extensions": ["sass"]
+  },
+  "text/x-scss": {
+    "extensions": ["scss"]
+  },
+  "text/x-setext": {
+    "source": "apache",
+    "extensions": ["etx"]
+  },
+  "text/x-sfv": {
+    "source": "apache",
+    "extensions": ["sfv"]
+  },
+  "text/x-suse-ymp": {
+    "compressible": true,
+    "extensions": ["ymp"]
+  },
+  "text/x-uuencode": {
+    "source": "apache",
+    "extensions": ["uu"]
+  },
+  "text/x-vcalendar": {
+    "source": "apache",
+    "extensions": ["vcs"]
+  },
+  "text/x-vcard": {
+    "source": "apache",
+    "extensions": ["vcf"]
+  },
+  "text/xml": {
+    "source": "iana",
+    "compressible": true,
+    "extensions": ["xml"]
+  },
+  "text/xml-external-parsed-entity": {
+    "source": "iana"
+  },
+  "text/yaml": {
+    "compressible": true,
+    "extensions": ["yaml","yml"]
+  },
+  "video/1d-interleaved-parityfec": {
+    "source": "iana"
+  },
+  "video/3gpp": {
+    "source": "iana",
+    "extensions": ["3gp","3gpp"]
+  },
+  "video/3gpp-tt": {
+    "source": "iana"
+  },
+  "video/3gpp2": {
+    "source": "iana",
+    "extensions": ["3g2"]
+  },
+  "video/av1": {
+    "source": "iana"
+  },
+  "video/bmpeg": {
+    "source": "iana"
+  },
+  "video/bt656": {
+    "source": "iana"
+  },
+  "video/celb": {
+    "source": "iana"
+  },
+  "video/dv": {
+    "source": "iana"
+  },
+  "video/encaprtp": {
+    "source": "iana"
+  },
+  "video/ffv1": {
+    "source": "iana"
+  },
+  "video/flexfec": {
+    "source": "iana"
+  },
+  "video/h261": {
+    "source": "iana",
+    "extensions": ["h261"]
+  },
+  "video/h263": {
+    "source": "iana",
+    "extensions": ["h263"]
+  },
+  "video/h263-1998": {
+    "source": "iana"
+  },
+  "video/h263-2000": {
+    "source": "iana"
+  },
+  "video/h264": {
+    "source": "iana",
+    "extensions": ["h264"]
+  },
+  "video/h264-rcdo": {
+    "source": "iana"
+  },
+  "video/h264-svc": {
+    "source": "iana"
+  },
+  "video/h265": {
+    "source": "iana"
+  },
+  "video/iso.segment": {
+    "source": "iana",
+    "extensions": ["m4s"]
+  },
+  "video/jpeg": {
+    "source": "iana",
+    "extensions": ["jpgv"]
+  },
+  "video/jpeg2000": {
+    "source": "iana"
+  },
+  "video/jpm": {
+    "source": "apache",
+    "extensions": ["jpm","jpgm"]
+  },
+  "video/jxsv": {
+    "source": "iana"
+  },
+  "video/mj2": {
+    "source": "iana",
+    "extensions": ["mj2","mjp2"]
+  },
+  "video/mp1s": {
+    "source": "iana"
+  },
+  "video/mp2p": {
+    "source": "iana"
+  },
+  "video/mp2t": {
+    "source": "iana",
+    "extensions": ["ts"]
+  },
+  "video/mp4": {
+    "source": "iana",
+    "compressible": false,
+    "extensions": ["mp4","mp4v","mpg4"]
+  },
+  "video/mp4v-es": {
+    "source": "iana"
+  },
+  "video/mpeg": {
+    "source": "iana",
+    "compressible": false,
+    "extensions": ["mpeg","mpg","mpe","m1v","m2v"]
+  },
+  "video/mpeg4-generic": {
+    "source": "iana"
+  },
+  "video/mpv": {
+    "source": "iana"
+  },
+  "video/nv": {
+    "source": "iana"
+  },
+  "video/ogg": {
+    "source": "iana",
+    "compressible": false,
+    "extensions": ["ogv"]
+  },
+  "video/parityfec": {
+    "source": "iana"
+  },
+  "video/pointer": {
+    "source": "iana"
+  },
+  "video/quicktime": {
+    "source": "iana",
+    "compressible": false,
+    "extensions": ["qt","mov"]
+  },
+  "video/raptorfec": {
+    "source": "iana"
+  },
+  "video/raw": {
+    "source": "iana"
+  },
+  "video/rtp-enc-aescm128": {
+    "source": "iana"
+  },
+  "video/rtploopback": {
+    "source": "iana"
+  },
+  "video/rtx": {
+    "source": "iana"
+  },
+  "video/scip": {
+    "source": "iana"
+  },
+  "video/smpte291": {
+    "source": "iana"
+  },
+  "video/smpte292m": {
+    "source": "iana"
+  },
+  "video/ulpfec": {
+    "source": "iana"
+  },
+  "video/vc1": {
+    "source": "iana"
+  },
+  "video/vc2": {
+    "source": "iana"
+  },
+  "video/vnd.cctv": {
+    "source": "iana"
+  },
+  "video/vnd.dece.hd": {
+    "source": "iana",
+    "extensions": ["uvh","uvvh"]
+  },
+  "video/vnd.dece.mobile": {
+    "source": "iana",
+    "extensions": ["uvm","uvvm"]
+  },
+  "video/vnd.dece.mp4": {
+    "source": "iana"
+  },
+  "video/vnd.dece.pd": {
+    "source": "iana",
+    "extensions": ["uvp","uvvp"]
+  },
+  "video/vnd.dece.sd": {
+    "source": "iana",
+    "extensions": ["uvs","uvvs"]
+  },
+  "video/vnd.dece.video": {
+    "source": "iana",
+    "extensions": ["uvv","uvvv"]
+  },
+  "video/vnd.directv.mpeg": {
+    "source": "iana"
+  },
+  "video/vnd.directv.mpeg-tts": {
+    "source": "iana"
+  },
+  "video/vnd.dlna.mpeg-tts": {
+    "source": "iana"
+  },
+  "video/vnd.dvb.file": {
+    "source": "iana",
+    "extensions": ["dvb"]
+  },
+  "video/vnd.fvt": {
+    "source": "iana",
+    "extensions": ["fvt"]
+  },
+  "video/vnd.hns.video": {
+    "source": "iana"
+  },
+  "video/vnd.iptvforum.1dparityfec-1010": {
+    "source": "iana"
+  },
+  "video/vnd.iptvforum.1dparityfec-2005": {
+    "source": "iana"
+  },
+  "video/vnd.iptvforum.2dparityfec-1010": {
+    "source": "iana"
+  },
+  "video/vnd.iptvforum.2dparityfec-2005": {
+    "source": "iana"
+  },
+  "video/vnd.iptvforum.ttsavc": {
+    "source": "iana"
+  },
+  "video/vnd.iptvforum.ttsmpeg2": {
+    "source": "iana"
+  },
+  "video/vnd.motorola.video": {
+    "source": "iana"
+  },
+  "video/vnd.motorola.videop": {
+    "source": "iana"
+  },
+  "video/vnd.mpegurl": {
+    "source": "iana",
+    "extensions": ["mxu","m4u"]
+  },
+  "video/vnd.ms-playready.media.pyv": {
+    "source": "iana",
+    "extensions": ["pyv"]
+  },
+  "video/vnd.nokia.interleaved-multimedia": {
+    "source": "iana"
+  },
+  "video/vnd.nokia.mp4vr": {
+    "source": "iana"
+  },
+  "video/vnd.nokia.videovoip": {
+    "source": "iana"
+  },
+  "video/vnd.objectvideo": {
+    "source": "iana"
+  },
+  "video/vnd.radgamettools.bink": {
+    "source": "iana"
+  },
+  "video/vnd.radgamettools.smacker": {
+    "source": "iana"
+  },
+  "video/vnd.sealed.mpeg1": {
+    "source": "iana"
+  },
+  "video/vnd.sealed.mpeg4": {
+    "source": "iana"
+  },
+  "video/vnd.sealed.swf": {
+    "source": "iana"
+  },
+  "video/vnd.sealedmedia.softseal.mov": {
+    "source": "iana"
+  },
+  "video/vnd.uvvu.mp4": {
+    "source": "iana",
+    "extensions": ["uvu","uvvu"]
+  },
+  "video/vnd.vivo": {
+    "source": "iana",
+    "extensions": ["viv"]
+  },
+  "video/vnd.youtube.yt": {
+    "source": "iana"
+  },
+  "video/vp8": {
+    "source": "iana"
+  },
+  "video/vp9": {
+    "source": "iana"
+  },
+  "video/webm": {
+    "source": "apache",
+    "compressible": false,
+    "extensions": ["webm"]
+  },
+  "video/x-f4v": {
+    "source": "apache",
+    "extensions": ["f4v"]
+  },
+  "video/x-fli": {
+    "source": "apache",
+    "extensions": ["fli"]
+  },
+  "video/x-flv": {
+    "source": "apache",
+    "compressible": false,
+    "extensions": ["flv"]
+  },
+  "video/x-m4v": {
+    "source": "apache",
+    "extensions": ["m4v"]
+  },
+  "video/x-matroska": {
+    "source": "apache",
+    "compressible": false,
+    "extensions": ["mkv","mk3d","mks"]
+  },
+  "video/x-mng": {
+    "source": "apache",
+    "extensions": ["mng"]
+  },
+  "video/x-ms-asf": {
+    "source": "apache",
+    "extensions": ["asf","asx"]
+  },
+  "video/x-ms-vob": {
+    "source": "apache",
+    "extensions": ["vob"]
+  },
+  "video/x-ms-wm": {
+    "source": "apache",
+    "extensions": ["wm"]
+  },
+  "video/x-ms-wmv": {
+    "source": "apache",
+    "compressible": false,
+    "extensions": ["wmv"]
+  },
+  "video/x-ms-wmx": {
+    "source": "apache",
+    "extensions": ["wmx"]
+  },
+  "video/x-ms-wvx": {
+    "source": "apache",
+    "extensions": ["wvx"]
+  },
+  "video/x-msvideo": {
+    "source": "apache",
+    "extensions": ["avi"]
+  },
+  "video/x-sgi-movie": {
+    "source": "apache",
+    "extensions": ["movie"]
+  },
+  "video/x-smv": {
+    "source": "apache",
+    "extensions": ["smv"]
+  },
+  "x-conference/x-cooltalk": {
+    "source": "apache",
+    "extensions": ["ice"]
+  },
+  "x-shader/x-fragment": {
+    "compressible": true
+  },
+  "x-shader/x-vertex": {
+    "compressible": true
+  }
+}
diff --git a/src/dep/style-vendorizer.mjs b/src/dep/style-vendorizer.mjs
new file mode 100644
index 0000000..fca0d2a
--- /dev/null
+++ b/src/dep/style-vendorizer.mjs
@@ -0,0 +1,58 @@
+/**
+ * style-vendorizer v2.0.0
+ * @license MIT
+ * @source https://unpkg.com/style-vendorizer@^2.0.0?module
+ */
+
+var i = new Map([
+  ['align-self', '-ms-grid-row-align'],
+  ['color-adjust', '-webkit-print-color-adjust'],
+  ['column-gap', 'grid-column-gap'],
+  ['gap', 'grid-gap'],
+  ['grid-template-columns', '-ms-grid-columns'],
+  ['grid-template-rows', '-ms-grid-rows'],
+  ['justify-self', '-ms-grid-column-align'],
+  ['margin-inline-end', '-webkit-margin-end'],
+  ['margin-inline-start', '-webkit-margin-start'],
+  ['overflow-wrap', 'word-wrap'],
+  ['padding-inline-end', '-webkit-padding-end'],
+  ['padding-inline-start', '-webkit-padding-start'],
+  ['row-gap', 'grid-row-gap'],
+  ['scroll-margin-bottom', 'scroll-snap-margin-bottom'],
+  ['scroll-margin-left', 'scroll-snap-margin-left'],
+  ['scroll-margin-right', 'scroll-snap-margin-right'],
+  ['scroll-margin-top', 'scroll-snap-margin-top'],
+  ['scroll-margin', 'scroll-snap-margin'],
+  ['text-combine-upright', '-ms-text-combine-horizontal'],
+]);
+function r(r) {
+  return i.get(r);
+}
+function n(i) {
+  var r =
+    /^(?:(text-(?:decoration$|e|or|si)|back(?:ground-cl|d|f)|box-d|(?:mask(?:$|-[ispro]|-cl)))|(tab-|column(?!-s)|text-align-l)|(ap)|(u|hy))/i.exec(
+      i
+    );
+  return r ? (r[1] ? 1 : r[2] ? 2 : r[3] ? 3 : 5) : 0;
+}
+function t(i, r) {
+  var n = /^(?:(pos)|(background-i)|((?:max-|min-)?(?:block-s|inl|he|widt))|(dis))/i.exec(i);
+  return n
+    ? n[1]
+      ? /^sti/i.test(r)
+        ? 1
+        : 0
+      : n[2]
+      ? /^image-/i.test(r)
+        ? 1
+        : 0
+      : n[3]
+      ? '-' === r[3]
+        ? 2
+        : 0
+      : /^(inline-)?grid$/i.test(r)
+      ? 4
+      : 0
+    : 0;
+}
+export { r as cssPropertyAlias, n as cssPropertyPrefixFlags, t as cssValuePrefixFlags };
diff --git a/src/dep/twind-content.mjs b/src/dep/twind-content.mjs
new file mode 100644
index 0000000..ca4c2bf
--- /dev/null
+++ b/src/dep/twind-content.mjs
@@ -0,0 +1,43 @@
+/**
+ * Twind v0.16.16
+ * @license MIT
+ * @source https://unpkg.com/@twind/content@0.1.0/content.js?module
+ */
+
+import { directive as o } from './twind.mjs';
+var c = new Set([
+    'open-quote',
+    'close-quote',
+    'no-open-quote',
+    'no-close-quote',
+    'normal',
+    'none',
+    'inherit',
+    'initial',
+    'unset',
+  ]),
+  n = (t) => t.join('-'),
+  s = (t) => {
+    switch (t[0]) {
+      case 'data':
+        return `attr(${n(t)})`;
+      case 'attr':
+      case 'counter':
+        return `${t[0]}(${n(t.slice(1))})`;
+      case 'var':
+        return `var(--${n(t)})`;
+      case void 0:
+        return 'attr(data-content)';
+      default:
+        return JSON.stringify(n(t));
+    }
+  },
+  i = (t, { theme: r }) => {
+    let e = Array.isArray(t) ? n(t) : t;
+    return {
+      content:
+        (e && r('content', [e], '')) || (c.has(e) && e) || (Array.isArray(t) ? s(t) : e),
+    };
+  },
+  u = (t, r) => (Array.isArray(t) ? i(t, r) : o(i, t));
+export { u as content };
diff --git a/src/dep/twind-css.mjs b/src/dep/twind-css.mjs
new file mode 100644
index 0000000..f337731
--- /dev/null
+++ b/src/dep/twind-css.mjs
@@ -0,0 +1,134 @@
+/**
+ * Twind v0.16.16
+ * @license MIT
+ * @source https://unpkg.com/twind@0.16.16/css/css.js?module
+ */
+
+// src/css/index.ts
+import { apply, hash, directive } from "./twind.mjs";
+
+// src/internal/util.ts
+var includes = (value, search) => !!~value.indexOf(search);
+var join = (parts, separator = "-") => parts.join(separator);
+var hyphenate = value => value.replace(/[A-Z]/g, "-$&").toLowerCase();
+var evalThunk = (value, context) => {
+  while (typeof value == "function") {
+    value = value(context);
+  }
+  return value;
+};
+var isCSSProperty = (key, value) => !includes("@:&", key[0]) && (includes("rg", (typeof value)[5]) || Array.isArray(value));
+var merge = (target, source, context) => source ? Object.keys(source).reduce((target2, key) => {
+  const value = evalThunk(source[key], context);
+  if (isCSSProperty(key, value)) {
+    target2[hyphenate(key)] = value;
+  } else {
+    target2[key] = key[0] == "@" && includes("figa", key[1]) ? (target2[key] || []).concat(value) : merge(target2[key] || {}, value, context);
+  }
+  return target2;
+}, target) : target;
+var escape = typeof CSS !== "undefined" && CSS.escape || (className => className.replace(/[!"'`*+.,;:\\/<=>?@#$%&^|~()[\]{}]/g, "\\$&").replace(/^\d/, "\\3$& "));
+var buildMediaQuery = screen2 => {
+  if (!Array.isArray(screen2)) {
+    screen2 = [screen2];
+  }
+  return "@media " + join(screen2.map(screen3 => {
+    if (typeof screen3 == "string") {
+      screen3 = { min: screen3 };
+    }
+    return screen3.raw || join(Object.keys(screen3).map(feature => `(${feature}-width:${screen3[feature]})`), " and ");
+  }), ",");
+};
+
+// src/css/index.ts
+var translate = (tokens, context) => {
+  const collect = (target, token) => Array.isArray(token) ? token.reduce(collect, target) : merge(target, evalThunk(token, context), context);
+  return tokens.reduce(collect, {});
+};
+var newRule = /\s*(?:([\w-%@]+)\s*:?\s*([^{;]+?)\s*(?:;|$|})|([^;}{]*?)\s*{)|(})/gi;
+var ruleClean = /\/\*[\s\S]*?\*\/|\s+|\n/gm;
+var decorate = (selectors, currentBlock) => selectors.reduceRight((rules, selector) => ({ [selector]: rules }), currentBlock);
+var saveBlock = (rules, selectors, currentBlock) => {
+  if (currentBlock) {
+    rules.push(decorate(selectors, currentBlock));
+  }
+};
+var interleave = (strings, interpolations, context) => {
+  let buffer = strings[0];
+  const result = [];
+  for (let index = 0; index < interpolations.length;) {
+    const interpolation = evalThunk(interpolations[index], context);
+    if (interpolation && typeof interpolation == "object") {
+      result.push(buffer, interpolation);
+      buffer = strings[++index];
+    } else {
+      buffer += (interpolation || "") + strings[++index];
+    }
+  }
+  result.push(buffer);
+  return result;
+};
+var astish = (values, context) => {
+  const selectors = [];
+  const rules = [];
+  let currentBlock;
+  let match;
+  for (let index = 0; index < values.length; index++) {
+    const value = values[index];
+    if (typeof value == "string") {
+      while (match = newRule.exec(value.replace(ruleClean, " "))) {
+        if (!match[0])
+        continue;
+        if (match[4]) {
+          currentBlock = saveBlock(rules, selectors, currentBlock);
+          selectors.pop();
+        }
+        if (match[3]) {
+          currentBlock = saveBlock(rules, selectors, currentBlock);
+          selectors.push(match[3]);
+        } else if (!match[4]) {
+          if (!currentBlock)
+          currentBlock = {};
+          const value2 = match[2] && /\S/.test(match[2]) ? match[2] : values[++index];
+          if (value2) {
+            if (match[1] == "@apply") {
+              merge(currentBlock, evalThunk(apply(value2), context), context);
+            } else {
+              currentBlock[match[1]] = value2;
+            }
+          }
+        }
+      }
+    } else {
+      currentBlock = saveBlock(rules, selectors, currentBlock);
+      rules.push(decorate(selectors, value));
+    }
+  }
+  saveBlock(rules, selectors, currentBlock);
+  return rules;
+};
+var cssFactory = (tokens, context) => translate(Array.isArray(tokens[0]) && Array.isArray(tokens[0].raw) ? astish(interleave(tokens[0], tokens.slice(1), context), context) : tokens, context);
+var css = (...tokens) => directive(cssFactory, tokens);
+var keyframesFactory = (tokens, context) => {
+  const waypoints = cssFactory(tokens, context);
+  const id = hash(JSON.stringify(waypoints));
+  context.tw(() => ({ [`@keyframes ${id}`]: waypoints }));
+  return id;
+};
+var keyframes = (...tokens) => directive(keyframesFactory, tokens);
+var animation = (value, waypoints) => waypoints === void 0 ? (...args) => animation(value, keyframes(...args)) : css({
+  ...(value && typeof value == "object" ? value : { animation: value }),
+  animationName: typeof waypoints == "function" ? waypoints : keyframes(waypoints) });
+
+var screenFactory = ({ size, rules }, context) => {
+  const media = buildMediaQuery(context.theme("screens", size));
+  return rules === void 0 ? media : {
+    [media]: typeof rules == "function" ? evalThunk(rules, context) : cssFactory([rules], context) };
+
+};
+var screen = (size, rules) => directive(screenFactory, { size, rules });
+export {
+animation,
+css,
+keyframes,
+screen };
\ No newline at end of file
diff --git a/src/dep/twind.mjs b/src/dep/twind.mjs
new file mode 100644
index 0000000..6d0ad35
--- /dev/null
+++ b/src/dep/twind.mjs
@@ -0,0 +1,2402 @@
+/**
+ * Twind v0.16.16
+ * @license MIT
+ * @source https://unpkg.com/twind@0.16.16/twind.js?module 
+ */
+
+// src/internal/util.ts
+var includes = (value, search) => !!~value.indexOf(search);
+var join = (parts, separator = '-') => parts.join(separator);
+var joinTruthy = (parts, separator) => join(parts.filter(Boolean), separator);
+var tail = (array, startIndex = 1) => array.slice(startIndex);
+var identity = (value) => value;
+var noop = () => {};
+var capitalize = (value) => value[0].toUpperCase() + tail(value);
+var hyphenate = (value) => value.replace(/[A-Z]/g, '-$&').toLowerCase();
+var evalThunk = (value, context) => {
+  while (typeof value == 'function') {
+    value = value(context);
+  }
+  return value;
+};
+var ensureMaxSize = (map, max) => {
+  if (map.size > max) {
+    map.delete(map.keys().next().value);
+  }
+};
+var isCSSProperty = (key, value) =>
+  !includes('@:&', key[0]) && (includes('rg', (typeof value)[5]) || Array.isArray(value));
+var merge = (target, source, context) =>
+  source
+    ? Object.keys(source).reduce((target2, key) => {
+        const value = evalThunk(source[key], context);
+        if (isCSSProperty(key, value)) {
+          target2[hyphenate(key)] = value;
+        } else {
+          target2[key] =
+            key[0] == '@' && includes('figa', key[1])
+              ? (target2[key] || []).concat(value)
+              : merge(target2[key] || {}, value, context);
+        }
+        return target2;
+      }, target)
+    : target;
+var escape =
+  (typeof CSS !== 'undefined' && CSS.escape) ||
+  ((className) =>
+    className.replace(/[!"'`*+.,;:\\/<=>?@#$%&^|~()[\]{}]/g, '\\$&').replace(/^\d/, '\\3$& '));
+var buildMediaQuery = (screen) => {
+  if (!Array.isArray(screen)) {
+    screen = [screen];
+  }
+  return (
+    '@media ' +
+    join(
+      screen.map((screen2) => {
+        if (typeof screen2 == 'string') {
+          screen2 = { min: screen2 };
+        }
+        return (
+          screen2.raw ||
+          join(
+            Object.keys(screen2).map((feature) => `(${feature}-width:${screen2[feature]})`),
+            ' and '
+          )
+        );
+      }),
+      ','
+    )
+  );
+};
+var cyrb32 = (value) => {
+  for (var h = 9, index = value.length; index--; ) {
+    h = Math.imul(h ^ value.charCodeAt(index), 1597334677);
+  }
+  return 'tw-' + ((h ^ (h >>> 9)) >>> 0).toString(36);
+};
+var sortedInsertionIndex = (array, element) => {
+  for (var low = 0, high = array.length; low < high; ) {
+    const pivot = (high + low) >> 1;
+    if (array[pivot] <= element) {
+      low = pivot + 1;
+    } else {
+      high = pivot;
+    }
+  }
+  return high;
+};
+
+// src/twind/parse.ts
+var groupings;
+var rules;
+var startGrouping = (value = '') => {
+  groupings.push(value);
+  return '';
+};
+var endGrouping = (isWhitespace) => {
+  groupings.length = Math.max(groupings.lastIndexOf('') + ~~isWhitespace, 0);
+};
+var onlyPrefixes = (s) => s && !includes('!:', s[0]);
+var onlyVariants = (s) => s[0] == ':';
+var addRule = (directive2, negate) => {
+  rules.push({
+    v: groupings.filter(onlyVariants),
+    d: directive2,
+    n: negate,
+    i: includes(groupings, '!'),
+    $: '',
+  });
+};
+var saveRule = (buffer) => {
+  const negate = buffer[0] == '-';
+  if (negate) {
+    buffer = tail(buffer);
+  }
+  const prefix = join(groupings.filter(onlyPrefixes));
+  addRule(buffer == '&' ? prefix : (prefix && prefix + '-') + buffer, negate);
+  return '';
+};
+var parseString = (token, isVariant) => {
+  let buffer = '';
+  for (let char, dynamic = false, position2 = 0; (char = token[position2++]); ) {
+    if (dynamic || char == '[') {
+      buffer += char;
+      dynamic = char != ']';
+      continue;
+    }
+    switch (char) {
+      case ':':
+        buffer =
+          buffer &&
+          startGrouping(':' + (token[position2] == char ? token[position2++] : '') + buffer);
+        break;
+      case '(':
+        buffer = buffer && startGrouping(buffer);
+        startGrouping();
+        break;
+      case '!':
+        startGrouping(char);
+        break;
+      case ')':
+      case ' ':
+      case '	':
+      case '\n':
+      case '\r':
+        buffer = buffer && saveRule(buffer);
+        endGrouping(char !== ')');
+        break;
+      default:
+        buffer += char;
+    }
+  }
+  if (buffer) {
+    if (isVariant) {
+      startGrouping(':' + buffer);
+    } else if (buffer.slice(-1) == '-') {
+      startGrouping(buffer.slice(0, -1));
+    } else {
+      saveRule(buffer);
+    }
+  }
+};
+var parseGroupedToken = (token) => {
+  startGrouping();
+  parseToken(token);
+  endGrouping();
+};
+var parseGroup = (key, token) => {
+  if (token) {
+    startGrouping();
+    const isVariant = includes('tbu', (typeof token)[1]);
+    parseString(key, isVariant);
+    if (isVariant) {
+      parseGroupedToken(token);
+    }
+    endGrouping();
+  }
+};
+var parseToken = (token) => {
+  switch (typeof token) {
+    case 'string':
+      parseString(token);
+      break;
+    case 'function':
+      addRule(token);
+      break;
+    case 'object':
+      if (Array.isArray(token)) {
+        token.forEach(parseGroupedToken);
+      } else if (token) {
+        Object.keys(token).forEach((key) => {
+          parseGroup(key, token[key]);
+        });
+      }
+  }
+};
+var staticsCaches = new WeakMap();
+var buildStatics = (strings) => {
+  let statics = staticsCaches.get(strings);
+  if (!statics) {
+    let slowModeIndex = NaN;
+    let buffer = '';
+    statics = strings.map((token, index) => {
+      if (
+        slowModeIndex !== slowModeIndex &&
+        (token.slice(-1) == '[' || includes(':-(', (strings[index + 1] || '')[0]))
+      ) {
+        slowModeIndex = index;
+      }
+      if (index >= slowModeIndex) {
+        return (interpolation) => {
+          if (index == slowModeIndex) {
+            buffer = '';
+          }
+          buffer += token;
+          if (includes('rg', (typeof interpolation)[5])) {
+            buffer += interpolation;
+          } else if (interpolation) {
+            parseString(buffer);
+            buffer = '';
+            parseToken(interpolation);
+          }
+          if (index == strings.length - 1) {
+            parseString(buffer);
+          }
+        };
+      }
+      const staticRules = (rules = []);
+      parseString(token);
+      const activeGroupings = [...groupings];
+      rules = [];
+      return (interpolation) => {
+        rules.push(...staticRules);
+        groupings = [...activeGroupings];
+        if (interpolation) {
+          parseToken(interpolation);
+        }
+      };
+    });
+    staticsCaches.set(strings, statics);
+  }
+  return statics;
+};
+var parse = (tokens) => {
+  groupings = [];
+  rules = [];
+  if (Array.isArray(tokens[0]) && Array.isArray(tokens[0].raw)) {
+    buildStatics(tokens[0]).forEach((apply2, index) => apply2(tokens[index + 1]));
+  } else {
+    parseToken(tokens);
+  }
+  return rules;
+};
+
+// src/twind/directive.ts
+var isFunctionFree;
+var detectFunction = (key, value) => {
+  if (typeof value == 'function') {
+    isFunctionFree = false;
+  }
+  return value;
+};
+var stringify = (data) => {
+  isFunctionFree = true;
+  const key = JSON.stringify(data, detectFunction);
+  return isFunctionFree && key;
+};
+var cacheByFactory = new WeakMap();
+var directive = (factory, data) => {
+  const key = stringify(data);
+  let directive2;
+  if (key) {
+    var cache = cacheByFactory.get(factory);
+    if (!cache) {
+      cacheByFactory.set(factory, (cache = new Map()));
+    }
+    directive2 = cache.get(key);
+  }
+  if (!directive2) {
+    directive2 = Object.defineProperty(
+      (params, context) => {
+        context = Array.isArray(params) ? context : params;
+        return evalThunk(factory(data, context), context);
+      },
+      'toJSON',
+      {
+        value: () => key || data,
+      }
+    );
+
+    if (cache) {
+      cache.set(key, directive2);
+      ensureMaxSize(cache, 1e4);
+    }
+  }
+  return directive2;
+};
+
+// src/twind/apply.ts
+var applyFactory = (tokens, { css }) => css(parse(tokens));
+var apply = (...tokens) => directive(applyFactory, tokens);
+
+// src/twind/helpers.ts
+var positions = (resolve) => (value, position2, prefix, suffix) => {
+  if (value) {
+    const properties = position2 && resolve(position2);
+    if (properties && properties.length > 0) {
+      return properties.reduce((declarations, property2) => {
+        declarations[joinTruthy([prefix, property2, suffix])] = value;
+        return declarations;
+      }, {});
+    }
+  }
+};
+var corners = /* @__PURE__ */ positions(
+  (key) =>
+    ({
+      t: ['top-left', 'top-right'],
+      r: ['top-right', 'bottom-right'],
+      b: ['bottom-left', 'bottom-right'],
+      l: ['bottom-left', 'top-left'],
+      tl: ['top-left'],
+      tr: ['top-right'],
+      bl: ['bottom-left'],
+      br: ['bottom-right'],
+    }[key])
+);
+var expandEdges = (key) => {
+  const parts = ({ x: 'lr', y: 'tb' }[key] || key || '').split('').sort();
+  for (let index = parts.length; index--; ) {
+    if (
+      !(parts[index] = {
+        t: 'top',
+        r: 'right',
+        b: 'bottom',
+        l: 'left',
+      }[parts[index]])
+    )
+      return;
+  }
+  if (parts.length) return parts;
+};
+var edges = /* @__PURE__ */ positions(expandEdges);
+
+// src/twind/plugins.ts
+var _;
+var __;
+var $;
+var toColumnsOrRows = (x) => (x == 'cols' ? 'columns' : 'rows');
+var property = (property2) => (params, context, id) => ({
+  [property2]: id + ((_ = join(params)) && '-' + _),
+});
+
+var propertyValue = (property2, separator) => (params, context, id) =>
+  (_ = join(params, separator)) && {
+    [property2 || id]: _,
+  };
+
+var themeProperty =
+  (section) =>
+  (params, { theme: theme2 }, id) =>
+    (_ = theme2(section || id, params)) && {
+      [section || id]: _,
+    };
+
+var themePropertyFallback =
+  (section, separator) =>
+  (params, { theme: theme2 }, id) =>
+    (_ = theme2(section || id, params, join(params, separator))) && {
+      [section || id]: _,
+    };
+
+var alias = (handler, name) => (params, context) => handler(params, context, name);
+var display = property('display');
+var position = property('position');
+var textTransform = property('textTransform');
+var textDecoration = property('textDecoration');
+var fontStyle = property('fontStyle');
+var fontVariantNumeric = (key) => (params, context, id) => ({
+  ['--tw-' + key]: id,
+  fontVariantNumeric:
+    'var(--tw-ordinal,/*!*/ /*!*/) var(--tw-slashed-zero,/*!*/ /*!*/) var(--tw-numeric-figure,/*!*/ /*!*/) var(--tw-numeric-spacing,/*!*/ /*!*/) var(--tw-numeric-fraction,/*!*/ /*!*/)',
+});
+
+var inset = (params, { theme: theme2 }, id) => (_ = theme2('inset', params)) && { [id]: _ };
+var opacityProperty = (params, theme2, id, section = id) =>
+  (_ = theme2(section + 'Opacity', tail(params))) && {
+    [`--tw-${id}-opacity`]: _,
+  };
+
+var parseColorComponent = (chars, factor) => Math.round(parseInt(chars, 16) * factor);
+var asRGBA = (color, opacityProperty2, opacityDefault) => {
+  if (
+    color &&
+    color[0] == '#' &&
+    (_ = (color.length - 1) / 3) &&
+    ($ = [17, 1, 0.062272][_ - 1])
+  ) {
+    return `rgba(${parseColorComponent(color.substr(1, _), $)},${parseColorComponent(
+      color.substr(1 + _, _),
+      $
+    )},${parseColorComponent(color.substr(1 + 2 * _, _), $)},${
+      opacityProperty2
+        ? `var(--tw-${opacityProperty2}${opacityDefault ? ',' + opacityDefault : ''})`
+        : opacityDefault || 1
+    })`;
+  }
+  return color;
+};
+var withOpacityFallback = (property2, kind, color) =>
+  color && typeof color == 'string'
+    ? (_ = asRGBA(color, kind + '-opacity')) && _ !== color
+      ? {
+          [`--tw-${kind}-opacity`]: '1',
+          [property2]: [color, _],
+        }
+      : { [property2]: color }
+    : void 0;
+var transparentTo = (color) => (($ = asRGBA(color, '', '0')) == _ ? 'transparent' : $);
+var reversableEdge = (params, { theme: theme2 }, id, section, prefix, suffix) =>
+  (_ = { x: ['right', 'left'], y: ['bottom', 'top'] }[params[0]]) &&
+  ($ = `--tw-${id}-${params[0]}-reverse`)
+    ? params[1] == 'reverse'
+      ? {
+          [$]: '1',
+        }
+      : {
+          [$]: '0',
+          [joinTruthy([prefix, _[0], suffix])]:
+            (__ = theme2(section, tail(params))) && `calc(${__} * var(${$}))`,
+          [joinTruthy([prefix, _[1], suffix])]: __ && [
+            __,
+            `calc(${__} * calc(1 - var(${$})))`,
+          ],
+        }
+    : void 0;
+var placeHelper = (property2, params) =>
+  params[0] && {
+    [property2]: (includes('wun', (params[0] || '')[3]) ? 'space-' : '') + params[0],
+  };
+
+var contentPluginFor = (property2) => (params) =>
+  includes(['start', 'end'], params[0])
+    ? { [property2]: 'flex-' + params[0] }
+    : placeHelper(property2, params);
+var gridPlugin =
+  (kind) =>
+  (params, { theme: theme2 }) => {
+    if ((_ = theme2('grid' + capitalize(kind), params, ''))) {
+      return { ['grid-' + kind]: _ };
+    }
+    switch (params[0]) {
+      case 'span':
+        return (
+          params[1] && {
+            ['grid-' + kind]: `span ${params[1]} / span ${params[1]}`,
+          }
+        );
+
+      case 'start':
+      case 'end':
+        return (
+          (_ = theme2(
+            'grid' + capitalize(kind) + capitalize(params[0]),
+            tail(params),
+            join(tail(params))
+          )) && {
+            [`grid-${kind}-${params[0]}`]: _,
+          }
+        );
+    }
+  };
+var border = (params, { theme: theme2 }, id) => {
+  switch (params[0]) {
+    case 'solid':
+    case 'dashed':
+    case 'dotted':
+    case 'double':
+    case 'none':
+      return propertyValue('borderStyle')(params);
+    case 'collapse':
+    case 'separate':
+      return propertyValue('borderCollapse')(params);
+    case 'opacity':
+      return opacityProperty(params, theme2, id);
+  }
+
+  return (_ = theme2(id + 'Width', params, ''))
+    ? { borderWidth: _ }
+    : withOpacityFallback('borderColor', id, theme2(id + 'Color', params));
+};
+var transform = (gpu) =>
+  (gpu
+    ? 'translate3d(var(--tw-translate-x,0),var(--tw-translate-y,0),0)'
+    : 'translateX(var(--tw-translate-x,0)) translateY(var(--tw-translate-y,0))') +
+  ' rotate(var(--tw-rotate,0)) skewX(var(--tw-skew-x,0)) skewY(var(--tw-skew-y,0)) scaleX(var(--tw-scale-x,1)) scaleY(var(--tw-scale-y,1))';
+var transformXYFunction = (params, context, id) =>
+  params[0] &&
+  (_ = context.theme(id, params[1] || params[0])) && {
+    [`--tw-${id}-x`]: params[0] !== 'y' && _,
+    [`--tw-${id}-y`]: params[0] !== 'x' && _,
+    transform: [`${id}${params[1] ? params[0].toUpperCase() : ''}(${_})`, transform()],
+  };
+
+var edgesPluginFor = (key) => (params, context, id) =>
+  id[1]
+    ? edges(context.theme(key, params), id[1], key)
+    : themeProperty(key)(params, context, id);
+var padding = edgesPluginFor('padding');
+var margin = edgesPluginFor('margin');
+var minMax = (params, { theme: theme2 }, id) =>
+  (_ = { w: 'width', h: 'height' }[params[0]]) && {
+    [(_ = `${id}${capitalize(_)}`)]: theme2(_, tail(params)),
+  };
+
+var filter = (params, { theme: theme2 }, id) => {
+  const parts = id.split('-');
+  const prefix = parts[0] == 'backdrop' ? parts[0] + '-' : '';
+  if (!prefix) {
+    params.unshift(...parts);
+  }
+  if (params[0] == 'filter') {
+    const filters = [
+      'blur',
+      'brightness',
+      'contrast',
+      'grayscale',
+      'hue-rotate',
+      'invert',
+      prefix && 'opacity',
+      'saturate',
+      'sepia',
+      !prefix && 'drop-shadow',
+    ].filter(Boolean);
+    return params[1] == 'none'
+      ? { [prefix + 'filter']: 'none' }
+      : filters.reduce(
+          (css, key) => {
+            css['--tw-' + prefix + key] = 'var(--tw-empty,/*!*/ /*!*/)';
+            return css;
+          },
+          {
+            [prefix + 'filter']: filters.map((key) => `var(--tw-${prefix}${key})`).join(' '),
+          }
+        );
+  }
+  $ = params.shift();
+  if (includes(['hue', 'drop'], $)) $ += capitalize(params.shift());
+  return (
+    (_ = theme2(prefix ? 'backdrop' + capitalize($) : $, params)) && {
+      ['--tw-' + prefix + $]: (Array.isArray(_) ? _ : [_])
+        .map((_4) => `${hyphenate($)}(${_4})`)
+        .join(' '),
+    }
+  );
+};
+var corePlugins = {
+  group: (params, { tag }, id) => tag(join([id, ...params])),
+  hidden: alias(display, 'none'),
+  inline: display,
+  block: display,
+  contents: display,
+  flow: display,
+  table: (params, context, id) =>
+    includes(['auto', 'fixed'], params[0])
+      ? { tableLayout: params[0] }
+      : display(params, context, id),
+  flex(params, context, id) {
+    switch (params[0]) {
+      case 'row':
+      case 'col':
+        return {
+          flexDirection: join(params[0] == 'col' ? ['column', ...tail(params)] : params),
+        };
+
+      case 'nowrap':
+      case 'wrap':
+        return { flexWrap: join(params) };
+      case 'grow':
+      case 'shrink':
+        _ = context.theme('flex' + capitalize(params[0]), tail(params), params[1] || 1);
+        return (
+          _ != null && {
+            ['flex-' + params[0]]: '' + _,
+          }
+        );
+    }
+
+    return (_ = context.theme('flex', params, ''))
+      ? { flex: _ }
+      : display(params, context, id);
+  },
+  grid(params, context, id) {
+    switch (params[0]) {
+      case 'cols':
+      case 'rows':
+        return (
+          (_ = context.theme(
+            'gridTemplate' + capitalize(toColumnsOrRows(params[0])),
+            tail(params),
+            params.length == 2 && Number(params[1])
+              ? `repeat(${params[1]},minmax(0,1fr))`
+              : join(tail(params))
+          )) && {
+            ['gridTemplate-' + toColumnsOrRows(params[0])]: _,
+          }
+        );
+
+      case 'flow':
+        return (
+          params.length > 1 && {
+            gridAutoFlow: join(
+              params[1] == 'col' ? ['column', ...tail(params, 2)] : tail(params),
+              ' '
+            ),
+          }
+        );
+    }
+
+    return display(params, context, id);
+  },
+  auto: (params, { theme: theme2 }) =>
+    includes(['cols', 'rows'], params[0]) &&
+    (_ = theme2(
+      'gridAuto' + capitalize(toColumnsOrRows(params[0])),
+      tail(params),
+      join(tail(params))
+    )) && {
+      ['gridAuto-' + toColumnsOrRows(params[0])]: _,
+    },
+
+  static: position,
+  fixed: position,
+  absolute: position,
+  relative: position,
+  sticky: position,
+  visible: { visibility: 'visible' },
+  invisible: { visibility: 'hidden' },
+  antialiased: {
+    WebkitFontSmoothing: 'antialiased',
+    MozOsxFontSmoothing: 'grayscale',
+  },
+
+  'subpixel-antialiased': {
+    WebkitFontSmoothing: 'auto',
+    MozOsxFontSmoothing: 'auto',
+  },
+
+  truncate: {
+    overflow: 'hidden',
+    whiteSpace: 'nowrap',
+    textOverflow: 'ellipsis',
+  },
+
+  'sr-only': {
+    position: 'absolute',
+    width: '1px',
+    height: '1px',
+    padding: '0',
+    margin: '-1px',
+    overflow: 'hidden',
+    whiteSpace: 'nowrap',
+    clip: 'rect(0,0,0,0)',
+    borderWidth: '0',
+  },
+
+  'not-sr-only': {
+    position: 'static',
+    width: 'auto',
+    height: 'auto',
+    padding: '0',
+    margin: '0',
+    overflow: 'visible',
+    whiteSpace: 'normal',
+    clip: 'auto',
+  },
+
+  resize: (params) => ({
+    resize: { x: 'horizontal', y: 'vertical' }[params[0]] || params[0] || 'both',
+  }),
+
+  box: (params) => params[0] && { boxSizing: params[0] + '-box' },
+  appearance: propertyValue(),
+  cursor: themePropertyFallback(),
+  float: propertyValue(),
+  clear: propertyValue(),
+  decoration: propertyValue('boxDecorationBreak'),
+  isolate: { isolation: 'isolate' },
+  isolation: propertyValue(),
+  'mix-blend': propertyValue('mixBlendMode'),
+  top: inset,
+  right: inset,
+  bottom: inset,
+  left: inset,
+  inset: (params, { theme: theme2 }) =>
+    (_ = expandEdges(params[0]))
+      ? edges(theme2('inset', tail(params)), params[0])
+      : (_ = theme2('inset', params)) && {
+          top: _,
+          right: _,
+          bottom: _,
+          left: _,
+        },
+
+  underline: textDecoration,
+  'line-through': textDecoration,
+  'no-underline': alias(textDecoration, 'none'),
+  'text-underline': alias(textDecoration, 'underline'),
+  'text-no-underline': alias(textDecoration, 'none'),
+  'text-line-through': alias(textDecoration, 'line-through'),
+  uppercase: textTransform,
+  lowercase: textTransform,
+  capitalize: textTransform,
+  'normal-case': alias(textTransform, 'none'),
+  'text-normal-case': alias(textTransform, 'none'),
+  italic: fontStyle,
+  'not-italic': alias(fontStyle, 'normal'),
+  'font-italic': alias(fontStyle, 'italic'),
+  'font-not-italic': alias(fontStyle, 'normal'),
+  font: (params, context, id) =>
+    (_ = context.theme('fontFamily', params, ''))
+      ? { fontFamily: _ }
+      : themeProperty('fontWeight')(params, context, id),
+  items: (params) =>
+    params[0] && {
+      alignItems: includes(['start', 'end'], params[0]) ? 'flex-' + params[0] : join(params),
+    },
+
+  'justify-self': propertyValue(),
+  'justify-items': propertyValue(),
+  justify: contentPluginFor('justifyContent'),
+  content: contentPluginFor('alignContent'),
+  self: contentPluginFor('alignSelf'),
+  place: (params) => params[0] && placeHelper('place-' + params[0], tail(params)),
+  overscroll: (params) =>
+    params[0] && {
+      ['overscrollBehavior' + (params[1] ? '-' + params[0] : '')]: params[1] || params[0],
+    },
+
+  col: gridPlugin('column'),
+  row: gridPlugin('row'),
+  duration: themeProperty('transitionDuration'),
+  delay: themeProperty('transitionDelay'),
+  tracking: themeProperty('letterSpacing'),
+  leading: themeProperty('lineHeight'),
+  z: themeProperty('zIndex'),
+  opacity: themeProperty(),
+  ease: themeProperty('transitionTimingFunction'),
+  p: padding,
+  py: padding,
+  px: padding,
+  pt: padding,
+  pr: padding,
+  pb: padding,
+  pl: padding,
+  m: margin,
+  my: margin,
+  mx: margin,
+  mt: margin,
+  mr: margin,
+  mb: margin,
+  ml: margin,
+  w: themeProperty('width'),
+  h: themeProperty('height'),
+  min: minMax,
+  max: minMax,
+  fill: themeProperty(),
+  order: themeProperty(),
+  origin: themePropertyFallback('transformOrigin', ' '),
+  select: propertyValue('userSelect'),
+  'pointer-events': propertyValue(),
+  align: propertyValue('verticalAlign'),
+  whitespace: propertyValue('whiteSpace'),
+  'normal-nums': { fontVariantNumeric: 'normal' },
+  ordinal: fontVariantNumeric('ordinal'),
+  'slashed-zero': fontVariantNumeric('slashed-zero'),
+  'lining-nums': fontVariantNumeric('numeric-figure'),
+  'oldstyle-nums': fontVariantNumeric('numeric-figure'),
+  'proportional-nums': fontVariantNumeric('numeric-spacing'),
+  'tabular-nums': fontVariantNumeric('numeric-spacing'),
+  'diagonal-fractions': fontVariantNumeric('numeric-fraction'),
+  'stacked-fractions': fontVariantNumeric('numeric-fraction'),
+  overflow: (params, context, id) =>
+    includes(['ellipsis', 'clip'], params[0])
+      ? propertyValue('textOverflow')(params)
+      : params[1]
+      ? { ['overflow-' + params[0]]: params[1] }
+      : propertyValue()(params, context, id),
+  transform: (params) =>
+    params[0] == 'none'
+      ? { transform: 'none' }
+      : {
+          '--tw-translate-x': '0',
+          '--tw-translate-y': '0',
+          '--tw-rotate': '0',
+          '--tw-skew-x': '0',
+          '--tw-skew-y': '0',
+          '--tw-scale-x': '1',
+          '--tw-scale-y': '1',
+          transform: transform(params[0] == 'gpu'),
+        },
+
+  rotate: (params, { theme: theme2 }) =>
+    (_ = theme2('rotate', params)) && {
+      '--tw-rotate': _,
+      transform: [`rotate(${_})`, transform()],
+    },
+
+  scale: transformXYFunction,
+  translate: transformXYFunction,
+  skew: transformXYFunction,
+  gap: (params, context, id) =>
+    (_ = { x: 'column', y: 'row' }[params[0]])
+      ? { [_ + 'Gap']: context.theme('gap', tail(params)) }
+      : themeProperty('gap')(params, context, id),
+  stroke: (params, context, id) =>
+    (_ = context.theme('stroke', params, ''))
+      ? { stroke: _ }
+      : themeProperty('strokeWidth')(params, context, id),
+  outline: (params, { theme: theme2 }) =>
+    (_ = theme2('outline', params)) && {
+      outline: _[0],
+      outlineOffset: _[1],
+    },
+
+  'break-normal': {
+    wordBreak: 'normal',
+    overflowWrap: 'normal',
+  },
+
+  'break-words': { overflowWrap: 'break-word' },
+  'break-all': { wordBreak: 'break-all' },
+  text(params, { theme: theme2 }, id) {
+    switch (params[0]) {
+      case 'left':
+      case 'center':
+      case 'right':
+      case 'justify':
+        return { textAlign: params[0] };
+      case 'uppercase':
+      case 'lowercase':
+      case 'capitalize':
+        return textTransform([], _, params[0]);
+      case 'opacity':
+        return opacityProperty(params, theme2, id);
+    }
+
+    const fontSize = theme2('fontSize', params, '');
+    if (fontSize) {
+      return typeof fontSize == 'string'
+        ? { fontSize }
+        : {
+            fontSize: fontSize[0],
+            ...(typeof fontSize[1] == 'string' ? { lineHeight: fontSize[1] } : fontSize[1]),
+          };
+    }
+    return withOpacityFallback('color', 'text', theme2('textColor', params));
+  },
+  bg(params, { theme: theme2 }, id) {
+    switch (params[0]) {
+      case 'fixed':
+      case 'local':
+      case 'scroll':
+        return propertyValue('backgroundAttachment', ',')(params);
+      case 'bottom':
+      case 'center':
+      case 'left':
+      case 'right':
+      case 'top':
+        return propertyValue('backgroundPosition', ' ')(params);
+      case 'no':
+        return params[1] == 'repeat' && propertyValue('backgroundRepeat')(params);
+      case 'repeat':
+        return includes('xy', params[1])
+          ? propertyValue('backgroundRepeat')(params)
+          : { backgroundRepeat: params[1] || params[0] };
+      case 'opacity':
+        return opacityProperty(params, theme2, id, 'background');
+      case 'clip':
+      case 'origin':
+        return (
+          params[1] && {
+            ['background-' + params[0]]: params[1] + (params[1] == 'text' ? '' : '-box'),
+          }
+        );
+
+      case 'blend':
+        return propertyValue('background-blend-mode')(tail(params));
+      case 'gradient':
+        if (params[1] == 'to' && (_ = expandEdges(params[2]))) {
+          return {
+            backgroundImage: `linear-gradient(to ${join(_, ' ')},var(--tw-gradient-stops))`,
+          };
+        }
+    }
+
+    return (_ = theme2('backgroundPosition', params, ''))
+      ? { backgroundPosition: _ }
+      : (_ = theme2('backgroundSize', params, ''))
+      ? { backgroundSize: _ }
+      : (_ = theme2('backgroundImage', params, ''))
+      ? { backgroundImage: _ }
+      : withOpacityFallback('backgroundColor', 'bg', theme2('backgroundColor', params));
+  },
+  from: (params, { theme: theme2 }) =>
+    (_ = theme2('gradientColorStops', params)) && {
+      '--tw-gradient-from': _,
+      '--tw-gradient-stops': `var(--tw-gradient-from),var(--tw-gradient-to,${transparentTo(
+        _
+      )})`,
+    },
+
+  via: (params, { theme: theme2 }) =>
+    (_ = theme2('gradientColorStops', params)) && {
+      '--tw-gradient-stops': `var(--tw-gradient-from),${_},var(--tw-gradient-to,${transparentTo(
+        _
+      )})`,
+    },
+
+  to: (params, { theme: theme2 }) =>
+    (_ = theme2('gradientColorStops', params)) && {
+      '--tw-gradient-to': _,
+    },
+
+  border: (params, context, id) =>
+    expandEdges(params[0])
+      ? edges(context.theme('borderWidth', tail(params)), params[0], 'border', 'width')
+      : border(params, context, id),
+  divide: (params, context, id) =>
+    (_ =
+      reversableEdge(params, context, id, 'divideWidth', 'border', 'width') ||
+      border(params, context, id)) && {
+      '&>:not([hidden])~:not([hidden])': _,
+    },
+
+  space: (params, context, id) =>
+    (_ = reversableEdge(params, context, id, 'space', 'margin')) && {
+      '&>:not([hidden])~:not([hidden])': _,
+    },
+
+  placeholder: (params, { theme: theme2 }, id) =>
+    (_ =
+      params[0] == 'opacity'
+        ? opacityProperty(params, theme2, id)
+        : withOpacityFallback('color', 'placeholder', theme2('placeholderColor', params))) && {
+      '&::placeholder': _,
+    },
+
+  shadow: (params, { theme: theme2 }) =>
+    (_ = theme2('boxShadow', params)) && {
+      ':global': {
+        '*': {
+          '--tw-shadow': '0 0 transparent',
+        },
+      },
+
+      '--tw-shadow': _ == 'none' ? '0 0 transparent' : _,
+      boxShadow: [
+        _,
+        `var(--tw-ring-offset-shadow,0 0 transparent),var(--tw-ring-shadow,0 0 transparent),var(--tw-shadow)`,
+      ],
+    },
+
+  animate: (params, { theme: theme2, tag }) => {
+    if (($ = theme2('animation', params))) {
+      const parts = $.split(' ');
+      if ((_ = theme2('keyframes', parts[0], (__ = {}))) !== __) {
+        return (
+          ($ = tag(parts[0])) && {
+            animation: $ + ' ' + join(tail(parts), ' '),
+            ['@keyframes ' + $]: _,
+          }
+        );
+      }
+      return { animation: $ };
+    }
+  },
+  ring(params, { theme: theme2 }, id) {
+    switch (params[0]) {
+      case 'inset':
+        return { '--tw-ring-inset': 'inset' };
+      case 'opacity':
+        return opacityProperty(params, theme2, id);
+      case 'offset':
+        return (_ = theme2('ringOffsetWidth', tail(params), ''))
+          ? {
+              '--tw-ring-offset-width': _,
+            }
+          : {
+              '--tw-ring-offset-color': theme2('ringOffsetColor', tail(params)),
+            };
+    }
+
+    return (_ = theme2('ringWidth', params, ''))
+      ? {
+          '--tw-ring-offset-shadow': `var(--tw-ring-inset) 0 0 0 var(--tw-ring-offset-width) var(--tw-ring-offset-color)`,
+          '--tw-ring-shadow': `var(--tw-ring-inset) 0 0 0 calc(${_} + var(--tw-ring-offset-width)) var(--tw-ring-color)`,
+          boxShadow: `var(--tw-ring-offset-shadow),var(--tw-ring-shadow),var(--tw-shadow,0 0 transparent)`,
+          ':global': {
+            '*': {
+              '--tw-ring-inset': 'var(--tw-empty,/*!*/ /*!*/)',
+              '--tw-ring-offset-width': theme2('ringOffsetWidth', '', '0px'),
+              '--tw-ring-offset-color': theme2('ringOffsetColor', '', '#fff'),
+              '--tw-ring-color': asRGBA(
+                theme2('ringColor', '', '#93c5fd'),
+                'ring-opacity',
+                theme2('ringOpacity', '', '0.5')
+              ),
+              '--tw-ring-offset-shadow': '0 0 transparent',
+              '--tw-ring-shadow': '0 0 transparent',
+            },
+          },
+        }
+      : {
+          '--tw-ring-opacity': '1',
+          '--tw-ring-color': asRGBA(theme2('ringColor', params), 'ring-opacity'),
+        };
+  },
+  object: (params, context, id) =>
+    includes(['contain', 'cover', 'fill', 'none', 'scale-down'], join(params))
+      ? { objectFit: join(params) }
+      : themePropertyFallback('objectPosition', ' ')(params, context, id),
+  list: (params, context, id) =>
+    join(params) == 'item'
+      ? display(params, context, id)
+      : includes(['inside', 'outside'], join(params))
+      ? { listStylePosition: params[0] }
+      : themePropertyFallback('listStyleType')(params, context, id),
+  rounded: (params, context, id) =>
+    corners(context.theme('borderRadius', tail(params), ''), params[0], 'border', 'radius') ||
+    themeProperty('borderRadius')(params, context, id),
+  'transition-none': { transitionProperty: 'none' },
+  transition: (params, { theme: theme2 }) => ({
+    transitionProperty: theme2('transitionProperty', params),
+    transitionTimingFunction: theme2('transitionTimingFunction', ''),
+    transitionDuration: theme2('transitionDuration', ''),
+  }),
+
+  container: (params, { theme: theme2 }) => {
+    const { screens = theme2('screens'), center, padding: padding2 } = theme2('container');
+    const paddingFor = (screen) =>
+      (_ =
+        padding2 &&
+        (typeof padding2 == 'string' ? padding2 : padding2[screen] || padding2.DEFAULT))
+        ? {
+            paddingRight: _,
+            paddingLeft: _,
+          }
+        : {};
+    return Object.keys(screens).reduce(
+      (rules2, screen) => {
+        if (($ = screens[screen]) && typeof $ == 'string') {
+          rules2[buildMediaQuery($)] = {
+            '&': {
+              'max-width': $,
+              ...paddingFor(screen),
+            },
+          };
+        }
+        return rules2;
+      },
+      {
+        width: '100%',
+        ...(center ? { marginRight: 'auto', marginLeft: 'auto' } : {}),
+        ...paddingFor('xs'),
+      }
+    );
+  },
+  filter,
+  blur: filter,
+  brightness: filter,
+  contrast: filter,
+  grayscale: filter,
+  'hue-rotate': filter,
+  invert: filter,
+  saturate: filter,
+  sepia: filter,
+  'drop-shadow': filter,
+  backdrop: filter,
+};
+
+// src/twind/preflight.ts
+var createPreflight = (theme2) => ({
+  ':root': { tabSize: 4 },
+  'body,blockquote,dl,dd,h1,h2,h3,h4,h5,h6,hr,figure,p,pre,fieldset,ol,ul': { margin: '0' },
+  button: { backgroundColor: 'transparent', backgroundImage: 'none' },
+  'button,[type="button"],[type="reset"],[type="submit"]': { WebkitAppearance: 'button' },
+  'button:focus': { outline: ['1px dotted', '5px auto -webkit-focus-ring-color'] },
+  'fieldset,ol,ul,legend': { padding: '0' },
+  'ol,ul': { listStyle: 'none' },
+  html: {
+    lineHeight: '1.5',
+    WebkitTextSizeAdjust: '100%',
+    fontFamily: theme2('fontFamily.sans', 'ui-sans-serif,system-ui,sans-serif'),
+  },
+
+  body: { fontFamily: 'inherit', lineHeight: 'inherit' },
+  '*,::before,::after': {
+    boxSizing: 'border-box',
+    border: `0 solid ${theme2('borderColor.DEFAULT', 'currentColor')}`,
+  },
+
+  hr: { height: '0', color: 'inherit', borderTopWidth: '1px' },
+  img: { borderStyle: 'solid' },
+  textarea: { resize: 'vertical' },
+  'input::placeholder,textarea::placeholder': {
+    opacity: '1',
+    color: theme2('placeholderColor.DEFAULT', theme2('colors.gray.400', '#a1a1aa')),
+  },
+
+  'button,[role="button"]': { cursor: 'pointer' },
+  table: { textIndent: '0', borderColor: 'inherit', borderCollapse: 'collapse' },
+  'h1,h2,h3,h4,h5,h6': { fontSize: 'inherit', fontWeight: 'inherit' },
+  a: { color: 'inherit', textDecoration: 'inherit' },
+  'button,input,optgroup,select,textarea': {
+    fontFamily: 'inherit',
+    fontSize: '100%',
+    margin: '0',
+    padding: '0',
+    lineHeight: 'inherit',
+    color: 'inherit',
+  },
+
+  'button,select': { textTransform: 'none' },
+  '::-moz-focus-inner': { borderStyle: 'none', padding: '0' },
+  ':-moz-focusring': { outline: '1px dotted ButtonText' },
+  ':-moz-ui-invalid': { boxShadow: 'none' },
+  progress: { verticalAlign: 'baseline' },
+  '::-webkit-inner-spin-button,::-webkit-outer-spin-button': { height: 'auto' },
+  '[type="search"]': { WebkitAppearance: 'textfield', outlineOffset: '-2px' },
+  '::-webkit-search-decoration': { WebkitAppearance: 'none' },
+  '::-webkit-file-upload-button': { WebkitAppearance: 'button', font: 'inherit' },
+  summary: { display: 'list-item' },
+  'abbr[title]': { textDecoration: 'underline dotted' },
+  'b,strong': { fontWeight: 'bolder' },
+  'pre,code,kbd,samp': {
+    fontFamily: theme2('fontFamily', 'mono', 'ui-monospace,monospace'),
+    fontSize: '1em',
+  },
+
+  'sub,sup': {
+    fontSize: '75%',
+    lineHeight: '0',
+    position: 'relative',
+    verticalAlign: 'baseline',
+  },
+  sub: { bottom: '-0.25em' },
+  sup: { top: '-0.5em' },
+  'img,svg,video,canvas,audio,iframe,embed,object': {
+    display: 'block',
+    verticalAlign: 'middle',
+  },
+  'img,video': { maxWidth: '100%', height: 'auto' },
+});
+
+// src/twind/variants.ts
+var coreVariants = {
+  dark: '@media (prefers-color-scheme:dark)',
+  sticky: '@supports ((position: -webkit-sticky) or (position:sticky))',
+  'motion-reduce': '@media (prefers-reduced-motion:reduce)',
+  'motion-safe': '@media (prefers-reduced-motion:no-preference)',
+  first: '&:first-child',
+  last: '&:last-child',
+  even: '&:nth-child(2n)',
+  odd: '&:nth-child(odd)',
+  children: '&>*',
+  siblings: '&~*',
+  sibling: '&+*',
+  override: '&&',
+};
+
+// src/internal/dom.ts
+var STYLE_ELEMENT_ID = '__twind';
+var getStyleElement = (nonce) => {
+  let element = self[STYLE_ELEMENT_ID];
+  if (!element) {
+    element = document.head.appendChild(document.createElement('style'));
+    element.id = STYLE_ELEMENT_ID;
+    nonce && (element.nonce = nonce);
+    element.appendChild(document.createTextNode(''));
+  }
+  return element;
+};
+
+// src/twind/sheets.ts
+var cssomSheet = ({ nonce, target = getStyleElement(nonce).sheet } = {}) => {
+  const offset = target.cssRules.length;
+  return {
+    target,
+    insert: (rule, index) => target.insertRule(rule, offset + index),
+  };
+};
+var voidSheet = () => ({
+  target: null,
+  insert: noop,
+});
+
+// src/twind/modes.ts
+var mode = (report) => ({
+  unknown(section, key = [], optional, context) {
+    if (!optional) {
+      this.report({ id: 'UNKNOWN_THEME_VALUE', key: section + '.' + join(key) }, context);
+    }
+  },
+  report({ id, ...info }) {
+    return report(`[${id}] ${JSON.stringify(info)}`);
+  },
+});
+
+var warn = /* @__PURE__ */ mode((message) => console.warn(message));
+var strict = /* @__PURE__ */ mode((message) => {
+  throw new Error(message);
+});
+var silent = /* @__PURE__ */ mode(noop);
+
+// src/twind/prefix.ts
+import {
+  cssPropertyAlias,
+  cssPropertyPrefixFlags,
+  cssValuePrefixFlags,
+} from './style-vendorizer.mjs';
+var noprefix = (property2, value, important) =>
+  `${property2}:${value}${important ? ' !important' : ''}`;
+var autoprefix = (property2, value, important) => {
+  let cssText = '';
+  const propertyAlias = cssPropertyAlias(property2);
+  if (propertyAlias) cssText += `${noprefix(propertyAlias, value, important)};`;
+  let flags = cssPropertyPrefixFlags(property2);
+  if (flags & 1) cssText += `-webkit-${noprefix(property2, value, important)};`;
+  if (flags & 2) cssText += `-moz-${noprefix(property2, value, important)};`;
+  if (flags & 4) cssText += `-ms-${noprefix(property2, value, important)};`;
+  flags = cssValuePrefixFlags(property2, value);
+  if (flags & 1) cssText += `${noprefix(property2, `-webkit-${value}`, important)};`;
+  if (flags & 2) cssText += `${noprefix(property2, `-moz-${value}`, important)};`;
+  if (flags & 4) cssText += `${noprefix(property2, `-ms-${value}`, important)};`;
+  cssText += noprefix(property2, value, important);
+  return cssText;
+};
+
+// src/twind/theme.ts
+var ratios = (start, end) => {
+  const result = {};
+  do {
+    for (let dividend = 1; dividend < start; dividend++) {
+      result[`${dividend}/${start}`] = Number(((dividend / start) * 100).toFixed(6)) + '%';
+    }
+  } while (++start <= end);
+  return result;
+};
+var exponential = (stop, unit, start = 0) => {
+  const result = {};
+  for (; start <= stop; start = start * 2 || 1) {
+    result[start] = start + unit;
+  }
+  return result;
+};
+var linear = (stop, unit = '', divideBy = 1, start = 0, step = 1, result = {}) => {
+  for (; start <= stop; start += step) {
+    result[start] = start / divideBy + unit;
+  }
+  return result;
+};
+var alias2 = (section) => (theme2) => theme2(section);
+var themeFactory = (args, { theme: theme2 }) => theme2(...args);
+var theme = (...args) => directive(themeFactory, args);
+var defaultTheme = {
+  screens: {
+    sm: '640px',
+    md: '768px',
+    lg: '1024px',
+    xl: '1280px',
+    '2xl': '1536px',
+  },
+
+  colors: {
+    transparent: 'transparent',
+    current: 'currentColor',
+    black: '#000',
+    white: '#fff',
+    gray: {
+      50: '#f9fafb',
+      100: '#f3f4f6',
+      200: '#e5e7eb',
+      300: '#d1d5db',
+      400: '#9ca3af',
+      500: '#6b7280',
+      600: '#4b5563',
+      700: '#374151',
+      800: '#1f2937',
+      900: '#111827',
+    },
+
+    red: {
+      50: '#fef2f2',
+      100: '#fee2e2',
+      200: '#fecaca',
+      300: '#fca5a5',
+      400: '#f87171',
+      500: '#ef4444',
+      600: '#dc2626',
+      700: '#b91c1c',
+      800: '#991b1b',
+      900: '#7f1d1d',
+    },
+
+    yellow: {
+      50: '#fffbeb',
+      100: '#fef3c7',
+      200: '#fde68a',
+      300: '#fcd34d',
+      400: '#fbbf24',
+      500: '#f59e0b',
+      600: '#d97706',
+      700: '#b45309',
+      800: '#92400e',
+      900: '#78350f',
+    },
+
+    green: {
+      50: '#ecfdf5',
+      100: '#d1fae5',
+      200: '#a7f3d0',
+      300: '#6ee7b7',
+      400: '#34d399',
+      500: '#10b981',
+      600: '#059669',
+      700: '#047857',
+      800: '#065f46',
+      900: '#064e3b',
+    },
+
+    blue: {
+      50: '#eff6ff',
+      100: '#dbeafe',
+      200: '#bfdbfe',
+      300: '#93c5fd',
+      400: '#60a5fa',
+      500: '#3b82f6',
+      600: '#2563eb',
+      700: '#1d4ed8',
+      800: '#1e40af',
+      900: '#1e3a8a',
+    },
+
+    indigo: {
+      50: '#eef2ff',
+      100: '#e0e7ff',
+      200: '#c7d2fe',
+      300: '#a5b4fc',
+      400: '#818cf8',
+      500: '#6366f1',
+      600: '#4f46e5',
+      700: '#4338ca',
+      800: '#3730a3',
+      900: '#312e81',
+    },
+
+    purple: {
+      50: '#f5f3ff',
+      100: '#ede9fe',
+      200: '#ddd6fe',
+      300: '#c4b5fd',
+      400: '#a78bfa',
+      500: '#8b5cf6',
+      600: '#7c3aed',
+      700: '#6d28d9',
+      800: '#5b21b6',
+      900: '#4c1d95',
+    },
+
+    pink: {
+      50: '#fdf2f8',
+      100: '#fce7f3',
+      200: '#fbcfe8',
+      300: '#f9a8d4',
+      400: '#f472b6',
+      500: '#ec4899',
+      600: '#db2777',
+      700: '#be185d',
+      800: '#9d174d',
+      900: '#831843',
+    },
+  },
+
+  spacing: {
+    px: '1px',
+    0: '0px',
+    .../* @__PURE__ */ linear(4, 'rem', 4, 0.5, 0.5),
+    .../* @__PURE__ */ linear(12, 'rem', 4, 5),
+    14: '3.5rem',
+    .../* @__PURE__ */ linear(64, 'rem', 4, 16, 4),
+    72: '18rem',
+    80: '20rem',
+    96: '24rem',
+  },
+
+  durations: {
+    75: '75ms',
+    100: '100ms',
+    150: '150ms',
+    200: '200ms',
+    300: '300ms',
+    500: '500ms',
+    700: '700ms',
+    1e3: '1000ms',
+  },
+
+  animation: {
+    none: 'none',
+    spin: 'spin 1s linear infinite',
+    ping: 'ping 1s cubic-bezier(0, 0, 0.2, 1) infinite',
+    pulse: 'pulse 2s cubic-bezier(0.4, 0, 0.6, 1) infinite',
+    bounce: 'bounce 1s infinite',
+  },
+
+  backdropBlur: /* @__PURE__ */ alias2('blur'),
+  backdropBrightness: /* @__PURE__ */ alias2('brightness'),
+  backdropContrast: /* @__PURE__ */ alias2('contrast'),
+  backdropGrayscale: /* @__PURE__ */ alias2('grayscale'),
+  backdropHueRotate: /* @__PURE__ */ alias2('hueRotate'),
+  backdropInvert: /* @__PURE__ */ alias2('invert'),
+  backdropOpacity: /* @__PURE__ */ alias2('opacity'),
+  backdropSaturate: /* @__PURE__ */ alias2('saturate'),
+  backdropSepia: /* @__PURE__ */ alias2('sepia'),
+  backgroundColor: /* @__PURE__ */ alias2('colors'),
+  backgroundImage: {
+    none: 'none',
+  },
+
+  backgroundOpacity: /* @__PURE__ */ alias2('opacity'),
+  backgroundSize: {
+    auto: 'auto',
+    cover: 'cover',
+    contain: 'contain',
+  },
+
+  blur: {
+    0: '0',
+    sm: '4px',
+    DEFAULT: '8px',
+    md: '12px',
+    lg: '16px',
+    xl: '24px',
+    '2xl': '40px',
+    '3xl': '64px',
+  },
+
+  brightness: {
+    .../* @__PURE__ */ linear(200, '', 100, 0, 50),
+    .../* @__PURE__ */ linear(110, '', 100, 90, 5),
+    75: '0.75',
+    125: '1.25',
+  },
+
+  borderColor: (theme2) => ({
+    ...theme2('colors'),
+    DEFAULT: theme2('colors.gray.200', 'currentColor'),
+  }),
+
+  borderOpacity: /* @__PURE__ */ alias2('opacity'),
+  borderRadius: {
+    none: '0px',
+    sm: '0.125rem',
+    DEFAULT: '0.25rem',
+    md: '0.375rem',
+    lg: '0.5rem',
+    xl: '0.75rem',
+    '2xl': '1rem',
+    '3xl': '1.5rem',
+    '1/2': '50%',
+    full: '9999px',
+  },
+
+  borderWidth: {
+    DEFAULT: '1px',
+    .../* @__PURE__ */ exponential(8, 'px'),
+  },
+
+  boxShadow: {
+    sm: '0 1px 2px 0 rgba(0, 0, 0, 0.05)',
+    DEFAULT: '0 1px 3px 0 rgba(0, 0, 0, 0.1), 0 1px 2px 0 rgba(0, 0, 0, 0.06)',
+    md: '0 4px 6px -1px rgba(0, 0, 0, 0.1), 0 2px 4px -1px rgba(0, 0, 0, 0.06)',
+    lg: '0 10px 15px -3px rgba(0, 0, 0, 0.1), 0 4px 6px -2px rgba(0, 0, 0, 0.05)',
+    xl: '0 20px 25px -5px rgba(0, 0, 0, 0.1), 0 10px 10px -5px rgba(0, 0, 0, 0.04)',
+    '2xl': '0 25px 50px -12px rgba(0, 0, 0, 0.25)',
+    inner: 'inset 0 2px 4px 0 rgba(0, 0, 0, 0.06)',
+    none: 'none',
+  },
+
+  contrast: {
+    .../* @__PURE__ */ linear(200, '', 100, 0, 50),
+    75: '0.75',
+    125: '1.25',
+  },
+
+  divideColor: /* @__PURE__ */ alias2('borderColor'),
+  divideOpacity: /* @__PURE__ */ alias2('borderOpacity'),
+  divideWidth: /* @__PURE__ */ alias2('borderWidth'),
+  dropShadow: {
+    sm: '0 1px 1px rgba(0,0,0,0.05)',
+    DEFAULT: ['0 1px 2px rgba(0, 0, 0, 0.1)', '0 1px 1px rgba(0, 0, 0, 0.06)'],
+    md: ['0 4px 3px rgba(0, 0, 0, 0.07)', '0 2px 2px rgba(0, 0, 0, 0.06)'],
+    lg: ['0 10px 8px rgba(0, 0, 0, 0.04)', '0 4px 3px rgba(0, 0, 0, 0.1)'],
+    xl: ['0 20px 13px rgba(0, 0, 0, 0.03)', '0 8px 5px rgba(0, 0, 0, 0.08)'],
+    '2xl': '0 25px 25px rgba(0, 0, 0, 0.15)',
+    none: '0 0 #0000',
+  },
+
+  fill: { current: 'currentColor' },
+  grayscale: {
+    0: '0',
+    DEFAULT: '100%',
+  },
+
+  hueRotate: {
+    0: '0deg',
+    15: '15deg',
+    30: '30deg',
+    60: '60deg',
+    90: '90deg',
+    180: '180deg',
+  },
+
+  invert: {
+    0: '0',
+    DEFAULT: '100%',
+  },
+
+  flex: {
+    1: '1 1 0%',
+    auto: '1 1 auto',
+    initial: '0 1 auto',
+    none: 'none',
+  },
+
+  fontFamily: {
+    sans: 'ui-sans-serif,system-ui,-apple-system,BlinkMacSystemFont,"Segoe UI",Roboto,"Helvetica Neue",Arial,"Noto Sans",sans-serif,"Apple Color Emoji","Segoe UI Emoji","Segoe UI Symbol","Noto Color Emoji"'.split(
+      ','
+    ),
+    serif: 'ui-serif,Georgia,Cambria,"Times New Roman",Times,serif'.split(','),
+    mono: 'ui-monospace,SFMono-Regular,Menlo,Monaco,Consolas,"Liberation Mono","Courier New",monospace'.split(
+      ','
+    ),
+  },
+
+  fontSize: {
+    xs: ['0.75rem', '1rem'],
+    sm: ['0.875rem', '1.25rem'],
+    base: ['1rem', '1.5rem'],
+    lg: ['1.125rem', '1.75rem'],
+    xl: ['1.25rem', '1.75rem'],
+    '2xl': ['1.5rem', '2rem'],
+    '3xl': ['1.875rem', '2.25rem'],
+    '4xl': ['2.25rem', '2.5rem'],
+    '5xl': ['3rem', '1'],
+    '6xl': ['3.75rem', '1'],
+    '7xl': ['4.5rem', '1'],
+    '8xl': ['6rem', '1'],
+    '9xl': ['8rem', '1'],
+  },
+
+  fontWeight: {
+    thin: '100',
+    extralight: '200',
+    light: '300',
+    normal: '400',
+    medium: '500',
+    semibold: '600',
+    bold: '700',
+    extrabold: '800',
+    black: '900',
+  },
+
+  gridTemplateColumns: {},
+  gridTemplateRows: {},
+  gridAutoColumns: {
+    min: 'min-content',
+    max: 'max-content',
+    fr: 'minmax(0,1fr)',
+  },
+
+  gridAutoRows: {
+    min: 'min-content',
+    max: 'max-content',
+    fr: 'minmax(0,1fr)',
+  },
+
+  gridColumn: {
+    auto: 'auto',
+    'span-full': '1 / -1',
+  },
+
+  gridRow: {
+    auto: 'auto',
+    'span-full': '1 / -1',
+  },
+
+  gap: /* @__PURE__ */ alias2('spacing'),
+  gradientColorStops: /* @__PURE__ */ alias2('colors'),
+  height: (theme2) => ({
+    auto: 'auto',
+    ...theme2('spacing'),
+    ...ratios(2, 6),
+    full: '100%',
+    screen: '100vh',
+  }),
+
+  inset: (theme2) => ({
+    auto: 'auto',
+    ...theme2('spacing'),
+    ...ratios(2, 4),
+    full: '100%',
+  }),
+
+  keyframes: {
+    spin: {
+      from: {
+        transform: 'rotate(0deg)',
+      },
+
+      to: {
+        transform: 'rotate(360deg)',
+      },
+    },
+
+    ping: {
+      '0%': {
+        transform: 'scale(1)',
+        opacity: '1',
+      },
+
+      '75%,100%': {
+        transform: 'scale(2)',
+        opacity: '0',
+      },
+    },
+
+    pulse: {
+      '0%,100%': {
+        opacity: '1',
+      },
+
+      '50%': {
+        opacity: '.5',
+      },
+    },
+
+    bounce: {
+      '0%, 100%': {
+        transform: 'translateY(-25%)',
+        animationTimingFunction: 'cubic-bezier(0.8,0,1,1)',
+      },
+
+      '50%': {
+        transform: 'none',
+        animationTimingFunction: 'cubic-bezier(0,0,0.2,1)',
+      },
+    },
+  },
+
+  letterSpacing: {
+    tighter: '-0.05em',
+    tight: '-0.025em',
+    normal: '0em',
+    wide: '0.025em',
+    wider: '0.05em',
+    widest: '0.1em',
+  },
+
+  lineHeight: {
+    none: '1',
+    tight: '1.25',
+    snug: '1.375',
+    normal: '1.5',
+    relaxed: '1.625',
+    loose: '2',
+    .../* @__PURE__ */ linear(10, 'rem', 4, 3),
+  },
+
+  margin: (theme2) => ({
+    auto: 'auto',
+    ...theme2('spacing'),
+  }),
+
+  maxHeight: (theme2) => ({
+    ...theme2('spacing'),
+    full: '100%',
+    screen: '100vh',
+  }),
+
+  maxWidth: (theme2, { breakpoints }) => ({
+    none: 'none',
+    0: '0rem',
+    xs: '20rem',
+    sm: '24rem',
+    md: '28rem',
+    lg: '32rem',
+    xl: '36rem',
+    '2xl': '42rem',
+    '3xl': '48rem',
+    '4xl': '56rem',
+    '5xl': '64rem',
+    '6xl': '72rem',
+    '7xl': '80rem',
+    full: '100%',
+    min: 'min-content',
+    max: 'max-content',
+    prose: '65ch',
+    ...breakpoints(theme2('screens')),
+  }),
+
+  minHeight: {
+    0: '0px',
+    full: '100%',
+    screen: '100vh',
+  },
+
+  minWidth: {
+    0: '0px',
+    full: '100%',
+    min: 'min-content',
+    max: 'max-content',
+  },
+
+  opacity: {
+    .../* @__PURE__ */ linear(100, '', 100, 0, 10),
+    5: '0.05',
+    25: '0.25',
+    75: '0.75',
+    95: '0.95',
+  },
+
+  order: {
+    first: '-9999',
+    last: '9999',
+    none: '0',
+    .../* @__PURE__ */ linear(12, '', 1, 1),
+  },
+
+  outline: {
+    none: ['2px solid transparent', '2px'],
+    white: ['2px dotted white', '2px'],
+    black: ['2px dotted black', '2px'],
+  },
+
+  padding: /* @__PURE__ */ alias2('spacing'),
+  placeholderColor: /* @__PURE__ */ alias2('colors'),
+  placeholderOpacity: /* @__PURE__ */ alias2('opacity'),
+  ringColor: (theme2) => ({
+    DEFAULT: theme2('colors.blue.500', '#3b82f6'),
+    ...theme2('colors'),
+  }),
+
+  ringOffsetColor: /* @__PURE__ */ alias2('colors'),
+  ringOffsetWidth: /* @__PURE__ */ exponential(8, 'px'),
+  ringOpacity: (theme2) => ({
+    DEFAULT: '0.5',
+    ...theme2('opacity'),
+  }),
+
+  ringWidth: {
+    DEFAULT: '3px',
+    .../* @__PURE__ */ exponential(8, 'px'),
+  },
+
+  rotate: {
+    .../* @__PURE__ */ exponential(2, 'deg'),
+    .../* @__PURE__ */ exponential(12, 'deg', 3),
+    .../* @__PURE__ */ exponential(180, 'deg', 45),
+  },
+
+  saturate: /* @__PURE__ */ linear(200, '', 100, 0, 50),
+  scale: {
+    .../* @__PURE__ */ linear(150, '', 100, 0, 50),
+    .../* @__PURE__ */ linear(110, '', 100, 90, 5),
+    75: '0.75',
+    125: '1.25',
+  },
+
+  sepia: {
+    0: '0',
+    DEFAULT: '100%',
+  },
+
+  skew: {
+    .../* @__PURE__ */ exponential(2, 'deg'),
+    .../* @__PURE__ */ exponential(12, 'deg', 3),
+  },
+
+  space: /* @__PURE__ */ alias2('spacing'),
+  stroke: {
+    current: 'currentColor',
+  },
+
+  strokeWidth: /* @__PURE__ */ linear(2),
+  textColor: /* @__PURE__ */ alias2('colors'),
+  textOpacity: /* @__PURE__ */ alias2('opacity'),
+  transitionDuration: (theme2) => ({
+    DEFAULT: '150ms',
+    ...theme2('durations'),
+  }),
+
+  transitionDelay: /* @__PURE__ */ alias2('durations'),
+  transitionProperty: {
+    none: 'none',
+    all: 'all',
+    DEFAULT:
+      'background-color,border-color,color,fill,stroke,opacity,box-shadow,transform,filter,backdrop-filter',
+    colors: 'background-color,border-color,color,fill,stroke',
+    opacity: 'opacity',
+    shadow: 'box-shadow',
+    transform: 'transform',
+  },
+
+  transitionTimingFunction: {
+    DEFAULT: 'cubic-bezier(0.4,0,0.2,1)',
+    linear: 'linear',
+    in: 'cubic-bezier(0.4,0,1,1)',
+    out: 'cubic-bezier(0,0,0.2,1)',
+    'in-out': 'cubic-bezier(0.4,0,0.2,1)',
+  },
+
+  translate: (theme2) => ({
+    ...theme2('spacing'),
+    ...ratios(2, 4),
+    full: '100%',
+  }),
+
+  width: (theme2) => ({
+    auto: 'auto',
+    ...theme2('spacing'),
+    ...ratios(2, 6),
+    ...ratios(12, 12),
+    screen: '100vw',
+    full: '100%',
+    min: 'min-content',
+    max: 'max-content',
+  }),
+
+  zIndex: {
+    auto: 'auto',
+    .../* @__PURE__ */ linear(50, '', 1, 0, 10),
+  },
+};
+
+var flattenColorPalette = (colors, target = {}, prefix = []) => {
+  Object.keys(colors).forEach((property2) => {
+    const value = colors[property2];
+    if (property2 == 'DEFAULT') {
+      target[join(prefix)] = value;
+      target[join(prefix, '.')] = value;
+    }
+    const key = [...prefix, property2];
+    target[join(key)] = value;
+    target[join(key, '.')] = value;
+    if (value && typeof value == 'object') {
+      flattenColorPalette(value, target, key);
+    }
+  }, target);
+  return target;
+};
+var resolveContext = {
+  negative: () => ({}),
+  breakpoints: (screens) =>
+    Object.keys(screens)
+      .filter((key) => typeof screens[key] == 'string')
+      .reduce((target, key) => {
+        target['screen-' + key] = screens[key];
+        return target;
+      }, {}),
+};
+
+var handleArbitraryValues = (section, key) =>
+  (key = key[0] == '[' && key.slice(-1) == ']' && key.slice(1, -1)) &&
+  includes(section, 'olor') == /^(#|(hsl|rgb)a?\(|[a-z]+$)/.test(key) &&
+  (includes(key, 'calc(')
+    ? key.replace(
+        /(-?\d*\.?\d(?!\b-.+[,)](?![^+\-/*])\D)(?:%|[a-z]+)?|\))([+\-/*])/g,
+        '$1 $2 '
+      )
+    : key);
+var makeThemeResolver = (config) => {
+  const cache = new Map();
+  const theme2 = { ...defaultTheme, ...config };
+  const deref = (theme3, section) => {
+    const base = theme3 && theme3[section];
+    const value = typeof base == 'function' ? base(resolve, resolveContext) : base;
+    return value && section == 'colors' ? flattenColorPalette(value) : value;
+  };
+  const resolve = (section, key, defaultValue) => {
+    const keypath = section.split('.');
+    section = keypath[0];
+    if (keypath.length > 1) {
+      defaultValue = key;
+      key = join(tail(keypath), '.');
+    }
+    let base = cache.get(section);
+    if (!base) {
+      cache.set(section, (base = { ...deref(theme2, section) }));
+      Object.assign(base, deref(theme2.extend, section));
+    }
+    if (key != null) {
+      key = (Array.isArray(key) ? join(key) : key) || 'DEFAULT';
+      const value = handleArbitraryValues(section, key) || base[key];
+      return value == null
+        ? defaultValue
+        : Array.isArray(value) && !includes(['fontSize', 'outline', 'dropShadow'], section)
+        ? join(value, ',')
+        : value;
+    }
+    return base;
+  };
+  return resolve;
+};
+
+// src/twind/translate.ts
+var translate = (plugins, context) => (rule, isTranslating) => {
+  if (typeof rule.d == 'function') {
+    return rule.d(context);
+  }
+  const parameters = rule.d.split(/-(?![^[]*])/g);
+  if (!isTranslating && parameters[0] == 'tw' && rule.$ == rule.d) {
+    return rule.$;
+  }
+  for (let index = parameters.length; index; index--) {
+    const id = join(parameters.slice(0, index));
+    const plugin = plugins[id];
+    if (plugin) {
+      return typeof plugin == 'function'
+        ? plugin(tail(parameters, index), context, id)
+        : typeof plugin == 'string'
+        ? context[isTranslating ? 'css' : 'tw'](plugin)
+        : plugin;
+    }
+  }
+};
+
+// src/twind/decorate.ts
+var _2;
+var GROUP_RE = /^:(group(?:(?!-focus).+?)*)-(.+)$/;
+var NOT_PREFIX_RE = /^(:not)-(.+)/;
+var prepareVariantSelector = (variant) => (variant[1] == '[' ? tail(variant) : variant);
+var decorate = (darkMode, variants, { theme: theme2, tag }) => {
+  const applyVariant = (translation, variant) => {
+    if ((_2 = theme2('screens', tail(variant), ''))) {
+      return { [buildMediaQuery(_2)]: translation };
+    }
+    if (variant == ':dark' && darkMode == 'class') {
+      return { '.dark &': translation };
+    }
+    if ((_2 = GROUP_RE.exec(variant))) {
+      return { [`.${escape(tag(_2[1]))}:${_2[2]} &`]: translation };
+    }
+    return {
+      [variants[tail(variant)] ||
+      '&' +
+        variant.replace(
+          NOT_PREFIX_RE,
+          (_4, not, variant2) => not + '(' + prepareVariantSelector(':' + variant2) + ')'
+        )]: translation,
+    };
+  };
+  return (translation, rule) => rule.v.reduceRight(applyVariant, translation);
+};
+
+// src/twind/presedence.ts
+var _3;
+var responsivePrecedence = (css) =>
+  (((_3 = /(?:^|min-width: *)(\d+(?:.\d+)?)(p)?/.exec(css))
+    ? +_3[1] / (_3[2] ? 15 : 1) / 10
+    : 0) &
+    31) <<
+  22;
+var seperatorPrecedence = (string) => {
+  _3 = 0;
+  for (let index = string.length; index--; ) {
+    _3 += includes('-:,', string[index]);
+  }
+  return _3;
+};
+var atRulePresedence = (css) => (seperatorPrecedence(css) & 15) << 18;
+var PRECEDENCES_BY_PSEUDO_CLASS = [
+  'rst',
+  'st',
+  'en',
+  'd',
+  'nk',
+  'sited',
+  'pty',
+  'ecked',
+  'cus-w',
+  'ver',
+  'cus',
+  'cus-v',
+  'tive',
+  'sable',
+  'ad-on',
+  'tiona',
+  'quire',
+];
+
+var pseudoPrecedence = (pseudoClass) =>
+  1 <<
+  (~(_3 = PRECEDENCES_BY_PSEUDO_CLASS.indexOf(
+    pseudoClass.replace(GROUP_RE, ':$2').slice(3, 8)
+  ))
+    ? _3
+    : 17);
+var makeVariantPresedenceCalculator = (theme2, variants) => (presedence, variant) =>
+  presedence |
+  ((_3 = theme2('screens', tail(variant), ''))
+    ? (1 << 27) | responsivePrecedence(buildMediaQuery(_3))
+    : variant == ':dark'
+    ? 1 << 30
+    : (_3 = variants[variant] || variant.replace(NOT_PREFIX_RE, ':$2'))[0] == '@'
+    ? atRulePresedence(_3)
+    : pseudoPrecedence(variant));
+var declarationPropertyPrecedence = (property2) =>
+  property2[0] == '-'
+    ? 0
+    : seperatorPrecedence(property2) +
+      ((_3 = /^(?:(border-(?!w|c|sty)|[tlbr].{2,4}m?$|c.{7}$)|([fl].{5}l|g.{8}$|pl))/.exec(
+        property2
+      ))
+        ? +!!_3[1] || -!!_3[2]
+        : 0) +
+      1;
+
+// src/twind/serialize.ts
+var stringifyBlock = (body, selector) => selector + '{' + body + '}';
+var serialize = (prefix, variants, context) => {
+  const { theme: theme2, tag } = context;
+  const tagVar = (_4, property2) => '--' + tag(property2);
+  const tagVars = (value) => `${value}`.replace(/--(tw-[\w-]+)\b/g, tagVar);
+  const stringifyDeclaration = (property2, value, important) => {
+    property2 = tagVars(property2);
+    return Array.isArray(value)
+      ? join(
+          value.filter(Boolean).map((value2) => prefix(property2, tagVars(value2), important)),
+          ';'
+        )
+      : prefix(property2, tagVars(value), important);
+  };
+  let rules2;
+  const stringify3 = (atRules, selector, presedence, css, important) => {
+    if (Array.isArray(css)) {
+      css.forEach(
+        (css2) => css2 && stringify3(atRules, selector, presedence, css2, important)
+      );
+      return;
+    }
+    let declarations = '';
+    let maxPropertyPresedence = 0;
+    let numberOfDeclarations = 0;
+    if (css['@apply']) {
+      css = merge(
+        evalThunk(apply(css['@apply']), context),
+        { ...css, '@apply': void 0 },
+        context
+      );
+    }
+    Object.keys(css).forEach((key) => {
+      const value = evalThunk(css[key], context);
+      if (isCSSProperty(key, value)) {
+        if (value !== '' && key.length > 1) {
+          const property2 = hyphenate(key);
+          numberOfDeclarations += 1;
+          maxPropertyPresedence = Math.max(
+            maxPropertyPresedence,
+            declarationPropertyPrecedence(property2)
+          );
+          declarations =
+            (declarations && declarations + ';') +
+            stringifyDeclaration(property2, value, important);
+        }
+      } else if (value) {
+        if (key == ':global') {
+          key = '@global';
+        }
+        if (key[0] == '@') {
+          if (key[1] == 'g') {
+            stringify3([], '', 0, value, important);
+          } else if (key[1] == 'f') {
+            stringify3([], key, 0, value, important);
+          } else if (key[1] == 'k') {
+            const currentSize = rules2.length;
+            stringify3([], '', 0, value, important);
+            const waypoints = rules2.splice(currentSize, rules2.length - currentSize);
+            rules2.push({
+              r: stringifyBlock(
+                join(
+                  waypoints.map((p) => p.r),
+                  ''
+                ),
+                key
+              ),
+              p: waypoints.reduce((sum, p) => sum + p.p, 0),
+            });
+          } else if (key[1] == 'i') {
+            (Array.isArray(value) ? value : [value]).forEach(
+              (value2) => value2 && rules2.push({ p: 0, r: `${key} ${value2};` })
+            );
+          } else {
+            if (key[2] == 'c') {
+              key = buildMediaQuery(context.theme('screens', tail(key, 8).trim()));
+            }
+            stringify3(
+              [...atRules, key],
+              selector,
+              presedence | responsivePrecedence(key) | atRulePresedence(key),
+              value,
+              important
+            );
+          }
+        } else {
+          stringify3(
+            atRules,
+            selector
+              ? join(
+                  selector.split(/,(?![^[]*])/g).map((selectorPart) =>
+                    join(
+                      key
+                        .split(/,(?![^[]*])/g)
+                        .map((keyPart) =>
+                          includes(keyPart, '&')
+                            ? keyPart.replace(/&/g, selectorPart)
+                            : (selectorPart && selectorPart + ' ') + keyPart
+                        ),
+                      ','
+                    )
+                  ),
+                  ','
+                )
+              : key,
+            presedence,
+            value,
+            important
+          );
+        }
+      }
+    });
+    if (numberOfDeclarations) {
+      rules2.push({
+        r: atRules.reduceRight(stringifyBlock, stringifyBlock(declarations, selector)),
+        p:
+          presedence * (1 << 8) +
+          (((Math.max(0, 15 - numberOfDeclarations) & 15) << 4) |
+            ((maxPropertyPresedence || 15) & 15)),
+      });
+    }
+  };
+  const variantPresedence = makeVariantPresedenceCalculator(theme2, variants);
+  return (css, className, rule, layer = 0) => {
+    layer <<= 28;
+    rules2 = [];
+    stringify3(
+      [],
+      className ? '.' + escape(className) : '',
+      rule ? rule.v.reduceRight(variantPresedence, layer) : layer,
+      css,
+      rule && rule.i
+    );
+    return rules2;
+  };
+};
+
+// src/twind/inject.ts
+var inject = (sheet, mode2, init, context) => {
+  let sortedPrecedences;
+  init((value = []) => (sortedPrecedences = value));
+  let insertedRules;
+  init((value = new Set()) => (insertedRules = value));
+  return ({ r: css, p: presedence }) => {
+    if (!insertedRules.has(css)) {
+      insertedRules.add(css);
+      const index = sortedInsertionIndex(sortedPrecedences, presedence);
+      try {
+        sheet.insert(css, index);
+        sortedPrecedences.splice(index, 0, presedence);
+      } catch (error) {
+        if (!/:-[mwo]/.test(css)) {
+          mode2.report({ id: 'INJECT_CSS_ERROR', css, error }, context);
+        }
+      }
+    }
+  };
+};
+
+// src/twind/configure.ts
+var sanitize = (value, defaultValue, disabled, enabled = defaultValue) =>
+  value === false ? disabled : value === true ? enabled : value || defaultValue;
+var loadMode = (mode2) =>
+  (typeof mode2 == 'string' ? { t: strict, a: warn, i: silent }[mode2[1]] : mode2) || warn;
+var stringifyVariant = (selector, variant) =>
+  selector + (variant[1] == ':' ? tail(variant, 2) + ':' : tail(variant)) + ':';
+var stringify2 = (rule, directive2 = rule.d) =>
+  typeof directive2 == 'function'
+    ? ''
+    : rule.v.reduce(stringifyVariant, '') +
+      (rule.i ? '!' : '') +
+      (rule.n ? '-' : '') +
+      directive2;
+var COMPONENT_PROPS = { _: { value: '', writable: true } };
+var configure = (config = {}) => {
+  const theme2 = makeThemeResolver(config.theme);
+  const mode2 = loadMode(config.mode);
+  const hash = sanitize(config.hash, false, false, cyrb32);
+  const important = config.important;
+  let activeRule = { v: [] };
+  let translateDepth = 0;
+  const lastTranslations = [];
+  const context = {
+    tw: (...tokens) => process(tokens),
+    theme: (section, key, defaultValue) => {
+      var _a;
+      const value =
+        (_a = theme2(section, key, defaultValue)) != null
+          ? _a
+          : mode2.unknown(
+              section,
+              key == null || Array.isArray(key) ? key : key.split('.'),
+              defaultValue != null,
+              context
+            );
+      return activeRule.n && value && includes('rg', (typeof value)[5])
+        ? `calc(${value} * -1)`
+        : value;
+    },
+    tag: (value) => (hash ? hash(value) : value),
+    css: (rules2) => {
+      translateDepth++;
+      const lastTranslationsIndex = lastTranslations.length;
+      try {
+        (typeof rules2 == 'string' ? parse([rules2]) : rules2).forEach(convert);
+        const css = Object.create(null, COMPONENT_PROPS);
+        for (let index = lastTranslationsIndex; index < lastTranslations.length; index++) {
+          const translation = lastTranslations[index];
+          if (translation) {
+            switch (typeof translation) {
+              case 'object':
+                merge(css, translation, context);
+                break;
+              case 'string':
+                css._ += (css._ && ' ') + translation;
+            }
+          }
+        }
+        return css;
+      } finally {
+        lastTranslations.length = lastTranslationsIndex;
+        translateDepth--;
+      }
+    },
+  };
+
+  const translate2 = translate({ ...corePlugins, ...config.plugins }, context);
+  const doTranslate = (rule) => {
+    const parentRule = activeRule;
+    activeRule = rule;
+    try {
+      return evalThunk(translate2(rule), context);
+    } finally {
+      activeRule = parentRule;
+    }
+  };
+  const variants = { ...coreVariants, ...config.variants };
+  const decorate2 = decorate(config.darkMode || 'media', variants, context);
+  const serialize2 = serialize(
+    sanitize(config.prefix, autoprefix, noprefix),
+    variants,
+    context
+  );
+  const sheet =
+    config.sheet || (typeof window == 'undefined' ? voidSheet() : cssomSheet(config));
+  const { init = (callback) => callback() } = sheet;
+  const inject2 = inject(sheet, mode2, init, context);
+  let idToClassName;
+  init((value = new Map()) => (idToClassName = value));
+  const inlineDirectiveName = new WeakMap();
+  const evaluateFunctions = (key, value) =>
+    key == '_'
+      ? void 0
+      : typeof value == 'function'
+      ? JSON.stringify(evalThunk(value, context), evaluateFunctions)
+      : value;
+  const convert = (rule) => {
+    if (!translateDepth && activeRule.v.length) {
+      rule = { ...rule, v: [...activeRule.v, ...rule.v], $: '' };
+    }
+    if (!rule.$) {
+      rule.$ = stringify2(rule, inlineDirectiveName.get(rule.d));
+    }
+    let className = translateDepth ? null : idToClassName.get(rule.$);
+    if (className == null) {
+      let translation = doTranslate(rule);
+      if (!rule.$) {
+        rule.$ = cyrb32(JSON.stringify(translation, evaluateFunctions));
+        inlineDirectiveName.set(rule.d, rule.$);
+        rule.$ = stringify2(rule, rule.$);
+      }
+      if (translation && typeof translation == 'object') {
+        rule.v = rule.v.map(prepareVariantSelector);
+        if (important) rule.i = important;
+        translation = decorate2(translation, rule);
+        if (translateDepth) {
+          lastTranslations.push(translation);
+        } else {
+          const layer =
+            typeof rule.d == 'function' ? (typeof translation._ == 'string' ? 1 : 3) : 2;
+          className =
+            hash || typeof rule.d == 'function' ? (hash || cyrb32)(layer + rule.$) : rule.$;
+          serialize2(translation, className, rule, layer).forEach(inject2);
+          if (translation._) {
+            className += ' ' + translation._;
+          }
+        }
+      } else {
+        if (typeof translation == 'string') {
+          className = translation;
+        } else {
+          className = rule.$;
+          mode2.report({ id: 'UNKNOWN_DIRECTIVE', rule: className }, context);
+        }
+        if (translateDepth && typeof rule.d !== 'function') {
+          lastTranslations.push(className);
+        }
+      }
+      if (!translateDepth) {
+        idToClassName.set(rule.$, className);
+        ensureMaxSize(idToClassName, 3e4);
+      }
+    }
+    return className;
+  };
+  const process = (tokens) => join(parse(tokens).map(convert).filter(Boolean), ' ');
+  const preflight = sanitize(config.preflight, identity, false);
+  if (preflight) {
+    const css = createPreflight(theme2);
+    const styles = serialize2(
+      typeof preflight == 'function'
+        ? evalThunk(preflight(css, context), context) || css
+        : { ...css, ...preflight }
+    );
+    init((injected = (styles.forEach(inject2), true)) => injected);
+  }
+  return {
+    init: () => mode2.report({ id: 'LATE_SETUP_CALL' }, context),
+    process,
+  };
+};
+
+// src/twind/instance.ts
+var create = (config) => {
+  let process = (tokens) => {
+    init();
+    return process(tokens);
+  };
+  let init = (config2) => {
+    ({ process, init } = configure(config2));
+  };
+  if (config) init(config);
+  let context;
+  const fromContext = (key) => () => {
+    if (!context) {
+      process([
+        (_4) => {
+          context = _4;
+          return '';
+        },
+      ]);
+    }
+    return context[key];
+  };
+  return {
+    tw: Object.defineProperties((...tokens) => process(tokens), {
+      theme: {
+        get: fromContext('theme'),
+      },
+    }),
+
+    setup: (config2) => init(config2),
+  };
+};
+
+// src/twind/default.ts
+var { tw, setup } = /* @__PURE__ */ create();
+export {
+  apply,
+  autoprefix,
+  create,
+  cssomSheet,
+  directive,
+  cyrb32 as hash,
+  mode,
+  noprefix,
+  setup,
+  silent,
+  strict,
+  theme,
+  tw,
+  voidSheet,
+  warn,
+};
diff --git a/insert/client.mjs b/src/electron/client.mjs
similarity index 100%
rename from insert/client.mjs
rename to src/electron/client.mjs
diff --git a/insert/electronApi.cjs b/src/electron/electronApi.cjs
similarity index 100%
rename from insert/electronApi.cjs
rename to src/electron/electronApi.cjs
diff --git a/insert/env/env.mjs b/src/electron/env/env.mjs
similarity index 100%
rename from insert/env/env.mjs
rename to src/electron/env/env.mjs
diff --git a/insert/env/fs.mjs b/src/electron/env/fs.mjs
similarity index 100%
rename from insert/env/fs.mjs
rename to src/electron/env/fs.mjs
diff --git a/insert/env/storage.mjs b/src/electron/env/storage.mjs
similarity index 100%
rename from insert/env/storage.mjs
rename to src/electron/env/storage.mjs
diff --git a/insert/frame.mjs b/src/electron/frame.mjs
similarity index 100%
rename from insert/frame.mjs
rename to src/electron/frame.mjs
diff --git a/insert/init.cjs b/src/electron/init.cjs
similarity index 100%
rename from insert/init.cjs
rename to src/electron/init.cjs
diff --git a/insert/worker.cjs b/src/electron/worker.cjs
similarity index 100%
rename from insert/worker.cjs
rename to src/electron/worker.cjs
diff --git a/src/manifest.json b/src/manifest.json
new file mode 100644
index 0000000..36abd33
--- /dev/null
+++ b/src/manifest.json
@@ -0,0 +1,30 @@
+{
+  "manifest_version": 2,
+  "name": "notion-enhancer",
+  "version": "0.11.0",
+  "author": "dragonwocky <thedragonring.bod@gmail.com> (https://dragonwocky.me/)",
+  "description": "an enhancer/customiser for the all-in-one productivity workspace notion.so",
+  "homepage_url": "https://notion-enhancer.github.io",
+  "icons": {
+    "16": "media/colour-x16.png",
+    "32": "media/colour-x32.png",
+    "48": "media/colour-x48.png",
+    "128": "media/colour-x128.png",
+    "256": "media/colour-x256.png",
+    "512": "media/colour-x512.png"
+  },
+  "browser_action": {},
+  "background": { "scripts": ["worker.js"] },
+  "options_ui": {
+    "page": "mods/menu/menu.html",
+    "open_in_tab": true
+  },
+  "web_accessible_resources": ["browser/*", "common/*", "dep/*", "media/*", "mods/*"],
+  "content_scripts": [
+    {
+      "matches": ["https://*.notion.so/*", "https://*.notion.site/*"],
+      "js": ["browser/init.js"]
+    }
+  ],
+  "permissions": ["tabs", "storage", "clipboardRead", "clipboardWrite", "unlimitedStorage"]
+}
diff --git a/src/media/animated.gif b/src/media/animated.gif
new file mode 100644
index 0000000..56f8300
Binary files /dev/null and b/src/media/animated.gif differ
diff --git a/src/media/blackwhite-x128.png b/src/media/blackwhite-x128.png
new file mode 100644
index 0000000..bc0b657
Binary files /dev/null and b/src/media/blackwhite-x128.png differ
diff --git a/src/media/blackwhite-x16.png b/src/media/blackwhite-x16.png
new file mode 100644
index 0000000..69224de
Binary files /dev/null and b/src/media/blackwhite-x16.png differ
diff --git a/src/media/blackwhite-x256.png b/src/media/blackwhite-x256.png
new file mode 100644
index 0000000..6d288a9
Binary files /dev/null and b/src/media/blackwhite-x256.png differ
diff --git a/src/media/blackwhite-x32.png b/src/media/blackwhite-x32.png
new file mode 100644
index 0000000..e8a517e
Binary files /dev/null and b/src/media/blackwhite-x32.png differ
diff --git a/src/media/blackwhite-x48.png b/src/media/blackwhite-x48.png
new file mode 100644
index 0000000..bf574dc
Binary files /dev/null and b/src/media/blackwhite-x48.png differ
diff --git a/src/media/blackwhite-x512.png b/src/media/blackwhite-x512.png
new file mode 100644
index 0000000..0ecf16c
Binary files /dev/null and b/src/media/blackwhite-x512.png differ
diff --git a/src/media/blackwhite.svg b/src/media/blackwhite.svg
new file mode 100644
index 0000000..7321a08
--- /dev/null
+++ b/src/media/blackwhite.svg
@@ -0,0 +1,30 @@
+<svg width="250" height="250" viewBox="0 0 250 250" fill="none" xmlns="http://www.w3.org/2000/svg" xmlns:xlink="http://www.w3.org/1999/xlink">
+<path d="M250 0H0V250H250V0Z" fill="url(#pattern0)"/>
+<rect x="77" y="86" width="119" height="120" fill="white"/>
+<g filter="url(#filter0_d)">
+<path d="M161 131L145 118L138 126.5L154 139.5L161 131Z" fill="white"/>
+<path d="M161.095 131.298L160.745 131.018L144.854 118.277L144.529 118.016L164.458 93.1745C165.339 92.0767 166.62 91.3736 168.019 91.2199C169.418 91.0662 170.821 91.4745 171.919 92.355L180.204 98.9958C181.302 99.8766 182.005 101.157 182.159 102.556C182.313 103.956 181.904 105.358 181.024 106.457L161.095 131.303L161.095 131.298ZM154.454 139.584L107.955 197.558C107.074 198.656 105.794 199.359 104.394 199.512C102.995 199.666 101.593 199.258 100.494 198.377L92.2135 191.731C91.1156 190.85 90.4125 189.569 90.2588 188.17C90.1052 186.771 90.5135 185.368 91.394 184.27L137.893 126.296L138.246 126.579L154.123 139.318L154.454 139.584Z" fill="black"/>
+<path d="M144.529 118.016L141.211 122.156L137.893 126.296L138.246 126.579L144.854 118.277L144.529 118.016Z" fill="black"/>
+<path d="M161.095 131.303L161.095 131.298L160.745 131.018L154.123 139.318L154.454 139.584L161.095 131.303Z" fill="black"/>
+<path d="M116.026 114.992L117.703 119.348L122.363 119.099L118.739 122.039L120.416 126.394L116.499 123.857L112.876 126.797L114.079 122.288L110.162 119.75L114.823 119.501L116.026 114.992Z" fill="#4B4B4B"/>
+<path d="M190.629 106.719L192.306 111.074L196.966 110.825L193.342 113.765L195.019 118.12L191.103 115.583L187.479 118.523L188.682 114.014L184.766 111.477L189.426 111.228L190.629 106.719Z" fill="#4B4B4B"/>
+<path d="M142.4 167.187L144.077 171.542L148.737 171.294L145.113 174.234L146.79 178.589L142.873 176.051L139.25 178.992L140.453 174.483L136.536 171.945L141.197 171.696L142.4 167.187Z" fill="#4B4B4B"/>
+<path d="M130.67 98.129L133.045 104.299L139.647 103.946L134.514 108.112L136.889 114.282L131.341 110.687L126.207 114.852L127.912 108.465L122.363 104.87L128.965 104.517L130.67 98.129Z" fill="black"/>
+<path d="M182.228 120.032L184.603 126.202L191.205 125.849L186.071 130.015L188.447 136.185L182.899 132.59L177.765 136.756L179.47 130.368L173.921 126.773L180.523 126.42L182.228 120.032Z" fill="black"/>
+</g>
+<defs>
+<pattern id="pattern0" patternContentUnits="objectBoundingBox" width="1" height="1">
+<use xlink:href="#image0" transform="scale(0.00195312)"/>
+</pattern>
+<filter id="filter0_d" x="76.6637" y="89.8204" width="124.685" height="119.091" filterUnits="userSpaceOnUse" color-interpolation-filters="sRGB">
+<feFlood flood-opacity="0" result="BackgroundImageFix"/>
+<feColorMatrix in="SourceAlpha" type="matrix" values="0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 127 0" result="hardAlpha"/>
+<feOffset dy="4"/>
+<feGaussianBlur stdDeviation="2"/>
+<feColorMatrix type="matrix" values="0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0.25 0"/>
+<feBlend mode="normal" in2="BackgroundImageFix" result="effect1_dropShadow"/>
+<feBlend mode="normal" in="SourceGraphic" in2="effect1_dropShadow" result="shape"/>
+</filter>
+<image id="image0" width="512" height="512" xlink:href="data:image/png;base64,iVBORw0KGgoAAAANSUhEUgAAAgAAAAIACAYAAAD0eNT6AAAACXBIWXMAAAsTAAALEwEAmpwYAAAAAXNSR0IArs4c6QAAAARnQU1BAACxjwv8YQUAACwjSURBVHgB7d39VRRLtwfg8l33fzUCIAIwgoMRqBGAESARCBEIEYgRiBGIEYARMEagRsDtPTOt48B8MR9d1f08a/UaOM6577mKU7+qXbXrSQLokLu7u2fVSzzbw9d4nlbP8+rZGr7t2dhT257xf/7X8Am9sX/2Y/jP4vn15MmTmwQNepIAClUN5tvDL7fT38G5fo3BfHSwH/21XEQIiHDwbfh1TzBgUwQAoHFzzspHf218Zt4mEQiuhs83gYB1EQCAlRkZyB+aedeD+kODPZP10iAMfKnCwGWCFREAgAeNLa+PD+ijs/LR97FesToQIUAYYGkCALTc2Kx8O3V7eb1NemmwMnBahYFeggUJAFCIRyyvp2RW3hVXaRAErhLMSQCABkxYXn9oVj76PpilVz0nVRD4lGAGAQCWYHmdTPWSIMAMAgAMDWflltdpk14SBJhAAKB1LK/DPb3qeaOnAKMEALI1YdNbPZCPzsq3k+V1mMdFcmqAIQGAjZjSstXyOmzWr+o5q0LAaaLTBAAWssDy+viADuSlVz0vrQZ0lwDQUQucKd9Oltehzc7SoCzwK9EpAkALWF4HltSrnrcaCXWLAJCRRyyvm5UDq3Rib0B3CABrYHkdKFgv2RvQCQLADFOW10PMyi2vA21kNaDlOhUARmbm2+nfM+WW1wHuu0qDvQG9ROu0NgBUg/1e9VI/W8PX7QTAInpJO+FWakUAGM7sY4B/XT27w6/N3gFW5yLpItgqxQaA4aB/kAaDvgEfYP16yXHB1igqAAwH/f3qORq+ArB5Ngi2QBEBYDjwx6D/LpnpA+SglxwXLNr/UsaqgX+/er5WX/6snpNk8AfIxXb13Faf0e8TRcpyBSAG/uolfqj2EwC5u0qOCxYnqxWAWOqvnovqy5j17ycASrBfPV+rz++DRDGyCQDVD07U+G/TYGc/AGXZrp6L6rP840gHVTLWeAlg2LDnQzLjB2iLXnJcMHuNBoDhrP8k2dwHbNCvX7/+PL1er//6+/fvP9+Pvyee0X82ybNnz+49W1tbaWdnJ+3u7va/39vbSx3iuGDGGgkAw2N9n5NZP7CkesCuB/KHBvN4Hf26SXUI2N/fT//991//teV6yXHBLG08AAyX/GPw304AQ/PMykcH+Vmz8VJEIIgQ8Pr16/Tq1av+9y1lNSAzGw0Awx2iZ8mSP7TW+ABdD94/fvxIP3/+/DOojw/sDBweHqaDg4O2rgxcJccFs7GxADCs958loBilLa+3SZQJ3r171w8DLdNLbhfMwkYCwLBT1EkCGjFteb2elbdxeb0Ntre308nJSRuDwEVyu2Cj1h4ADP6wWg/NvC2vt18EgY8fP7atNNBLjgs2Zq0BwOAPk827vD4+oNNtsUfg/fv3/UDQIjYINmBtAUDNn654aNPb+PL66NK75XWWFScFYn9ABIEW6SXHBTdqLQFgeNTvOkFhLK9TklgF+Pr1q9UAHmXlAWDYAzou89lO0JBFl9fNyilZbBJs2WrAVXJccO3WEQDiQp/tBCsw75lyy+t0XQtXA3rJccG1WmkAqAb/uNTnXYIHWF6H9WvhasBFclxwLVYWAKrB/7B6+ZhovfHz5JbXIS9xVDCODLZsNcBxwRVbSQBQ9y+T5XVor5Y2ELJBcIVWFQAuqpfWtakqyUMz7xjIx3/N8jp0S31csEWXDPWS44IrsXQAqAb/12lwux8r0NUb0YD1cVyQh6wiANj1/wA3ogG5cVyQUUsFgK5s/HMjGtAWjgtSWzYAFDv7j0H65ubmT63c8jrQJWdnZ+no6Ci1yEVyXHAhjw4AJc3+YxC/vLzsD/jfvn3rvwJ03evXr9OHDx8cF2QxMfu/y1hVZ7+rEu7d/v7+Xfznejwej+f+Uw3+dxcXF3ct8z6xHtVv7uFdpm5vb++qZa27Z8+eFfMX0OPxeJp+Dg8P+xOnFrm9G/SoYZXuMpz9x8B/cHBQ1F84j8fjyemJ1YDr6+u7lnmfWI3qN3P/LjOx1G/G7/F4PKt5Tk5O7lrm653VgHsW3gR4l1HXv9jc9+bNm3R1dZUAllVvhovX6JwXz9OnT9Pz58//fD1utONmfYqofi2Z44Ltt1AAGCao25SB+Av28uVLZ+6Be+rBO556MK8H8q2trf57Rgf5+lmlCACjJ49iolJiKHBcsL0WDQCHKYOjfwZ/6IbxAXp8hh6D+uggv46BfJUiBEQgqI8ll8JxwXZaNAB8rV72U4MM/lCm0UF60kA+/mttFp9h0Zo3AkEJn2ctvV3wrAoBx6mj5g4A1eAfsfpnatjOzo7BHxo0rU4+urzelYF8FS4uLtLp6WkRn22Hh4f91QC3C5ZvkQDQ+K1/x8fH/XoUsLx5B/J11sn5VylBIH4uPn/+nPb29lKLdO52wUUCwEVqcPd/1M5i6R/417QNbyXWySknCLTwdsHYmPGmK6sBiwSA2P2/nRpi6Z+2m3fDW5fq5F0XA2wEgZy18LhgHNV414XjgnMFgKaP/0Uafvv2bYJSjA7Q44N1LK8byJlXKRufW7gacJFaflxw3gDQaP3f7J+mqJOTixJWA/b399PHjx/bdlzwuAoBl6mF5g0AsfOukU4QZv+sQg6NYWBZ0Tsgup/mPCFyXLAc8waAxs7/x9KXVr/U2tYYBhYVg3+ciIpmQjmL44JREmjZakCrjgvOGwDi/P/GP0XjBz2W/2knjWHg8UrZIBglgSgNtEhrjgvODABNNgCy/F8GjWGgGTYINqYVxwXnCQD71cvX1IDoP/3ly5fEZtjwBuWJC4ZiJSD3JmmOC+ZnngBwmBq6ACgGntKv1GyCxjDQPZoHNeYiFXpccJ4AcFK9bPxPK3a7vnjxInWZxjDAImLwj1MCud806LhgHuYJABepgRbAsfQfJYC20BgG2JRSNgi28bhgGqwGFLF0PU8AaOQIYPzwxg9HKSLR7u7u9i/HsLwONK2UDYKOCzYn2wBQwgbAGNiPjo7Su3fvDPJAdmLwj4nUp09571NzXLAZ/5vjPdupAb9//045i2Wr29vb/l8ugz+QoxhYY3NgDK45f07VqxW5ly0WdBKX6A3v0snSPCsAjdwCmHP//1iyir9QAKUopSTguODmZLsCkPPxv5YdYQE6IAbUWLXM/fOr7gDbotWAWHq5qCbTH4eN9bIxzwrAXWpAlZZSrhr6LQFYibhfJbqs5r4a0NLjgtlsEJxnBYAxmhMBJYuBNZbZcz+CF0Elyha5b2JcwHb1xL6ALJZhBIBHOD8/TwAlqzcIfvjwIfsNgrHvqoQViwXEBsGvTW8QVAJ4pOvr6/6Zf4DSlbRBsGXHBXvV87Ya765SA6wAPFLLlqWADitpg2DLjgtuV8/XpkoCVgCW1MKLLYAOu7y8TMfHx44Lbt5FGtwnsLFNZlYAlhQBIC7faFFtCuiw6MIaA2vud7G08LjgYfVcb3JfgBWAFWlhGgU6roRLhULLjgv2qudNNQau/UpHKwArEmk0ri92QgBoiwgAsTcg94G1ZccFt9NgJWDtZzQFgBWK/gBxMVDL+lkDHRaDf5x6is+2nLXwuODFujcHKgGsSRwR/Pz5s5IA0BrRNyAmOI4LbtTabhW0ArAmNzc3/SWpeAVog5hhx16n3AfWlh0XPFnXSoAAsEb2BQBtU294LuH4c+xhyPlm2QWsJQQoAWxI1M+i5SZAW5TSQTC0pGdL9Ak4SysiAGyQo4JA29Sbn0vYgd+S44IvV9U6WAlgg+q0HEdWANogLhKKzYElDKwtOS74eVXNgqwANEQLYaBtSioJxIbG+AwudDWgVz0vlm0bbAWgIREA4rxqLJ8BtEEplwqFWLUoeEV2u3qW/k22AtAw+wKANooj0KXck1LwiuxS+wEEgAxEDS3qZ7lfvgGwiJI2CBY6GeulJUoBSgAZiL8kkZS1EAbapN4geHCw9rb2Syv0dsHttEQpwApAZmIVIPoFKAkAbRGTnGiKVkpDngKPC+5UY2YvLcgKQGYuLy+L2UULMI+6zFmKAo8LPuo3VwDIkBbCQNvEBWklGb1dsIDTWvvVYv1+WpAAkClXCwNtUuqEJvYwFFK+WHgvgD0ABXC1MJCDehAcf/39+3d/0vLz588/Xz/0lK6A44IL7QUQAAoRg3+EgNKW0YA81IN1PRhPGrzr944O2vYk/ZX5Ru3Tauw8mffNAkBhzs7O0tHRUQK6Y3wwHv3+x48ff/75tFdWJ+MJWfxQ7MzbF0AAKJCrhaEciwze47Pztiydt1WmJYG5uwMKAIXSQhg2Y96l87bWvZkuTgrEhCyOOmbioho/387zRgGgYDH4x9naaFoB3Dc+eNePujerlNmE7Fc1fj6f540CQAu4Wpg2UvemJJmFgLnKAAJAS2S4DEWHPTSTrl/VvWmrjELAXKcBBIAWsS+AVXls3Xv034UuyuRz+KoaQ1/OepMA0EKOCnabujc0Kwb/6+vrJldk59oHIAC0VJQEYl+A1YCyLFP3tnQO+cjguPbMroACQItF+owNglYDNmfS4KzuDd0TqwANNgt6W42jF9PeIAB0QKwCRBA4ODhITDZv3bt+r6VzYJpYiW3wGuTjahw9m/YGAaBD2hwEJjVhmTR4P/QKsEqxCnt7e9vUXoCZDYEEgA6KIBDNgyII5NBESKtUoK3iOuGGJl1fqnH09bQ3CAAdF8k0alS7u7v9MBDfR0BYZPPgIme+Rwd4gzfQdg1uBrypxtEX094gADDVtCBg6Rxgurg+OG4ObECvGkd3pr1BAACANYlJVOwDaMDMXgD/SwDAWjRY5py589AKAACsUUPDaIyjUwdSKwAA0EECAAB0kAAAAB0kAABABwkAANBBAgAAdJAAAAAdJAAAQAcJAADQQQIAAHTQ/yUA2KD6ltG4fnz0efr0aXr+/Pmfr0ffO/7v1KLX/s3NTfr+/Xs6OztzS+kC3AUAwNzGB+L6+0mD9+iAPe168VW5uLhIp6enWQWBXO8CEAAAOuChgXjS4D0+Mx99bwliVeDt27fp8vIy5UAAWJAAADAwPhA/NDBvbW39896HBvGuefPmTRYhQABYkAAAtMG0AXnS4D2p3s1iYiXgxYsXjZcDBIAFCQBA0xatdz/0SrNiBSBWApokACxIAACWMWlAzmWzGpsTqwBxUqApuQYAxwCBrEzbrDar3j36HqgdHh6md+/eJf5lBQBYmcdsVlPvZt1iL0Cs+jRFCWBBAgBs1qTmLKO/Vg/es5qzQG52dnYa2wyoBACsjc1qMN3+/n6/SRB/CQDQMJvVYP329vYS/xIA4JFsVoNy+Pt2nwBAJ9msBt1S/33mLwGA4mzPuEks2KwGjPL3/j4BgI1adLOaJXOA9RAAWEg9aBu8AcomADBVDOAHBwf9IzSxi9ZADtAOAgAPisH+w4cP/YEfgPYRALgnBn59swHaTQDgHx8/fuxfnAFAu/0vwVDM/A3+AN0gANDnukyAbhEA6Hv//n0CoDsEAPqzf8f7ALpFACC9evUqAdAtAgDO+gN0kADQcTH4uyQDoHsEgI6Ljn8AdI8A0HFm/wDdJAB0nN3/AN0kAHTc1tZWAqB7BAAA6CABAAA6SAAAgA4SAACggwQAAOggAQAAOkgAAIAOEgAAoIMEAADoIAEAADpIAACADhIAAKCDBAAA6CABAAA6SAAAgA4SAACgg/4vAcCIXq/Xf/3169c/z+/fv/uvP3/+TM+ePUsnJyeJcgkAAC1SD97jr6ODd3xd/1o9uI++dx4CQPkEAIAMjA/Eo9//+PHjzz8ffe9jB+9ViP/d+N/c3t5OlEkAAFjS+IA8z+A9/n2JSv3vZkAAAFjQ1dVV+vbtW//15uamswNhhJi9vb1EmQQAgDnFgH96etp/Jf3ZS0CZBACAGWKWf3x8bOAf8/Tp00S59AEAmOL8/Dy9fPnS4P+AOAlAuawAQIuNHgV76Cx3fL2/v58ODg4S98Vyv6NukwkAZRMAIHPzDOLjO8sXORJ2eXmZ/vvvP8e5xhj8p4vB3wbAsgkAsAEPDeIhjoitYhBfRvxvvn37Nn39+jUxEL/3Bv/pYuWIsgkAMKdJ57inDeKlnPGO+nbUuo+OjhKpX/NnutevXyfKJgDQSTFA108YHcTrX3+oqUubxYz31atXnS8FXFxcbLyrXmniZ8S+kfIJAHRCDOAxw+1645ZplAIG4ueE6T5+/JgonwBAq8VMLgY1R7jm0/VSQPy8REBksvfv36v/t4Q+ALRW7OLe2dkx+C8oSgFdXQL3szJZ7Pr//PmzzZEtYgWA1oml7Ddv3vgwf6QulwK+f/+e+FfM9mPDX9T8nftvFwGAVonB68WLFzZxLamrpYAuL//X5/p3d3f7rzHw6w3RbgIArRLHtwz+q+FUQHsZ7AkCAK0RNX8buFani6WAtl5uE4N8dHs02DNKAKAVdG5bjygFRKvgrjR9ef78eWqj+POL3fswSgCgFQz+6xOrADFr7MIGsLq5Td0Iqn6FNhIAKF58SH/69CmxHnUpII6AtV0EnfEz7qNBIE4JxGvdTGq0mySURgCgeDq3rV+UAbpUChg1euvdpAY4dRCIUBBtpW9vb/uvQgI5EwAonvP+m9GlUsCiYlPdrI117969E1bJik6AFK1ejmX94vc6TlrwOG3dYEi5BACKZvDfrLOzMysu0BICAEXTunXzohRgZzyUTwCgaAaizYsNbUoBUD4BAFiYUgCUTwAAHkUpAMomAFC0ra2tRDOUAqBsAgBFc6lJs5QCoFwaAVG0aExzd3fXX4quu66FeI1ObPXXo/+8fi+rEaWA6+trDYKgMAIArRCDTzyLrAiMhoG6hWu8/vz5s/91tL5ltroU8OHDhwSUQwCgs2aFhSdPniTmE6WAV69eTeyVD+THHgBgJZwKgLIIAMBKOBUAZREAgJWJUoD7GaAMAgCwUlEKAPInAAArFSsASgGQPwEAWLmTkxOlAMicAACshVIA5E0AANYiVgDOz88TkCcBAFibKAXUbZiBvAgAwNpEYyClAMiTAACsVdwWqBQA+REAgLVTCoD8CADA2ikFQH4EAGAjlAIgLwIAsDFKAZAPAQDYGKUAyIcAAGyUUgDkQQAANk4pAJonAAAbpxQAzRMAgEYoBUCzBACgMVEKiNUAYPMEAKAxSgHQHAEAaNTl5WX/ATZLAAAaF6sASgGwWQIA0DilANg8AQDIQpQB4mQAsBkCAJANpQDYHAEAyEZ0Bzw9PU3A+gkAQFbOzs6UAmADBAAgO0oBsH4CAJAdpQBYPwEAyJJSAKyXAABkSykA1kcAALKlFADrIwBAxg4ODtKzZ89SlykFwHoIAJCxnZ2d9P79+9R1SgGwegIAZO7du3dpf38/dZlSAKyeAAAF+Pjxo1KAUgCslAAABdje3u6vBHSdUgCsjgAAhYi9AHt7e6nLohRwfn6egOUJAFCQDx8+pK47OTlJNzc3CViOAAAFic2ASgGDUgCwHAEAChOlgNgT0GWxAuBUACxHAIDCxGmAOBXQdUoBsBwBAAqkFDBwfHycgMcRAKBQUQroem+A6AvgVAA8jgAAhYrB36mAQSkgjgcCixEAoGCHh4edbxMcjYGcCoDFCQBQOG2ClQLgMQQAKFwcCXRjoFIALEoAgBZwY6BSACxKAICWsCFQKQAWIQBAS8RFQbEM3nVKATAfAQBa5OjoqPNtgpUCYD4CALSINsEDSgEwmwAALaNN8IBSAEwnAEALuTFQKQBmEQCghZQCBqIUcHl5mYD7BABoqSgFvH79OnVdrALEagDwLwEAWkybYKUAmEQAgBaLwV+b4NQvAygFwL8EAGg5bYIHlALgXwIAdIBSwKAUcHp6moABAQA6II4E6g2Q0tnZWf9kACAAQGfEXoC4L6DrlAJgQACADnFjYOp3B1QKAAEAOkWb4AGlABAAoHO0CR5QCqDrBADoGG2CB5QC6DoBADpIKWBAKYAuEwCgo6IU0PXeAEEpgK4SAKCjlAIGlALoKgEAOixuC9QmWCmAbhIAoOO0CR5QCqBrBADouDgS6MZApQC6RwAA3Bg4pBRAlwgAQJ82wQPHx8cJukAAAPrioqCTk5PUdTc3N0oBdIIAAPxxdHSkTXAlglAEAWgzAQD4Q2+Av+JUALSZAAD8Q5vgAaUA2k4AAO5xY+BAnAqI44HQRgIAcI9SwEA0BlIKoK0EAOBBUQqIVsFdF30Bzs/PE7SNAABMpE3wQJwKUAqgbQQAYKIY/LUJVgqgnQQAYCptggeUAmgbAQCYSSlgQCmANhEAgJncGDigFECbCADAXKIUEPcFdJ1SAG0hAABzc2PggFIAbSAAAHPTJnhAKYA2EACAhWgTPKAUQOkEAGAh2gT/pRRAyQQAYGFKAQNRCjg+Pk5QIgEAeJQoBegNkNLl5WX/gdIIAMCjKAX8FRsCYzUASiIAAI8WtwVqE+xUAGUSAIClaBM8oBRAaQQAYCnaBP8VGwKVAiiFAAAszY2BA3Ek8PT0NEEJBABgJWwIHDg7O+s3CYLcCQDASkQpIBrj4FQAZRAAgJU5OjrSJjgpBVAGAQBYGb0B/lIKIHcCALBS2gT/pRRAzgQAYOXcGDigFEDOBABg5ZQC/lIKIFcCALAWUQqIVsEoBZAnAQBYG22CB6IUcHFxkSAnAgCwNjH4axM8YAWA3AgAwFppEwx5EgCAtVMKgPwIAMDauTEQ8iMAABsRpYC9vb0E5EEAADbmw4cPCciDAABsjDbBkA8BANgobYIhDwIAsFHaBEMeBABg45QCoHkCANCIKAXoDQDNEQCARigFQLMEAKAxcVugNsHQDAEAaJQ2wdAMAQBolDbB0AwBAGicGwNh8wQAIAs2BMJmCQBAFqIUcHJykoDNEACAbGgTDJsjAABZUQqAzRAAgKxoEwybIQAA2VEKgPUTAIDsaBMM6ycAAFmKUkC0CgbWQwAAsqVNMKyPAABkKwZ/bYJhPQQAIGvaBMN6CABA9pQCYPUEACB7bgyE1RMAgCJEKWBvby8BqzFPAPiVGqAJCDBObwBYnWwDAMC4WAHQJhhWI9sSgBUA4CHaBMNqKAEARdEmGFZjngDQSw0QAIBJ3BgIy5snAPxODdja2koAk0QpQG8AeLxsVwB0/gKmUQqA5WRdApDugWnitkCTBXiceQLATWqIph/ALNoEw+NkuwIQ3AUOzKJNMDzOzADw5MmTOAbYyFHA3d3dBDCLGwNhcfM2AmqkDBB/oS3tAfOwIRAWM28A+J4acnh4mABmiVLAyclJAuaT9QpAePXqVQKYhzbBML95A8BVakiUAdT2gHkpBcB85goAT5486aUGbwV0GgCYlzbBMJ9FbgP8khpycHBgMyAwN6UAmG2RANDYPoAY/CV6YF7aBMNsiwSAi9Sgo6OjBDCvKAUoH8JkcweAYUOgq9SQSPRRCgCYlzbBMNkiKwDhW2pQnPH1lxmYV3xeaBMMD1s0AFylBsWmHnsBgEVoEwwPWygAVGWAq9Tg5UAh9gJYBQAWoRQA9y26AhA+pQZZ0gMW5cZAuO8xAeAsNSyW9Pb29hK03c+fPxOroRQA/1o4ADR9GqD24cOHBG13fn6enj9/nt68edP/+urqKvF4Pjfgr8esAITz1DDtPumKX79+pcvLy/7P+8uXLyOE91/j+/jnvV4vMZ9YOfS5AQNP0iPd3d3F2mSju2rig/HFixc+AJfw9etXy6ITxEBbiqhxx+AWf5a7u7v+TKfo4udGHKHu+h6I+PPe2dlJTajGy9SEJzM+xP4vPV6sAjT6E1W3+4zZEHRZfLjFEysCtdEwEOFAb/wBnxsw8NgSQIjNgI3dEFhTCoCHxX6B2DcQ+wdi5hOPvQQDPjdgiRWA2AxYLWvEkcDGm/TH0pZaKEw3vkoQM+FYGahXCeLp0ln52BB4c3NjYyWdtcwKQGj8SGBw8xcsLmrho6sEcdqga+JzQ2mErloqAFSrAL3UcGOgWsxeHPFhGTE77vJg2MXeGjH4f/78WZdAOmmZTYC1k+rJ4pq+qOl9+fLFkh5ziRlwLAHHknj83HS9hNTV5lrx/3dMHt6+fZugS5YOALEKMNwLkEUIqHf32g/AQyIcfvv2rf8qKP6ry0cHDw8P+58Zp6enCbpiFSsA4aR6XqWG+wKEWNJzxIda3UQnBv14je952KtXr1KXxVn5CAGfPmVR1YS1W3YTYN9wL0Dj3QFr9gN0WwzyMZOLZi9Ry4+l3YuLC4P/FDEDVgdP6ezszD0jsKiqDPAsugPeZeTg4CDaL3mmPF+/fr1rk+oD/K4ayIr6M8jhub29vWMgfi+qlcSi/vymPdWE6O76+vqu6+LPtak/g6akGVayAhCGlwRlVUCLNO+IT3fErD82gprpLyb6aPh78lf8XkSL7NJ/T2IlNP7/iMeqBhtRhY6vdxmJ1GdGOPlpywpAzPxL+n3P5akGhjseVupKQMz427aytwpWAO5b2QrAiKxWASLF2w/QbrFxKzZwsZj6DDwPK20lIPZx1DN+l0Exj5UHgKoUcJUy2hAY4i+Gvt/tFYO/Zf/FtGWZe91y/32KjZtRwvn582f/9JOBn0WsYwUgnKQMLgoaFasA6mDtFE18mN/r16/T9fW1wX9O8ftULR9nNYmIgT5Wb+K/KwKwExw8xloCwHBDYHZttbT8bJ8Y/M3+5xM/+3Ec0t+Dx4lJRJN3B8SgX8/2Y1Uigpw/R5axrhWACAFx5dhlyoiaZ/vo5jdbvUwcs8WDg4PE40U5MX4fNxUE6kE//jdj0DfbZ5WepDW6u7uLn9TblEGHwFHxl0jLz4HSNwxFx0ch4L4YnKKzX8wS1YXXJ7pL1p0mV9F+PMqU//33X//VDH+14s9nZ2cnNWGODflrUU3Ep47xq2oFPOl//Ff1/3iUArKadkcA+P79+5970aEU47PO+D4GiXhi0Nja2uoP+AaOzYhBOp4QF0vFIBOfLfFaB4IoUY2WqeLPpv5zi9f4M4s/u/qfwaasNQCEKAVUISBOBRyljMQSXv0XFjahHrzrAbv+/unTp/2WxfHP4uvR946/kq8YxOuZO5Rg7QFg6CQNLgvaTpmID9vYDxBLyDaRlaseMNepHrDDpIE5ZnGj733o3wHIyUYCwEgp4GvKSKT12GBzfHycKFNc+DPtGOD4gPzQwDw+eI/P1AHaaFMrAP0GQVUIiJE2q7Z8cbb3x48f/XsDKM/R0VF/ALdkDrCYtZ4CeEgVAmIVYD9lJEoAUQqIPQFdo20o0AVOAdy3tj4AU0QpoJcyUu8HsNwLQFdsPABUgaSXMuwSqEkQAF3SxApAfWFQdjvv6q5bANB2jQSAUIWA2HWXXSeeaBKkJg5A2zUWAIay2w8QohRgFzkAbdZoABjeGvgyZXZ1cL0pEIB20PX1vqZXAOpNgdntB4gmQXH9JwC0UeMBIFQh4KJ6OU+ZiSZB8QBQNisA92URAEIVAmKkza4TT5wKsB8AoGzR8ZV/ZRMAht6kDPcDRLc8TYIAynV9fZ34V1YBYLgf4E3KTKwAxPXBAJTJCsB9ua0A1E2CTlNm4o5v+wEAyhP1/y7e9TJLdgEgVCHgpHq5SpmJUwGaBAGU5erqKnFflgFgKEoBvZSZKAXYFAhQjk+fPiXuyzYADJsEZbcp0H4AgHLE8r8VgIflvAIQISCKNtntB4gygCZBAPmL+114WNYBIAwvDcqySdDBwUECIE8XFxeW/6fIPgAMnaQMmwSdnZ3ZDwCQoVj6Pz3NbgE5K0UEgFz3A2gSBJCfGPxfvnyp/e8MpawAZN0kyH4AgDzEhj+D/3yKCQAh1yZBh4eHmgQBNCgG/PgsNvjPr6gAEHJuEhRXCAOwGb9+/erP+N+8eZN2dnZs+FvQ/6UyRSkgbnbYThn5/Pmz9AmwBvG5GgN+tPSN5/v37/3X+Gc8TpEBIDYF3t3d1SEgG3WToAgBpXBBBrBOMUDXg3Q9Oapff//+3f+1nz9/9r+uf+2hf4fVK3UFoN8kqAoBx9WXWe3Aq5sEHR8fpxJIz8Ak4wPx6Pf15KEeoOtfG3/IV7EBIESToCoEROE9q448sSHw27dv6fLyMuVOuoZ2Gh+YZ826H/p3aLeiA8BQbL//L2W2HyBKAVGfyn2AdUUm5GXaknk9664H74dm20J9XhpsFjczwRUfAIb7AaLoHvsBsunIE82B6k2BOSfpehONZkawvGnL4JOWzM26WZP2B4AQTYKqEPC2+vJzykgcC3z//n3W+wHqXbWxdwG6bJklc7NuJsm5XXwrAkCoQsBlFQLi0qCjlJHYDxDJP+4NyNX5+bkAQLGW2ag2+muwDg2urvZmvaE1ASBUIeBdFQJ2qy/3U0ZiFSCaVeRab4//NmUAmjBtYB4fvG1Uo0RWADYrSgFfU0abAuv9AC9evMjyAyv+m+LWLHcasIhJA7Oz3fBXgwGgN+sNT1ILVasA+2kQArJSX1KRq7jZUCmg/Zzths1p8HP1dNg6f6JWBoBQhYA4HpjdlPbk5CTbO6ojqcYPa85LVl03aWB2thvyFH8nGyqvHkevnGlvaG0ACFUIuEiZNQkKsQoQqwE5EgLWQztU6J74HL29vU0NeTm8QXeitgeAiF3ZXRoUH+qxHyDXD/X6TgPlgAFnu4HHiOuJ47O0IS+iZf60N7Q6AIQqBGynzJoEhTgRkHuToPjhjRMMJa8GaIcKNOXi4iIdHDSzCF0N/jPH99YHgFCFgMPqpbEYNkn0Bijh0qDXr1/3n1evXm2slqUdKlC6WP5vaAJ1U43/L2a9qRMBIFQhIDZDZNUkKEQAyLlJ0LgoC+zu7qadnZ20tbXVDwSTfsAtmQNdFZOmOP7dkC9VAHg9602dCQChCgFRCthLGYnBLkoBLuUBaI8Y/CMENGTmEcDQtQCwnTJrEhRi9ptrkyAAFtPw7v8w8wRA+F/qkLg0KA06BWal3nUPQPmi30vD5lpS7lQACMNUlF0nnlgqiouDAChXTOia2vk/FBsA51pO7lQJYFRVDojdGY0VaCbJuUkQANM1uPO/dh4X483zxs6tAIyIUkAvZSZKAbrwAZQnk74pl/O+sbMrAKFaBYgTAbEpMLsmQbEpEIAyHB0d5XCk+1c1+38+75u7vAKQhm0Ss9sPsLe352pegELEZ3Ym/Vy+LfLmTgeAMLwt6TxlJjYENryRBIAZ4nM6LlDLxEKdhzpdAqgNLw2KP8HsmgTlfGkQQJdlsuxfW2j5P3R+BSAMj0y8qZ6sOvFEm91Ilg3dJQ3AA+pr0zNr4z735r+aADA0bBL0JmUmftDsBwDIQ+z0v76+zvG69E+J5VTlgJO7DL179+4u/vM8Ho/Hs9mnWoW9q5b7725vb+8ydZsewR6AB1S/mV+rl/2UGU2CADYnZvn//fdff1N25qXYw2oVe+EVAAHgAXeDTYFxc+B2ykhsBowQYFMgwOrFIB9H+qI1+6tXr0ppytarBv+d9AgCwAR3gyZB1ykzsQIQIQCAx4vBPgb4GPDj2d3d7b8WuOn6UbP/IABMUYWA6Kec3Q682Hl6fHycABioZ+sxgNeDe3j69Gl6/vx52tra6n9fD/Itabn+6Nl/EABmqEJAnPM4Spl58+ZNurxc+NQHQHbqQTvEwDz+fagH8Pr78QG/ox49+w8CwAx3mgQBTDXv7Lv+9fGHR1lq9h8EgDlUIWA7DfYDZPWTGoN/hIAIAwCPMWlQrgfv+uswaXZOI3aG/WseTQCYUxUCXqcF+yxvwsXFRXr79m0CumeRpfPx2bnZd9HOq8H/XVqSALCAXPcDnJycpNPT7C41BGaYtXRez74tnTOiVz0vhi3slyIALCjXJkGHh4fp0yedIGFTLJ3TkKWX/msCwIKG+wEiBGynzMR+gJubmwRMZ+mcQp1Wg/9JWhEB4BGqELCfBiEgK7EZMJoECQG03WOXzkf/XSjMZTX4r/TCOgHgkXJtEiQEkLtZs+/xpfOHXqFjemlFdf9RAsASqhBwUb0cpAxFp8DM7qqmJSYNypbOYS161fNyVXX/UQLAEnK9NKjmdADj5l06r99r6RwaFTP+F+sY/IMAsKRcmwTV4vKg6BOgY2D5lmmXavCG4sTgHzP/tdVzBYAVqELAYfXyMWUqBv9YDXBMsFmWzoE5rX3wDwLAiuTaJGiUIPB4ls6BDdnI4B8EgBXKtUnQuK4FAUvnQCF6aU0b/h4iAKxQzk2CHhJHBuNK4S9fvvT3CuR6qZCbxoAOuKqet5sa/IMAsGK5NgmaR/QOiNWBCAPfv3/vB4L4fplgoF0qwEwrudxnUQLAGuTaJGgZdRCYFgZGB2+zb4CZ4gM1Zv2XqQECwJpUISCuDn6dAOC+q7ThJf9xAsCa5N4kCIBGxKz/XTXwN74L+3+JtRj2bI6LG/LcWQfApkVr1p0cBv8gAKzR8BynXrwA3XaRBgP/yaov9FmGEsAGlNAkCICVu6ieT9Wgf5UyJABsSClNggBYSszwz6vnLKfZ/kMEgA2xKRCg1a6qJ2r7l7kP/DUBYINK6xQIwFRX1RNn+D+VMuiPEgA2rAoBe2kQAnTJAShLDPIx4H9LBc30JxEAGiAEABShlwaz/DjR9aXJpj3rIAA0RAgAyMKv4ROD/I/hazy90mf4swgADRICAFaqN3ytB/X6+9/D738Ov+4Nn19tH+SnEQAaJgQA9NWDduiNff9j5J/fe23b0vymCAAZcDoAaIHehNfxwXt8dt7pWXiTBIBMCAFAg3rD11lL5/V7/8zOzb7LJQBkZNgs6GNyjTAwP0vnPIoAkKEqCJxUL+8T0AW9Ca/17Lv+3tI5KyUAZKoKAftpsBqwnYBc9Yavv8YeS+dkTwDI2HBfwEn1HCRg1RZZOjf7pnUEgAJUQeAwDUoC2wmo9Yavszaujc/ODd6QBIBiWA2gZX5NeCydw4YIAIUZBoEPyUkBmmPpHFpAACjUcJNglAX2EyymN3y1dA4dJgAUbhgEDpPSQFdMWjoPMfu2dA7MRQBoiZE9Av8lmwVz1pvwaukc2CgBoIWqMBD7A+J5lVwytEq94euspfP6vWbfQLYEgJYbKRHsVs9e6i7tUgFGCAAdMiwTRAjYT38DQSkrBL0Jr5bOAR5BAOi4KhTUISACwc7wNWyn1e0l6A1fLZ0DZOL/AWgjuJqRzjE6AAAAAElFTkSuQmCC"/>
+</defs>
+</svg>
diff --git a/src/media/colour-x128.png b/src/media/colour-x128.png
new file mode 100644
index 0000000..4012672
Binary files /dev/null and b/src/media/colour-x128.png differ
diff --git a/src/media/colour-x16.png b/src/media/colour-x16.png
new file mode 100644
index 0000000..21be6b5
Binary files /dev/null and b/src/media/colour-x16.png differ
diff --git a/src/media/colour-x256.png b/src/media/colour-x256.png
new file mode 100644
index 0000000..30c25a0
Binary files /dev/null and b/src/media/colour-x256.png differ
diff --git a/src/media/colour-x32.png b/src/media/colour-x32.png
new file mode 100644
index 0000000..8e14320
Binary files /dev/null and b/src/media/colour-x32.png differ
diff --git a/src/media/colour-x48.png b/src/media/colour-x48.png
new file mode 100644
index 0000000..1e52a45
Binary files /dev/null and b/src/media/colour-x48.png differ
diff --git a/src/media/colour-x512.png b/src/media/colour-x512.png
new file mode 100644
index 0000000..f3adbac
Binary files /dev/null and b/src/media/colour-x512.png differ
diff --git a/src/media/colour.svg b/src/media/colour.svg
new file mode 100644
index 0000000..99027d9
--- /dev/null
+++ b/src/media/colour.svg
@@ -0,0 +1,64 @@
+<svg width="250" height="250" viewBox="0 0 250 250" fill="none" xmlns="http://www.w3.org/2000/svg" xmlns:xlink="http://www.w3.org/1999/xlink">
+<path d="M250 0H0V250H250V0Z" fill="url(#pattern0)"/>
+<rect x="77" y="86" width="119" height="120" fill="white"/>
+<path d="M161 131L145 118L138 126.5L154 139.5L161 131Z" fill="white"/>
+<path d="M161.095 131.298L160.745 131.018L144.854 118.277L144.529 118.016L164.458 93.1746C165.339 92.0767 166.62 91.3736 168.019 91.2199C169.418 91.0663 170.821 91.4746 171.919 92.355L180.204 98.9958C181.302 99.8766 182.005 101.157 182.159 102.557C182.313 103.956 181.904 105.359 181.024 106.457L161.095 131.303L161.095 131.298ZM154.454 139.584L107.955 197.558C107.074 198.656 105.794 199.359 104.394 199.513C102.995 199.666 101.593 199.258 100.494 198.377L92.2135 191.731C91.1156 190.85 90.4125 189.569 90.2588 188.17C90.1052 186.771 90.5135 185.368 91.394 184.27L137.893 126.296L138.246 126.579L154.123 139.318L154.454 139.584Z" fill="#9038FF"/>
+<path d="M161.095 131.298L160.745 131.018L144.854 118.277L144.529 118.016L164.458 93.1746C165.339 92.0767 166.62 91.3736 168.019 91.2199C169.418 91.0663 170.821 91.4746 171.919 92.355L180.204 98.9958C181.302 99.8766 182.005 101.157 182.159 102.557C182.313 103.956 181.904 105.359 181.024 106.457L161.095 131.303L161.095 131.298ZM154.454 139.584L107.955 197.558C107.074 198.656 105.794 199.359 104.394 199.513C102.995 199.666 101.593 199.258 100.494 198.377L92.2135 191.731C91.1156 190.85 90.4125 189.569 90.2588 188.17C90.1052 186.771 90.5135 185.368 91.394 184.27L137.893 126.296L138.246 126.579L154.123 139.318L154.454 139.584Z" fill="url(#paint0_linear)"/>
+<path d="M144.529 118.016L141.211 122.156L137.893 126.296L138.246 126.579L144.854 118.277L144.529 118.016Z" fill="#9038FF"/>
+<path d="M144.529 118.016L141.211 122.156L137.893 126.296L138.246 126.579L144.854 118.277L144.529 118.016Z" fill="url(#paint1_linear)"/>
+<path d="M161.095 131.303L161.095 131.298L160.745 131.018L154.123 139.318L154.454 139.584L161.095 131.303Z" fill="#9038FF"/>
+<path d="M161.095 131.303L161.095 131.298L160.745 131.018L154.123 139.318L154.454 139.584L161.095 131.303Z" fill="url(#paint2_linear)"/>
+<path d="M116.112 116.608L117.236 119.527L117.367 119.866L117.729 119.847L120.853 119.68L118.424 121.651L118.142 121.88L118.272 122.219L119.396 125.138L116.771 123.437L116.466 123.239L116.184 123.468L113.755 125.439L114.562 122.417L114.656 122.066L114.351 121.869L111.726 120.168L114.849 120.001L115.212 119.981L115.306 119.63L116.112 116.608Z" fill="#FDCC80"/>
+<path d="M116.112 116.608L117.236 119.527L117.367 119.866L117.729 119.847L120.853 119.68L118.424 121.651L118.142 121.88L118.272 122.219L119.396 125.138L116.771 123.437L116.466 123.239L116.184 123.468L113.755 125.439L114.562 122.417L114.656 122.066L114.351 121.869L111.726 120.168L114.849 120.001L115.212 119.981L115.306 119.63L116.112 116.608Z" fill="url(#paint3_linear)"/>
+<path d="M116.112 116.608L117.236 119.527L117.367 119.866L117.729 119.847L120.853 119.68L118.424 121.651L118.142 121.88L118.272 122.219L119.396 125.138L116.771 123.437L116.466 123.239L116.184 123.468L113.755 125.439L114.562 122.417L114.656 122.066L114.351 121.869L111.726 120.168L114.849 120.001L115.212 119.981L115.306 119.63L116.112 116.608Z" stroke="#FDCC80"/>
+<path d="M190.715 108.334L191.839 111.253L191.97 111.592L192.333 111.573L195.456 111.406L193.027 113.377L192.745 113.606L192.876 113.945L194 116.864L191.375 115.163L191.07 114.966L190.788 115.194L188.359 117.165L189.165 114.143L189.259 113.792L188.954 113.595L186.329 111.894L189.452 111.727L189.815 111.707L189.909 111.356L190.715 108.334Z" fill="#FDCC80"/>
+<path d="M190.715 108.334L191.839 111.253L191.97 111.592L192.333 111.573L195.456 111.406L193.027 113.377L192.745 113.606L192.876 113.945L194 116.864L191.375 115.163L191.07 114.966L190.788 115.194L188.359 117.165L189.165 114.143L189.259 113.792L188.954 113.595L186.329 111.894L189.452 111.727L189.815 111.707L189.909 111.356L190.715 108.334Z" fill="url(#paint4_linear)"/>
+<path d="M190.715 108.334L191.839 111.253L191.97 111.592L192.333 111.573L195.456 111.406L193.027 113.377L192.745 113.606L192.876 113.945L194 116.864L191.375 115.163L191.07 114.966L190.788 115.194L188.359 117.165L189.165 114.143L189.259 113.792L188.954 113.595L186.329 111.894L189.452 111.727L189.815 111.707L189.909 111.356L190.715 108.334Z" stroke="#FDCC80"/>
+<path d="M142.486 168.803L143.61 171.722L143.741 172.061L144.103 172.042L147.227 171.875L144.798 173.846L144.516 174.075L144.647 174.414L145.77 177.333L143.145 175.632L142.841 175.434L142.558 175.663L140.13 177.634L140.936 174.612L141.03 174.261L140.725 174.063L138.1 172.362L141.223 172.196L141.586 172.176L141.68 171.825L142.486 168.803Z" fill="#FDCC80"/>
+<path d="M142.486 168.803L143.61 171.722L143.741 172.061L144.103 172.042L147.227 171.875L144.798 173.846L144.516 174.075L144.647 174.414L145.77 177.333L143.145 175.632L142.841 175.434L142.558 175.663L140.13 177.634L140.936 174.612L141.03 174.261L140.725 174.063L138.1 172.362L141.223 172.196L141.586 172.176L141.68 171.825L142.486 168.803Z" fill="url(#paint5_linear)"/>
+<path d="M142.486 168.803L143.61 171.722L143.741 172.061L144.103 172.042L147.227 171.875L144.798 173.846L144.516 174.075L144.647 174.414L145.77 177.333L143.145 175.632L142.841 175.434L142.558 175.663L140.13 177.634L140.936 174.612L141.03 174.261L140.725 174.063L138.1 172.362L141.223 172.196L141.586 172.176L141.68 171.825L142.486 168.803Z" stroke="#FDCC80"/>
+<path d="M130.756 99.7448L132.579 104.478L132.709 104.818L133.072 104.798L138.137 104.528L134.199 107.724L133.917 107.953L134.047 108.292L135.87 113.025L131.613 110.267L131.308 110.069L131.026 110.298L127.087 113.495L128.395 108.594L128.489 108.243L128.184 108.045L123.927 105.287L128.992 105.016L129.355 104.997L129.448 104.646L130.756 99.7448Z" fill="#FDCC80"/>
+<path d="M130.756 99.7448L132.579 104.478L132.709 104.818L133.072 104.798L138.137 104.528L134.199 107.724L133.917 107.953L134.047 108.292L135.87 113.025L131.613 110.267L131.308 110.069L131.026 110.298L127.087 113.495L128.395 108.594L128.489 108.243L128.184 108.045L123.927 105.287L128.992 105.016L129.355 104.997L129.448 104.646L130.756 99.7448Z" fill="url(#paint6_linear)"/>
+<path d="M130.756 99.7448L132.579 104.478L132.709 104.818L133.072 104.798L138.137 104.528L134.199 107.724L133.917 107.953L134.047 108.292L135.87 113.025L131.613 110.267L131.308 110.069L131.026 110.298L127.087 113.495L128.395 108.594L128.489 108.243L128.184 108.045L123.927 105.287L128.992 105.016L129.355 104.997L129.448 104.646L130.756 99.7448Z" stroke="#FDCC80"/>
+<path d="M182.314 121.648L184.137 126.382L184.267 126.721L184.63 126.701L189.695 126.431L185.756 129.627L185.474 129.856L185.605 130.195L187.427 134.929L183.17 132.17L182.866 131.973L182.584 132.202L178.645 135.398L179.953 130.497L180.046 130.146L179.741 129.948L175.484 127.19L180.55 126.919L180.912 126.9L181.006 126.549L182.314 121.648Z" fill="#FDCC80"/>
+<path d="M182.314 121.648L184.137 126.382L184.267 126.721L184.63 126.701L189.695 126.431L185.756 129.627L185.474 129.856L185.605 130.195L187.427 134.929L183.17 132.17L182.866 131.973L182.584 132.202L178.645 135.398L179.953 130.497L180.046 130.146L179.741 129.948L175.484 127.19L180.55 126.919L180.912 126.9L181.006 126.549L182.314 121.648Z" fill="url(#paint7_linear)"/>
+<path d="M182.314 121.648L184.137 126.382L184.267 126.721L184.63 126.701L189.695 126.431L185.756 129.627L185.474 129.856L185.605 130.195L187.427 134.929L183.17 132.17L182.866 131.973L182.584 132.202L178.645 135.398L179.953 130.497L180.046 130.146L179.741 129.948L175.484 127.19L180.55 126.919L180.912 126.9L181.006 126.549L182.314 121.648Z" stroke="#FDCC80"/>
+<defs>
+<pattern id="pattern0" patternContentUnits="objectBoundingBox" width="1" height="1">
+<use xlink:href="#image0" transform="scale(0.00195312)"/>
+</pattern>
+<linearGradient id="paint0_linear" x1="130.712" y1="95.3178" x2="141.707" y2="195.414" gradientUnits="userSpaceOnUse">
+<stop stop-color="#F342FF"/>
+<stop offset="1" stop-color="white" stop-opacity="0"/>
+</linearGradient>
+<linearGradient id="paint1_linear" x1="130.712" y1="95.3178" x2="141.707" y2="195.414" gradientUnits="userSpaceOnUse">
+<stop stop-color="#F342FF"/>
+<stop offset="1" stop-color="white" stop-opacity="0"/>
+</linearGradient>
+<linearGradient id="paint2_linear" x1="130.712" y1="95.3178" x2="141.707" y2="195.414" gradientUnits="userSpaceOnUse">
+<stop stop-color="#F342FF"/>
+<stop offset="1" stop-color="white" stop-opacity="0"/>
+</linearGradient>
+<linearGradient id="paint3_linear" x1="116.026" y1="114.992" x2="116.711" y2="127.821" gradientUnits="userSpaceOnUse">
+<stop stop-color="#FFE171"/>
+<stop offset="1" stop-color="white" stop-opacity="0"/>
+</linearGradient>
+<linearGradient id="paint4_linear" x1="190.629" y1="106.719" x2="191.314" y2="119.547" gradientUnits="userSpaceOnUse">
+<stop stop-color="#FFE171"/>
+<stop offset="1" stop-color="white" stop-opacity="0"/>
+</linearGradient>
+<linearGradient id="paint5_linear" x1="142.4" y1="167.187" x2="143.085" y2="180.016" gradientUnits="userSpaceOnUse">
+<stop stop-color="#FFE171"/>
+<stop offset="1" stop-color="white" stop-opacity="0"/>
+</linearGradient>
+<linearGradient id="paint6_linear" x1="130.67" y1="98.1291" x2="131.641" y2="116.302" gradientUnits="userSpaceOnUse">
+<stop stop-color="#FFE171"/>
+<stop offset="1" stop-color="white" stop-opacity="0"/>
+</linearGradient>
+<linearGradient id="paint7_linear" x1="182.228" y1="120.032" x2="183.199" y2="138.206" gradientUnits="userSpaceOnUse">
+<stop stop-color="#FFE171"/>
+<stop offset="1" stop-color="white" stop-opacity="0"/>
+</linearGradient>
+<image id="image0" width="512" height="512" xlink:href="data:image/png;base64,iVBORw0KGgoAAAANSUhEUgAAAgAAAAIACAYAAAD0eNT6AAAACXBIWXMAAAsTAAALEwEAmpwYAAAAAXNSR0IArs4c6QAAAARnQU1BAACxjwv8YQUAACwjSURBVHgB7d39VRRLtwfg8l33fzUCIAIwgoMRqBGAESARCBEIEYgRiBGIEYARMEagRsDtPTOt48B8MR9d1f08a/UaOM6577mKU7+qXbXrSQLokLu7u2fVSzzbw9d4nlbP8+rZGr7t2dhT257xf/7X8Am9sX/2Y/jP4vn15MmTmwQNepIAClUN5tvDL7fT38G5fo3BfHSwH/21XEQIiHDwbfh1TzBgUwQAoHFzzspHf218Zt4mEQiuhs83gYB1EQCAlRkZyB+aedeD+kODPZP10iAMfKnCwGWCFREAgAeNLa+PD+ijs/LR97FesToQIUAYYGkCALTc2Kx8O3V7eb1NemmwMnBahYFeggUJAFCIRyyvp2RW3hVXaRAErhLMSQCABkxYXn9oVj76PpilVz0nVRD4lGAGAQCWYHmdTPWSIMAMAgAMDWflltdpk14SBJhAAKB1LK/DPb3qeaOnAKMEALI1YdNbPZCPzsq3k+V1mMdFcmqAIQGAjZjSstXyOmzWr+o5q0LAaaLTBAAWssDy+viADuSlVz0vrQZ0lwDQUQucKd9Oltehzc7SoCzwK9EpAkALWF4HltSrnrcaCXWLAJCRRyyvm5UDq3Rib0B3CABrYHkdKFgv2RvQCQLADFOW10PMyi2vA21kNaDlOhUARmbm2+nfM+WW1wHuu0qDvQG9ROu0NgBUg/1e9VI/W8PX7QTAInpJO+FWakUAGM7sY4B/XT27w6/N3gFW5yLpItgqxQaA4aB/kAaDvgEfYP16yXHB1igqAAwH/f3qORq+ArB5Ngi2QBEBYDjwx6D/LpnpA+SglxwXLNr/UsaqgX+/er5WX/6snpNk8AfIxXb13Faf0e8TRcpyBSAG/uolfqj2EwC5u0qOCxYnqxWAWOqvnovqy5j17ycASrBfPV+rz++DRDGyCQDVD07U+G/TYGc/AGXZrp6L6rP840gHVTLWeAlg2LDnQzLjB2iLXnJcMHuNBoDhrP8k2dwHbNCvX7/+PL1er//6+/fvP9+Pvyee0X82ybNnz+49W1tbaWdnJ+3u7va/39vbSx3iuGDGGgkAw2N9n5NZP7CkesCuB/KHBvN4Hf26SXUI2N/fT//991//teV6yXHBLG08AAyX/GPw304AQ/PMykcH+Vmz8VJEIIgQ8Pr16/Tq1av+9y1lNSAzGw0Awx2iZ8mSP7TW+ABdD94/fvxIP3/+/DOojw/sDBweHqaDg4O2rgxcJccFs7GxADCs958loBilLa+3SZQJ3r171w8DLdNLbhfMwkYCwLBT1EkCGjFteb2elbdxeb0Ntre308nJSRuDwEVyu2Cj1h4ADP6wWg/NvC2vt18EgY8fP7atNNBLjgs2Zq0BwOAPk827vD4+oNNtsUfg/fv3/UDQIjYINmBtAUDNn654aNPb+PL66NK75XWWFScFYn9ABIEW6SXHBTdqLQFgeNTvOkFhLK9TklgF+Pr1q9UAHmXlAWDYAzou89lO0JBFl9fNyilZbBJs2WrAVXJccO3WEQDiQp/tBCsw75lyy+t0XQtXA3rJccG1WmkAqAb/uNTnXYIHWF6H9WvhasBFclxwLVYWAKrB/7B6+ZhovfHz5JbXIS9xVDCODLZsNcBxwRVbSQBQ9y+T5XVor5Y2ELJBcIVWFQAuqpfWtakqyUMz7xjIx3/N8jp0S31csEWXDPWS44IrsXQAqAb/12lwux8r0NUb0YD1cVyQh6wiANj1/wA3ogG5cVyQUUsFgK5s/HMjGtAWjgtSWzYAFDv7j0H65ubmT63c8jrQJWdnZ+no6Ci1yEVyXHAhjw4AJc3+YxC/vLzsD/jfvn3rvwJ03evXr9OHDx8cF2QxMfu/y1hVZ7+rEu7d/v7+Xfznejwej+f+Uw3+dxcXF3ct8z6xHtVv7uFdpm5vb++qZa27Z8+eFfMX0OPxeJp+Dg8P+xOnFrm9G/SoYZXuMpz9x8B/cHBQ1F84j8fjyemJ1YDr6+u7lnmfWI3qN3P/LjOx1G/G7/F4PKt5Tk5O7lrm653VgHsW3gR4l1HXv9jc9+bNm3R1dZUAllVvhovX6JwXz9OnT9Pz58//fD1utONmfYqofi2Z44Ltt1AAGCao25SB+Av28uVLZ+6Be+rBO556MK8H8q2trf57Rgf5+lmlCACjJ49iolJiKHBcsL0WDQCHKYOjfwZ/6IbxAXp8hh6D+uggv46BfJUiBEQgqI8ll8JxwXZaNAB8rV72U4MM/lCm0UF60kA+/mttFp9h0Zo3AkEJn2ctvV3wrAoBx6mj5g4A1eAfsfpnatjOzo7BHxo0rU4+urzelYF8FS4uLtLp6WkRn22Hh4f91QC3C5ZvkQDQ+K1/x8fH/XoUsLx5B/J11sn5VylBIH4uPn/+nPb29lKLdO52wUUCwEVqcPd/1M5i6R/417QNbyXWySknCLTwdsHYmPGmK6sBiwSA2P2/nRpi6Z+2m3fDW5fq5F0XA2wEgZy18LhgHNV414XjgnMFgKaP/0Uafvv2bYJSjA7Q44N1LK8byJlXKRufW7gacJFaflxw3gDQaP3f7J+mqJOTixJWA/b399PHjx/bdlzwuAoBl6mF5g0AsfOukU4QZv+sQg6NYWBZ0Tsgup/mPCFyXLAc8waAxs7/x9KXVr/U2tYYBhYVg3+ciIpmQjmL44JREmjZakCrjgvOGwDi/P/GP0XjBz2W/2knjWHg8UrZIBglgSgNtEhrjgvODABNNgCy/F8GjWGgGTYINqYVxwXnCQD71cvX1IDoP/3ly5fEZtjwBuWJC4ZiJSD3JmmOC+ZnngBwmBq6ACgGntKv1GyCxjDQPZoHNeYiFXpccJ4AcFK9bPxPK3a7vnjxInWZxjDAImLwj1MCud806LhgHuYJABepgRbAsfQfJYC20BgG2JRSNgi28bhgGqwGFLF0PU8AaOQIYPzwxg9HKSLR7u7u9i/HsLwONK2UDYKOCzYn2wBQwgbAGNiPjo7Su3fvDPJAdmLwj4nUp09571NzXLAZ/5vjPdupAb9//045i2Wr29vb/l8ugz+QoxhYY3NgDK45f07VqxW5ly0WdBKX6A3v0snSPCsAjdwCmHP//1iyir9QAKUopSTguODmZLsCkPPxv5YdYQE6IAbUWLXM/fOr7gDbotWAWHq5qCbTH4eN9bIxzwrAXWpAlZZSrhr6LQFYibhfJbqs5r4a0NLjgtlsEJxnBYAxmhMBJYuBNZbZcz+CF0Elyha5b2JcwHb1xL6ALJZhBIBHOD8/TwAlqzcIfvjwIfsNgrHvqoQViwXEBsGvTW8QVAJ4pOvr6/6Zf4DSlbRBsGXHBXvV87Ya765SA6wAPFLLlqWADitpg2DLjgtuV8/XpkoCVgCW1MKLLYAOu7y8TMfHx44Lbt5FGtwnsLFNZlYAlhQBIC7faFFtCuiw6MIaA2vud7G08LjgYfVcb3JfgBWAFWlhGgU6roRLhULLjgv2qudNNQau/UpHKwArEmk0ri92QgBoiwgAsTcg94G1ZccFt9NgJWDtZzQFgBWK/gBxMVDL+lkDHRaDf5x6is+2nLXwuODFujcHKgGsSRwR/Pz5s5IA0BrRNyAmOI4LbtTabhW0ArAmNzc3/SWpeAVog5hhx16n3AfWlh0XPFnXSoAAsEb2BQBtU294LuH4c+xhyPlm2QWsJQQoAWxI1M+i5SZAW5TSQTC0pGdL9Ak4SysiAGyQo4JA29Sbn0vYgd+S44IvV9U6WAlgg+q0HEdWANogLhKKzYElDKwtOS74eVXNgqwANEQLYaBtSioJxIbG+AwudDWgVz0vlm0bbAWgIREA4rxqLJ8BtEEplwqFWLUoeEV2u3qW/k22AtAw+wKANooj0KXck1LwiuxS+wEEgAxEDS3qZ7lfvgGwiJI2CBY6GeulJUoBSgAZiL8kkZS1EAbapN4geHCw9rb2Syv0dsHttEQpwApAZmIVIPoFKAkAbRGTnGiKVkpDngKPC+5UY2YvLcgKQGYuLy+L2UULMI+6zFmKAo8LPuo3VwDIkBbCQNvEBWklGb1dsIDTWvvVYv1+WpAAkClXCwNtUuqEJvYwFFK+WHgvgD0ABXC1MJCDehAcf/39+3d/0vLz588/Xz/0lK6A44IL7QUQAAoRg3+EgNKW0YA81IN1PRhPGrzr944O2vYk/ZX5Ru3Tauw8mffNAkBhzs7O0tHRUQK6Y3wwHv3+x48ff/75tFdWJ+MJWfxQ7MzbF0AAKJCrhaEciwze47Pztiydt1WmJYG5uwMKAIXSQhg2Y96l87bWvZkuTgrEhCyOOmbioho/387zRgGgYDH4x9naaFoB3Dc+eNePujerlNmE7Fc1fj6f540CQAu4Wpg2UvemJJmFgLnKAAJAS2S4DEWHPTSTrl/VvWmrjELAXKcBBIAWsS+AVXls3Xv034UuyuRz+KoaQ1/OepMA0EKOCnabujc0Kwb/6+vrJldk59oHIAC0VJQEYl+A1YCyLFP3tnQO+cjguPbMroACQItF+owNglYDNmfS4KzuDd0TqwANNgt6W42jF9PeIAB0QKwCRBA4ODhITDZv3bt+r6VzYJpYiW3wGuTjahw9m/YGAaBD2hwEJjVhmTR4P/QKsEqxCnt7e9vUXoCZDYEEgA6KIBDNgyII5NBESKtUoK3iOuGGJl1fqnH09bQ3CAAdF8k0alS7u7v9MBDfR0BYZPPgIme+Rwd4gzfQdg1uBrypxtEX094gADDVtCBg6Rxgurg+OG4ObECvGkd3pr1BAACANYlJVOwDaMDMXgD/SwDAWjRY5py589AKAACsUUPDaIyjUwdSKwAA0EECAAB0kAAAAB0kAABABwkAANBBAgAAdJAAAAAdJAAAQAcJAADQQQIAAHTQ/yUA2KD6ltG4fnz0efr0aXr+/Pmfr0ffO/7v1KLX/s3NTfr+/Xs6OztzS+kC3AUAwNzGB+L6+0mD9+iAPe168VW5uLhIp6enWQWBXO8CEAAAOuChgXjS4D0+Mx99bwliVeDt27fp8vIy5UAAWJAAADAwPhA/NDBvbW39896HBvGuefPmTRYhQABYkAAAtMG0AXnS4D2p3s1iYiXgxYsXjZcDBIAFCQBA0xatdz/0SrNiBSBWApokACxIAACWMWlAzmWzGpsTqwBxUqApuQYAxwCBrEzbrDar3j36HqgdHh6md+/eJf5lBQBYmcdsVlPvZt1iL0Cs+jRFCWBBAgBs1qTmLKO/Vg/es5qzQG52dnYa2wyoBACsjc1qMN3+/n6/SRB/CQDQMJvVYP329vYS/xIA4JFsVoNy+Pt2nwBAJ9msBt1S/33mLwGA4mzPuEks2KwGjPL3/j4BgI1adLOaJXOA9RAAWEg9aBu8AcomADBVDOAHBwf9IzSxi9ZADtAOAgAPisH+w4cP/YEfgPYRALgnBn59swHaTQDgHx8/fuxfnAFAu/0vwVDM/A3+AN0gANDnukyAbhEA6Hv//n0CoDsEAPqzf8f7ALpFACC9evUqAdAtAgDO+gN0kADQcTH4uyQDoHsEgI6Ljn8AdI8A0HFm/wDdJAB0nN3/AN0kAHTc1tZWAqB7BAAA6CABAAA6SAAAgA4SAACggwQAAOggAQAAOkgAAIAOEgAAoIMEAADoIAEAADpIAACADhIAAKCDBAAA6CABAAA6SAAAgA4SAACgg/4vAcCIXq/Xf/3169c/z+/fv/uvP3/+TM+ePUsnJyeJcgkAAC1SD97jr6ODd3xd/1o9uI++dx4CQPkEAIAMjA/Eo9//+PHjzz8ffe9jB+9ViP/d+N/c3t5OlEkAAFjS+IA8z+A9/n2JSv3vZkAAAFjQ1dVV+vbtW//15uamswNhhJi9vb1EmQQAgDnFgH96etp/Jf3ZS0CZBACAGWKWf3x8bOAf8/Tp00S59AEAmOL8/Dy9fPnS4P+AOAlAuawAQIuNHgV76Cx3fL2/v58ODg4S98Vyv6NukwkAZRMAIHPzDOLjO8sXORJ2eXmZ/vvvP8e5xhj8p4vB3wbAsgkAsAEPDeIhjoitYhBfRvxvvn37Nn39+jUxEL/3Bv/pYuWIsgkAMKdJ57inDeKlnPGO+nbUuo+OjhKpX/NnutevXyfKJgDQSTFA108YHcTrX3+oqUubxYz31atXnS8FXFxcbLyrXmniZ8S+kfIJAHRCDOAxw+1645ZplAIG4ueE6T5+/JgonwBAq8VMLgY1R7jm0/VSQPy8REBksvfv36v/t4Q+ALRW7OLe2dkx+C8oSgFdXQL3szJZ7Pr//PmzzZEtYgWA1oml7Ddv3vgwf6QulwK+f/+e+FfM9mPDX9T8nftvFwGAVonB68WLFzZxLamrpYAuL//X5/p3d3f7rzHw6w3RbgIArRLHtwz+q+FUQHsZ7AkCAK0RNX8buFani6WAtl5uE4N8dHs02DNKAKAVdG5bjygFRKvgrjR9ef78eWqj+POL3fswSgCgFQz+6xOrADFr7MIGsLq5Td0Iqn6FNhIAKF58SH/69CmxHnUpII6AtV0EnfEz7qNBIE4JxGvdTGq0mySURgCgeDq3rV+UAbpUChg1euvdpAY4dRCIUBBtpW9vb/uvQgI5EwAonvP+m9GlUsCiYlPdrI117969E1bJik6AFK1ejmX94vc6TlrwOG3dYEi5BACKZvDfrLOzMysu0BICAEXTunXzohRgZzyUTwCgaAaizYsNbUoBUD4BAFiYUgCUTwAAHkUpAMomAFC0ra2tRDOUAqBsAgBFc6lJs5QCoFwaAVG0aExzd3fXX4quu66FeI1ObPXXo/+8fi+rEaWA6+trDYKgMAIArRCDTzyLrAiMhoG6hWu8/vz5s/91tL5ltroU8OHDhwSUQwCgs2aFhSdPniTmE6WAV69eTeyVD+THHgBgJZwKgLIIAMBKOBUAZREAgJWJUoD7GaAMAgCwUlEKAPInAAArFSsASgGQPwEAWLmTkxOlAMicAACshVIA5E0AANYiVgDOz88TkCcBAFibKAXUbZiBvAgAwNpEYyClAMiTAACsVdwWqBQA+REAgLVTCoD8CADA2ikFQH4EAGAjlAIgLwIAsDFKAZAPAQDYGKUAyIcAAGyUUgDkQQAANk4pAJonAAAbpxQAzRMAgEYoBUCzBACgMVEKiNUAYPMEAKAxSgHQHAEAaNTl5WX/ATZLAAAaF6sASgGwWQIA0DilANg8AQDIQpQB4mQAsBkCAJANpQDYHAEAyEZ0Bzw9PU3A+gkAQFbOzs6UAmADBAAgO0oBsH4CAJAdpQBYPwEAyJJSAKyXAABkSykA1kcAALKlFADrIwBAxg4ODtKzZ89SlykFwHoIAJCxnZ2d9P79+9R1SgGwegIAZO7du3dpf38/dZlSAKyeAAAF+Pjxo1KAUgCslAAABdje3u6vBHSdUgCsjgAAhYi9AHt7e6nLohRwfn6egOUJAFCQDx8+pK47OTlJNzc3CViOAAAFic2ASgGDUgCwHAEAChOlgNgT0GWxAuBUACxHAIDCxGmAOBXQdUoBsBwBAAqkFDBwfHycgMcRAKBQUQroem+A6AvgVAA8jgAAhYrB36mAQSkgjgcCixEAoGCHh4edbxMcjYGcCoDFCQBQOG2ClQLgMQQAKFwcCXRjoFIALEoAgBZwY6BSACxKAICWsCFQKQAWIQBAS8RFQbEM3nVKATAfAQBa5OjoqPNtgpUCYD4CALSINsEDSgEwmwAALaNN8IBSAEwnAEALuTFQKQBmEQCghZQCBqIUcHl5mYD7BABoqSgFvH79OnVdrALEagDwLwEAWkybYKUAmEQAgBaLwV+b4NQvAygFwL8EAGg5bYIHlALgXwIAdIBSwKAUcHp6moABAQA6II4E6g2Q0tnZWf9kACAAQGfEXoC4L6DrlAJgQACADnFjYOp3B1QKAAEAOkWb4AGlABAAoHO0CR5QCqDrBADoGG2CB5QC6DoBADpIKWBAKYAuEwCgo6IU0PXeAEEpgK4SAKCjlAIGlALoKgEAOixuC9QmWCmAbhIAoOO0CR5QCqBrBADouDgS6MZApQC6RwAA3Bg4pBRAlwgAQJ82wQPHx8cJukAAAPrioqCTk5PUdTc3N0oBdIIAAPxxdHSkTXAlglAEAWgzAQD4Q2+Av+JUALSZAAD8Q5vgAaUA2k4AAO5xY+BAnAqI44HQRgIAcI9SwEA0BlIKoK0EAOBBUQqIVsFdF30Bzs/PE7SNAABMpE3wQJwKUAqgbQQAYKIY/LUJVgqgnQQAYCptggeUAmgbAQCYSSlgQCmANhEAgJncGDigFECbCADAXKIUEPcFdJ1SAG0hAABzc2PggFIAbSAAAHPTJnhAKYA2EACAhWgTPKAUQOkEAGAh2gT/pRRAyQQAYGFKAQNRCjg+Pk5QIgEAeJQoBegNkNLl5WX/gdIIAMCjKAX8FRsCYzUASiIAAI8WtwVqE+xUAGUSAIClaBM8oBRAaQQAYCnaBP8VGwKVAiiFAAAszY2BA3Ek8PT0NEEJBABgJWwIHDg7O+s3CYLcCQDASkQpIBrj4FQAZRAAgJU5OjrSJjgpBVAGAQBYGb0B/lIKIHcCALBS2gT/pRRAzgQAYOXcGDigFEDOBABg5ZQC/lIKIFcCALAWUQqIVsEoBZAnAQBYG22CB6IUcHFxkSAnAgCwNjH4axM8YAWA3AgAwFppEwx5EgCAtVMKgPwIAMDauTEQ8iMAABsRpYC9vb0E5EEAADbmw4cPCciDAABsjDbBkA8BANgobYIhDwIAsFHaBEMeBABg45QCoHkCANCIKAXoDQDNEQCARigFQLMEAKAxcVugNsHQDAEAaJQ2wdAMAQBolDbB0AwBAGicGwNh8wQAIAs2BMJmCQBAFqIUcHJykoDNEACAbGgTDJsjAABZUQqAzRAAgKxoEwybIQAA2VEKgPUTAIDsaBMM6ycAAFmKUkC0CgbWQwAAsqVNMKyPAABkKwZ/bYJhPQQAIGvaBMN6CABA9pQCYPUEACB7bgyE1RMAgCJEKWBvby8BqzFPAPiVGqAJCDBObwBYnWwDAMC4WAHQJhhWI9sSgBUA4CHaBMNqKAEARdEmGFZjngDQSw0QAIBJ3BgIy5snAPxODdja2koAk0QpQG8AeLxsVwB0/gKmUQqA5WRdApDugWnitkCTBXiceQLATWqIph/ALNoEw+NkuwIQ3AUOzKJNMDzOzADw5MmTOAbYyFHA3d3dBDCLGwNhcfM2AmqkDBB/oS3tAfOwIRAWM28A+J4acnh4mABmiVLAyclJAuaT9QpAePXqVQKYhzbBML95A8BVakiUAdT2gHkpBcB85goAT5486aUGbwV0GgCYlzbBMJ9FbgP8khpycHBgMyAwN6UAmG2RANDYPoAY/CV6YF7aBMNsiwSAi9Sgo6OjBDCvKAUoH8JkcweAYUOgq9SQSPRRCgCYlzbBMNkiKwDhW2pQnPH1lxmYV3xeaBMMD1s0AFylBsWmHnsBgEVoEwwPWygAVGWAq9Tg5UAh9gJYBQAWoRQA9y26AhA+pQZZ0gMW5cZAuO8xAeAsNSyW9Pb29hK03c+fPxOroRQA/1o4ADR9GqD24cOHBG13fn6enj9/nt68edP/+urqKvF4Pjfgr8esAITz1DDtPumKX79+pcvLy/7P+8uXLyOE91/j+/jnvV4vMZ9YOfS5AQNP0iPd3d3F2mSju2rig/HFixc+AJfw9etXy6ITxEBbiqhxx+AWf5a7u7v+TKfo4udGHKHu+h6I+PPe2dlJTajGy9SEJzM+xP4vPV6sAjT6E1W3+4zZEHRZfLjFEysCtdEwEOFAb/wBnxsw8NgSQIjNgI3dEFhTCoCHxX6B2DcQ+wdi5hOPvQQDPjdgiRWA2AxYLWvEkcDGm/TH0pZaKEw3vkoQM+FYGahXCeLp0ln52BB4c3NjYyWdtcwKQGj8SGBw8xcsLmrho6sEcdqga+JzQ2mErloqAFSrAL3UcGOgWsxeHPFhGTE77vJg2MXeGjH4f/78WZdAOmmZTYC1k+rJ4pq+qOl9+fLFkh5ziRlwLAHHknj83HS9hNTV5lrx/3dMHt6+fZugS5YOALEKMNwLkEUIqHf32g/AQyIcfvv2rf8qKP6ry0cHDw8P+58Zp6enCbpiFSsA4aR6XqWG+wKEWNJzxIda3UQnBv14je952KtXr1KXxVn5CAGfPmVR1YS1W3YTYN9wL0Dj3QFr9gN0WwzyMZOLZi9Ry4+l3YuLC4P/FDEDVgdP6ezszD0jsKiqDPAsugPeZeTg4CDaL3mmPF+/fr1rk+oD/K4ayIr6M8jhub29vWMgfi+qlcSi/vymPdWE6O76+vqu6+LPtak/g6akGVayAhCGlwRlVUCLNO+IT3fErD82gprpLyb6aPh78lf8XkSL7NJ/T2IlNP7/iMeqBhtRhY6vdxmJ1GdGOPlpywpAzPxL+n3P5akGhjseVupKQMz427aytwpWAO5b2QrAiKxWASLF2w/QbrFxKzZwsZj6DDwPK20lIPZx1DN+l0Exj5UHgKoUcJUy2hAY4i+Gvt/tFYO/Zf/FtGWZe91y/32KjZtRwvn582f/9JOBn0WsYwUgnKQMLgoaFasA6mDtFE18mN/r16/T9fW1wX9O8ftULR9nNYmIgT5Wb+K/KwKwExw8xloCwHBDYHZttbT8bJ8Y/M3+5xM/+3Ec0t+Dx4lJRJN3B8SgX8/2Y1Uigpw/R5axrhWACAFx5dhlyoiaZ/vo5jdbvUwcs8WDg4PE40U5MX4fNxUE6kE//jdj0DfbZ5WepDW6u7uLn9TblEGHwFHxl0jLz4HSNwxFx0ch4L4YnKKzX8wS1YXXJ7pL1p0mV9F+PMqU//33X//VDH+14s9nZ2cnNWGODflrUU3Ep47xq2oFPOl//Ff1/3iUArKadkcA+P79+5970aEU47PO+D4GiXhi0Nja2uoP+AaOzYhBOp4QF0vFIBOfLfFaB4IoUY2WqeLPpv5zi9f4M4s/u/qfwaasNQCEKAVUISBOBRyljMQSXv0XFjahHrzrAbv+/unTp/2WxfHP4uvR946/kq8YxOuZO5Rg7QFg6CQNLgvaTpmID9vYDxBLyDaRlaseMNepHrDDpIE5ZnGj733o3wHIyUYCwEgp4GvKSKT12GBzfHycKFNc+DPtGOD4gPzQwDw+eI/P1AHaaFMrAP0GQVUIiJE2q7Z8cbb3x48f/XsDKM/R0VF/ALdkDrCYtZ4CeEgVAmIVYD9lJEoAUQqIPQFdo20o0AVOAdy3tj4AU0QpoJcyUu8HsNwLQFdsPABUgaSXMuwSqEkQAF3SxApAfWFQdjvv6q5bANB2jQSAUIWA2HWXXSeeaBKkJg5A2zUWAIay2w8QohRgFzkAbdZoABjeGvgyZXZ1cL0pEIB20PX1vqZXAOpNgdntB4gmQXH9JwC0UeMBIFQh4KJ6OU+ZiSZB8QBQNisA92URAEIVAmKkza4TT5wKsB8AoGzR8ZV/ZRMAht6kDPcDRLc8TYIAynV9fZ34V1YBYLgf4E3KTKwAxPXBAJTJCsB9ua0A1E2CTlNm4o5v+wEAyhP1/y7e9TJLdgEgVCHgpHq5SpmJUwGaBAGU5erqKnFflgFgKEoBvZSZKAXYFAhQjk+fPiXuyzYADJsEZbcp0H4AgHLE8r8VgIflvAIQISCKNtntB4gygCZBAPmL+114WNYBIAwvDcqySdDBwUECIE8XFxeW/6fIPgAMnaQMmwSdnZ3ZDwCQoVj6Pz3NbgE5K0UEgFz3A2gSBJCfGPxfvnyp/e8MpawAZN0kyH4AgDzEhj+D/3yKCQAh1yZBh4eHmgQBNCgG/PgsNvjPr6gAEHJuEhRXCAOwGb9+/erP+N+8eZN2dnZs+FvQ/6UyRSkgbnbYThn5/Pmz9AmwBvG5GgN+tPSN5/v37/3X+Gc8TpEBIDYF3t3d1SEgG3WToAgBpXBBBrBOMUDXg3Q9Oapff//+3f+1nz9/9r+uf+2hf4fVK3UFoN8kqAoBx9WXWe3Aq5sEHR8fpxJIz8Ak4wPx6Pf15KEeoOtfG3/IV7EBIESToCoEROE9q448sSHw27dv6fLyMuVOuoZ2Gh+YZ826H/p3aLeiA8BQbL//L2W2HyBKAVGfyn2AdUUm5GXaknk9664H74dm20J9XhpsFjczwRUfAIb7AaLoHvsBsunIE82B6k2BOSfpehONZkawvGnL4JOWzM26WZP2B4AQTYKqEPC2+vJzykgcC3z//n3W+wHqXbWxdwG6bJklc7NuJsm5XXwrAkCoQsBlFQLi0qCjlJHYDxDJP+4NyNX5+bkAQLGW2ag2+muwDg2urvZmvaE1ASBUIeBdFQJ2qy/3U0ZiFSCaVeRab4//NmUAmjBtYB4fvG1Uo0RWADYrSgFfU0abAuv9AC9evMjyAyv+m+LWLHcasIhJA7Oz3fBXgwGgN+sNT1ILVasA+2kQArJSX1KRq7jZUCmg/Zzths1p8HP1dNg6f6JWBoBQhYA4HpjdlPbk5CTbO6ojqcYPa85LVl03aWB2thvyFH8nGyqvHkevnGlvaG0ACFUIuEiZNQkKsQoQqwE5EgLWQztU6J74HL29vU0NeTm8QXeitgeAiF3ZXRoUH+qxHyDXD/X6TgPlgAFnu4HHiOuJ47O0IS+iZf60N7Q6AIQqBGynzJoEhTgRkHuToPjhjRMMJa8GaIcKNOXi4iIdHDSzCF0N/jPH99YHgFCFgMPqpbEYNkn0Bijh0qDXr1/3n1evXm2slqUdKlC6WP5vaAJ1U43/L2a9qRMBIFQhIDZDZNUkKEQAyLlJ0LgoC+zu7qadnZ20tbXVDwSTfsAtmQNdFZOmOP7dkC9VAHg9602dCQChCgFRCthLGYnBLkoBLuUBaI8Y/CMENGTmEcDQtQCwnTJrEhRi9ptrkyAAFtPw7v8w8wRA+F/qkLg0KA06BWal3nUPQPmi30vD5lpS7lQACMNUlF0nnlgqiouDAChXTOia2vk/FBsA51pO7lQJYFRVDojdGY0VaCbJuUkQANM1uPO/dh4X483zxs6tAIyIUkAvZSZKAbrwAZQnk74pl/O+sbMrAKFaBYgTAbEpMLsmQbEpEIAyHB0d5XCk+1c1+38+75u7vAKQhm0Ss9sPsLe352pegELEZ3Ym/Vy+LfLmTgeAMLwt6TxlJjYENryRBIAZ4nM6LlDLxEKdhzpdAqgNLw2KP8HsmgTlfGkQQJdlsuxfW2j5P3R+BSAMj0y8qZ6sOvFEm91Ilg3dJQ3AA+pr0zNr4z735r+aADA0bBL0JmUmftDsBwDIQ+z0v76+zvG69E+J5VTlgJO7DL179+4u/vM8Ho/Hs9mnWoW9q5b7725vb+8ydZsewR6AB1S/mV+rl/2UGU2CADYnZvn//fdff1N25qXYw2oVe+EVAAHgAXeDTYFxc+B2ykhsBowQYFMgwOrFIB9H+qI1+6tXr0ppytarBv+d9AgCwAR3gyZB1ykzsQIQIQCAx4vBPgb4GPDj2d3d7b8WuOn6UbP/IABMUYWA6Kec3Q682Hl6fHycABioZ+sxgNeDe3j69Gl6/vx52tra6n9fD/Itabn+6Nl/EABmqEJAnPM4Spl58+ZNurxc+NQHQHbqQTvEwDz+fagH8Pr78QG/ox49+w8CwAx3mgQBTDXv7Lv+9fGHR1lq9h8EgDlUIWA7DfYDZPWTGoN/hIAIAwCPMWlQrgfv+uswaXZOI3aG/WseTQCYUxUCXqcF+yxvwsXFRXr79m0CumeRpfPx2bnZd9HOq8H/XVqSALCAXPcDnJycpNPT7C41BGaYtXRez74tnTOiVz0vhi3slyIALCjXJkGHh4fp0yedIGFTLJ3TkKWX/msCwIKG+wEiBGynzMR+gJubmwRMZ+mcQp1Wg/9JWhEB4BGqELCfBiEgK7EZMJoECQG03WOXzkf/XSjMZTX4r/TCOgHgkXJtEiQEkLtZs+/xpfOHXqFjemlFdf9RAsASqhBwUb0cpAxFp8DM7qqmJSYNypbOYS161fNyVXX/UQLAEnK9NKjmdADj5l06r99r6RwaFTP+F+sY/IMAsKRcmwTV4vKg6BOgY2D5lmmXavCG4sTgHzP/tdVzBYAVqELAYfXyMWUqBv9YDXBMsFmWzoE5rX3wDwLAiuTaJGiUIPB4ls6BDdnI4B8EgBXKtUnQuK4FAUvnQCF6aU0b/h4iAKxQzk2CHhJHBuNK4S9fvvT3CuR6qZCbxoAOuKqet5sa/IMAsGK5NgmaR/QOiNWBCAPfv3/vB4L4fplgoF0qwEwrudxnUQLAGuTaJGgZdRCYFgZGB2+zb4CZ4gM1Zv2XqQECwJpUISCuDn6dAOC+q7ThJf9xAsCa5N4kCIBGxKz/XTXwN74L+3+JtRj2bI6LG/LcWQfApkVr1p0cBv8gAKzR8BynXrwA3XaRBgP/yaov9FmGEsAGlNAkCICVu6ieT9Wgf5UyJABsSClNggBYSszwz6vnLKfZ/kMEgA2xKRCg1a6qJ2r7l7kP/DUBYINK6xQIwFRX1RNn+D+VMuiPEgA2rAoBe2kQAnTJAShLDPIx4H9LBc30JxEAGiAEABShlwaz/DjR9aXJpj3rIAA0RAgAyMKv4ROD/I/hazy90mf4swgADRICAFaqN3ytB/X6+9/D738Ov+4Nn19tH+SnEQAaJgQA9NWDduiNff9j5J/fe23b0vymCAAZcDoAaIHehNfxwXt8dt7pWXiTBIBMCAFAg3rD11lL5/V7/8zOzb7LJQBkZNgs6GNyjTAwP0vnPIoAkKEqCJxUL+8T0AW9Ca/17Lv+3tI5KyUAZKoKAftpsBqwnYBc9Yavv8YeS+dkTwDI2HBfwEn1HCRg1RZZOjf7pnUEgAJUQeAwDUoC2wmo9Yavszaujc/ODd6QBIBiWA2gZX5NeCydw4YIAIUZBoEPyUkBmmPpHFpAACjUcJNglAX2EyymN3y1dA4dJgAUbhgEDpPSQFdMWjoPMfu2dA7MRQBoiZE9Av8lmwVz1pvwaukc2CgBoIWqMBD7A+J5lVwytEq94euspfP6vWbfQLYEgJYbKRHsVs9e6i7tUgFGCAAdMiwTRAjYT38DQSkrBL0Jr5bOAR5BAOi4KhTUISACwc7wNWyn1e0l6A1fLZ0DZOL/AWgjuJqRzjE6AAAAAElFTkSuQmCC"/>
+</defs>
+</svg>
diff --git a/src/media/promo-large.jpg b/src/media/promo-large.jpg
new file mode 100644
index 0000000..c2718ca
Binary files /dev/null and b/src/media/promo-large.jpg differ
diff --git a/src/media/promo-marquee.jpg b/src/media/promo-marquee.jpg
new file mode 100644
index 0000000..6f22df3
Binary files /dev/null and b/src/media/promo-marquee.jpg differ
diff --git a/src/media/promo-small.jpg b/src/media/promo-small.jpg
new file mode 100644
index 0000000..23062f6
Binary files /dev/null and b/src/media/promo-small.jpg differ
diff --git a/src/mods/.github/workflows/update-parents.yml b/src/mods/.github/workflows/update-parents.yml
new file mode 100644
index 0000000..ac428e4
--- /dev/null
+++ b/src/mods/.github/workflows/update-parents.yml
@@ -0,0 +1,29 @@
+name: 'update parent repositories'
+
+on:
+  push:
+    branches:
+      - dev
+
+jobs:
+  sync:
+    name: update parent
+    runs-on: ubuntu-latest
+    strategy:
+      matrix:
+        repo: ['notion-enhancer/extension', 'notion-enhancer/desktop']
+    steps:
+      - name: checkout repo
+        uses: actions/checkout@v2
+        with:
+          token: ${{ secrets.CI_TOKEN }}
+          submodules: true
+          repository: ${{ matrix.repo }}
+      - name: pull updates
+        run: |
+          git pull --recurse-submodules
+          git submodule update --remote --recursive
+      - name: commit changes
+        uses: stefanzweifel/git-auto-commit-action@v4
+        with:
+          commit_message: '[${{ github.event.repository.name }}] ${{ github.event.head_commit.message }}'
diff --git a/src/mods/LICENSE b/src/mods/LICENSE
new file mode 100644
index 0000000..b503961
--- /dev/null
+++ b/src/mods/LICENSE
@@ -0,0 +1,21 @@
+MIT License
+
+Copyright (c) 2021 dragonwocky <thedragonring.bod@gmail.com> (https://dragonwocky.me/)
+
+Permission is hereby granted, free of charge, to any person obtaining a copy
+of this software and associated documentation files (the "Software"), to deal
+in the Software without restriction, including without limitation the rights
+to use, copy, modify, merge, publish, distribute, sublicense, and/or sell
+copies of the Software, and to permit persons to whom the Software is
+furnished to do so, subject to the following conditions:
+
+The above copyright notice and this permission notice shall be included in all
+copies or substantial portions of the Software.
+
+THE SOFTWARE IS PROVIDED "AS IS", WITHOUT WARRANTY OF ANY KIND, EXPRESS OR
+IMPLIED, INCLUDING BUT NOT LIMITED TO THE WARRANTIES OF MERCHANTABILITY,
+FITNESS FOR A PARTICULAR PURPOSE AND NONINFRINGEMENT. IN NO EVENT SHALL THE
+AUTHORS OR COPYRIGHT HOLDERS BE LIABLE FOR ANY CLAIM, DAMAGES OR OTHER
+LIABILITY, WHETHER IN AN ACTION OF CONTRACT, TORT OR OTHERWISE, ARISING FROM,
+OUT OF OR IN CONNECTION WITH THE SOFTWARE OR THE USE OR OTHER DEALINGS IN THE
+SOFTWARE.
diff --git a/src/mods/README.md b/src/mods/README.md
new file mode 100644
index 0000000..0885816
--- /dev/null
+++ b/src/mods/README.md
@@ -0,0 +1,5 @@
+# notion-enhancer/repo
+
+the collection of mods run by the notion-enhancer
+
+[read the docs online](https://notion-enhancer.github.io/getting-started/features)
diff --git a/src/mods/always-on-top/always-on-top.jpg b/src/mods/always-on-top/always-on-top.jpg
new file mode 100644
index 0000000..bed945f
Binary files /dev/null and b/src/mods/always-on-top/always-on-top.jpg differ
diff --git a/src/mods/always-on-top/button.css b/src/mods/always-on-top/button.css
new file mode 100644
index 0000000..71150b4
--- /dev/null
+++ b/src/mods/always-on-top/button.css
@@ -0,0 +1,47 @@
+/**
+ * notion-enhancer: integrated titlebar
+ * (c) 2021 dragonwocky <thedragonring.bod@gmail.com> (https://dragonwocky.me/)
+ * (https://notion-enhancer.github.io/) under the MIT license
+ */
+
+.always_on_top--button {
+  display: flex;
+  align-items: center;
+}
+.sidebar > .always_on_top--button {
+  margin: 0 0 0.75rem auto;
+}
+
+.always_on_top--button button {
+  user-select: none;
+  transition: background 20ms ease-in 0s;
+  cursor: pointer;
+  display: inline-flex;
+  align-items: center;
+  justify-content: center;
+  flex-shrink: 0;
+  border-radius: 3px;
+  height: 28px;
+  width: 33px;
+  padding: 0 0.25px 0 0;
+
+  margin-left: 2px;
+  border: none;
+  background: transparent;
+  font-size: 18px;
+}
+.always_on_top--button button svg {
+  display: block;
+  width: 20px;
+  height: 20px;
+  fill: var(--theme--icon);
+  color: var(--theme--icon);
+}
+
+.always_on_top--button button:focus,
+.always_on_top--button button:hover {
+  background: var(--theme--ui_interactive-hover);
+}
+.always_on_top--button button:active {
+  background: var(--theme--ui_interactive-active);
+}
diff --git a/src/mods/always-on-top/button.mjs b/src/mods/always-on-top/button.mjs
new file mode 100644
index 0000000..50f0454
--- /dev/null
+++ b/src/mods/always-on-top/button.mjs
@@ -0,0 +1,45 @@
+/**
+ * notion-enhancer: always on top
+ * (c) 2021 dragonwocky <thedragonring.bod@gmail.com> (https://dragonwocky.me/)
+ * (https://notion-enhancer.github.io/) under the MIT license
+ */
+
+export const createButton = async ({ electron, web, components }, db) => {
+  let pinIcon =
+      (await db.get(['pin_icon'])) ||
+      `<svg viewBox="0 0 20 20" fill="currentColor">
+        <path fill-rule="evenodd" clip-rule="evenodd" d="M14.5036 1.13488C14.3765 0.925602 14.2483 0.707495 14.1174 0.479601L14.9536 0C15.6901 1.28291 16.3103 2.18846 17.0583 2.94838C17.8041 3.70619 18.6966 4.33897 20 5.04819L19.5391 5.89451C19.3035 5.76631 19.0792 5.63964 18.865 5.5134L15.0521 9.80084C15.4553 11.0798 15.495 12.4878 15.0464 13.8871C14.727 14.8833 14.1631 15.8645 13.3206 16.7832C13.1407 16.9793 12.8358 16.9926 12.6396 16.8128C12.6328 16.8065 12.6262 16.8001 12.6198 16.7936C12.6184 16.7923 12.6171 16.7909 12.6158 16.7896L12.6157 16.7896L8.83994 13.0156L0.819221 19.8752C0.357424 20.2701 -0.27004 19.6423 0.124825 19.1811L6.98768 11.1642L3.21189 7.39021L3.21188 7.39019C3.21074 7.38905 3.2096 7.38791 3.20847 7.38676C3.19722 7.37583 3.18639 7.36425 3.17604 7.35202C3.00408 7.1489 3.02943 6.84489 3.23266 6.67301C3.87295 6.13148 4.53111 5.70968 5.19581 5.39767C6.91511 4.59063 8.64205 4.5275 10.1724 4.98295L14.5036 1.13488ZM15.0286 1.95762L11.1853 5.37229C12.6878 6.08669 13.9221 7.31677 14.6512 8.80124L16.2331 7.02243L14.6084 5.39847C14.4202 5.21031 14.4202 4.90525 14.6084 4.7171C14.7967 4.52895 15.1019 4.52895 15.2901 4.7171L16.8747 6.30098L18.0377 4.99329C17.4012 4.56407 16.861 4.12205 16.371 3.62414C15.8839 3.12926 15.4531 2.58595 15.0286 1.95762ZM4.26612 7.08121L7.97786 10.7912C7.97786 10.7912 7.97787 10.7912 7.97788 10.7912C8.15977 10.973 8.171 11.264 8.00385 11.4593L8.00384 11.4593L4.79816 15.204L8.54467 11.9999C8.54468 11.9999 8.54468 11.9999 8.54468 11.9999C8.74012 11.8328 9.03128 11.8441 9.21312 12.0258L12.9392 15.7502C13.5101 15.0445 13.8964 14.3165 14.1283 13.5931C15.6562 8.82761 10.5772 3.93621 5.60561 6.26987C5.15973 6.47917 4.71155 6.74739 4.26612 7.08121ZM0.193019 19.1425C0.19283 19.1427 0.192641 19.1428 0.192451 19.143L0.499031 19.5011L0.491164 19.4944L0.499031 19.5011L0.505838 19.5091L0.499032 19.5011L0.857328 19.8076C0.85747 19.8074 0.857613 19.8072 0.857755 19.8071L0.857333 19.8076L0.499031 19.5011L0.192456 19.143L0.193019 19.1425ZM0.499031 19.5011H0.499031L0.499031 19.5011H0.499032L0.499031 19.5011Z"/>
+      </svg>`,
+    unpinIcon =
+      (await db.get(['unpin_icon'])) ||
+      `<svg viewBox="0 0 20 20" fill="currentColor">
+        <path d="M14.5036 1.13488C14.3765 0.925602 14.2483 0.707495 14.1174 0.479601L14.9536 0C15.6901 1.28291 16.3103 2.18846 17.0583 2.94839C17.8041 3.70619 18.6966 4.33897 20 5.04819L19.5391 5.89451C19.3035 5.76631 19.0792 5.63965 18.865 5.5134L15.0521 9.80084C15.4553 11.0798 15.495 12.4878 15.0464 13.8871C14.727 14.8833 14.1631 15.8645 13.3206 16.7832C13.1407 16.9793 12.8358 16.9926 12.6396 16.8128C12.6328 16.8065 12.6262 16.8001 12.6198 16.7936L12.6158 16.7896L8.83994 13.0156L0.819221 19.8752C0.357424 20.2701 -0.27004 19.6423 0.124825 19.1811L6.98768 11.1642L3.21189 7.39021L3.20847 7.38676C3.19722 7.37583 3.18639 7.36425 3.17604 7.35203C3.00408 7.1489 3.02943 6.84489 3.23266 6.67301C3.87295 6.13148 4.53111 5.70968 5.19581 5.39767C6.91511 4.59063 8.64205 4.5275 10.1724 4.98295L14.5036 1.13488Z"/>
+      </svg>`;
+  pinIcon = pinIcon.trim();
+  unpinIcon = unpinIcon.trim();
+
+  pinIcon =
+    pinIcon.startsWith('<svg') && pinIcon.endsWith('</svg>') ? pinIcon : web.escape(pinIcon);
+  unpinIcon =
+    unpinIcon.startsWith('<svg') && unpinIcon.endsWith('</svg>')
+      ? unpinIcon
+      : web.escape(unpinIcon);
+
+  const $button = web.html`<div class="always_on_top--button"></div>`,
+    $pin = web.html`<button id="always_on_top--pin">${pinIcon}</button>`,
+    $unpin = web.html`<button id="always_on_top--unpin">${unpinIcon}</button>`;
+  components.addTooltip($pin, '**Pin window to top**');
+  components.addTooltip($unpin, '**Unpin window from top**');
+  web.render($button, $pin);
+
+  $pin.addEventListener('click', () => {
+    $pin.replaceWith($unpin);
+    electron.browser.setAlwaysOnTop(true);
+  });
+  $unpin.addEventListener('click', () => {
+    $unpin.replaceWith($pin);
+    electron.browser.setAlwaysOnTop(false);
+  });
+
+  return $button;
+};
diff --git a/src/mods/always-on-top/client.mjs b/src/mods/always-on-top/client.mjs
new file mode 100644
index 0000000..7262f15
--- /dev/null
+++ b/src/mods/always-on-top/client.mjs
@@ -0,0 +1,17 @@
+/**
+ * notion-enhancer: always on top
+ * (c) 2021 dragonwocky <thedragonring.bod@gmail.com> (https://dragonwocky.me/)
+ * (https://notion-enhancer.github.io/) under the MIT license
+ */
+
+import { createButton } from './button.mjs';
+
+export default async function (api, db) {
+  const { web } = api,
+    topbarActionsSelector = '.notion-topbar-action-buttons';
+
+  await web.whenReady([topbarActionsSelector]);
+  const $topbarActions = document.querySelector(topbarActionsSelector),
+    $button = await createButton(api, db);
+  $topbarActions.after($button);
+}
diff --git a/src/mods/always-on-top/menu.mjs b/src/mods/always-on-top/menu.mjs
new file mode 100644
index 0000000..1250d12
--- /dev/null
+++ b/src/mods/always-on-top/menu.mjs
@@ -0,0 +1,20 @@
+/**
+ * notion-enhancer: always on top
+ * (c) 2021 dragonwocky <thedragonring.bod@gmail.com> (https://dragonwocky.me/)
+ * (https://notion-enhancer.github.io/) under the MIT license
+ */
+
+import { createButton } from './button.mjs';
+
+export default async function (api, db) {
+  const { web } = api,
+    sidebarSelector = '.sidebar',
+    windowButtonsSelector = '.integrated_titlebar--buttons';
+
+  await web.whenReady([sidebarSelector]);
+  await new Promise(requestAnimationFrame);
+  const $sidebar = document.querySelector(sidebarSelector),
+    $windowButtons = document.querySelector(windowButtonsSelector),
+    $button = await createButton(api, db);
+  ($windowButtons || $sidebar).prepend($button);
+}
diff --git a/src/mods/always-on-top/mod.json b/src/mods/always-on-top/mod.json
new file mode 100644
index 0000000..efaee88
--- /dev/null
+++ b/src/mods/always-on-top/mod.json
@@ -0,0 +1,41 @@
+{
+  "name": "always on top",
+  "id": "be2d75f5-48f5-4ece-98bd-772244e559f3",
+  "environments": ["linux", "win32", "darwin"],
+  "version": "0.2.0",
+  "description": "adds a button that can be used to pin the notion window on top of all other windows at all times.",
+  "preview": "always-on-top.jpg",
+  "tags": ["extension", "app"],
+  "authors": [
+    {
+      "name": "dragonwocky",
+      "email": "thedragonring.bod@gmail.com",
+      "homepage": "https://dragonwocky.me/",
+      "avatar": "https://dragonwocky.me/avatar.jpg"
+    }
+  ],
+  "css": {
+    "client": ["button.css"],
+    "menu": ["button.css"]
+  },
+  "js": {
+    "client": ["client.mjs"],
+    "menu": ["menu.mjs"]
+  },
+  "options": [
+    {
+      "type": "text",
+      "key": "pin_icon",
+      "label": "pin window icon",
+      "tooltip": "**may be an svg string or any unicode symbol e.g. an emoji** (the default icon will be used if this field is left empty)",
+      "value": ""
+    },
+    {
+      "type": "text",
+      "key": "unpin_icon",
+      "label": "unpin window icon",
+      "tooltip": "**may be an svg string or any unicode symbol e.g. an emoji** (the default icon will be used if this field is left empty)",
+      "value": ""
+    }
+  ]
+}
diff --git a/src/mods/bypass-preview/client.css b/src/mods/bypass-preview/client.css
new file mode 100644
index 0000000..cae2982
--- /dev/null
+++ b/src/mods/bypass-preview/client.css
@@ -0,0 +1,9 @@
+/**
+ * notion-enhancer: bypass preview
+ * (c) 2021 dragonwocky <thedragonring.bod@gmail.com> (https://dragonwocky.me/)
+ * (https://notion-enhancer.github.io/) under the MIT license
+ */
+
+.notion-peek-renderer {
+  display: none;
+}
diff --git a/src/mods/bypass-preview/client.mjs b/src/mods/bypass-preview/client.mjs
new file mode 100644
index 0000000..af5e597
--- /dev/null
+++ b/src/mods/bypass-preview/client.mjs
@@ -0,0 +1,37 @@
+/**
+ * notion-enhancer: bypass preview
+ * (c) 2021 dragonwocky <thedragonring.bod@gmail.com> (https://dragonwocky.me/)
+ * (https://notion-enhancer.github.io/) under the MIT license
+ */
+
+"use strict";
+
+export default function ({ web, notion }, db) {
+  let _openPage = {};
+
+  const getCurrentPage = () => ({
+    type: web.queryParams().get("p") ? "preview" : "page",
+    id: notion.getPageID(),
+  });
+
+  const interceptPreview = () => {
+    const currentPage = getCurrentPage();
+    if (
+      currentPage.id !== _openPage.id ||
+      currentPage.type !== _openPage.type
+    ) {
+      const $openAsPage = document.querySelector(
+        ".notion-peek-renderer a > div"
+      );
+
+      if ($openAsPage) {
+        if (currentPage.id === _openPage.id && currentPage.type === "preview") {
+          history.back();
+        } else $openAsPage.click();
+      }
+
+      _openPage = getCurrentPage();
+    }
+  };
+  web.addDocumentObserver(interceptPreview, [".notion-peek-renderer"]);
+}
diff --git a/src/mods/bypass-preview/mod.json b/src/mods/bypass-preview/mod.json
new file mode 100644
index 0000000..bda76dc
--- /dev/null
+++ b/src/mods/bypass-preview/mod.json
@@ -0,0 +1,22 @@
+{
+  "name": "bypass preview",
+  "id": "cb6fd684-f113-4a7a-9423-8f0f0cff069f",
+  "version": "0.2.0",
+  "description": "go straight to the normal full view when opening a page.",
+  "tags": ["extension", "automation"],
+  "authors": [
+    {
+      "name": "dragonwocky",
+      "email": "thedragonring.bod@gmail.com",
+      "homepage": "https://dragonwocky.me/",
+      "avatar": "https://dragonwocky.me/avatar.jpg"
+    }
+  ],
+  "js": {
+    "client": ["client.mjs"]
+  },
+  "css": {
+    "client": ["client.css"]
+  },
+  "options": []
+}
diff --git a/src/mods/calendar-scroll/calendar-scroll.png b/src/mods/calendar-scroll/calendar-scroll.png
new file mode 100644
index 0000000..42ab520
Binary files /dev/null and b/src/mods/calendar-scroll/calendar-scroll.png differ
diff --git a/src/mods/calendar-scroll/client.css b/src/mods/calendar-scroll/client.css
new file mode 100644
index 0000000..2cbdb62
--- /dev/null
+++ b/src/mods/calendar-scroll/client.css
@@ -0,0 +1,25 @@
+/**
+ * notion-enhancer: calendar scroll
+ * (c) 2021 dragonwocky <thedragonring.bod@gmail.com> (https://dragonwocky.me/)
+ * (https://notion-enhancer.github.io/) under the MIT license
+ */
+
+#enhancer--calendar-scroll {
+  background: var(--theme--ui_interactive-hover);
+  border: 1px solid transparent;
+  font-size: 14px;
+  color: var(--theme--text);
+  height: 24px;
+  border-radius: 3px;
+  line-height: 1.2;
+  padding: 0 0.5em;
+  margin-right: 5px;
+}
+#enhancer--calendar-scroll:focus,
+#enhancer--calendar-scroll:hover {
+  background: transparent;
+  border: 1px solid var(--theme--ui_interactive-hover);
+}
+#enhancer--calendar-scroll:active {
+  background: var(--theme--ui_interactive-active);
+}
diff --git a/src/mods/calendar-scroll/client.mjs b/src/mods/calendar-scroll/client.mjs
new file mode 100644
index 0000000..a13851e
--- /dev/null
+++ b/src/mods/calendar-scroll/client.mjs
@@ -0,0 +1,41 @@
+/**
+ * notion-enhancer: calendar scroll
+ * (c) 2021 dragonwocky <thedragonring.bod@gmail.com> (https://dragonwocky.me/)
+ * (https://notion-enhancer.github.io/) under the MIT license
+ */
+
+'use strict';
+
+const pageSelector = '.notion-page-content',
+  calendarSelector = '.notion-calendar-view:not([data-calendar-scroll])',
+  scrollerSelector = '.notion-frame > .notion-scroller',
+  toolbarSelector = '.notion-calendar-view > :first-child > :first-child > :first-child',
+  todaySelector = '.notion-calendar-view-day[style*="background:"]';
+
+export default function ({ web }, db) {
+  const insertButton = () => {
+    document.querySelectorAll(calendarSelector).forEach(($calendar) => {
+      $calendar.dataset.calendarScroll = true;
+      const $page = document.querySelector(pageSelector);
+      if ($page) return;
+      const $toolbar = $calendar.querySelector(toolbarSelector),
+        $pageScroller = document.querySelector(scrollerSelector),
+        $scrollButton = web.html`<button id="enhancer--calendar-scroll">Scroll</button>`;
+      $scrollButton.addEventListener('click', async (event) => {
+        let $today = $calendar.querySelector(todaySelector);
+        if (!$today) {
+          $toolbar.children[4].click();
+          await new Promise((res, rej) => setTimeout(res, 500));
+          $today = $calendar.querySelector(todaySelector);
+        }
+        $pageScroller.scroll({
+          top: $today.offsetParent.offsetParent.offsetTop + 70,
+          behavior: 'auto',
+        });
+      });
+      $toolbar.insertBefore($scrollButton, $toolbar.children[2]);
+    });
+  };
+  web.addDocumentObserver(insertButton, [calendarSelector]);
+  insertButton();
+}
diff --git a/src/mods/calendar-scroll/mod.json b/src/mods/calendar-scroll/mod.json
new file mode 100644
index 0000000..5dbd371
--- /dev/null
+++ b/src/mods/calendar-scroll/mod.json
@@ -0,0 +1,23 @@
+{
+  "name": "calendar scroll",
+  "id": "b1c7db33-dfee-489a-a76c-0dd66f7ed29a",
+  "version": "0.2.0",
+  "description": "adds a button to jump down to the current week in fullpage/infinite-scroll calendars.",
+  "preview": "calendar-scroll.png",
+  "tags": ["extension", "shortcut"],
+  "authors": [
+    {
+      "name": "dragonwocky",
+      "email": "thedragonring.bod@gmail.com",
+      "homepage": "https://dragonwocky.me/",
+      "avatar": "https://dragonwocky.me/avatar.jpg"
+    }
+  ],
+  "js": {
+    "client": ["client.mjs"]
+  },
+  "css": {
+    "client": ["client.css"]
+  },
+  "options": []
+}
diff --git a/src/mods/cherry-cola/cherry-cola.png b/src/mods/cherry-cola/cherry-cola.png
new file mode 100644
index 0000000..86a445e
Binary files /dev/null and b/src/mods/cherry-cola/cherry-cola.png differ
diff --git a/src/mods/cherry-cola/mod.json b/src/mods/cherry-cola/mod.json
new file mode 100644
index 0000000..e81c336
--- /dev/null
+++ b/src/mods/cherry-cola/mod.json
@@ -0,0 +1,23 @@
+{
+  "name": "cherry cola",
+  "id": "ec5c4640-68d4-4d25-aefd-62c7e9737cfb",
+  "version": "0.2.0",
+  "description": "a delightfully plummy, cherry cola flavored theme.",
+  "preview": "cherry-cola.png",
+  "tags": ["theme", "dark"],
+  "authors": [
+    {
+      "name": "runargs",
+      "email": "alnbaldon@gmail.com",
+      "homepage": "http://github.com/runargs",
+      "avatar": "https://avatars.githubusercontent.com/u/39810066"
+    }
+  ],
+  "css": {
+    "frame": ["variables.css"],
+    "client": ["variables.css"],
+    "menu": ["variables.css"]
+  },
+  "js": {},
+  "options": []
+}
diff --git a/src/mods/cherry-cola/variables.css b/src/mods/cherry-cola/variables.css
new file mode 100644
index 0000000..e2cc5f9
--- /dev/null
+++ b/src/mods/cherry-cola/variables.css
@@ -0,0 +1,172 @@
+/**
+ * notion-enhancer: cherry cola
+ * (c) 2020 Alexa Baldon <alnbaldon@gmail.com> (https://github.com/runargs)
+ * (https://notion-enhancer.github.io/) under the MIT license
+ */
+
+:root.dark {
+  --cola--main: #180915;
+  --cola--sec: #1d0919;
+  --cola--tet: #492341;
+  --cola--info: #9b6890;
+  --cola--accent: #bf799b;
+  --cola--light_gray: #ADADAD;
+  --cola--gray: #8a8a8a;
+  --cola--brown: #755241;
+  --cola--orange: #e6846b;
+  --cola--yellow: #d7b56e;
+  --cola--green: #8f9b4f;
+  --cola--blue: #6ebdb7;
+  --cola--purple: #813d63;
+  --cola--pink: #d86f71;
+  --cola--red: #a33232;
+
+  --theme--accent_blue: var(--cola--accent);
+  --theme--accent_blue-selection: rgba(78, 32, 69, 0.5);
+  --theme--accent_blue-hover: #bd6992;
+  --theme--accent_blue-active: #cc86a8;
+  --theme--accent_blue-text: #fff;
+  --theme--accent_red: var(--cola--accent);
+  --theme--accent_red-button: #bf799b63;
+  --theme--accent_red-text: #fff;
+
+  --theme--bg: var(--cola--main);
+  --theme--bg_secondary: var(--cola--sec);
+  --theme--bg_card: var(--cola--sec);
+
+  --theme--scrollbar_track: transparent;
+  --theme--scrollbar_thumb: var(--cola--sec);
+  --theme--scrollbar_thumb-hover: var(--cola--accent);
+
+  --theme--ui_divider: rgba(73, 35, 65, 0.7);
+  --theme--ui_interactive-hover: var(--cola--tet);
+  --theme--ui_interactive-active: var(--cola--tet);
+  --theme--ui_toggle-off: rgba(73, 35, 65, 0.7);
+  --theme--ui_corner_action: var(--theme--bg_card);
+  --theme--ui_corner_action-hover: var(--theme--ui_interactive-hover);
+  --theme--ui_corner_action-active: var(--theme--ui_interactive-active);
+
+  --theme--icon: #fff;
+  --theme--icon_secondary: var(--cola--info);
+
+  --theme--text: #fff;
+  --theme--text_secondary: var(--cola--info);
+  --theme--text_gray: var(--cola--gray);
+  --theme--text_brown: var(--cola--brown);
+  --theme--text_orange: var(--cola--orange);
+  --theme--text_yellow: var(--cola--yellow);
+  --theme--text_green: var(--cola--green);
+  --theme--text_blue: var(--cola--blue);
+  --theme--text_purple: var(--cola--purple);
+  --theme--text_pink: var(--cola--pink);
+  --theme--text_red: var(--cola--red);
+
+  --theme--highlight_gray: var(--theme--tag_gray);
+  --theme--highlight_gray-text: var(--theme--tag-text);
+  --theme--highlight_brown: var(--theme--tag_brown);
+  --theme--highlight_brown-text: var(--theme--tag-text);
+  --theme--highlight_orange: var(--theme--tag_orange);
+  --theme--highlight_orange-text: var(--theme--tag-text);
+  --theme--highlight_yellow: var(--theme--tag_yellow);
+  --theme--highlight_yellow-text: var(--theme--tag-text);
+  --theme--highlight_green: var(--theme--tag_green);
+  --theme--highlight_green-text: var(--theme--tag-text);
+  --theme--highlight_blue: var(--theme--tag_blue);
+  --theme--highlight_blue-text: var(--theme--tag-text);
+  --theme--highlight_purple: var(--theme--tag_purple);
+  --theme--highlight_purple-text: var(--theme--tag-text);
+  --theme--highlight_pink: var(--theme--tag_pink);
+  --theme--highlight_pink-text: var(--theme--tag-text);
+  --theme--highlight_red: var(--theme--tag_red);
+  --theme--highlight_red-text: var(--theme--tag-text);
+
+  --theme--callout_gray: var(--theme--tag_gray);
+  --theme--callout_gray-text: var(--theme--tag-text);
+  --theme--callout_brown: var(--theme--tag_brown);
+  --theme--callout_brown-text: var(--theme--tag-text);
+  --theme--callout_orange: var(--theme--tag_orange);
+  --theme--callout_orange-text: var(--theme--tag-text);
+  --theme--callout_yellow: var(--theme--tag_yellow);
+  --theme--callout_yellow-text: var(--theme--tag-text);
+  --theme--callout_green: var(--theme--tag_green);
+  --theme--callout_green-text: var(--theme--tag-text);
+  --theme--callout_blue: var(--theme--tag_blue);
+  --theme--callout_blue-text: var(--theme--tag-text);
+  --theme--callout_purple: var(--theme--tag_purple);
+  --theme--callout_purple-text: var(--theme--tag-text);
+  --theme--callout_pink: var(--theme--tag_pink);
+  --theme--callout_pink-text: var(--theme--tag-text);
+  --theme--callout_red: var(--theme--tag_red);
+  --theme--callout_red-text: var(--theme--tag-text);
+
+  --theme--tag_light_gray: var(--cola--light_gray);
+  --theme--tag_light_gray-text: var(--cola--main);
+  --theme--tag_gray: var(--cola--gray);
+  --theme--tag_gray-text: var(--cola--main);
+  --theme--tag_brown: var(--cola--brown);
+  --theme--tag_brown-text: #ffffff;
+  --theme--tag_orange: var(--cola--orange);
+  --theme--tag_orange-text: var(--cola--main);
+  --theme--tag_yellow: var(--cola--yellow);
+  --theme--tag_yellow-text: var(--cola--main);
+  --theme--tag_green: var(--cola--green);
+  --theme--tag_green-text: var(--cola--main);
+  --theme--tag_blue: var(--cola--blue);
+  --theme--tag_blue-text: var(--cola--main);
+  --theme--tag_purple: var(--cola--purple);
+  --theme--tag_purple-text: #ffffff;
+  --theme--tag_pink: var(--cola--pink);
+  --theme--tag_pink-text: var(--cola--main);
+  --theme--tag_red: var(--cola--red);
+  --theme--tag_red-text: #ffffff;
+
+  --theme--board_light_gray: var(--cola--light_gray);
+  --theme--board_light_gray-text: var(--cola--main);
+  --theme--board_light_gray-card: var(--theme--tag_light_gray);
+  --theme--board_gray: var(--cola--gray);
+  --theme--board_gray-text: var(--cola--main);
+  --theme--board_gray-card: var(--theme--tag_gray);
+  --theme--board_brown: var(--cola--brown);
+  --theme--board_brown-text: var(--cola--main);
+  --theme--board_brown-card: var(--theme--tag_brown);
+  --theme--board_orange: var(--cola--orange);
+  --theme--board_orange-text: var(--cola--main);
+  --theme--board_orange-card: var(--theme--tag_orange);
+  --theme--board_yellow: var(--cola--yellow);
+  --theme--board_yellow-text: var(--cola--main);
+  --theme--board_yellow-card: var(--theme--tag_yellow);
+  --theme--board_green: var(--cola--green);
+  --theme--board_green-text: var(--cola--main);
+  --theme--board_green-card: var(--theme--tag_green);
+  --theme--board_blue: var(--cola--blue);
+  --theme--board_blue-text: var(--cola--main);
+  --theme--board_blue-card: var(--theme--tag_blue);
+  --theme--board_purple: var(--cola--purple);
+  --theme--board_purple-text: var(--cola--main);
+  --theme--board_purple-card: var(--theme--tag_purple);
+  --theme--board_pink: var(--cola--pink);
+  --theme--board_pink-text: var(--cola--main);
+  --theme--board_pink-card: var(--theme--tag_pink);
+  --theme--board_red: var(--cola--red);
+  --theme--board_red-text: var(--cola--main);
+  --theme--board_red-card: var(--theme--tag_red);
+
+  --theme--code_inline: var(--cola--main);
+  --theme--code_inline-text: var(--cola--accent);
+
+  --theme--code: var(--cola--sec);
+  --theme--code_function: var(--theme--text_blue);
+  --theme--code_keyword: var(--theme--text_pink);
+  --theme--code_tag: var(--theme--text_pink);
+  --theme--code_operator: var(--theme--text_yellow);
+  --theme--code_property: var(--theme--text_pink);
+  --theme--code_builtin: var(--theme--text_yellow);
+  --theme--code_attr-name: var(--theme--text_yellow);
+  --theme--code_comment: var(--theme--text_gray);
+  --theme--code_punctuation: var(--theme--text_gray);
+  --theme--code_doctype: var(--theme--text_gray);
+  --theme--code_number: var(--theme--text_purple);
+  --theme--code_selector: var(--theme--text_orange);
+  --theme--code_atrule: var(--theme--text_orange);
+  --theme--code_regex: var(--theme--text_yellow);
+}
diff --git a/src/mods/code-line-numbers/client.css b/src/mods/code-line-numbers/client.css
new file mode 100644
index 0000000..5f3a4df
--- /dev/null
+++ b/src/mods/code-line-numbers/client.css
@@ -0,0 +1,63 @@
+/**
+ * notion-enhancer: code line numbers
+ * (c) 2020 CloudHill <rl.cloudhill@gmail.com> (https://github.com/CloudHill)
+ * (c) 2021 dragonwocky <thedragonring.bod@gmail.com> (https://dragonwocky.me/)
+ * (https://notion-enhancer.github.io/) under the MIT license
+ */
+
+.notion-code-block.line-numbers {
+  position: relative;
+}
+.code_line_numbers--plain:not(:empty) + div,
+.code_line_numbers--background:not(:empty) + div,
+.code_line_numbers--border:not(:empty) + div {
+  padding-left: 64px !important;
+}
+
+.code_line_numbers--plain,
+.code_line_numbers--background,
+.code_line_numbers--border {
+  position: absolute;
+  left: 0;
+  right: calc(100% - 64px);
+  top: 34px;
+  bottom: 32px;
+  padding-right: 27px;
+
+  font-size: 85%;
+  font-family: var(--theme--font_code);
+  text-align: right;
+  line-height: 1.5;
+  opacity: 0.8;
+  color: var(--theme--text_secondary);
+
+  overflow: hidden;
+  pointer-events: none;
+}
+.code_line_numbers--plain:empty,
+.code_line_numbers--background:empty,
+.code_line_numbers--border:empty {
+  display: none;
+}
+.code_line_numbers--background::before {
+  content: '';
+  position: absolute;
+  top: 0;
+  left: 7.25px;
+  width: calc(100% - 27px);
+  height: 100%;
+  display: block;
+  background-color: var(--theme--bg);
+  border-radius: 4px;
+  z-index: -1;
+}
+.code_line_numbers--border::before {
+  content: '';
+  position: absolute;
+  top: 0;
+  right: calc(100% - 52px);
+  width: 2px;
+  height: 100%;
+  display: block;
+  background-color: var(--theme--ui_divider);
+}
diff --git a/src/mods/code-line-numbers/client.mjs b/src/mods/code-line-numbers/client.mjs
new file mode 100644
index 0000000..5072b39
--- /dev/null
+++ b/src/mods/code-line-numbers/client.mjs
@@ -0,0 +1,62 @@
+/**
+ * notion-enhancer: code line numbers
+ * (c) 2020 CloudHill <rl.cloudhill@gmail.com> (https://github.com/CloudHill)
+ * (c) 2021 dragonwocky <thedragonring.bod@gmail.com> (https://dragonwocky.me/)
+ * (https://notion-enhancer.github.io/) under the MIT license
+ */
+
+export default async function ({ web }, db) {
+  const singleLined = await db.get(['single_lined']),
+    codeBlockSelector = '.notion-code-block.line-numbers',
+    numbersClass = `code_line_numbers--${await db.get(['style'])}`,
+    $temp = web.html`<span></span>`;
+
+  const numberCodeBlock = ($codeBlock) => {
+      const $numbers =
+        $codeBlock.querySelector(`.${numbersClass}`) ||
+        web.html`<span class="${numbersClass}">1</span>`;
+      if (!$codeBlock.contains($numbers)) $codeBlock.prepend($numbers);
+
+      const lines = $codeBlock.lastElementChild.innerText.split(/\r\n|\r|\n/),
+        wordWrap = $codeBlock.lastElementChild.style.wordBreak === 'break-all';
+      if (lines.reverse()[0] === '') lines.pop();
+
+      let lineNumbers = '';
+      for (let i = 1; i <= lines.length + 1; i++) {
+        lineNumbers += `${i}\n`;
+        if (wordWrap && lines[i - 1]) {
+          $temp.innerText = lines[i - 1];
+          web.render($codeBlock.lastElementChild, $temp);
+          const height = parseFloat($temp.getBoundingClientRect().height);
+          $temp.remove();
+          for (let j = 1; j < height / 20.4; j++) lineNumbers += '\n';
+        }
+      }
+
+      if (!singleLined && lines.length < 2) lineNumbers = '';
+      if ($numbers.innerText !== lineNumbers) $numbers.innerText = lineNumbers;
+    },
+    numberAllCodeBlocks = () => {
+      for (const $codeBlock of document.querySelectorAll(codeBlockSelector)) {
+        numberCodeBlock($codeBlock);
+      }
+    },
+    observeCodeBlocks = (event) => {
+      const tempEvent = [...event.addedNodes, ...event.removedNodes].includes($temp),
+        numbersEvent =
+          event.target.classList.contains(numbersClass) ||
+          [...event.addedNodes, ...event.removedNodes].some(($node) =>
+            $node?.classList?.contains(numbersClass)
+          ),
+        codeEvent = event.target.matches(`${codeBlockSelector}, ${codeBlockSelector} *`);
+      if (tempEvent || numbersEvent || !codeEvent) return;
+
+      let $codeBlock = event.target;
+      while (!$codeBlock.matches(codeBlockSelector)) $codeBlock = $codeBlock.parentElement;
+      numberCodeBlock($codeBlock);
+    };
+
+  await web.whenReady();
+  numberAllCodeBlocks();
+  web.addDocumentObserver(observeCodeBlocks, [codeBlockSelector]);
+}
diff --git a/src/mods/code-line-numbers/code-line-numbers.png b/src/mods/code-line-numbers/code-line-numbers.png
new file mode 100644
index 0000000..c1b6b08
Binary files /dev/null and b/src/mods/code-line-numbers/code-line-numbers.png differ
diff --git a/src/mods/code-line-numbers/mod.json b/src/mods/code-line-numbers/mod.json
new file mode 100644
index 0000000..4e9c0d4
--- /dev/null
+++ b/src/mods/code-line-numbers/mod.json
@@ -0,0 +1,36 @@
+{
+  "name": "code line numbers",
+  "id": "d61dc8a7-b195-465b-935f-53eea9efe74e",
+  "version": "0.4.0",
+  "description": "adds line numbers to code blocks.",
+  "preview": "code-line-numbers.png",
+  "tags": ["extension", "usability"],
+  "authors": [
+    {
+      "name": "CloudHill",
+      "email": "rh.cloudhill@gmail.com",
+      "homepage": "https://github.com/CloudHill",
+      "avatar": "https://avatars.githubusercontent.com/u/54142180"
+    }
+  ],
+  "js": {
+    "client": ["client.mjs"]
+  },
+  "css": {
+    "client": ["client.css"]
+  },
+  "options": [
+    {
+      "type": "toggle",
+      "key": "single_lined",
+      "label": "number single-lined code blocks",
+      "value": false
+    },
+    {
+      "type": "select",
+      "key": "style",
+      "label": "line number style",
+      "values": ["plain", "background", "border"]
+    }
+  ]
+}
diff --git a/src/mods/collapsible-properties/client.css b/src/mods/collapsible-properties/client.css
new file mode 100644
index 0000000..84eba06
--- /dev/null
+++ b/src/mods/collapsible-properties/client.css
@@ -0,0 +1,56 @@
+/**
+ * notion-enhancer: collapse properties
+ * (c) 2021 dragonwocky <thedragonring.bod@gmail.com> (https://dragonwocky.me/)
+ * (https://notion-enhancer.github.io/) under the MIT license
+ */
+
+#enhancer--collapse-properties {
+  display: flex;
+  background: var(--theme--ui_interactive-hover);
+  border: 1px solid transparent;
+  font-size: 14px;
+  border-radius: 3px;
+  line-height: 1.2;
+  font-weight: 600;
+  padding: 0.3em 0.5em;
+  margin: 1em 0;
+  width: 100%;
+}
+#enhancer--collapse-properties:focus,
+#enhancer--collapse-properties:hover {
+  background: transparent;
+  border: 1px solid var(--theme--ui_interactive-hover);
+}
+#enhancer--collapse-properties:active {
+  background: var(--theme--ui_interactive-active);
+}
+
+#enhancer--collapse-properties > span {
+  text-align: left;
+  color: var(--theme--text);
+}
+#enhancer--collapse-properties > span:before {
+  content: 'Properties';
+}
+#enhancer--collapse-properties > svg {
+  fill: var(--theme--icon);
+  height: 0.8em;
+  width: 0.8em;
+  margin: auto 0.5em auto 0;
+  transition: transform 200ms ease-out 0s;
+}
+
+#enhancer--collapse-properties[data-collapsed='false'] > svg {
+  transform: rotateZ(180deg);
+}
+#enhancer--collapse-properties[data-collapsed='true'] > svg {
+  transform: rotateZ(90deg);
+}
+
+#enhancer--collapse-properties + div {
+  overflow: hidden;
+}
+#enhancer--collapse-properties[data-collapsed='true'] + div {
+  max-height: 0 !important;
+  opacity: 0;
+}
diff --git a/src/mods/collapsible-properties/client.mjs b/src/mods/collapsible-properties/client.mjs
new file mode 100644
index 0000000..28f88e8
--- /dev/null
+++ b/src/mods/collapsible-properties/client.mjs
@@ -0,0 +1,35 @@
+/**
+ * notion-enhancer: collapse properties
+ * (c) 2021 dragonwocky <thedragonring.bod@gmail.com> (https://dragonwocky.me/)
+ * (https://notion-enhancer.github.io/) under the MIT license
+ */
+
+'use strict';
+
+export default function ({ web, notion }, db) {
+  const propertyListSelector =
+      '.notion-scroller.vertical [style*="env(safe-area-inset-left)"] > [style="width: 100%; font-size: 14px;"]',
+    $collapseButton = web.html`<button id="enhancer--collapse-properties">
+      <svg viewBox="0 0 100 100"><polygon points="5.9,88.2 50,11.8 94.1,88.2"></polygon></svg>
+      <span></span>
+    </button>`;
+  $collapseButton.addEventListener('click', async (event) => {
+    if ($collapseButton.dataset.collapsed === 'true') {
+      await db.set([notion.getPageID()], false);
+      $collapseButton.dataset.collapsed = false;
+    } else {
+      await db.set([notion.getPageID()], true);
+      $collapseButton.dataset.collapsed = true;
+    }
+  });
+  const insertButton = async () => {
+    if (document.contains($collapseButton)) return;
+    const $propertyList = document.querySelector(propertyListSelector);
+    if ($propertyList) {
+      $collapseButton.dataset.collapsed = await db.get([notion.getPageID()], true);
+      $propertyList.before($collapseButton);
+    }
+  };
+  web.addDocumentObserver(insertButton, [propertyListSelector]);
+  insertButton();
+}
diff --git a/src/mods/collapsible-properties/collapsible-properties.jpg b/src/mods/collapsible-properties/collapsible-properties.jpg
new file mode 100644
index 0000000..1489e8f
Binary files /dev/null and b/src/mods/collapsible-properties/collapsible-properties.jpg differ
diff --git a/src/mods/collapsible-properties/mod.json b/src/mods/collapsible-properties/mod.json
new file mode 100644
index 0000000..7ef89df
--- /dev/null
+++ b/src/mods/collapsible-properties/mod.json
@@ -0,0 +1,23 @@
+{
+  "name": "collapsible properties",
+  "id": "4034a578-7dd3-4633-80c6-f47ac5b7b160",
+  "version": "0.3.0",
+  "description": "adds a button to quickly collapse/expand page properties that usually push down page content.",
+  "preview": "collapsible-properties.jpg",
+  "tags": ["extension", "layout"],
+  "authors": [
+    {
+      "name": "dragonwocky",
+      "email": "thedragonring.bod@gmail.com",
+      "homepage": "https://dragonwocky.me/",
+      "avatar": "https://dragonwocky.me/avatar.jpg"
+    }
+  ],
+  "css": {
+    "client": ["client.css"]
+  },
+  "js": {
+    "client": ["client.mjs"]
+  },
+  "options": []
+}
diff --git a/src/mods/components/mod.json b/src/mods/components/mod.json
new file mode 100644
index 0000000..ceb59ed
--- /dev/null
+++ b/src/mods/components/mod.json
@@ -0,0 +1,33 @@
+{
+  "__comment": "pseudo-mod to allow configuration of api-provided components",
+  "name": "components",
+  "id": "36a2ffc9-27ff-480e-84a7-c7700a7d232d",
+  "version": "0.2.0",
+  "description": "shared notion-style elements.",
+  "tags": ["core"],
+  "authors": [
+    {
+      "name": "dragonwocky",
+      "email": "thedragonring.bod@gmail.com",
+      "homepage": "https://dragonwocky.me/",
+      "avatar": "https://dragonwocky.me/avatar.jpg"
+    },
+    {
+      "name": "CloudHill",
+      "email": "rh.cloudhill@gmail.com",
+      "homepage": "https://github.com/CloudHill",
+      "avatar": "https://avatars.githubusercontent.com/u/54142180"
+    }
+  ],
+  "js": {},
+  "css": {},
+  "options": [
+    {
+      "type": "hotkey",
+      "key": "panel.hotkey",
+      "label": "toggle panel hotkey",
+      "value": "Ctrl+Alt+\\",
+      "tooltip": "**opens/closes the side panel in notion** if a mod that uses it has been enabled"
+    }
+  ]
+}
diff --git a/src/mods/dark+/dark+.png b/src/mods/dark+/dark+.png
new file mode 100644
index 0000000..b00aaec
Binary files /dev/null and b/src/mods/dark+/dark+.png differ
diff --git a/src/mods/dark+/mod.json b/src/mods/dark+/mod.json
new file mode 100644
index 0000000..1bef8f6
--- /dev/null
+++ b/src/mods/dark+/mod.json
@@ -0,0 +1,42 @@
+{
+  "name": "dark+",
+  "id": "c86cfe98-e645-4822-aa6b-e2de1e08bafa",
+  "version": "0.2.0",
+  "description": "a vivid-colour near-black theme, with configurable accents.",
+  "preview": "dark+.png",
+  "tags": ["theme", "dark"],
+  "authors": [
+    {
+      "name": "dragonwocky",
+      "email": "thedragonring.bod@gmail.com",
+      "homepage": "https://dragonwocky.me/",
+      "avatar": "https://dragonwocky.me/avatar.jpg"
+    }
+  ],
+  "css": {
+    "frame": ["variables.css"],
+    "client": ["variables.css"],
+    "menu": ["variables.css"]
+  },
+  "js": {
+    "frame": ["theme.mjs"],
+    "client": ["theme.mjs"],
+    "menu": ["theme.mjs"]
+  },
+  "options": [
+    {
+      "type": "color",
+      "key": "primary",
+      "label": "primary accent color",
+      "tooltip": "**replaces notion's blue accent**",
+      "value": "rgba(46,170,220,1)"
+    },
+    {
+      "type": "color",
+      "key": "secondary",
+      "label": "secondary accent color",
+      "tooltip": "**replaces notion's red accent**",
+      "value": "rgba(235,87,87,1)"
+    }
+  ]
+}
diff --git a/src/mods/dark+/theme.mjs b/src/mods/dark+/theme.mjs
new file mode 100644
index 0000000..ea464fb
--- /dev/null
+++ b/src/mods/dark+/theme.mjs
@@ -0,0 +1,55 @@
+/**
+ * notion-enhancer: dark+
+ * (c) 2021 dragonwocky <thedragonring.bod@gmail.com> (https://dragonwocky.me/)
+ * (https://notion-enhancer.github.io/) under the MIT license
+ */
+
+'use strict';
+
+export default async function ({ fmt }, db) {
+  {
+    const primary = await db.get(['primary']),
+      [r, g, b] = primary
+        .slice(5, -1)
+        .split(',')
+        .map((i) => parseInt(i));
+    if (!(r === 46 && g === 170 && b === 220)) {
+      document.documentElement.style.setProperty('--dark_plus--accent_blue', primary);
+      document.documentElement.style.setProperty(
+        '--dark_plus--accent_blue-selection',
+        `rgba(${r},${g},${b},0.2)`
+      );
+      document.documentElement.style.setProperty(
+        '--dark_plus--accent_blue-hover',
+        fmt.rgbLogShade(0.05, primary)
+      );
+      document.documentElement.style.setProperty(
+        '--dark_plus--accent_blue-active',
+        fmt.rgbLogShade(0.025, primary)
+      );
+      document.documentElement.style.setProperty(
+        '--dark_plus--accent_blue-text',
+        fmt.rgbContrast(r, g, b)
+      );
+    }
+  }
+
+  {
+    const secondary = await db.get(['secondary']),
+      [r, g, b] = secondary
+        .slice(5, -1)
+        .split(',')
+        .map((i) => parseInt(i));
+    if (!(r === 235 && g === 87 && b === 87)) {
+      document.documentElement.style.setProperty('--dark_plus--accent_red', secondary);
+      document.documentElement.style.setProperty(
+        '--dark_plus--accent_red-button',
+        `rgba(${r},${g},${b},0.2)`
+      );
+      document.documentElement.style.setProperty(
+        '--dark_plus--accent_red-text',
+        fmt.rgbContrast(r, g, b)
+      );
+    }
+  }
+}
diff --git a/src/mods/dark+/variables.css b/src/mods/dark+/variables.css
new file mode 100644
index 0000000..4f757d7
--- /dev/null
+++ b/src/mods/dark+/variables.css
@@ -0,0 +1,132 @@
+/**
+ * notion-enhancer: dark+
+ * (c) 2021 dragonwocky <thedragonring.bod@gmail.com> (https://dragonwocky.me/)
+ * (https://notion-enhancer.github.io/) under the MIT license
+ */
+
+:root.dark {
+  --theme--accent_blue: var(--dark_plus--accent_blue, rgb(46, 170, 220));
+  --theme--accent_blue-selection: var(
+    --dark_plus--accent_blue-selection,
+    rgb(46, 170, 220, 0.25)
+  );
+  --theme--accent_blue-hover: var(--dark_plus--accent_blue-hover, rgb(6, 156, 205));
+  --theme--accent_blue-active: var(--dark_plus--accent_blue-active, rgb(0, 141, 190));
+  --theme--accent_blue-text: var(--dark_plus--accent_blue-text, #fff);
+  --theme--accent_red: var(--dark_plus--accent_red, #eb5757);
+  --theme--accent_red-button: var(--dark_plus--accent_red-button, rgba(235, 87, 87, 0.1));
+  --theme--accent_red-text: var(--dark_plus--accent_red-text, #fff);
+
+  --theme--bg: rgb(14, 14, 14);
+  --theme--bg_secondary: rgb(0, 0, 0);
+  --theme--bg_card: rgb(0, 0, 0);
+
+  --theme--scrollbar_track: transparent;
+  --theme--scrollbar_thumb: #181818;
+  --theme--scrollbar_thumb-hover: #222222;
+
+  --theme--ui_divider: rgba(36, 36, 36, 0.7);
+  --theme--ui_interactive-hover: rgba(55, 56, 56, 0.3);
+  --theme--ui_interactive-active: rgba(55, 56, 56, 0.402);
+  --theme--ui_toggle-on: var(--theme--accent_blue);
+  --theme--ui_toggle-off: rgb(40, 40, 40);
+  --theme--ui_corner_action: var(--theme--bg_card);
+  --theme--ui_corner_action-hover: var(--theme--ui_interactive-hover);
+  --theme--ui_corner_action-active: var(--theme--ui_interactive-active);
+
+  --theme--icon: rgb(228, 228, 228);
+  --theme--icon_secondary: rgba(211, 211, 211, 0.637);
+
+  --theme--text: rgb(255, 255, 255);
+  --theme--text_secondary: rgb(228, 228, 228);
+  --theme--text_gray: rgba(151, 154, 155, 0.95);
+  --theme--text_brown: rgb(147, 114, 100);
+  --theme--text_orange: rgb(255, 163, 68);
+  --theme--text_yellow: rgb(255, 220, 73);
+  --theme--text_green: rgb(50, 169, 104);
+  --theme--text_blue: rgb(82, 156, 202);
+  --theme--text_purple: rgb(154, 109, 215);
+  --theme--text_pink: rgb(226, 85, 161);
+  --theme--text_red: rgb(218, 47, 35);
+
+  --theme--highlight_gray: var(--theme--tag_gray);
+  --theme--highlight_brown: var(--theme--tag_brown);
+  --theme--highlight_orange: var(--theme--tag_orange);
+  --theme--highlight_yellow: var(--theme--tag_yellow);
+  --theme--highlight_green: var(--theme--tag_green);
+  --theme--highlight_blue: var(--theme--tag_blue);
+  --theme--highlight_purple: var(--theme--tag_purple);
+  --theme--highlight_pink: var(--theme--tag_pink);
+  --theme--highlight_red: var(--theme--tag_red);
+
+  --theme--callout_gray: rgba(126, 128, 129, 0.301);
+  --theme--callout_brown: #50331fad;
+  --theme--callout_orange: rgba(255, 153, 0, 0.315);
+  --theme--callout_yellow: rgba(183, 156, 0, 0.445);
+  --theme--callout_green: rgba(50, 129, 47, 0.39);
+  --theme--callout_blue: rgba(0, 90, 146, 0.521);
+  --theme--callout_purple: rgba(90, 49, 148, 0.349);
+  --theme--callout_pink: rgba(243, 61, 158, 0.301);
+  --theme--callout_red: rgba(122, 20, 20, 0.623);
+
+  --theme--tag_light_gray: rgba(165, 166, 167, 0.5);
+  --theme--tag_gray: rgba(126, 128, 129, 0.5);
+  --theme--tag_brown: #50331f;
+  --theme--tag_orange: rgba(255, 155, 0, 0.58);
+  --theme--tag_yellow: rgba(183, 155, 0, 1);
+  --theme--tag_green: rgb(50, 129, 47);
+  --theme--tag_blue: rgba(0, 90, 146, 0.71);
+  --theme--tag_purple: rgba(91, 49, 148, 0.74);
+  --theme--tag_pink: rgba(243, 61, 159, 0.5);
+  --theme--tag_red: rgb(122, 20, 20);
+
+  --theme--board_light_gray: rgba(165, 166, 167, 0.089);
+  --theme--board_light_gray-card: var(--theme--tag_light_gray);
+  --theme--board_light_gray-card_text: var(--theme--tag_light_gray-text);
+  --theme--board_gray: rgba(126, 128, 129, 0.089);
+  --theme--board_gray-card: var(--theme--tag_gray);
+  --theme--board_gray-card_text: var(--theme--tag_gray-text);
+  --theme--board_brown: #50331f59;
+  --theme--board_brown-card: var(--theme--tag_brown);
+  --theme--board_brown-card_text: var(--theme--tag_brown-text);
+  --theme--board_orange: rgba(255, 153, 0, 0.164);
+  --theme--board_orange-card: var(--theme--tag_orange);
+  --theme--board_orange-card_text: var(--theme--tag_orange-text);
+  --theme--board_yellow: rgba(183, 156, 0, 0.274);
+  --theme--board_yellow-card: var(--theme--tag_yellow);
+  --theme--board_yellow-card_text: var(--theme--tag_yellow-text);
+  --theme--board_green: rgba(50, 129, 47, 0.191);
+  --theme--board_green-card: var(--theme--tag_green);
+  --theme--board_green-card_text: var(--theme--tag_green-text);
+  --theme--board_blue: rgba(0, 90, 146, 0.294);
+  --theme--board_blue-card: var(--theme--tag_blue);
+  --theme--board_purple: rgba(90, 49, 148, 0.219);
+  --theme--board_purple-card: var(--theme--tag_purple);
+  --theme--board_purple-card_text: var(--theme--tag_purple-text);
+  --theme--board_pink: rgba(243, 61, 158, 0.191);
+  --theme--board_pink-card: var(--theme--tag_pink);
+  --theme--board_pink-card_text: var(--theme--tag_pink-text);
+  --theme--board_red: rgba(122, 20, 20, 0.376);
+  --theme--board_red-card: var(--theme--tag_red);
+  --theme--board_red-card_text: var(--theme--tag_red-text);
+
+  --theme--code_inline-text: #7dc582;
+  --theme--code_inline-background: rgb(0, 0, 0);
+
+  --theme--code: rgb(0, 0, 0);
+  --theme--code_plain: var(--theme--text);
+  --theme--code_function: #c7e1ff;
+  --theme--code_keyword: #c397d8;
+  --theme--code_property: #82aed8;
+  --theme--code_operator: rgb(166, 175, 201);
+  --theme--code_regex: #da265f;
+  --theme--code_property: #82aed8;
+  --theme--code_builtin: #ff6294;
+  --theme--code_selector: #ff6294;
+  --theme--code_comment: rgb(166, 175, 201);
+  --theme--code_punctuation: rgb(166, 175, 201);
+  --theme--code_doctype: rgb(166, 175, 201);
+  --theme--code_number: #c397d8;
+  --theme--code_string: #7dc582;
+  --theme--code_atrule: #7dc582;
+}
diff --git a/src/mods/dracula/app.css b/src/mods/dracula/app.css
new file mode 100644
index 0000000..449ffe4
--- /dev/null
+++ b/src/mods/dracula/app.css
@@ -0,0 +1,84 @@
+/**
+ * notion-enhancer: dracula
+ * (c) 2016 Dracula Theme
+ * (c) 2020 CloudHill
+ * (c) 2020 mimishahzad
+ * (c) 2021 dragonwocky <thedragonring.bod@gmail.com> (https://dragonwocky.me/)
+ * (https://notion-enhancer.github.io/) under the MIT license
+ */
+
+.notion-dark-theme img[src*='/images/onboarding/use-case-note.png'],
+.notion-dark-theme img[src*='/images/onboarding/team-features-illustration.png'] {
+  filter: invert(1) !important;
+}
+.notion-dark-theme img[src*='/images/onboarding/checked.svg'] {
+  filter: hue-rotate(45deg) !important;
+}
+.notion-dark-theme
+  img[style*='display: block; object-fit: cover; border-radius: 100%; width: 90px; height: 90px;'],
+.notion-dark-theme
+  img[style*='display: block; object-fit: cover; border-radius: 3px; width: 56.832px; height: 56.832px; transition: opacity 100ms ease-out 0s;'] {
+  transition: filter 0.4s ease !important;
+}
+.notion-dark-theme
+  img[style*='display: block; object-fit: cover; border-radius: 100%; width: 90px; height: 90px;']:hover,
+.notion-dark-theme
+  img[style*='display: block; object-fit: cover; border-radius: 3px; width: 56.832px; height: 56.832px; transition: opacity 100ms ease-out 0s;']:hover {
+  filter: brightness(1.2);
+}
+
+.notion-dark-theme .notion-token-remove-button[role*='button'][tabindex*='0']:hover,
+.notion-dark-theme .notion-record-icon {
+  background: transparent !important;
+}
+
+.notion-dark-theme .notion-focusable:focus-within,
+.notion-dark-theme .notion-to_do-block > div > div > div[style*='background:'],
+.notion-dark-theme div[role='button'],
+[style*='height: 4px;'] > .notion-selectable.notion-collection_view_page-block > *,
+.notion-dark-theme .notion-calendar-view-day[style*='background: #282a36;'],
+.DayPicker-Day--today,
+.notion-dark-theme
+  .DayPicker:not(.DayPicker--interactionDisabled)
+  .DayPicker-Day--outside:hover,
+.notion-dark-theme
+  .DayPicker:not(.DayPicker--interactionDisabled)
+  .DayPicker-Day:not(.DayPicker-Day--disabled):not(.DayPicker-Day--value)
+  .DayPicker-Day.DayPicker-Day--start.DayPicker-Day--selected,
+.notion-dark-theme .DayPicker-Day.DayPicker-Day--range.DayPicker-Day--start,
+.notion-dark-theme .DayPicker-Day.DayPicker-Day--range.DayPicker-Day--end {
+  transition: color 0.4s ease, background 0.4s ease, box-shadow 0.4s ease !important;
+}
+
+.notion-dark-theme [style*='background: #282a36;'],
+.notion-dark-theme
+  [style*='background: rgb(80, 85, 88);'][style*='color: rgba(255, 255, 255, 0.7)'],
+.notion-dark-theme
+  [style*='background: rgb(80, 85, 88);'][style*='width: 18px;'][style*='height: 18px;'],
+.notion-dark-theme
+  [style*='box-shadow: rgba(15, 15, 15, 0.1) 0px 0px 0px 1px, rgba(15, 15, 15, 0.2) 0px 5px 10px, rgba(15, 15, 15, 0.4) 0px 15px 40px;'],
+.notion-dark-theme [style*='background: rgba(151, 154, 155, 0.5);'],
+.notion-dark-theme [style*='background: rgba(147, 114, 100, 0.5)'],
+.notion-dark-theme [style*='background: rgba(255, 163, 68, 0.5)'],
+.notion-dark-theme [style*='background: rgba(255, 220, 73, 0.5)'],
+.notion-dark-theme [style*='background: rgba(77, 171, 154, 0.5)'],
+.notion-dark-theme [style*='background: rgba(82, 156, 202, 0.5)'],
+.notion-dark-theme [style*='background: rgba(154, 109, 215, 0.5)'],
+.notion-dark-theme [style*='background: rgba(226, 85, 161, 0.5)'],
+.notion-dark-theme [style*='background: rgba(255, 115, 105, 0.5)'] {
+  box-shadow: 0 2px 4px rgb(0 0 0 / 66%) !important;
+}
+
+.notion-dark-theme .notion-code-block .token.parameter,
+.notion-dark-theme .notion-code-block .token.decorator,
+.notion-dark-theme .notion-code-block .token.id,
+.notion-dark-theme .notion-code-block .token.class,
+.notion-dark-theme .notion-code-block .token.pseudo-element,
+.notion-dark-theme .notion-code-block .token.pseudo-class,
+.notion-dark-theme .notion-code-block .token.attribute {
+  font-style: italic;
+}
+
+.notion-dark-theme .notion-code-block .token.punctuation {
+  opacity: 1;
+}
diff --git a/src/mods/dracula/dracula.png b/src/mods/dracula/dracula.png
new file mode 100644
index 0000000..035ca0a
Binary files /dev/null and b/src/mods/dracula/dracula.png differ
diff --git a/src/mods/dracula/mod.json b/src/mods/dracula/mod.json
new file mode 100644
index 0000000..3eb186b
--- /dev/null
+++ b/src/mods/dracula/mod.json
@@ -0,0 +1,28 @@
+{
+  "name": "dracula",
+  "id": "033bff54-50ba-4cec-bdc0-b2ca7e307086",
+  "version": "0.3.0",
+  "description": "a theme based on the popular dracula color palette originally by zeno rocha and friends.",
+  "preview": "dracula.png",
+  "tags": ["theme", "dark"],
+  "authors": [
+    {
+      "name": "dracula",
+      "email": "zno.rocha@gmail.com",
+      "homepage": "https://draculatheme.com/",
+      "avatar": "https://draculatheme.com/static/icons/pack-1/045-dracula.svg"
+    },
+    {
+      "name": "mimishahzad",
+      "homepage": "https://github.com/mimishahzad",
+      "avatar": "https://avatars.githubusercontent.com/u/34081810"
+    }
+  ],
+  "css": {
+    "frame": ["variables.css"],
+    "client": ["variables.css", "app.css"],
+    "menu": ["variables.css"]
+  },
+  "js": {},
+  "options": []
+}
diff --git a/src/mods/dracula/variables.css b/src/mods/dracula/variables.css
new file mode 100644
index 0000000..0ef8311
--- /dev/null
+++ b/src/mods/dracula/variables.css
@@ -0,0 +1,213 @@
+/**
+ * notion-enhancer: dracula
+ * (c) 2016 Dracula Theme
+ * (c) 2020 mimishahzad
+ * (c) 2021 dragonwocky <thedragonring.bod@gmail.com> (https://dragonwocky.me/)
+ * (https://notion-enhancer.github.io/) under the MIT license
+ */
+
+:root.dark {
+  --dracula--bg: #282a36;
+  --dracula--bg_lighter: #424450;
+  --dracula--bg_light: #343746;
+  --dracula--bg_dark: #21222c;
+  --dracula--bg_darker: #191a21;
+
+  --dracula--fg: #f8f8f2;
+  --dracula--fg_dark: #babbba;
+
+  --dracula--comment: #6272a4;
+  --dracula--selection: #44475a;
+  --dracula--block_highlight: #44475a75;
+
+  --dracula--light_gray: #CFCFCF;
+  --dracula--gray: var(--dracula--fg_dark);
+  --dracula--brown: #6272a4;
+  --dracula--orange: #ffb86c;
+  --dracula--yellow: #f1fa8c;
+  --dracula--green: #50fa7b;
+  --dracula--blue: #8be9fd;
+  --dracula--purple: #bd93f9;
+  --dracula--pink: #ff79c6;
+  --dracula--red: #ff5555;
+
+  --dracula--bg_light_gray: #71737E;
+  --dracula--bg_gray: var(--dracula--bg_light);
+  --dracula--bg_brown: #465079;
+  --dracula--bg_orange: #8a6345;
+  --dracula--bg_yellow: #8e9656;
+  --dracula--bg_green: #3f945f;
+  --dracula--bg_blue: #498096;
+  --dracula--bg_purple: #6a549b;
+  --dracula--bg_pink: #8d4a7c;
+  --dracula--bg_red: #943844;
+
+  --theme--accent_blue: var(--dracula--purple);
+  --theme--accent_blue-selection: #bb8dfd3d;
+  --theme--accent_blue-hover: #b179ff;
+  --theme--accent_blue-active: #9f5ff8;
+  --theme--accent_red: var(--dracula--comment);
+  --theme--accent_red-button: #6273a439;
+
+  --theme--danger_text: var(--dracula--red);
+  --theme--danger_border: var(--dracula--bg_red);
+
+  --theme--bg: var(--dracula--bg);
+  --theme--bg_secondary: var(--dracula--bg_dark);
+  --theme--bg_card: var(--dracula--bg_light);
+
+  --theme--scrollbar_track: transparent;
+  --theme--scrollbar_thumb: var(--dracula--selection);
+  --theme--scrollbar_thumb-hover: var(--dracula--comment);
+
+  --theme--ui_divider: var(--dracula--bg_lighter);
+  --theme--ui_interactive-hover: var(--dracula--block_highlight);
+  --theme--ui_interactive-active: var(--dracula--bg_lighter);
+  --theme--ui_toggle-off: var(--dracula--block_highlight);
+  --theme--ui_corner_action: var(--theme--bg_card);
+  --theme--ui_corner_action-hover: var(--theme--ui_interactive-hover);
+  --theme--ui_corner_action-active: var(--theme--ui_interactive-active);
+
+  --theme--icon: var(--dracula--comment);
+  --theme--icon_secondary: var(--dracula--comment);
+
+  --theme--text: var(--dracula--fg);
+  --theme--text_secondary: var(--dracula--fg_dark);
+  --theme--text_gray: var(--dracula--gray);
+  --theme--text_brown: var(--dracula--brown);
+  --theme--text_orange: var(--dracula--orange);
+  --theme--text_yellow: var(--dracula--yellow);
+  --theme--text_green: var(--dracula--green);
+  --theme--text_blue: var(--dracula--blue);
+  --theme--text_purple: var(--dracula--purple);
+  --theme--text_pink: var(--dracula--pink);
+  --theme--text_red: var(--dracula--red);
+
+  --theme--highlight_gray: var(--dracula--gray);
+  --theme--highlight_gray-text: var(--dracula--bg);
+  --theme--highlight_brown: var(--dracula--brown);
+  --theme--highlight_brown-text: var(--dracula--fg);
+  --theme--highlight_orange: var(--dracula--orange);
+  --theme--highlight_orange-text: var(--dracula--bg);
+  --theme--highlight_yellow: var(--dracula--yellow);
+  --theme--highlight_yellow-text: var(--dracula--bg);
+  --theme--highlight_green: var(--dracula--green);
+  --theme--highlight_green-text: var(--dracula--bg);
+  --theme--highlight_blue: var(--dracula--blue);
+  --theme--highlight_blue-text: var(--dracula--bg);
+  --theme--highlight_purple: var(--dracula--purple);
+  --theme--highlight_purple-text: var(--dracula--bg);
+  --theme--highlight_pink: var(--dracula--pink);
+  --theme--highlight_pink-text: var(--dracula--bg);
+  --theme--highlight_red: var(--dracula--red);
+  --theme--highlight_red-text: var(--dracula--fg);
+
+  --theme--callout_gray: var(--dracula--bg_gray);
+  --theme--callout_brown: var(--dracula--bg_brown);
+  --theme--callout_orange: var(--dracula--bg_orange);
+  --theme--callout_yellow: var(--dracula--bg_yellow);
+  --theme--callout_green: var(--dracula--bg_green);
+  --theme--callout_blue: var(--dracula--bg_blue);
+  --theme--callout_purple: var(--dracula--bg_purple);
+  --theme--callout_pink: var(--dracula--bg_pink);
+  --theme--callout_red: var(--dracula--bg_red);
+
+  --theme--tag_default: var(--dracula--comment);
+  --theme--tag_default-text: var(--dracula--fg);
+  --theme--tag_light_gray: var(--dracula--light_gray);
+  --theme--tag_light_gray-text: var(--dracula--bg);
+  --theme--tag_gray: var(--dracula--gray);
+  --theme--tag_gray-text: var(--dracula--bg);
+  --theme--tag_brown: var(--dracula--brown);
+  --theme--tag_brown-text: var(--dracula--fg);
+  --theme--tag_orange: var(--dracula--orange);
+  --theme--tag_orange-text: var(--dracula--bg);
+  --theme--tag_yellow: var(--dracula--yellow);
+  --theme--tag_yellow-text: var(--dracula--bg);
+  --theme--tag_green: var(--dracula--green);
+  --theme--tag_green-text: var(--dracula--bg);
+  --theme--tag_blue: var(--dracula--blue);
+  --theme--tag_blue-text: var(--dracula--bg);
+  --theme--tag_purple: var(--dracula--purple);
+  --theme--tag_purple-text: var(--dracula--bg);
+  --theme--tag_pink: var(--dracula--pink);
+  --theme--tag_pink-text: var(--dracula--bg);
+  --theme--tag_red: var(--dracula--red);
+  --theme--tag_red-text: var(--dracula--fg);
+
+  --theme--board_light_gray: var(--dracula--bg_light_gray);
+  --theme--board_light_gray-card: var(--theme--tag_light_gray);
+  --theme--board_light_gray-card_text: var(--theme--tag_light_gray-text);
+  --theme--board_light_gray-text: var(--dracula--fg);
+  --theme--board_gray: var(--dracula--bg_gray);
+  --theme--board_gray-card: var(--theme--tag_gray);
+  --theme--board_gray-card_text: var(--theme--tag_gray-text);
+  --theme--board_gray-text: var(--dracula--fg);
+  --theme--board_brown: var(--dracula--bg_brown);
+  --theme--board_brown-card: var(--theme--tag_brown);
+  --theme--board_brown-card_text: var(--theme--tag_brown-text);
+  --theme--board_brown-text: var(--dracula--fg);
+  --theme--board_orange: var(--dracula--bg_orange);
+  --theme--board_orange-card: var(--theme--tag_orange);
+  --theme--board_orange-card_text: var(--theme--tag_orange-text);
+  --theme--board_orange-text: var(--dracula--fg);
+  --theme--board_yellow: var(--dracula--bg_yellow);
+  --theme--board_yellow-card: var(--theme--tag_yellow);
+  --theme--board_yellow-card_text: var(--theme--tag_yellow-text);
+  --theme--board_yellow-text: var(--dracula--fg);
+  --theme--board_green: var(--dracula--bg_green);
+  --theme--board_green-card: var(--theme--tag_green);
+  --theme--board_green-card_text: var(--theme--tag_green-text);
+  --theme--board_green-text: var(--dracula--fg);
+  --theme--board_blue: var(--dracula--bg_blue);
+  --theme--board_blue-card: var(--theme--tag_blue);
+  --theme--board_blue-card_text: var(--theme--tag_blue-text);
+  --theme--board_blue-text: var(--dracula--fg);
+  --theme--board_purple: var(--dracula--bg_purple);
+  --theme--board_purple-card: var(--theme--tag_purple);
+  --theme--board_purple-card_text: var(--theme--tag_purple-text);
+  --theme--board_purple-text: var(--dracula--fg);
+  --theme--board_pink: var(--dracula--bg_pink);
+  --theme--board_pink-card: var(--theme--tag_pink);
+  --theme--board_pink-card_text: var(--theme--tag_pink-text);
+  --theme--board_pink-text: var(--dracula--fg);
+  --theme--board_red: var(--dracula--bg_red);
+  --theme--board_red-card: var(--theme--tag_red);
+  --theme--board_red-card_text: var(--theme--tag_red-text);
+  --theme--board_red-text: var(--dracula--fg);
+
+  --theme--code_inline: var(--dracula--bg_light);
+  --theme--code_inline-text: var(--dracula--green);
+
+  --theme--code: var(--dracula--bg_light);
+  --theme--code_plain: var(--dracula--fg);
+  --theme--code_function: var(--dracula--green);
+  --theme--code_parameter: var(--dracula--orange);
+  --theme--code_keyword: var(--dracula--pink);
+  --theme--code_constant: var(--dracula--purple);
+  --theme--code_tag: var(--dracula--pink);
+  --theme--code_operator: var(--dracula--pink);
+  --theme--code_important: var(--dracula--pink);
+  --theme--code_regex: var(--dracula--red);
+  --theme--code_property: var(--dracula--blue);
+  --theme--code_builtin: var(--dracula--blue);
+  --theme--code_class-name: var(--dracula--blue);
+  --theme--code_attr-name: var(--dracula--green);
+  --theme--code_attr-value: var(--dracula--yellow);
+  --theme--code_selector: var(--dracula--pink);
+  --theme--code_id: var(--dracula--green);
+  --theme--code_class: var(--dracula--green);
+  --theme--code_pseudo-element: var(--dracula--green);
+  --theme--code_pseudo-class: var(--dracula--green);
+  --theme--code_attribute: var(--dracula--green);
+  --theme--code_value: var(--dracula--yellow);
+  --theme--code_unit: var(--dracula--pink);
+  --theme--code_comment: var(--dracula--comment);
+  --theme--code_punctuation: var(--dracula--text);
+  --theme--code_annotation: var(--theme--code_punctuation);
+  --theme--code_decorator: var(--dracula--green);
+  --theme--code_doctype: var(--dracula--fg_dark);
+  --theme--code_number: var(--dracula--purple);
+  --theme--code_string: var(--dracula--yellow);
+  --theme--code_boolean: var(--dracula--purple);
+}
diff --git a/src/mods/emoji-sets/client.css b/src/mods/emoji-sets/client.css
new file mode 100644
index 0000000..81e3e7d
--- /dev/null
+++ b/src/mods/emoji-sets/client.css
@@ -0,0 +1,10 @@
+/**
+ * notion-enhancer: emoji sets
+ * (c) 2021 Arecsu
+ * (c) 2021 dragonwocky <thedragonring.bod@gmail.com> (https://dragonwocky.me/)
+ * (https://notion-enhancer.github.io/) under the MIT license
+ */
+
+[aria-label][role='image'][style*='Apple Color Emoji']:not([data-emoji-sets-unsupported]) {
+  margin-left: 2.5px !important;
+}
diff --git a/src/mods/emoji-sets/client.mjs b/src/mods/emoji-sets/client.mjs
new file mode 100644
index 0000000..1e6a9bf
--- /dev/null
+++ b/src/mods/emoji-sets/client.mjs
@@ -0,0 +1,71 @@
+/**
+ * notion-enhancer: emoji sets
+ * (c) 2021 dragonwocky <thedragonring.bod@gmail.com> (https://dragonwocky.me/)
+ * (https://notion-enhancer.github.io/) under the MIT license
+ */
+
+export default async function ({ web, env }, db) {
+  const style = await db.get(['style']),
+    // real emojis are used on macos instead of the twitter set
+    nativeEmojiSelector = `[aria-label][role="image"][style*="Apple Color Emoji"]:not([data-emoji-sets-unsupported])`,
+    imgEmojiSelector = '.notion-emoji:not([data-emoji-sets-unsupported])',
+    imgEmojiOverlaySelector = `${imgEmojiSelector} + [src*="notion-emojis"]`;
+
+  await Promise.any([web.whenReady([nativeEmojiSelector]), web.whenReady([imgEmojiSelector])]);
+
+  const nativeEmojis = document.querySelectorAll(nativeEmojiSelector).length,
+    imgEmojis = document.querySelectorAll(imgEmojiSelector).length;
+
+  const unsupportedEmojis = [],
+    emojiReqs = new Map(),
+    getEmoji = async (emoji) => {
+      emoji = encodeURIComponent(emoji);
+      if (unsupportedEmojis.includes(emoji)) return undefined;
+      try {
+        if (!emojiReqs.get(emoji)) {
+          emojiReqs.set(emoji, fetch(`https://emojicdn.elk.sh/${emoji}?style=${style}`));
+        }
+        const res = await emojiReqs.get(emoji);
+        if (!res.ok) throw new Error();
+        return `url("https://emojicdn.elk.sh/${emoji}?style=${style}") 100% 100% / 100%`;
+      } catch {
+        unsupportedEmojis.push(emoji);
+        return undefined;
+      }
+    };
+
+  if (nativeEmojis) {
+    const updateEmojis = async () => {
+      const $emojis = document.querySelectorAll(nativeEmojiSelector);
+      for (const $emoji of $emojis) {
+        const emojiSrc = await getEmoji($emoji.ariaLabel);
+        if (emojiSrc) {
+          $emoji.style.background = emojiSrc;
+          $emoji.style.width = '1em';
+          $emoji.style.height = '1em';
+          $emoji.style.display = 'inline-block';
+          $emoji.innerText = '';
+        } else $emoji.dataset.emojiSetsUnsupported = true;
+      }
+    };
+    web.addDocumentObserver(updateEmojis, [nativeEmojiSelector]);
+  }
+
+  if (style !== 'twitter' && imgEmojis) {
+    const updateEmojis = async () => {
+      const $emojis = document.querySelectorAll(imgEmojiSelector);
+      for (const $emoji of $emojis) {
+        const emojiSrc = await getEmoji($emoji.ariaLabel);
+        if (emojiSrc) {
+          $emoji.style.background = emojiSrc;
+          $emoji.style.opacity = 1;
+          if ($emoji.nextElementSibling?.matches?.(imgEmojiOverlaySelector)) {
+            $emoji.nextElementSibling.style.opacity = 0;
+          }
+        } else $emoji.dataset.emojiSetsUnsupported = true;
+      }
+    };
+    updateEmojis();
+    web.addDocumentObserver(updateEmojis, [imgEmojiSelector, imgEmojiOverlaySelector]);
+  }
+}
diff --git a/src/mods/emoji-sets/emoji-sets.jpg b/src/mods/emoji-sets/emoji-sets.jpg
new file mode 100644
index 0000000..1716d4c
Binary files /dev/null and b/src/mods/emoji-sets/emoji-sets.jpg differ
diff --git a/src/mods/emoji-sets/mod.json b/src/mods/emoji-sets/mod.json
new file mode 100644
index 0000000..ac3ba3e
--- /dev/null
+++ b/src/mods/emoji-sets/mod.json
@@ -0,0 +1,46 @@
+{
+  "name": "emoji sets",
+  "id": "a2401ee1-93ba-4b8c-9781-7f570bf5d71e",
+  "version": "0.4.0",
+  "description": "pick from a variety of emoji styles to use.",
+  "preview": "emoji-sets.jpg",
+  "tags": ["extension", "customisation"],
+  "authors": [
+    {
+      "name": "dragonwocky",
+      "email": "thedragonring.bod@gmail.com",
+      "homepage": "https://dragonwocky.me/",
+      "avatar": "https://dragonwocky.me/avatar.jpg"
+    }
+  ],
+  "js": {
+    "client": ["client.mjs"]
+  },
+  "css": {
+    "client": ["client.css"]
+  },
+  "options": [
+    {
+      "type": "select",
+      "key": "style",
+      "label": "emoji style",
+      "tooltip": "**initial use may involve some lag and load-time for emojis until they have all been cached**",
+      "values": [
+        "twitter",
+        "apple",
+        "google",
+        "microsoft",
+        "samsung",
+        "whatsapp",
+        "facebook",
+        "messenger",
+        "joypixels",
+        "openmoji",
+        "emojidex",
+        "lg",
+        "htc",
+        "mozilla"
+      ]
+    }
+  ]
+}
diff --git a/src/mods/focus-mode/client.css b/src/mods/focus-mode/client.css
new file mode 100644
index 0000000..d615b0c
--- /dev/null
+++ b/src/mods/focus-mode/client.css
@@ -0,0 +1,21 @@
+/**
+ * notion-enhancer: focus mode
+ * (c) 2020 Arecsu
+ * (c) 2021 dragonwocky <thedragonring.bod@gmail.com> (https://dragonwocky.me/)
+ * (https://notion-enhancer.github.io/) under the MIT license
+ */
+
+.notion-sidebar-container[style*='width: 0px;'] ~ div .notion-topbar > :first-child {
+  opacity: 0 !important;
+  transition: opacity 200ms ease-in-out !important;
+}
+.notion-sidebar-container[style*='width: 0px;'] ~ div .notion-topbar > :first-child:hover {
+  opacity: 1 !important;
+}
+
+[data-focus-mode='padded']
+  .notion-sidebar-container[style*='width: 0px;']
+  ~ div
+  .notion-frame {
+  height: calc(100vh - 90px) !important;
+}
diff --git a/src/mods/focus-mode/client.mjs b/src/mods/focus-mode/client.mjs
new file mode 100644
index 0000000..8423026
--- /dev/null
+++ b/src/mods/focus-mode/client.mjs
@@ -0,0 +1,12 @@
+/**
+ * notion-enhancer: focus mode
+ * (c) 2020 Arecsu
+ * (c) 2021 dragonwocky <thedragonring.bod@gmail.com> (https://dragonwocky.me/)
+ * (https://notion-enhancer.github.io/) under the MIT license
+ */
+
+'use strict';
+
+export default async function (api, db) {
+  if (await db.get(['padded'])) document.body.dataset.focusMode = 'padded';
+}
diff --git a/src/mods/focus-mode/mod.json b/src/mods/focus-mode/mod.json
new file mode 100644
index 0000000..0ffb3c8
--- /dev/null
+++ b/src/mods/focus-mode/mod.json
@@ -0,0 +1,39 @@
+{
+  "name": "focus mode",
+  "id": "5a08598d-bfac-4167-9ae8-2bd0e2ef141e",
+  "version": "0.3.0",
+  "description": "hide the titlebar/menubar when the sidebar is closed (returns on hover).",
+  "tags": ["extension", "layout"],
+  "authors": [
+    {
+      "name": "arecsu",
+      "email": "alejandro9r@gmail.com",
+      "homepage": "https://github.com/Arecsu",
+      "avatar": "https://avatars.githubusercontent.com/u/12679098"
+    }
+  ],
+  "css": {
+    "frame": ["tabs.css"],
+    "client": ["client.css"]
+  },
+  "js": {
+    "frame": ["tabs.mjs"],
+    "client": ["client.mjs"]
+  },
+  "options": [
+    {
+      "type": "toggle",
+      "key": "padded",
+      "label": "even padding",
+      "tooltip": "matches the empty space at the top and sides of the frame with **extra padding at the bottom when the sidebar is hidden**",
+      "value": true
+    },
+    {
+      "type": "toggle",
+      "key": "tabs",
+      "label": "hide tabs",
+      "tooltip": "makes the tab bar transparent unless hovered over",
+      "value": false
+    }
+  ]
+}
diff --git a/src/mods/focus-mode/tabs.css b/src/mods/focus-mode/tabs.css
new file mode 100644
index 0000000..8b0414f
--- /dev/null
+++ b/src/mods/focus-mode/tabs.css
@@ -0,0 +1,14 @@
+/**
+ * notion-enhancer: focus mode
+ * (c) 2021 dragonwocky <thedragonring.bod@gmail.com> (https://dragonwocky.me/)
+ * (https://notion-enhancer.github.io/) under the MIT license
+ */
+
+[data-focus-mode='hide-tabs'] header:not(:hover) {
+  background: var(--theme--bg);
+  border-bottom-color: transparent;
+}
+[data-focus-mode='hide-tabs'] header:not(:hover) > * {
+  opacity: 0;
+  transition: opacity 200ms ease-in-out;
+}
diff --git a/src/mods/focus-mode/tabs.mjs b/src/mods/focus-mode/tabs.mjs
new file mode 100644
index 0000000..6074834
--- /dev/null
+++ b/src/mods/focus-mode/tabs.mjs
@@ -0,0 +1,12 @@
+/**
+ * notion-enhancer: focus mode
+ * (c) 2020 Arecsu
+ * (c) 2021 dragonwocky <thedragonring.bod@gmail.com> (https://dragonwocky.me/)
+ * (https://notion-enhancer.github.io/) under the MIT license
+ */
+
+'use strict';
+
+export default async function (api, db) {
+  if (await db.get(['tabs'])) document.body.dataset.focusMode = 'hide-tabs';
+}
diff --git a/src/mods/font-chooser/fonts.css b/src/mods/font-chooser/fonts.css
new file mode 100644
index 0000000..7d5b32e
--- /dev/null
+++ b/src/mods/font-chooser/fonts.css
@@ -0,0 +1,25 @@
+/**
+ * notion-enhancer: font chooser
+ * (c) 2021 TorchAtlas (https://github.com/torchatlas/)
+ * (c) 2021 admiraldus (https://github.com/admiraldus)
+ * (c) 2021 dragonwocky <thedragonring.bod@gmail.com> (https://dragonwocky.me/)
+ * (https://notion-enhancer.github.io/) under the MIT license
+ */
+
+:root {
+  --theme--font_sans: var(--font_chooser--sans);
+  --theme--font_serif: var(--font_chooser--serif);
+  --theme--font_mono: var(--font_chooser--mono);
+  --theme--font_code: var(--font_chooser--code);
+}
+
+.notion-quote-block {
+  font-family: var(--font_chooser--quotes, inherit) !important;
+}
+
+[placeholder='Untitled'],
+[placeholder='Heading 1'],
+[placeholder='Heading 2'],
+[placeholder='Heading 3'] {
+  font-family: var(--font_chooser--headings, inherit) !important;
+}
diff --git a/src/mods/font-chooser/fonts.mjs b/src/mods/font-chooser/fonts.mjs
new file mode 100644
index 0000000..5d344d3
--- /dev/null
+++ b/src/mods/font-chooser/fonts.mjs
@@ -0,0 +1,28 @@
+/**
+ * notion-enhancer: font chooser
+ * (c) 2021 TorchAtlas (https://github.com/torchatlas/)
+ * (c) 2021 admiraldus (https://github.com/admiraldus
+ * (c) 2021 dragonwocky <thedragonring.bod@gmail.com> (https://dragonwocky.me/)
+ * (https://notion-enhancer.github.io/) under the MIT license
+ */
+
+'use strict';
+
+export default async function ({}, db) {
+  const defaults = {
+    sans: " -apple-system, BlinkMacSystemFont, 'Segoe UI', Helvetica, 'Apple Color Emoji', Arial, sans-serif, 'Segoe UI Emoji', 'Segoe UI Symbol'",
+    serif:
+      "Lyon-Text, Georgia, YuMincho, 'Yu Mincho', 'Hiragino Mincho ProN', 'Hiragino Mincho Pro', 'Songti TC', 'Songti SC', SimSun, 'Nanum Myeongjo', NanumMyeongjo, Batang, serif",
+    mono: 'iawriter-mono, Nitti, Menlo, Courier, monospace',
+    code: "SFMono-Regular, Consolas, 'Liberation Mono', Menlo, Courier, monospace",
+    quotes: 'inherit',
+    headings: 'inherit',
+  };
+  for (let style of ['sans', 'serif', 'mono', 'code', 'quotes', 'headings']) {
+    const font = await db.get([style]);
+    document.documentElement.style.setProperty(
+      `--font_chooser--${style}`,
+      font || defaults[style]
+    );
+  }
+}
diff --git a/src/mods/font-chooser/mod.json b/src/mods/font-chooser/mod.json
new file mode 100644
index 0000000..9d36d8a
--- /dev/null
+++ b/src/mods/font-chooser/mod.json
@@ -0,0 +1,68 @@
+{
+  "name": "font chooser",
+  "id": "e0d8d148-45e7-4d79-8313-e7b2ad8abe16",
+  "version": "0.4.0",
+  "description": "set custom fonts.",
+  "tags": ["extension", "customisation"],
+  "authors": [
+    {
+      "name": "TorchAtlas",
+      "homepage": "https://github.com/torchatlas/",
+      "avatar": "https://avatars.githubusercontent.com/u/12666855"
+    }
+  ],
+  "js": {
+    "client": ["fonts.mjs"],
+    "menu": ["fonts.mjs"],
+    "frame": ["fonts.mjs"]
+  },
+  "css": {
+    "client": ["fonts.css"],
+    "menu": ["fonts.css"],
+    "frame": ["fonts.css"]
+  },
+  "options": [
+    {
+      "type": "text",
+      "key": "sans",
+      "label": "sans-serif (inc. ui)",
+      "tooltip": "**this font needs to be installed on your device** - leave the option blank to use notion's default font",
+      "value": ""
+    },
+    {
+      "type": "text",
+      "key": "serif",
+      "label": "serif",
+      "tooltip": "**this font needs to be installed on your device** - leave the option blank to use notion's default font",
+      "value": ""
+    },
+    {
+      "type": "text",
+      "key": "mono",
+      "label": "monospace",
+      "tooltip": "**this font needs to be installed on your device** - leave the option blank to use notion's default font",
+      "value": ""
+    },
+    {
+      "type": "text",
+      "key": "code",
+      "label": "code",
+      "tooltip": "**this font needs to be installed on your device** - leave the option blank to use notion's default font",
+      "value": ""
+    },
+    {
+      "type": "text",
+      "key": "quotes",
+      "label": "quotes",
+      "tooltip": "**this font needs to be installed on your device** - leave the option blank to use notion's default font",
+      "value": ""
+    },
+    {
+      "type": "text",
+      "key": "headings",
+      "label": "headings",
+      "tooltip": "**this font needs to be installed on your device** - leave the option blank to use notion's default font",
+      "value": ""
+    }
+  ]
+}
diff --git a/src/mods/global-block-links/client.css b/src/mods/global-block-links/client.css
new file mode 100644
index 0000000..66dcc54
--- /dev/null
+++ b/src/mods/global-block-links/client.css
@@ -0,0 +1,73 @@
+/**
+ * notion-enhancer: global block links
+ * (c) 2021 admiraldus (https://github.com/admiraldus)
+ * (c) 2021 dragonwocky <thedragonring.bod@gmail.com> (https://dragonwocky.me/)
+ * (https://notion-enhancer.github.io/) under the MIT license
+ */
+
+.global_block_links--topbar_copy {
+  display: inline-flex;
+  align-items: center;
+  border-radius: 3px;
+  height: 28px;
+  min-width: 0px;
+  padding-right: 8px;
+  padding-left: 6px;
+  font-size: 14px;
+  line-height: 1.2;
+  color: var(--theme--text);
+  cursor: pointer;
+  transition: background 20ms ease-in 0s;
+  user-select: none;
+}
+.global_block_links--topbar_copy > svg {
+  display: block;
+  height: 16px;
+  width: 16px;
+  fill: var(--theme--icon);
+}
+.global_block_links--topbar_copy > span {
+  margin-left: 2px;
+  opacity: 1;
+  transition: opacity 0.4s ease;
+}
+.global_block_links--topbar_copy > svg + span {
+  margin-left: 6px;
+}
+
+.global_block_links--block_copy {
+  display: flex;
+  align-items: center;
+  height: 28px;
+  width: 100%;
+  font-size: 14px;
+  line-height: 1.2;
+  cursor: pointer;
+  transition: background 20ms ease-in 0s;
+  user-select: none;
+}
+.global_block_links--block_copy > svg {
+  display: block;
+  margin-left: 14px;
+  height: 17px;
+  width: 17px;
+  color: var(--theme--icon);
+}
+.global_block_links--block_copy > span {
+  margin-right: 14px;
+  margin-left: 8px;
+  overflow: hidden;
+  text-overflow: ellipsis;
+  white-space: nowrap;
+}
+
+.global_block_links--topbar_copy:hover,
+.global_block_links--block_copy:hover {
+  background: var(--theme--ui_interactive-hover);
+}
+
+.global_block_links--hidden {
+  position: absolute;
+  top: -9999px;
+  opacity: 0 !important;
+}
diff --git a/src/mods/global-block-links/client.mjs b/src/mods/global-block-links/client.mjs
new file mode 100644
index 0000000..5cd864e
--- /dev/null
+++ b/src/mods/global-block-links/client.mjs
@@ -0,0 +1,109 @@
+/**
+ * notion-enhancer: global block links
+ * (c) 2021 admiraldus (https://github.com/admiraldus)
+ * (c) 2021 dragonwocky <thedragonring.bod@gmail.com> (https://dragonwocky.me/)
+ * (https://notion-enhancer.github.io/) under the MIT license
+ */
+
+export default async function ({ web, components, notion }, db) {
+  const topbarShareSelector = '.notion-topbar-share-menu',
+    blockActionSelector =
+      '.notion-overlay-container .notion-scroller.vertical .notion-focusable > div > div > [style*="text-overflow: ellipsis;"]',
+    hoveredActionSelector =
+      '.notion-overlay-container .notion-scroller.vertical .notion-focusable[style*="background:"]',
+    topbarCopyClass = 'global_block_links--topbar_copy',
+    blockCopyClass = 'global_block_links--block_copy',
+    hiddenClass = 'global_block_links--hidden';
+
+  const topbarCopyIcon = await db.get(['topbar_copy_icon']),
+    topbarCopyText = await db.get(['topbar_copy_text']);
+  if (topbarCopyIcon || topbarCopyText) {
+    const $topbarCopyTemplate = web.render(
+      web.html`<div class="${topbarCopyClass}" role="button" tabindex="0"></div>`,
+      topbarCopyIcon
+        ? web.html`<svg viewBox="0 0 30 30">
+            <path d="M2,12c0-3.309,2.691-6,6-6h8c3.309,0,6,2.691,6,6s-2.691,6-6,6h-6c0,0.736,
+            0.223,1.41,0.574,2H16c4.418,0,8-3.582,8-8 c0-4.418-3.582-8-8-8H8c-4.418,0-8,3.582-8,
+            8c0,2.98,1.634,5.575,4.051,6.951C4.021,18.638,4,18.321,4,18 c0-0.488,0.046-0.967,
+            0.115-1.436C2.823,15.462,2,13.827,2,12z M25.953,11.051C25.984,11.363,26,11.68,26,12
+            c0,0.489-0.047,0.965-0.117,1.434C27.176,14.536,28,16.172,28,18c0,3.309-2.691,6-6,6h-8c-3.309,
+            0-6-2.691-6-6s2.691-6,6-6h6 c0-0.731-0.199-1.413-0.545-2H14c-4.418,0-8,3.582-8,8c0,
+            4.418,3.582,8,8,8h8c4.418,0,8-3.582,8-8 C30,15.021,28.368,12.428,25.953,11.051z"></path>
+          </svg>`
+        : '',
+      topbarCopyText
+        ? web.html`
+            <span data-copy>Copy link</span>
+            <span data-copied class="${hiddenClass}">Link copied!</span>
+          `
+        : ''
+    );
+
+    const insertTopbarCopy = () => {
+      const $btns = document.querySelectorAll(topbarShareSelector);
+      $btns.forEach(($btn) => {
+        if (!$btn.previousElementSibling?.classList?.contains?.(topbarCopyClass)) {
+          const $copy = $topbarCopyTemplate.cloneNode(true);
+          components.addTooltip($copy, '**Copy page link**');
+          $btn.before($copy);
+
+          let resetButtonDelay;
+          $copy.addEventListener('click', () => {
+            if (topbarCopyText) {
+              const $copyText = $copy.querySelector('[data-copy]'),
+                $copiedText = $copy.querySelector('[data-copied]');
+              $copyText.classList.add(hiddenClass);
+              $copiedText.classList.remove(hiddenClass);
+              clearTimeout(resetButtonDelay);
+              resetButtonDelay = setTimeout(() => {
+                $copyText.classList.remove(hiddenClass);
+                $copiedText.classList.add(hiddenClass);
+              }, 1250);
+            }
+
+            web.copyToClipboard(`https://notion.so/${notion.getPageID().replace(/-/g, '')}`);
+          });
+        }
+      });
+    };
+    insertTopbarCopy();
+    web.addDocumentObserver(insertTopbarCopy, [topbarShareSelector]);
+  }
+
+  const $blockCopyTemplate = web.html`
+    <div class="${blockCopyClass}" role="button" tabindex="0">
+      ${await components.feather('globe')}
+      <span>Global link</span>
+    </div>`;
+
+  const getLinkButtons = () =>
+      [...document.querySelectorAll(blockActionSelector)]
+        .filter(($action) =>
+          ['Copy link', '링크 복사', 'リンクをコピー'].includes($action.textContent)
+        )
+        .map(($action) => $action.closest('.notion-focusable')),
+    insertBlockCopy = () => {
+      const $btns = getLinkButtons();
+      $btns.forEach(($btn) => {
+        if (!$btn.previousElementSibling?.classList?.contains?.(blockCopyClass)) {
+          const $copy = $blockCopyTemplate.cloneNode(true);
+          $btn.before($copy);
+
+          $copy.addEventListener('mouseover', () => {
+            document.querySelectorAll(hoveredActionSelector).forEach(($action) => {
+              $action.style.background = '';
+            });
+          });
+
+          $copy.addEventListener('click', async () => {
+            $btn.click();
+            const link = await web.readFromClipboard(),
+              id = link.replace(/.+#(?=\w+)/, '');
+            web.copyToClipboard(id.length === 32 ? `https://notion.so/${id}` : link);
+          });
+        }
+      });
+    };
+  insertBlockCopy();
+  web.addDocumentObserver(insertBlockCopy, [blockActionSelector]);
+}
diff --git a/src/mods/global-block-links/global-block-links.jpg b/src/mods/global-block-links/global-block-links.jpg
new file mode 100644
index 0000000..eb84be2
Binary files /dev/null and b/src/mods/global-block-links/global-block-links.jpg differ
diff --git a/src/mods/global-block-links/mod.json b/src/mods/global-block-links/mod.json
new file mode 100644
index 0000000..698e9b2
--- /dev/null
+++ b/src/mods/global-block-links/mod.json
@@ -0,0 +1,35 @@
+{
+  "name": "global block links",
+  "id": "74856af4-6970-455d-bd86-0a385a402dd1",
+  "version": "0.1.0",
+  "description": "easily copy the global link of a page or block.",
+  "preview": "global-block-links.jpg",
+  "tags": ["extension", "shortcut"],
+  "authors": [
+    {
+      "name": "admiraldus",
+      "homepage": "https://github.com/admiraldus",
+      "avatar": "https://raw.githubusercontent.com/admiraldus/admiraldus/main/module.gif"
+    }
+  ],
+  "js": {
+    "client": ["client.mjs"]
+  },
+  "css": {
+    "client": ["client.css"]
+  },
+  "options": [
+    {
+      "key": "topbar_copy_icon",
+      "label": "copy page links from the topbar (icon)",
+      "type": "toggle",
+      "value": true
+    },
+    {
+      "key": "topbar_copy_text",
+      "label": "copy page links from the topbar (text)",
+      "type": "toggle",
+      "value": true
+    }
+  ]
+}
diff --git a/src/mods/gruvbox-dark/gruvbox-dark.png b/src/mods/gruvbox-dark/gruvbox-dark.png
new file mode 100644
index 0000000..e0756e3
Binary files /dev/null and b/src/mods/gruvbox-dark/gruvbox-dark.png differ
diff --git a/src/mods/gruvbox-dark/mod.json b/src/mods/gruvbox-dark/mod.json
new file mode 100644
index 0000000..13b088b
--- /dev/null
+++ b/src/mods/gruvbox-dark/mod.json
@@ -0,0 +1,29 @@
+{
+  "name": "gruvbox dark",
+  "id": "ad0f5c5c-8b62-4b20-8a54-929e663ea368",
+  "version": "0.3.0",
+  "description": "a gray, 'retro groove' palette based on the vim theme of the same name.",
+  "preview": "gruvbox-dark.png",
+  "tags": ["theme", "dark"],
+  "authors": [
+    {
+      "name": "morhetz",
+      "email": "morhetz@gmail.com",
+      "homepage": "https://github.com/morhetz",
+      "avatar": "https://avatars.githubusercontent.com/u/554231"
+    },
+    {
+      "name": "jordanrobinson",
+      "email": "me@jordanrobinson.co.uk",
+      "homepage": "https://jordanrobinson.co.uk/",
+      "avatar": "https://avatars.githubusercontent.com/u/1202911"
+    }
+  ],
+  "css": {
+    "frame": ["variables.css"],
+    "client": ["variables.css"],
+    "menu": ["variables.css"]
+  },
+  "js": {},
+  "options": []
+}
diff --git a/src/mods/gruvbox-dark/variables.css b/src/mods/gruvbox-dark/variables.css
new file mode 100644
index 0000000..4096c4e
--- /dev/null
+++ b/src/mods/gruvbox-dark/variables.css
@@ -0,0 +1,191 @@
+/**
+ * notion-enhancer: gruvbox dark
+ * (c) 2015-2020 morhetz <morhetz@gmail.com>
+ * (c) 2021 jordanrobinson <me@jordanrobinson.co.uk> (https://jordanrobinson.co.uk/)
+ * (c) 2021 dragonwocky <thedragonring.bod@gmail.com> (https://dragonwocky.me/)
+ * (https://notion-enhancer.github.io/) under the MIT license
+ */
+
+:root.dark {
+  --gruvbox_dark--bg: #282828;
+  --gruvbox_dark--light_gray_dark: #B3A89E;
+  --gruvbox_dark--gray_dark: #928374;
+  --gruvbox_dark--red_dark: #cc241d;
+  --gruvbox_dark--red_light: #fb4934;
+  --gruvbox_dark--green_dark: #98971a;
+  --gruvbox_dark--green_light: #b8bb26;
+  --gruvbox_dark--yellow_dark: #d79921;
+  --gruvbox_dark--yellow_light: #fabd2f;
+  --gruvbox_dark--blue_dark: #458588;
+  --gruvbox_dark--blue_light: #83a598;
+  --gruvbox_dark--purple_dark: #b16286;
+  --gruvbox_dark--purple_light: #d3869b;
+  --gruvbox_dark--aqua_dark: #689d6a;
+  --gruvbox_dark--aqua_light: #8ec07c;
+  --gruvbox_dark--gray_light: #a89984;
+  --gruvbox_dark--orange_dark: #d65d0e;
+  --gruvbox_dark--orange_light: #fe8019;
+  --gruvbox_dark--fg: #ebdbb2;
+  --gruvbox_dark--bg0_h: #1d2021;
+  --gruvbox_dark--bg0: #282828;
+  --gruvbox_dark--bg1: #3c3836;
+  --gruvbox_dark--bg2: #504945;
+  --gruvbox_dark--bg3: #665c54;
+  --gruvbox_dark--bg4: #7c6f64;
+  --gruvbox_dark--bg0_s: #32302f;
+  --gruvbox_dark--fg4: #a89984;
+  --gruvbox_dark--fg3: #bdae93;
+  --gruvbox_dark--fg2: #d5c4a1;
+  --gruvbox_dark--fg1: #ebdbb2;
+  --gruvbox_dark--fg0: #fbf1c7;
+
+  --theme--accent_blue: var(--gruvbox_dark--bg3);
+  --theme--accent_blue-selection: rgba(80, 73, 69, 0.5);
+  --theme--accent_blue-hover: var(--gruvbox_dark--fg3);
+  --theme--accent_blue-active: var(--gruvbox_dark--fg3);
+  --theme--accent_red: var(--gruvbox_dark--blue_dark);
+  --theme--accent_red-button: var(--gruvbox_dark--blue_light);
+
+  --theme--bg: var(--gruvbox_dark--bg0);
+  --theme--bg_secondary: var(--gruvbox_dark--bg1);
+  --theme--bg_card: var(--gruvbox_dark--bg3);
+
+  --theme--scrollbar_track: transparent;
+  --theme--scrollbar_thumb: var(--gruvbox_dark--bg0_s);
+  --theme--scrollbar_thumb-hover: var(--gruvbox_dark--bg3);
+
+  --theme--ui_divider: var(--gruvbox_dark--gray_light);
+  --theme--ui_interactive-hover: rgba(80, 73, 69, 0.7);
+  --theme--ui_interactive-active: rgba(80, 73, 69, 0.9);
+  --theme--ui_toggle-off: var(--gruvbox_dark--bg4);
+  --theme--ui_toggle-feature: var(--gruvbox_dark--fg);
+  --theme--ui_corner_action: var(--theme--bg_card);
+  --theme--ui_corner_action-hover: var(--theme--ui_interactive-hover);
+  --theme--ui_corner_action-active: var(--theme--ui_interactive-active);
+
+  --theme--icon: var(--gruvbox_dark--fg0);
+  --theme--icon_secondary: var(--gruvbox_dark--fg3);
+
+  --theme--text: var(--gruvbox_dark--fg0);
+  --theme--text_secondary: var(--gruvbox_dark--fg3);
+  --theme--text_gray: var(--gruvbox_dark--gray_dark);
+  --theme--text_brown: var(--gruvbox_dark--bg4);
+  --theme--text_orange: var(--gruvbox_dark--orange_dark);
+  --theme--text_yellow: var(--gruvbox_dark--yellow_dark);
+  --theme--text_green: var(--gruvbox_dark--green_dark);
+  --theme--text_blue: var(--gruvbox_dark--blue_dark);
+  --theme--text_purple: var(--gruvbox_dark--purple_dark);
+  --theme--text_pink: var(--gruvbox_dark--purple_light);
+  --theme--text_red: var(--gruvbox_dark--red_dark);
+
+  --theme--highlight_gray: var(--gruvbox_dark--gray_dark);
+  --theme--highlight_gray-text: var(--gruvbox_dark--bg0);
+  --theme--highlight_brown: var(--theme--tag_brown);
+  --theme--highlight_brown-text: var(--gruvbox_dark--bg0);
+  --theme--highlight_orange: var(--gruvbox_dark--orange_dark);
+  --theme--highlight_orange-text: var(--gruvbox_dark--bg0);
+  --theme--highlight_yellow: var(--gruvbox_dark--yellow_dark);
+  --theme--highlight_yellow-text: var(--gruvbox_dark--bg0);
+  --theme--highlight_green: var(--gruvbox_dark--green_dark);
+  --theme--highlight_green-text: var(--gruvbox_dark--bg0);
+  --theme--highlight_blue: var(--gruvbox_dark--blue_dark);
+  --theme--highlight_blue-text: var(--gruvbox_dark--bg0);
+  --theme--highlight_purple: var(--gruvbox_dark--purple_dark);
+  --theme--highlight_purple-text: var(--gruvbox_dark--bg0);
+  --theme--highlight_pink: var(--theme--tag_pink);
+  --theme--highlight_pink-text: var(--gruvbox_dark--bg0);
+  --theme--highlight_red: var(--gruvbox_dark--red_dark);
+  --theme--highlight_red-text: var(--gruvbox_dark--bg0);
+
+  --theme--callout_gray: var(--theme--highlight_gray);
+  --theme--callout_gray-text: var(--gruvbox_dark--bg0);
+  --theme--callout_brown: var(--theme--highlight_brown);
+  --theme--callout_brown-text: var(--gruvbox_dark--bg0);
+  --theme--callout_orange: var(--theme--highlight_orange);
+  --theme--callout_orange-text: var(--gruvbox_dark--bg0);
+  --theme--callout_yellow: var(--theme--highlight_yellow);
+  --theme--callout_yellow-text: var(--gruvbox_dark--bg0);
+  --theme--callout_green: var(--theme--highlight_green);
+  --theme--callout_green-text: var(--gruvbox_dark--bg0);
+  --theme--callout_blue: var(--theme--highlight_blue);
+  --theme--callout_blue-text: var(--gruvbox_dark--bg0);
+  --theme--callout_purple: var(--theme--highlight_purple);
+  --theme--callout_purple-text: var(--gruvbox_dark--bg0);
+  --theme--callout_pink: var(--theme--highlight_pink);
+  --theme--callout_pink-text: var(--gruvbox_dark--bg0);
+  --theme--callout_red: var(--theme--highlight_red);
+  --theme--callout_red-text: var(--gruvbox_dark--bg0);
+
+  --theme--tag_default: var(--gruvbox_dark--gray_dark);
+  --theme--tag_default-text: var(--gruvbox_dark--bg2);
+  --theme--tag_light_gray: var(--gruvbox_dark--light_gray_dark);
+  --theme--tag_light_gray-text: var(--gruvbox_dark--bg2);
+  --theme--tag_gray: var(--gruvbox_dark--gray_dark);
+  --theme--tag_gray-text: var(--gruvbox_dark--bg2);
+  --theme--tag_brown: var(--gruvbox_dark--fg3);
+  --theme--tag_brown-text: var(--gruvbox_dark--bg2);
+  --theme--tag_orange: var(--gruvbox_dark--orange_dark);
+  --theme--tag_orange-text: var(--gruvbox_dark--bg0);
+  --theme--tag_yellow: var(--gruvbox_dark--yellow_dark);
+  --theme--tag_yellow-text: var(--gruvbox_dark--bg0);
+  --theme--tag_green: var(--gruvbox_dark--green_dark);
+  --theme--tag_green-text: var(--gruvbox_dark--bg0);
+  --theme--tag_blue: var(--gruvbox_dark--blue_dark);
+  --theme--tag_blue-text: var(--gruvbox_dark--bg0);
+  --theme--tag_purple: var(--gruvbox_dark--purple_dark);
+  --theme--tag_purple-text: var(--gruvbox_dark--bg0);
+  --theme--tag_pink: var(--gruvbox_dark--purple_light);
+  --theme--tag_pink-text: var(--gruvbox_dark--bg0);
+  --theme--tag_red: var(--gruvbox_dark--red_dark);
+  --theme--tag_red-text: var(--gruvbox_dark--bg0);
+
+  --theme--board_light_gray: var(--gruvbox_dark--light_gray_dark);
+  --theme--board_light_gray-text: var(--gruvbox_dark--bg0);
+  --theme--board_light_gray-card: var(--theme--tag_light_gray);
+  --theme--board_gray: var(--theme--text_gray);
+  --theme--board_gray-text: var(--gruvbox_dark--bg0);
+  --theme--board_gray-card: var(--theme--tag_gray);
+  --theme--board_brown: var(--theme--text_brown);
+  --theme--board_brown-text: var(--gruvbox_dark--bg0);
+  --theme--board_brown-card: var(--theme--tag_brown);
+  --theme--board_orange: var(--theme--text_orange);
+  --theme--board_orange-text: var(--gruvbox_dark--bg0);
+  --theme--board_orange-card: var(--theme--tag_orange);
+  --theme--board_yellow: var(--theme--text_yellow);
+  --theme--board_yellow-text: var(--gruvbox_dark--bg0);
+  --theme--board_yellow-card: var(--theme--tag_yellow);
+  --theme--board_green: var(--theme--text_green);
+  --theme--board_green-text: var(--gruvbox_dark--bg0);
+  --theme--board_green-card: var(--theme--tag_green);
+  --theme--board_blue: var(--theme--text_blue);
+  --theme--board_blue-text: var(--gruvbox_dark--bg0);
+  --theme--board_blue-card: var(--theme--tag_blue);
+  --theme--board_purple: var(--theme--text_purple);
+  --theme--board_purple-text: var(--gruvbox_dark--bg0);
+  --theme--board_purple-card: var(--theme--tag_purple);
+  --theme--board_pink: var(--theme--text_pink);
+  --theme--board_pink-text: var(--gruvbox_dark--bg0);
+  --theme--board_pink-card: var(--theme--tag_pink);
+  --theme--board_red: var(--theme--text_red);
+  --theme--board_red-text: var(--gruvbox_dark--bg0);
+  --theme--board_red-card: var(--theme--tag_red);
+
+  --theme--code_inline: var(--gruvbox_dark--bg1);
+  --theme--code_inline-text: var(--gruvbox_dark--blue_light);
+
+  --theme--code: var(--gruvbox_dark--bg1);
+  --theme--code_function: var(--theme--text_blue);
+  --theme--code_keyword: var(--theme--text_pink);
+  --theme--code_tag: var(--theme--text_pink);
+  --theme--code_operator: var(--theme--text_yellow);
+  --theme--code_important: var(--theme--text_yellow);
+  --theme--code_property: var(--theme--text_pink);
+  --theme--code_builtin: var(--theme--text_yellow);
+  --theme--code_attr-name: var(--theme--text_yellow);
+  --theme--code_comment: var(--theme--text_ui);
+  --theme--code_punctuation: var(--gruvbox_dark--aqua_light);
+  --theme--code_doctype: var(--gruvbox_dark--aqua_light);
+  --theme--code_number: var(--theme--text_purple);
+  --theme--code_string: var(--theme--text_orange);
+  --theme--code_attr-value: var(--theme--text_orange);
+}
diff --git a/src/mods/gruvbox-light/gruvbox-light.png b/src/mods/gruvbox-light/gruvbox-light.png
new file mode 100644
index 0000000..f9a02c4
Binary files /dev/null and b/src/mods/gruvbox-light/gruvbox-light.png differ
diff --git a/src/mods/gruvbox-light/mod.json b/src/mods/gruvbox-light/mod.json
new file mode 100644
index 0000000..272b2ec
--- /dev/null
+++ b/src/mods/gruvbox-light/mod.json
@@ -0,0 +1,29 @@
+{
+  "name": "gruvbox light",
+  "id": "54f01911-60fc-4c9d-85b5-5c5ca3dd6b81",
+  "version": "0.3.0",
+  "description": "a sepia, 'retro groove' palette based on the vim theme of the same name.",
+  "preview": "gruvbox-light.png",
+  "tags": ["theme", "light"],
+  "authors": [
+    {
+      "name": "morhetz",
+      "email": "morhetz@gmail.com",
+      "homepage": "https://github.com/morhetz",
+      "avatar": "https://avatars.githubusercontent.com/u/554231"
+    },
+    {
+      "name": "jordanrobinson",
+      "email": "me@jordanrobinson.co.uk",
+      "homepage": "https://jordanrobinson.co.uk/",
+      "avatar": "https://avatars.githubusercontent.com/u/1202911"
+    }
+  ],
+  "css": {
+    "frame": ["variables.css"],
+    "client": ["variables.css"],
+    "menu": ["variables.css"]
+  },
+  "js": {},
+  "options": []
+}
diff --git a/src/mods/gruvbox-light/variables.css b/src/mods/gruvbox-light/variables.css
new file mode 100644
index 0000000..9b3722f
--- /dev/null
+++ b/src/mods/gruvbox-light/variables.css
@@ -0,0 +1,196 @@
+/**
+ * notion-enhancer: gruvbox light
+ * (c) 2015-2020 morhetz <morhetz@gmail.com>
+ * (c) 2021 jordanrobinson <me@jordanrobinson.co.uk> (https://jordanrobinson.co.uk/)
+ * (c) 2021 dragonwocky <thedragonring.bod@gmail.com> (https://dragonwocky.me/)
+ * (https://notion-enhancer.github.io/) under the MIT license
+ */
+
+:root.light {
+  /*
+   * variables are named for consistency with gruvbox dark,
+   * but the _light variants are actually darker here
+   */
+  --gruvbox_light--bg: #fbf1c7;
+  --gruvbox_light--light_gray_dark: #B3A89E;
+  --gruvbox_light--gray_dark: #928374;
+  --gruvbox_light--red_dark: #cc241d;
+  --gruvbox_light--red_light: #9d0006;
+  --gruvbox_light--green_dark: #98971a;
+  --gruvbox_light--green_light: #79740e;
+  --gruvbox_light--yellow_dark: #d79921;
+  --gruvbox_light--yellow_light: #b57614;
+  --gruvbox_light--blue_dark: #458588;
+  --gruvbox_light--blue_light: #076678;
+  --gruvbox_light--purple_dark: #b16286;
+  --gruvbox_light--purple_light: #b16286;
+  --gruvbox_light--aqua_dark: #689d6a;
+  --gruvbox_light--aqua_light: #427b58;
+  --gruvbox_light--gray_light: #7c6f64;
+  --gruvbox_light--orange_dark: #d65d0e;
+  --gruvbox_light--orange_light: #af3a03;
+  --gruvbox_light--fg: #3c3836;
+  --gruvbox_light--bg0_h: #f9f5d7;
+  --gruvbox_light--bg0: #fbf1c7;
+  --gruvbox_light--bg1: #ebdbb2;
+  --gruvbox_light--bg2: #d5c4a1;
+  --gruvbox_light--bg3: #bdae93;
+  --gruvbox_light--bg4: #a89984;
+  --gruvbox_light--bg0_s: #f2e5bc;
+  --gruvbox_light--fg4: #7c6f64;
+  --gruvbox_light--fg3: #665c54;
+  --gruvbox_light--fg2: #504945;
+  --gruvbox_light--fg1: #3c3836;
+  --gruvbox_light--fg0: #282828;
+
+  --theme--accent_blue: var(--gruvbox_light--bg3);
+  --theme--accent_blue-selection: rgba(189, 175, 147, 0.5);
+  --theme--accent_blue-hover: var(--gruvbox_light--fg3);
+  --theme--accent_blue-active: var(--gruvbox_light--fg3);
+  --theme--accent_red: var(--gruvbox_light--blue_light);
+  --theme--accent_red-button: var(--gruvbox_light--blue_dark);
+
+  --theme--bg: var(--gruvbox_light--bg0);
+  --theme--bg_secondary: var(--gruvbox_light--bg1);
+  --theme--bg_card: var(--gruvbox_light--bg2);
+
+  --theme--scrollbar_track: transparent;
+  --theme--scrollbar_thumb: var(--gruvbox_light--bg0_s);
+  --theme--scrollbar_thumb-hover: var(--gruvbox_light--bg3);
+
+  --theme--ui_divider: var(--gruvbox_light--gray_light);
+  --theme--ui_interactive-hover: rgba(124, 111, 100, 0.3);
+  --theme--ui_interactive-active: rgba(124, 111, 100, 0.4);
+  --theme--ui_input: var(--gruvbox_light--bg3);
+  --theme--ui_toggle-off: var(--gruvbox_light--bg4);
+  --theme--ui_toggle-feature: var(--gruvbox_light--bg);
+  --theme--ui_corner_action: var(--theme--bg_card);
+  --theme--ui_corner_action-hover: var(--theme--ui_interactive-hover);
+  --theme--ui_corner_action-active: var(--theme--ui_interactive-active);
+
+  --theme--icon: var(--gruvbox_light--fg0);
+  --theme--icon_secondary: var(--gruvbox_light--fg3);
+
+  --theme--text: var(--gruvbox_light--fg0);
+  --theme--text_secondary: var(--gruvbox_light--fg3);
+  --theme--text_gray: var(--gruvbox_light--gray_dark);
+  --theme--text_brown: var(--gruvbox_light--bg4);
+  --theme--text_orange: var(--gruvbox_light--orange_dark);
+  --theme--text_yellow: var(--gruvbox_light--yellow_dark);
+  --theme--text_green: var(--gruvbox_light--green_dark);
+  --theme--text_blue: var(--gruvbox_light--blue_dark);
+  --theme--text_purple: var(--gruvbox_light--purple_dark);
+  --theme--text_pink: var(--gruvbox_light--purple_light);
+  --theme--text_red: var(--gruvbox_light--red_dark);
+
+  --theme--highlight_gray: var(--gruvbox_light--gray_dark);
+  --theme--highlight_gray-text: var(--gruvbox_light--bg0);
+  --theme--highlight_brown: var(--theme--tag_brown);
+  --theme--highlight_brown-text: var(--gruvbox_light--bg0);
+  --theme--highlight_orange: var(--gruvbox_light--orange_dark);
+  --theme--highlight_orange-text: var(--gruvbox_light--bg0);
+  --theme--highlight_yellow: var(--gruvbox_light--yellow_dark);
+  --theme--highlight_yellow-text: var(--gruvbox_light--bg0);
+  --theme--highlight_green: var(--gruvbox_light--green_dark);
+  --theme--highlight_green-text: var(--gruvbox_light--bg0);
+  --theme--highlight_blue: var(--gruvbox_light--blue_dark);
+  --theme--highlight_blue-text: var(--gruvbox_light--bg0);
+  --theme--highlight_purple: var(--gruvbox_light--purple_dark);
+  --theme--highlight_purple-text: var(--gruvbox_light--bg0);
+  --theme--highlight_pink: var(--theme--tag_pink);
+  --theme--highlight_pink-text: var(--gruvbox_light--bg0);
+  --theme--highlight_red: var(--gruvbox_light--red_dark);
+  --theme--highlight_red-text: var(--gruvbox_light--bg0);
+
+  --theme--callout_gray: var(--theme--highlight_gray);
+  --theme--callout_gray-text: var(--gruvbox_light--bg0);
+  --theme--callout_brown: var(--theme--highlight_brown);
+  --theme--callout_brown-text: var(--gruvbox_light--bg0);
+  --theme--callout_orange: var(--theme--highlight_orange);
+  --theme--callout_orange-text: var(--gruvbox_light--bg0);
+  --theme--callout_yellow: var(--theme--highlight_yellow);
+  --theme--callout_yellow-text: var(--gruvbox_light--bg0);
+  --theme--callout_green: var(--theme--highlight_green);
+  --theme--callout_green-text: var(--gruvbox_light--bg0);
+  --theme--callout_blue: var(--theme--highlight_blue);
+  --theme--callout_blue-text: var(--gruvbox_light--bg0);
+  --theme--callout_purple: var(--theme--highlight_purple);
+  --theme--callout_purple-text: var(--gruvbox_light--bg0);
+  --theme--callout_pink: var(--theme--highlight_pink);
+  --theme--callout_pink-text: var(--gruvbox_light--bg0);
+  --theme--callout_red: var(--theme--highlight_red);
+  --theme--callout_red-text: var(--gruvbox_light--bg0);
+
+  --theme--tag_default: var(--gruvbox_light--gray_dark);
+  --theme--tag_default-text: var(--gruvbox_light--bg2);
+  --theme--tag_light_gray: var(--gruvbox_light--light_gray_dark);
+  --theme--tag_light_gray-text: var(--gruvbox_light--bg0);
+  --theme--tag_gray: var(--gruvbox_light--gray_dark);
+  --theme--tag_gray-text: var(--gruvbox_light--bg2);
+  --theme--tag_brown: var(--gruvbox_light--fg3);
+  --theme--tag_brown-text: var(--gruvbox_light--bg2);
+  --theme--tag_orange: var(--gruvbox_light--orange_dark);
+  --theme--tag_orange-text: var(--gruvbox_light--bg0);
+  --theme--tag_yellow: var(--gruvbox_light--yellow_dark);
+  --theme--tag_yellow-text: var(--gruvbox_light--bg0);
+  --theme--tag_green: var(--gruvbox_light--green_dark);
+  --theme--tag_green-text: var(--gruvbox_light--bg0);
+  --theme--tag_blue: var(--gruvbox_light--blue_dark);
+  --theme--tag_blue-text: var(--gruvbox_light--bg0);
+  --theme--tag_purple: var(--gruvbox_light--purple_dark);
+  --theme--tag_purple-text: var(--gruvbox_light--bg0);
+  --theme--tag_pink: var(--gruvbox_light--purple_light);
+  --theme--tag_pink-text: var(--gruvbox_light--bg0);
+  --theme--tag_red: var(--gruvbox_light--red_dark);
+  --theme--tag_red-text: var(--gruvbox_light--bg0);
+
+  --theme--board_light_gray: var(--gruvbox_light--light_gray_dark);
+  --theme--board_light_gray-text: var(--gruvbox_light--bg0_h);
+  --theme--board_light_gray-card: var(--theme--tag_light_gray);
+  --theme--board_gray: var(--theme--text_gray);
+  --theme--board_gray-text: var(--gruvbox_light--bg0);
+  --theme--board_gray-card: var(--theme--tag_gray);
+  --theme--board_brown: var(--theme--text_brown);
+  --theme--board_brown-text: var(--gruvbox_light--bg0);
+  --theme--board_brown-card: var(--theme--tag_brown);
+  --theme--board_orange: var(--theme--text_orange);
+  --theme--board_orange-text: var(--gruvbox_light--bg0);
+  --theme--board_orange-card: var(--theme--tag_orange);
+  --theme--board_yellow: var(--theme--text_yellow);
+  --theme--board_yellow-text: var(--gruvbox_light--bg0);
+  --theme--board_yellow-card: var(--theme--tag_yellow);
+  --theme--board_green: var(--theme--text_green);
+  --theme--board_green-text: var(--gruvbox_light--bg0);
+  --theme--board_green-card: var(--theme--tag_green);
+  --theme--board_blue: var(--theme--text_blue);
+  --theme--board_blue-text: var(--gruvbox_light--bg0);
+  --theme--board_blue-card: var(--theme--tag_blue);
+  --theme--board_purple: var(--theme--text_purple);
+  --theme--board_purple-text: var(--gruvbox_light--bg0);
+  --theme--board_purple-card: var(--theme--tag_purple);
+  --theme--board_pink: var(--theme--text_pink);
+  --theme--board_pink-text: var(--gruvbox_light--bg0);
+  --theme--board_pink-card: var(--theme--tag_pink);
+  --theme--board_red: var(--theme--text_red);
+  --theme--board_red-text: var(--gruvbox_light--bg0);
+  --theme--board_red-card: var(--theme--tag_red);
+
+  --theme--code_inline: var(--gruvbox_light--bg1);
+  --theme--code_inline-text: var(--gruvbox_light--blue_light);
+
+  --theme--code: var(--gruvbox_light--bg1);
+  --theme--code_function: var(--theme--text_blue);
+  --theme--code_keyword: var(--theme--text_pink);
+  --theme--code_tag: var(--theme--text_pink);
+  --theme--code_operator: var(--theme--text_yellow);
+  --theme--code_important: var(--theme--text_yellow);
+  --theme--code_property: var(--theme--text_pink);
+  --theme--code_builtin: var(--theme--text_yellow);
+  --theme--code_attr-name: var(--theme--text_yellow);
+  --theme--code_comment: var(--theme--text_ui);
+  --theme--code_punctuation: var(--gruvbox_light--aqua_light);
+  --theme--code_doctype: var(--gruvbox_light--aqua_light);
+  --theme--code_number: var(--theme--text_purple);
+  --theme--code_string: var(--theme--text_orange);
+  --theme--code_attr-value: var(--theme--text_orange);
+}
diff --git a/src/mods/icon-sets/client.css b/src/mods/icon-sets/client.css
new file mode 100644
index 0000000..0259d1e
--- /dev/null
+++ b/src/mods/icon-sets/client.css
@@ -0,0 +1,236 @@
+/**
+ * notion-enhancer: icon sets
+ * (c) 2019 jayhxmo (https://jaymo.io/)
+ * (c) 2020 CloudHill <rl.cloudhill@gmail.com> (https://github.com/CloudHill)
+ * (c) 2021 dragonwocky <thedragonring.bod@gmail.com> (https://dragonwocky.me/)
+ * (https://notion-enhancer.github.io/) under the MIT license
+ */
+
+.icon_sets--tab_button {
+  position: relative;
+  padding-top: 6px;
+  padding-bottom: 6px;
+  flex-shrink: 0;
+}
+.icon_sets--tab_button > .notion-focusable {
+  user-select: none;
+  transition: background 20ms ease-in 0s;
+  cursor: pointer;
+  display: inline-flex;
+  align-items: center;
+  height: 28px;
+  border-radius: 3px;
+  font-size: 14px;
+  line-height: 1.2;
+  padding-left: 8px;
+  padding-right: 8px;
+  color: var(--theme--text);
+}
+.icon_sets--tab_button:hover > .notion-focusable {
+  background: var(--theme--ui_interactive-hover);
+}
+.icon_sets--tab_button:active > .notion-focusable {
+  background: var(--theme--ui_interactive-active);
+}
+
+.icon_sets--view {
+  padding: 0;
+  overflow: hidden;
+  display: flex;
+  flex-direction: column;
+  flex-grow: 1;
+  z-index: 1;
+}
+.icon_sets--actions {
+  display: flex;
+  padding: 10px 14px;
+}
+
+.icon_sets--actions > .notion-focusable-within {
+  flex-grow: 1;
+}
+.icon_sets--link_input {
+  flex-grow: 1;
+  font-size: 14px;
+  line-height: 20px;
+  padding: 4px 6px;
+  border-top-left-radius: 3px;
+  border-bottom-left-radius: 3px;
+  box-shadow: var(--theme--ui_shadow) 0px 0px 0px 1px inset;
+  background: var(--theme--ui_input);
+  cursor: text;
+  height: 28px;
+}
+.icon_sets--link_input > input {
+  font-size: inherit;
+  line-height: inherit;
+  border: none;
+  background: none;
+  width: 100%;
+  display: block;
+  resize: none;
+  padding: 0px;
+}
+
+.icon_sets--link_submit {
+  border-top-left-radius: 0;
+  border-bottom-left-radius: 0;
+  border-top-right-radius: 3px;
+  border-bottom-right-radius: 3px;
+}
+
+.icon_sets--upload,
+.icon_sets--link_submit {
+  user-select: none;
+  transition: background 20ms ease-in 0s;
+  cursor: pointer;
+  border: none;
+  background: var(--theme--accent_blue);
+  color: var(--theme--accent_blue-text);
+  line-height: 1.2;
+  padding: 6px 8px;
+  height: 28px;
+  font-size: 14px;
+  font-weight: 500;
+}
+.icon_sets--upload:hover,
+.icon_sets--link_submit:hover {
+  background: var(--theme--accent_blue-hover);
+}
+.icon_sets--upload:active,
+.icon_sets--link_submit:active {
+  background: var(--theme--accent_blue-active);
+}
+
+.icon_sets--upload {
+  margin-left: 0.5em;
+  border-radius: 3px;
+}
+
+.icon_sets--list {
+  /* scroller */
+  height: 100%;
+  word-break: break-all;
+  overflow: hidden auto;
+  padding: 0 14px 10px 14px;
+}
+
+.icon_sets--error {
+  color: var(--theme--accent_red);
+}
+.icon_sets--title,
+.icon_sets--error {
+  margin: 6px 0 8px 0;
+  font-size: 11px;
+  font-weight: 500;
+  line-height: 1.2;
+  user-select: none;
+  text-transform: uppercase;
+  border-radius: 2px;
+  padding: 0.25em;
+  display: flex;
+  align-items: center;
+}
+
+.icon_sets--title {
+  cursor: pointer;
+  color: var(--theme--text_secondary);
+}
+.icon_sets--title:hover {
+  background: var(--theme--ui_interactive-hover);
+}
+.icon_sets--title:active {
+  background: var(--theme--ui_interactive-active);
+}
+
+.icon_sets--title .info {
+  /* tooltips */
+  height: 1em;
+  margin-left: 0.5em;
+}
+
+.icon_sets--spinner {
+  margin-left: 0.5em;
+  height: 1em;
+  width: 1em;
+}
+.icon_sets--spinner img {
+  width: 100%;
+  height: 100%;
+  animation: rotation 1.3s infinite linear;
+}
+@keyframes rotation {
+  from {
+    transform: rotate(0deg);
+  }
+  to {
+    transform: rotate(359deg);
+  }
+}
+
+.icon_sets--title a {
+  color: currentColor;
+  transition: color 100ms ease-in;
+}
+.icon_sets--title a:hover {
+  color: var(--theme--accent_blue);
+}
+
+.icon_sets--title .triangle {
+  height: 1em;
+  width: 0.9em;
+  margin: 0 0.5em 0 0.25em;
+  transition: transform 200ms ease-out 0s;
+  transform: rotateZ(180deg);
+}
+.icon_sets--title[data-collapsed='true'] .triangle {
+  transform: rotateZ(90deg);
+}
+.icon_sets--title[data-collapsed='true'] + .icon_sets--set {
+  height: 0 !important;
+}
+
+.icon_sets--set {
+  display: flex;
+  flex-wrap: wrap;
+  overflow: hidden;
+  transition: height 200ms ease-out 0s;
+}
+.icon_sets--icon {
+  user-select: none;
+  transition: background 20ms ease-in 0s;
+  cursor: pointer;
+  display: flex;
+  align-items: center;
+  justify-content: center;
+  border-radius: 3px;
+  width: 32px;
+  height: 32px;
+  font-size: 24px;
+}
+.icon_sets--icon:hover {
+  background: var(--theme--ui_interactive-hover);
+}
+.icon_sets--icon:active {
+  background: var(--theme--ui_interactive-active);
+}
+.icon_sets--icon > img {
+  max-width: 24px;
+  max-height: 24px;
+}
+.icon_sets--sprite {
+  width: 24px;
+  height: 24px;
+  background-size: 24px;
+  background-repeat: no-repeat;
+  pointer-events: none;
+}
+
+.icon_sets--divider {
+  height: 1px;
+  margin: 1em 0;
+  border-bottom: 1px solid var(--theme--ui_divider);
+}
+.icon_sets--title[data-collapsed='true'] + .icon_sets--set + .icon_sets--divider {
+  margin-top: 0.5em;
+}
diff --git a/src/mods/icon-sets/client.mjs b/src/mods/icon-sets/client.mjs
new file mode 100644
index 0000000..df6e491
--- /dev/null
+++ b/src/mods/icon-sets/client.mjs
@@ -0,0 +1,313 @@
+/**
+ * notion-enhancer: icon sets
+ * (c) 2019 jayhxmo (https://jaymo.io/)
+ * (c) 2020 CloudHill <rl.cloudhill@gmail.com> (https://github.com/CloudHill)
+ * (c) 2021 dragonwocky <thedragonring.bod@gmail.com> (https://dragonwocky.me/)
+ * (https://notion-enhancer.github.io/) under the MIT license
+ */
+
+const getImgData = (url) =>
+  new Promise(async (res, rej) => {
+    const blob = await fetch(url).then((res) => res.blob()),
+      reader = new FileReader();
+    reader.onload = (e) => res(e.target.result);
+    reader.readAsDataURL(blob);
+  });
+
+export default async function ({ web, fs, components, notion }, db) {
+  const recentUploads = await db.get(['recent_uploads'], []),
+    preventQualityReduction = await db.get(['prevent_quality_reduction']),
+    $triangleSvg = web.html`<svg viewBox="0 0 100 100" class="triangle">
+      <polygon points="5.9,88.2 50,11.8 94.1,88.2" />
+    </svg>`;
+
+  const customIconSets = [],
+    customIconsFile = await db.get(['json']);
+  if (customIconsFile?.content) {
+    const iconsData = JSON.parse(customIconsFile.content);
+    customIconSets.push(...(iconsData.icons || iconsData));
+  }
+
+  const enhancerIconSets = [],
+    enhancerIconsUrl = 'https://raw.githubusercontent.com/notion-enhancer/icons/main/';
+  if (await db.get(['default_sets'])) {
+    const iconsData = await fs.getJSON(`${enhancerIconsUrl}/icons.json`);
+    enhancerIconSets.push(...(iconsData.icons || iconsData));
+  }
+
+  const mediaMenuSelector = '.notion-media-menu',
+    mediaScrollerSelector = '.notion-media-menu > .notion-scroller',
+    mediaFilterSelector = '.notion-media-menu > :first-child > :last-child',
+    mediaLinkInputSelector = '.notion-focusable-within > input[type=url]',
+    tabBtnSelector = (n) =>
+      `.notion-media-menu > :first-child > :first-child > :nth-child(${n})`;
+
+  const renderSetTitle = async (title, loadPromises = [], $tooltip = undefined) => {
+    const isCollapsed = await db.get(['collapsed', title], false),
+      $title = web.html`<p class="icon_sets--title"
+            ${isCollapsed ? 'data-collapsed="true"' : ''}></p>`,
+      $spinner = web.html`<span class="icon_sets--spinner">
+        <img src="/images/loading-spinner.4dc19970.svg" />
+      </span>`;
+    web.render(
+      $title,
+      $triangleSvg.cloneNode(true),
+      web.html`<span>${title}</span>`,
+      $spinner
+    );
+    $title.addEventListener('click', () => {
+      const newState = $title.dataset.collapsed !== 'true';
+      db.set(['collapsed', title], newState);
+      $title.dataset.collapsed = newState;
+    });
+    // hide spinner after all icons finish loading
+    // doesn't need to be waited on by renderers
+    (async () => {
+      await Promise.all(loadPromises);
+      $spinner.remove();
+      if ($tooltip) {
+        const $infoSvg = web.html`${await components.feather('info', { class: 'info' })}`;
+        components.addTooltip($infoSvg, $tooltip, { offsetDirection: 'right' });
+        web.render($title, $infoSvg);
+      }
+    })();
+    return $title;
+  };
+
+  const $iconsTab = web.html`<div class="icon_sets--tab_button">
+      <div class="notion-focusable" role="button" tabindex="0">Icons</div>
+    </div>`,
+    // actions
+    $iconsLinkInput = web.html`<div class="icon_sets--link_input">
+      <input placeholder="Paste an image link…" type="url">
+    </div>`,
+    $iconsLinkSubmit = web.html`<button class="icon_sets--link_submit">Submit</button>`,
+    $iconsUploadFile = web.html`<input type="file" accept="image/*" style="display:none">`,
+    $iconsUploadSubmit = web.render(
+      web.html`<button class="icon_sets--upload"></button>`,
+      'Upload an image',
+      $iconsUploadFile
+    ),
+    // sets
+    $setsList = web.html`<div class="icon_sets--list"></div>`,
+    // container
+    $iconsView = web.render(
+      web.html`<div class="icon_sets--view" style="display:none"></div>`,
+      web.render(
+        web.html`<div class="icon_sets--actions"></div>`,
+        web.render(
+          web.html`<div class="notion-focusable-within" style="display:flex;border-radius:3px;"></div>`,
+          $iconsLinkInput,
+          $iconsLinkSubmit
+        ),
+        $iconsUploadSubmit
+      ),
+      web.render($setsList)
+    );
+
+  let $mediaMenu, $activeTabUnderline;
+  const insertIconsTab = async () => {
+    if (document.contains($mediaMenu)) return;
+
+    // prevent injection into file upload menus
+    $mediaMenu = document.querySelector(mediaMenuSelector);
+    if (!$mediaMenu || !$mediaMenu.textContent.includes('Emoji')) return;
+
+    const $emojiTab = document.querySelector(tabBtnSelector(1)),
+      $emojiScroller = document.querySelector(mediaScrollerSelector),
+      $emojiFilter = document.querySelector(mediaFilterSelector),
+      $uploadTab = document.querySelector(tabBtnSelector(2)),
+      $linkTab = document.querySelector(tabBtnSelector(3));
+    $uploadTab.style.display = 'none';
+    $linkTab.style.display = 'none';
+    if ($activeTabUnderline) $activeTabUnderline.remove();
+    $activeTabUnderline =
+      $emojiTab.children[1] || $uploadTab.children[1] || $linkTab.children[1];
+    $emojiTab.after($iconsTab);
+    $emojiScroller.after($iconsView);
+
+    const renderRecentUploads = async () => {
+        const $recentUploads = web.html`<div class="icon_sets--set"></div>`,
+          loadPromises = [];
+        for (let i = recentUploads.length - 1; i >= 0; i--) {
+          const { signed, url } = recentUploads[i],
+            $icon = web.html`<span class="icon_sets--icon">
+              <img src="${web.escape(signed)}">
+            </span>`;
+          web.render($recentUploads, $icon);
+          $icon.addEventListener('click', (event) => {
+            if (event.shiftKey) {
+              recentUploads.splice(i, 1);
+              db.set(['recent_uploads'], recentUploads);
+              $icon.remove();
+            } else setIcon({ signed, url });
+          });
+          loadPromises.push(
+            new Promise((res, rej) => {
+              $icon.firstElementChild.onload = res;
+              $icon.firstElementChild.onerror = res;
+            })
+          );
+        }
+
+        const $recentUploadsTitle = await renderSetTitle(
+          'Recent',
+          loadPromises,
+          web.html`<p><b>Click</b> to reuse an icon <br><b>Shift-click</b> to remove it</p>`
+        );
+        web.render($setsList, $recentUploadsTitle, $recentUploads);
+      },
+      renderIconSet = async (iconData, enhancerSet = false) => {
+        try {
+          const $set = web.html`<div class="icon_sets--set"></div>`;
+          if (iconData.sourceUrl?.endsWith?.('/')) {
+            iconData.sourceUrl = iconData.sourceUrl.slice(0, -1);
+          }
+
+          const loadPromises = [];
+          for (let i = 0; i < (iconData.count || iconData.source.length); i++) {
+            const iconUrl = iconData.sourceUrl
+                ? Array.isArray(iconData.source)
+                  ? `${iconData.sourceUrl}/${iconData.source[i]}.${iconData.extension}`
+                  : `${iconData.sourceUrl}/${iconData.source}_${i}.${iconData.extension}`
+                : iconData.source[i],
+              sprite = enhancerSet
+                ? `style="
+                    background-image: url(${enhancerIconsUrl}${iconData.source}/sprite.png);
+                    background-position: 0 -${i * 24}px;
+                  "`
+                : '',
+              $img = sprite
+                ? web.html`<div class="icon_sets--sprite" ${sprite}></div>`
+                : web.html`<img src="${web.escape(iconUrl)}">`,
+              $icon = web.render(web.html`<span class="icon_sets--icon"></span>`, $img);
+            web.render($set, $icon);
+            $icon.addEventListener('click', (event) => {
+              if (!event.shiftKey) setIcon({ signed: iconUrl, url: iconUrl });
+            });
+            if (!sprite) {
+              loadPromises.push(
+                new Promise((res, rej) => {
+                  $img.onload = res;
+                  $img.onerror = res;
+                })
+              );
+            }
+          }
+
+          const author = iconData.author
+              ? iconData.authorUrl
+                ? web.raw`by <a target="_blank" href="${web.escape(iconData.authorUrl)}">
+                  ${iconData.author}
+                </a>`
+                : web.raw`by ${web.escape(iconData.author)}`
+              : '',
+            $title = await renderSetTitle(
+              `${web.escape(iconData.name)} ${author}`,
+              loadPromises
+            );
+          web.render($setsList, $title, $set);
+        } catch (err) {
+          console.error(err);
+          web.render(
+            $setsList,
+            web.html`<div class="icon_sets--error">
+              Invalid set: ${web.escape(iconData?.name || 'Unknown')}
+            </div>`
+          );
+        }
+      },
+      renderCustomIconSets = async () => {
+        if (customIconSets.length) {
+          web.render($setsList, web.html`<div class="icon_sets--divider"></div>`);
+        }
+        await Promise.all(customIconSets.map((set) => renderIconSet(set)));
+      },
+      renderEnhancerIconSets = async () => {
+        if (enhancerIconSets.length) {
+          web.render($setsList, web.html`<div class="icon_sets--divider"></div>`);
+        }
+        await Promise.all(
+          enhancerIconSets.map((set) => {
+            set.sourceUrl = set.sourceUrl || enhancerIconsUrl + set.source;
+            return renderIconSet(set, true);
+          })
+        );
+      };
+
+    const displayIconsTab = async (force = false) => {
+        if ($iconsTab.contains($activeTabUnderline) && !force) return;
+        web.render($iconsTab, $activeTabUnderline);
+        $iconsView.style.display = '';
+        $emojiScroller.style.display = 'none';
+        $emojiFilter.style.display = 'none';
+        web.empty($setsList);
+        await renderRecentUploads();
+        await renderCustomIconSets();
+        await renderEnhancerIconSets();
+        $iconsView.querySelectorAll('.icon_sets--set').forEach(($set) => {
+          $set.style.height = `${$set.scrollHeight}px`;
+        });
+      },
+      displayEmojiTab = (force = false) => {
+        if ($emojiTab.contains($activeTabUnderline) && !force) return;
+        web.render($emojiTab, $activeTabUnderline);
+        $iconsView.style.display = 'none';
+        $emojiScroller.style.display = '';
+        $emojiFilter.style.display = '';
+      };
+    // use onclick instead of eventlistener to override prev
+    $iconsTab.onclick = displayIconsTab;
+    $emojiTab.onclick = displayEmojiTab;
+    // otherwise both may be visible on reopen
+    displayEmojiTab(true);
+
+    async function setIcon({ signed, url }) {
+      // without this react gets upset
+      displayEmojiTab();
+      $linkTab.firstChild.click();
+      await new Promise(requestAnimationFrame);
+
+      $mediaMenu.parentElement.style.opacity = '0';
+      const iconUrl = preventQualityReduction ? await getImgData(signed) : url;
+
+      // call native setter, imitate human input
+      const $notionLinkInput = $mediaMenu.querySelector(mediaLinkInputSelector),
+        proto = Object.getOwnPropertyDescriptor(window.HTMLInputElement.prototype, 'value');
+      proto.set.call($notionLinkInput, iconUrl);
+      const inputEvent = new Event('input', { bubbles: true }),
+        enterKeydownEvent = new KeyboardEvent('keydown', {
+          bubbles: true,
+          cancelable: true,
+          keyCode: 13,
+        });
+      $notionLinkInput.dispatchEvent(inputEvent);
+      $notionLinkInput.dispatchEvent(enterKeydownEvent);
+    }
+
+    const submitLinkIcon = () => {
+      const url = $iconsLinkInput.firstElementChild.value;
+      if (!url) return;
+      const icon = { signed: notion.sign(url, notion.getPageID()), url: url };
+      setIcon(icon);
+      recentUploads.push(icon);
+      db.set(['recent_uploads'], recentUploads);
+    };
+    $iconsLinkInput.onkeyup = (event) => {
+      if (event.code === 13) submitLinkIcon();
+    };
+    $iconsLinkSubmit.onclick = submitLinkIcon;
+
+    // upload file to aws, then submit link
+    $iconsUploadSubmit.onclick = () => $iconsUploadFile.click();
+    $iconsUploadFile.onchange = async (event) => {
+      const file = event.target.files[0],
+        url = await notion.upload(file),
+        icon = { signed: notion.sign(url, notion.getPageID()), url: url };
+      setIcon(icon);
+      recentUploads.push(icon);
+      db.set(['recent_uploads'], recentUploads);
+    };
+  };
+  web.addDocumentObserver(insertIconsTab, [mediaMenuSelector]);
+}
diff --git a/src/mods/icon-sets/icon-sets.jpg b/src/mods/icon-sets/icon-sets.jpg
new file mode 100644
index 0000000..f44e245
Binary files /dev/null and b/src/mods/icon-sets/icon-sets.jpg differ
diff --git a/src/mods/icon-sets/mod.json b/src/mods/icon-sets/mod.json
new file mode 100644
index 0000000..72c616b
--- /dev/null
+++ b/src/mods/icon-sets/mod.json
@@ -0,0 +1,43 @@
+{
+  "name": "icon sets",
+  "id": "2d1f4809-9581-40dd-9bf3-4239db406483",
+  "version": "0.4.0",
+  "description": "upload, save and reuse custom icons directly from the icon picker. check out the [icons page](https://notion-enhancer.github.io/advanced/icons) for instructions on loading entire sets.",
+  "preview": "icon-sets.jpg",
+  "tags": ["integration", "customisation"],
+  "authors": [
+    {
+      "name": "dragonwocky",
+      "email": "thedragonring.bod@gmail.com",
+      "homepage": "https://dragonwocky.me/",
+      "avatar": "https://dragonwocky.me/avatar.jpg"
+    }
+  ],
+  "js": {
+    "client": ["client.mjs"]
+  },
+  "css": {
+    "client": ["client.css"]
+  },
+  "options": [
+    {
+      "type": "toggle",
+      "key": "default_sets",
+      "label": "load default icon sets from github",
+      "value": true
+    },
+    {
+      "type": "toggle",
+      "key": "prevent_quality_reduction",
+      "label": "prevent icon quality reduction",
+      "tooltip": "**this may break icons in widgets or be rejected by notion if images are too high quality** - encodes and submits images as data urls to prevent notion from optimising them (reduces image quality by ~20%)",
+      "value": true
+    },
+    {
+      "type": "file",
+      "key": "json",
+      "label": "custom icon sets (.json)",
+      "extensions": [".json"]
+    }
+  ]
+}
diff --git a/src/mods/indentation-lines/client.css b/src/mods/indentation-lines/client.css
new file mode 100644
index 0000000..bcb867a
--- /dev/null
+++ b/src/mods/indentation-lines/client.css
@@ -0,0 +1,101 @@
+/**
+ * notion-enhancer: indentation lines
+ * (c) 2020 Alexa Baldon <alnbaldon@gmail.com> (https://github.com/runargs)
+ * (c) 2021 dragonwocky <thedragonring.bod@gmail.com> (https://dragonwocky.me/)
+ * (https://notion-enhancer.github.io/) under the MIT license
+ */
+
+.notion-page-content .notion-bulleted_list-block > div > div:last-child,
+.notion-page-content .notion-numbered_list-block > div > div:last-child,
+.notion-page-content .notion-to_do-block > div > div:last-child,
+.notion-page-content .notion-toggle-block > div > div:last-child,
+.notion-page-content [class$='header-block'] > div > div > div:last-child,
+.notion-page-content .notion-table_of_contents-block > div > div > a > div > div {
+  position: relative;
+}
+
+.notion-page-content .notion-bulleted_list-block > div > div:last-child::before,
+.notion-page-content .notion-numbered_list-block > div > div:last-child::before,
+.notion-page-content .notion-to_do-block > div > div:last-child::before,
+.notion-page-content .notion-toggle-block > div > div:last-child::before,
+.notion-page-content [class$='header-block'] > div > div > div:last-child::before,
+.notion-page-content .pseudoSelection > div > div:last-child::before {
+  content: '';
+  position: absolute;
+  height: calc(100% - 2em);
+  top: 2em;
+  margin-inline-start: -14.48px;
+}
+.notion-page-content [class$='header-block'] > div > div > div:last-child::before {
+  margin-inline-start: -15.48px;
+}
+
+.notion-page-content
+  .notion-table_of_contents-block
+  > div
+  > div
+  > a
+  > div
+  > div:not([style*='margin-left: 0px'])
+  > div::before {
+  content: '';
+  position: absolute;
+  height: 100%;
+  top: 0;
+  margin-inline-start: -14.48px;
+}
+
+/* add background to block dragger */
+.notion-frame
+  > [style*='position: absolute; top: 0px; left: 0px;']
+  [style*='position: absolute; top: 3px; left: -20px; width: 18px; height: 24px; pointer-events: auto; cursor: -webkit-grab;']
+  [data-block-id],
+.notion-peek-renderer
+  > div
+  > [style*='position: absolute; top: 0px; left: 0px;']
+  [style*='position: absolute; top: 3px; left: -20px; width: 18px; height: 24px; pointer-events: auto; cursor: -webkit-grab;']
+  [data-block-id] {
+  background: var(--theme--bg) !important;
+  border-radius: 3px;
+}
+.notion-frame
+  > [style*='position: absolute; top: 0px; left: 0px;']
+  [style*='position: absolute; top: 3px; left: -20px; width: 18px; height: 24px; pointer-events: auto; cursor: -webkit-grab;']
+  + .notion-focusable,
+.notion-peek-renderer
+  > div
+  > [style*='position: absolute; top: 0px; left: 0px;']
+  [style*='position: absolute; top: 3px; left: -20px; width: 18px; height: 24px; pointer-events: auto; cursor: -webkit-grab;']
+  + .notion-focusable {
+  left: -42px !important;
+  background: transparent !important;
+}
+.notion-frame
+  > [style*='position: absolute; top: 0px; left: 0px;']
+  [style*='position: absolute; top: 3px; left: -20px; width: 18px; height: 24px; pointer-events: auto; cursor: -webkit-grab;']
+  + .notion-focusable
+  > .plus,
+.notion-peek-renderer
+  > div
+  > [style*='position: absolute; top: 0px; left: 0px;']
+  [style*='position: absolute; top: 3px; left: -20px; width: 18px; height: 24px; pointer-events: auto; cursor: -webkit-grab;']
+  + .notion-focusable
+  > .plus {
+  border-radius: 3px;
+  width: 18px !important;
+  padding: 0 1px !important;
+  background: var(--theme--bg) !important;
+}
+.notion-frame
+  > [style*='position: absolute; top: 0px; left: 0px;']
+  [style*='position: absolute; top: 3px; left: -20px; width: 18px; height: 24px; pointer-events: auto; cursor: -webkit-grab;']
+  + .notion-focusable
+  > .plus:hover,
+.notion-peek-renderer
+  > div
+  > [style*='position: absolute; top: 0px; left: 0px;']
+  [style*='position: absolute; top: 3px; left: -20px; width: 18px; height: 24px; pointer-events: auto; cursor: -webkit-grab;']
+  + .notion-focusable
+  > .plus:hover {
+  background: var(--theme--ui_interactive-hover) !important;
+}
diff --git a/src/mods/indentation-lines/client.mjs b/src/mods/indentation-lines/client.mjs
new file mode 100644
index 0000000..3cb8736
--- /dev/null
+++ b/src/mods/indentation-lines/client.mjs
@@ -0,0 +1,109 @@
+/**
+ * notion-enhancer: indentation lines
+ * (c) 2020 Alexa Baldon <alnbaldon@gmail.com> (https://github.com/runargs)
+ * (https://notion-enhancer.github.io/) under the MIT license
+ */
+
+'use strict';
+
+export default async function ({ web }, db) {
+  let style = 'solid',
+    opacity = 1,
+    rainbow = false;
+  switch (await db.get(['style'])) {
+    case 'dashed':
+      style = 'dashed';
+      break;
+    case 'dotted':
+      style = 'dotted';
+      break;
+    case 'soft':
+      opacity = 0.25;
+      break;
+    case 'rainbow':
+      opacity = 0.7;
+      rainbow = true;
+      break;
+  }
+
+  let css = '';
+  const colors = ['red', 'pink', 'purple', 'blue', 'green', 'yellow'];
+  colors.push(...colors, ...colors, ...colors, 'gray');
+
+  for (const listType of ['bulleted_list', 'numbered_list', 'to_do', 'toggle']) {
+    if (!(await db.get([listType]))) continue;
+    css += `
+      .notion-page-content .notion-${listType}-block > div > div:last-child::before {
+        border-left: 1px ${style} var(--indentation_lines--color, currentColor);
+        opacity: ${opacity};
+      }`;
+
+    if (rainbow) {
+      for (let i = 0; i < colors.length; i++) {
+        css += `
+          .notion-page-content ${`.notion-${listType}-block `.repeat(i + 1)}
+            > div > div:last-child::before {
+            --indentation_lines--color: var(--theme--text_${colors[i]});
+          }`;
+      }
+    }
+  }
+
+  if (await db.get(['toggle_header'])) {
+    css += `
+      .notion-page-content [class$=header-block] > div > div > div:last-child::before {
+        border-left: 1px ${style} var(--indentation_lines--color, currentColor);
+        opacity: ${opacity};
+      }`;
+
+    if (rainbow) {
+      for (let i = 0; i < colors.length; i++) {
+        css += `
+        .notion-page-content ${`[class$=header-block] `.repeat(i + 1)}
+          > div > div > div:last-child::before{
+          --indentation_lines--color: var(--theme--text_${colors[i]});
+        }`;
+      }
+    }
+  }
+
+  if (await db.get(['table_of_contents'])) {
+    css += `
+      .notion-page-content .notion-table_of_contents-block > div > div > a > div
+        > div:not([style*='margin-left: 0px']) > div::before {
+        border-left: 1px ${style} var(--indentation_lines--color, currentColor);
+        opacity: ${opacity};
+      }`;
+
+    if (rainbow) {
+      css += `
+        .notion-page-content .notion-table_of_contents-block > div > div > a > div
+          > div[style*='margin-left: 24px'] > div::before {
+          --indentation_lines--color: var(--theme--text_${colors[0]});
+        }
+        .notion-page-content .notion-table_of_contents-block > div > div > a > div
+          > div[style*='margin-left: 48px'] > div::before {
+          --indentation_lines--color: var(--theme--text_${colors[1]});
+        }`;
+    }
+  }
+
+  if (await db.get(['outliner'])) {
+    css += `
+      .outliner--header:not([style='--outliner--indent:0px;'])::before {
+        border-left: 1px ${style} var(--indentation_lines--color, currentColor);
+        opacity: ${opacity};
+      }`;
+    if (rainbow) {
+      css += `
+        .outliner--header[style='--outliner--indent:18px;']::before {
+          --indentation_lines--color: var(--theme--text_${colors[0]});
+        }
+        .outliner--header[style='--outliner--indent:36px;']::before {
+          --indentation_lines--color: var(--theme--text_${colors[1]});
+        }`;
+    }
+  }
+
+  web.render(document.head, web.html`<style>${css}</style>`);
+}
diff --git a/src/mods/indentation-lines/indentation-lines.jpg b/src/mods/indentation-lines/indentation-lines.jpg
new file mode 100644
index 0000000..0587e6d
Binary files /dev/null and b/src/mods/indentation-lines/indentation-lines.jpg differ
diff --git a/src/mods/indentation-lines/mod.json b/src/mods/indentation-lines/mod.json
new file mode 100644
index 0000000..33a82d9
--- /dev/null
+++ b/src/mods/indentation-lines/mod.json
@@ -0,0 +1,72 @@
+{
+  "name": "indentation lines",
+  "id": "35815b3b-3916-4dc6-8769-c9c2448f8b57",
+  "version": "0.2.0",
+  "description": "adds vertical relationship lines to make list trees easier to follow.",
+  "preview": "indentation-lines.jpg",
+  "tags": ["extension", "usability"],
+  "authors": [
+    {
+      "name": "runargs",
+      "email": "alnbaldon@gmail.com",
+      "homepage": "http://github.com/runargs",
+      "avatar": "https://avatars.githubusercontent.com/u/39810066"
+    }
+  ],
+  "css": {
+    "client": ["client.css"]
+  },
+  "js": {
+    "client": ["client.mjs"]
+  },
+  "options": [
+    {
+      "type": "select",
+      "key": "style",
+      "label": "style",
+      "values": ["solid", "dashed", "dotted", "soft", "rainbow"]
+    },
+    {
+      "type": "toggle",
+      "key": "bulleted_list",
+      "label": "bulleted lists",
+      "value": true
+    },
+    {
+      "type": "toggle",
+      "key": "numbered_list",
+      "label": "numbered lists",
+      "value": true
+    },
+    {
+      "type": "toggle",
+      "key": "to_do",
+      "label": "to-do lists",
+      "value": true
+    },
+    {
+      "type": "toggle",
+      "key": "toggle",
+      "label": "toggle lists",
+      "value": true
+    },
+    {
+      "type": "toggle",
+      "key": "toggle_header",
+      "label": "toggle headers",
+      "value": true
+    },
+    {
+      "type": "toggle",
+      "key": "table_of_contents",
+      "label": "tables of contents",
+      "value": true
+    },
+    {
+      "type": "toggle",
+      "key": "outliner",
+      "label": "outliner (panel extension)",
+      "value": true
+    }
+  ]
+}
diff --git a/src/mods/integrated-titlebar/buttons.css b/src/mods/integrated-titlebar/buttons.css
new file mode 100644
index 0000000..3a59d9c
--- /dev/null
+++ b/src/mods/integrated-titlebar/buttons.css
@@ -0,0 +1,76 @@
+/**
+ * notion-enhancer: integrated titlebar
+ * (c) 2021 dragonwocky <thedragonring.bod@gmail.com> (https://dragonwocky.me/)
+ * (https://notion-enhancer.github.io/) under the MIT license
+ */
+
+.integrated_titlebar--dragarea {
+  width: 100%;
+  display: block;
+  -webkit-app-region: drag;
+  background: var(--theme--bg_secondary);
+  height: var(--integrated_titlebar--dragarea-height);
+}
+
+.integrated_titlebar--buttons {
+  display: flex;
+  align-items: center;
+}
+.sidebar > .integrated_titlebar--buttons {
+  margin: -0.5rem 0 0.75rem auto;
+}
+
+.integrated_titlebar--buttons button {
+  user-select: none;
+  transition: background 20ms ease-in 0s;
+  cursor: pointer;
+  display: inline-flex;
+  align-items: center;
+  justify-content: center;
+  flex-shrink: 0;
+  border-radius: 3px;
+  height: 28px;
+  width: 33px;
+  padding: 0 0.25px 0 0;
+
+  margin-left: 2px;
+  border: none;
+  background: transparent;
+  font-size: 18px;
+  -webkit-app-region: no-drag;
+}
+.integrated_titlebar--buttons button svg {
+  display: block;
+  width: 20px;
+  height: 20px;
+  fill: var(--theme--icon);
+  color: var(--theme--icon);
+}
+
+.integrated_titlebar--buttons button:focus,
+.integrated_titlebar--buttons button:hover {
+  background: var(--theme--ui_interactive-hover);
+}
+.integrated_titlebar--buttons button:active {
+  background: var(--theme--ui_interactive-active);
+}
+#integrated_titlebar--close:focus,
+#integrated_titlebar--close:hover,
+#integrated_titlebar--close:active {
+  background: var(--theme--accent_red);
+  color: var(--theme--accent_red-text);
+}
+
+.notion-update-sidebar [style*='margin-top: 45px;'] {
+  margin-top: calc(45px + var(--integrated_titlebar--dragarea-height, 0px)) !important;
+}
+.notion-topbar {
+  height: calc(45px + var(--integrated_titlebar--dragarea-height, 0px)) !important;
+}
+.notion-frame {
+  height: calc(100vh - 45px - var(--integrated_titlebar--dragarea-height, 0px)) !important;
+}
+
+body > .body-container {
+  height: calc(100% - var(--integrated_titlebar--dragarea-height, 0px)) !important;
+}
diff --git a/src/mods/integrated-titlebar/buttons.mjs b/src/mods/integrated-titlebar/buttons.mjs
new file mode 100644
index 0000000..da307f5
--- /dev/null
+++ b/src/mods/integrated-titlebar/buttons.mjs
@@ -0,0 +1,73 @@
+/**
+ * notion-enhancer: integrated titlebar
+ * (c) 2021 dragonwocky <thedragonring.bod@gmail.com> (https://dragonwocky.me/)
+ * (https://notion-enhancer.github.io/) under the MIT license
+ */
+
+'use strict';
+
+export const createWindowButtons = async ({ electron, web, components }, db) => {
+  let minimizeIcon = (await db.get(['minimize_icon'])) || (await components.feather('minus')),
+    maximizeIcon = (await db.get(['maximize_icon'])) || (await components.feather('maximize')),
+    unmaximizeIcon =
+      (await db.get(['unmaximize_icon'])) || (await components.feather('minimize')),
+    closeIcon = (await db.get(['close_icon'])) || (await components.feather('x'));
+  minimizeIcon = minimizeIcon.trim();
+  maximizeIcon = maximizeIcon.trim();
+  unmaximizeIcon = unmaximizeIcon.trim();
+  closeIcon = closeIcon.trim();
+
+  minimizeIcon =
+    minimizeIcon.startsWith('<svg') && minimizeIcon.endsWith('</svg>')
+      ? minimizeIcon
+      : web.escape(minimizeIcon);
+  maximizeIcon =
+    maximizeIcon.startsWith('<svg') && maximizeIcon.endsWith('</svg>')
+      ? maximizeIcon
+      : web.escape(maximizeIcon);
+  unmaximizeIcon =
+    unmaximizeIcon.startsWith('<svg') && unmaximizeIcon.endsWith('</svg>')
+      ? unmaximizeIcon
+      : web.escape(unmaximizeIcon);
+  closeIcon =
+    closeIcon.startsWith('<svg') && closeIcon.endsWith('</svg>')
+      ? closeIcon
+      : web.escape(closeIcon);
+
+  const $windowButtons = web.html`<div class="integrated_titlebar--buttons"></div>`,
+    $minimize = web.html`<button id="integrated_titlebar--minimize">
+      ${minimizeIcon}
+    </button>`,
+    $maximize = web.html`<button id="integrated_titlebar--maximize">
+      ${maximizeIcon}
+    </button>`,
+    $unmaximize = web.html`<button id="integrated_titlebar--unmaximize">
+      ${unmaximizeIcon}
+    </button>`,
+    $close = web.html`<button id="integrated_titlebar--close">
+      ${closeIcon}
+    </button>`;
+  components.addTooltip($minimize, '**Minimize window**');
+  components.addTooltip($maximize, '**Maximize window**');
+  components.addTooltip($unmaximize, '**Unmaximize window**');
+  components.addTooltip($close, '**Close window**');
+
+  $minimize.addEventListener('click', () => electron.browser.minimize());
+  $maximize.addEventListener('click', () => electron.browser.maximize());
+  $unmaximize.addEventListener('click', () => electron.browser.unmaximize());
+  $close.addEventListener('click', () => electron.browser.close());
+  electron.browser.on('maximize', () => {
+    $maximize.replaceWith($unmaximize);
+  });
+  electron.browser.on('unmaximize', () => {
+    $unmaximize.replaceWith($maximize);
+  });
+
+  web.render(
+    $windowButtons,
+    $minimize,
+    electron.browser.isMaximized() ? $unmaximize : $maximize,
+    $close
+  );
+  return $windowButtons;
+};
diff --git a/src/mods/integrated-titlebar/client.mjs b/src/mods/integrated-titlebar/client.mjs
new file mode 100644
index 0000000..f217e60
--- /dev/null
+++ b/src/mods/integrated-titlebar/client.mjs
@@ -0,0 +1,58 @@
+/**
+ * notion-enhancer: integrated titlebar
+ * (c) 2021 dragonwocky <thedragonring.bod@gmail.com> (https://dragonwocky.me/)
+ * (https://notion-enhancer.github.io/) under the MIT license
+ */
+
+'use strict';
+
+import { createWindowButtons } from './buttons.mjs';
+
+export default async function (api, db) {
+  const { web, registry, electron } = api,
+    tilingMode = await db.get(['tiling']),
+    dragareaHeight = await db.get(['dragarea_height']),
+    tabsEnabled = await registry.enabled('e1692c29-475e-437b-b7ff-3eee872e1a42'),
+    sidebarSelector = '.notion-sidebar',
+    panelSelector = '#enhancer--panel',
+    topbarSelector = '.notion-topbar',
+    topbarActionsSelector = '.notion-topbar-action-buttons';
+  if (tilingMode || tabsEnabled) return;
+
+  let sidebarWidth = '0px',
+    panelWidth = '0px';
+  const updateDragareaOffsets = () => {
+    const $sidebar = document.querySelector(sidebarSelector),
+      newSidebarWidth =
+        !$sidebar || $sidebar.style.height === 'auto' ? '0px' : $sidebar.style.width,
+      $panel = document.querySelector(panelSelector),
+      newPanelWidth =
+        $panel && $panel.dataset.enhancerPanelPinned === 'true'
+          ? window
+              .getComputedStyle(document.documentElement)
+              .getPropertyValue('--component--panel-width')
+          : '0px';
+    if (newSidebarWidth !== sidebarWidth) {
+      sidebarWidth = newSidebarWidth;
+      electron.sendMessageToHost('sidebar-width', sidebarWidth);
+    }
+    if (newPanelWidth !== panelWidth) {
+      panelWidth = newPanelWidth;
+      electron.sendMessageToHost('panel-width', panelWidth);
+    }
+  };
+  web.addDocumentObserver(updateDragareaOffsets);
+
+  await web.whenReady([topbarSelector, topbarActionsSelector]);
+  const $topbar = document.querySelector(topbarSelector),
+    $dragarea = web.html`<div class="integrated_titlebar--dragarea"></div>`;
+  $topbar.prepend($dragarea);
+  document.documentElement.style.setProperty(
+    '--integrated_titlebar--dragarea-height',
+    dragareaHeight + 'px'
+  );
+
+  const $topbarActions = document.querySelector(topbarActionsSelector),
+    $windowButtons = await createWindowButtons(api, db);
+  web.render($topbarActions.parentElement, $windowButtons);
+}
diff --git a/src/mods/integrated-titlebar/createWindow.cjs b/src/mods/integrated-titlebar/createWindow.cjs
new file mode 100644
index 0000000..39e42e6
--- /dev/null
+++ b/src/mods/integrated-titlebar/createWindow.cjs
@@ -0,0 +1,18 @@
+/**
+ * notion-enhancer: integrated titlebar
+ * (c) 2021 dragonwocky <thedragonring.bod@gmail.com> (https://dragonwocky.me/)
+ * (https://notion-enhancer.github.io/) under the MIT license
+ */
+
+'use strict';
+
+module.exports = function (api, db, __exports, __eval) {
+  __eval(`
+    const notionRectFromFocusedWindow = getRectFromFocusedWindow;
+    getRectFromFocusedWindow = (windowState) => {
+      const rect = notionRectFromFocusedWindow(windowState);
+      rect.frame = false;
+      return rect;
+    };
+  `);
+};
diff --git a/src/mods/integrated-titlebar/frame.mjs b/src/mods/integrated-titlebar/frame.mjs
new file mode 100644
index 0000000..f0e7729
--- /dev/null
+++ b/src/mods/integrated-titlebar/frame.mjs
@@ -0,0 +1,43 @@
+/**
+ * notion-enhancer: integrated titlebar
+ * (c) 2021 dragonwocky <thedragonring.bod@gmail.com> (https://dragonwocky.me/)
+ * (https://notion-enhancer.github.io/) under the MIT license
+ */
+
+'use strict';
+
+import { createWindowButtons } from './buttons.mjs';
+
+export default async function (api, db) {
+  const { web, registry } = api,
+    tilingMode = await db.get(['tiling']),
+    dragareaHeight = await db.get(['dragarea_height']),
+    tabsEnabled = await registry.enabled('e1692c29-475e-437b-b7ff-3eee872e1a42');
+
+  if (tabsEnabled && !tilingMode) {
+    const windowActionsSelector = '#window-actions';
+    await web.whenReady([windowActionsSelector]);
+
+    const $topbarActions = document.querySelector(windowActionsSelector),
+      $windowButtons = await createWindowButtons(api, db);
+    web.render($topbarActions, $windowButtons);
+  } else {
+    const dragareaSelector = '[style*="-webkit-app-region: drag;"]';
+    await web.whenReady([dragareaSelector]);
+
+    const dragarea = document.querySelector(dragareaSelector);
+    dragarea.style.top = '2px';
+    dragarea.style.height = tilingMode ? '0' : `${dragareaHeight}px`;
+
+    document.getElementById('notion').addEventListener('ipc-message', (event) => {
+      switch (event.channel) {
+        case 'notion-enhancer:sidebar-width':
+          dragarea.style.left = event.args[0];
+          break;
+        case 'notion-enhancer:panel-width':
+          dragarea.style.right = event.args[0];
+          break;
+      }
+    });
+  }
+}
diff --git a/src/mods/integrated-titlebar/integrated-titlebar.jpg b/src/mods/integrated-titlebar/integrated-titlebar.jpg
new file mode 100644
index 0000000..0802010
Binary files /dev/null and b/src/mods/integrated-titlebar/integrated-titlebar.jpg differ
diff --git a/src/mods/integrated-titlebar/menu.mjs b/src/mods/integrated-titlebar/menu.mjs
new file mode 100644
index 0000000..2e015f3
--- /dev/null
+++ b/src/mods/integrated-titlebar/menu.mjs
@@ -0,0 +1,29 @@
+/**
+ * notion-enhancer: integrated titlebar
+ * (c) 2021 dragonwocky <thedragonring.bod@gmail.com> (https://dragonwocky.me/)
+ * (https://notion-enhancer.github.io/) under the MIT license
+ */
+
+'use strict';
+
+import { createWindowButtons } from './buttons.mjs';
+
+export default async function (api, db) {
+  const { web } = api,
+    tilingMode = await db.get(['tiling']),
+    dragareaHeight = await db.get(['dragarea_height']),
+    sidebarSelector = '.sidebar';
+  if (tilingMode) return;
+
+  await web.whenReady([sidebarSelector]);
+  const $dragarea = web.html`<div class="integrated_titlebar--dragarea"></div>`;
+  document.body.prepend($dragarea);
+  document.documentElement.style.setProperty(
+    '--integrated_titlebar--dragarea-height',
+    dragareaHeight + 'px'
+  );
+
+  const $sidebar = document.querySelector(sidebarSelector),
+    $windowButtons = await createWindowButtons(api, db);
+  $sidebar.prepend($windowButtons);
+}
diff --git a/src/mods/integrated-titlebar/mod.json b/src/mods/integrated-titlebar/mod.json
new file mode 100644
index 0000000..c84d400
--- /dev/null
+++ b/src/mods/integrated-titlebar/mod.json
@@ -0,0 +1,72 @@
+{
+  "name": "integrated titlebar",
+  "id": "a5658d03-21c6-4088-bade-fa4780459133",
+  "environments": ["linux", "win32"],
+  "version": "0.11.0",
+  "description": "replaces the native window titlebar with buttons inset into the app.",
+  "preview": "integrated-titlebar.jpg",
+  "tags": ["extension", "layout"],
+  "authors": [
+    {
+      "name": "dragonwocky",
+      "email": "thedragonring.bod@gmail.com",
+      "homepage": "https://dragonwocky.me/",
+      "avatar": "https://dragonwocky.me/avatar.jpg"
+    }
+  ],
+  "css": {
+    "frame": ["buttons.css"],
+    "client": ["buttons.css"],
+    "menu": ["buttons.css"]
+  },
+  "js": {
+    "frame": ["frame.mjs"],
+    "client": ["client.mjs"],
+    "menu": ["menu.mjs"],
+    "electron": [{ "source": "createWindow.cjs", "target": "main/createWindow.js" }]
+  },
+  "options": [
+    {
+      "type": "toggle",
+      "key": "tiling",
+      "label": "tiling window manager mode",
+      "tooltip": "**completely remove the close/minimise/maximise buttons** (only for advanced use, not recommended)",
+      "value": false
+    },
+    {
+      "type": "number",
+      "key": "dragarea_height",
+      "label": "dragarea height (px)",
+      "tooltip": "**the height of the rectangle added to the top of the window, used to drag/move the window around** (dragging is not possible in a frameless window without this bar)",
+      "value": 12
+    },
+    {
+      "type": "text",
+      "key": "minimize_icon",
+      "label": "minimize window icon",
+      "tooltip": "**may be an svg string or any unicode symbol e.g. an emoji** (the default icon will be used if this field is left empty)",
+      "value": ""
+    },
+    {
+      "type": "text",
+      "key": "maximize_icon",
+      "label": "maximize window icon",
+      "tooltip": "**may be an svg string or any unicode symbol e.g. an emoji** (the default icon will be used if this field is left empty)",
+      "value": ""
+    },
+    {
+      "type": "text",
+      "key": "unmaximize_icon",
+      "label": "unmaximize window icon",
+      "tooltip": "**may be an svg string or any unicode symbol e.g. an emoji** (the default icon will be used if this field is left empty)",
+      "value": ""
+    },
+    {
+      "type": "text",
+      "key": "close_icon",
+      "label": "close window icon",
+      "tooltip": "**may be an svg string or any unicode symbol e.g. an emoji** (the default icon will be used if this field is left empty)",
+      "value": ""
+    }
+  ]
+}
diff --git a/src/mods/light+/light+.png b/src/mods/light+/light+.png
new file mode 100644
index 0000000..8d6586d
Binary files /dev/null and b/src/mods/light+/light+.png differ
diff --git a/src/mods/light+/mod.json b/src/mods/light+/mod.json
new file mode 100644
index 0000000..cf7fc57
--- /dev/null
+++ b/src/mods/light+/mod.json
@@ -0,0 +1,48 @@
+{
+  "name": "light+",
+  "id": "336cbc54-67b9-4b00-b4a2-9cc86eef763b",
+  "version": "0.2.0",
+  "description": "a simple white theme that brightens coloured text and blocks, with configurable accents.",
+  "preview": "light+.png",
+  "tags": ["theme", "light"],
+  "authors": [
+    {
+      "name": "Lizishan",
+      "homepage": "https://www.reddit.com/user/Lizishan",
+      "avatar": "https://styles.redditmedia.com/t5_110nz4/styles/profileIcon_h1m3b16exoi51.jpg"
+    }
+  ],
+  "css": {
+    "frame": ["variables.css"],
+    "client": ["variables.css"],
+    "menu": ["variables.css"]
+  },
+  "js": {
+    "frame": ["theme.mjs"],
+    "client": ["theme.mjs"],
+    "menu": ["theme.mjs"]
+  },
+  "options": [
+    {
+      "type": "color",
+      "key": "primary",
+      "label": "primary accent color",
+      "tooltip": "**replaces notion's blue accent**",
+      "value": "rgba(46,170,220,1)"
+    },
+    {
+      "type": "color",
+      "key": "secondary",
+      "label": "secondary accent color",
+      "tooltip": "**replaces notion's red accent**",
+      "value": "rgba(235,87,87,1)"
+    },
+    {
+      "type": "color",
+      "key": "highlight",
+      "label": "highlight accent color",
+      "tooltip": "**affects dividers, text, icons and hovered scrollbars. set this to rgba(0,0,0,0) to disable it**",
+      "value": "rgba(0,0,0,0)"
+    }
+  ]
+}
diff --git a/src/mods/light+/theme.mjs b/src/mods/light+/theme.mjs
new file mode 100644
index 0000000..64c7302
--- /dev/null
+++ b/src/mods/light+/theme.mjs
@@ -0,0 +1,70 @@
+/**
+ * notion-enhancer: light+
+ * (c) 2021 dragonwocky <thedragonring.bod@gmail.com> (https://dragonwocky.me/)
+ * (https://notion-enhancer.github.io/) under the MIT license
+ */
+
+'use strict';
+
+export default async function ({ fmt }, db) {
+  {
+    const primary = await db.get(['primary']),
+      [r, g, b] = primary
+        .slice(5, -1)
+        .split(',')
+        .map((i) => parseInt(i));
+    if (!(r === 46 && g === 170 && b === 220)) {
+      document.documentElement.style.setProperty('--light_plus--accent_blue', primary);
+      document.documentElement.style.setProperty(
+        '--light_plus--accent_blue-selection',
+        `rgba(${r},${g},${b},0.2)`
+      );
+      document.documentElement.style.setProperty(
+        '--light_plus--accent_blue-hover',
+        fmt.rgbLogShade(0.05, primary)
+      );
+      document.documentElement.style.setProperty(
+        '--light_plus--accent_blue-active',
+        fmt.rgbLogShade(0.025, primary)
+      );
+      document.documentElement.style.setProperty(
+        '--light_plus--accent_blue-text',
+        fmt.rgbContrast(r, g, b)
+      );
+    }
+  }
+
+  {
+    const secondary = await db.get(['secondary']),
+      [r, g, b] = secondary
+        .slice(5, -1)
+        .split(',')
+        .map((i) => parseInt(i));
+    if (!(r === 235 && g === 87 && b === 87)) {
+      document.documentElement.style.setProperty('--light_plus--accent_red', secondary);
+      document.documentElement.style.setProperty(
+        '--light_plus--accent_red-button',
+        `rgba(${r},${g},${b},0.2)`
+      );
+      document.documentElement.style.setProperty(
+        '--light_plus--accent_red-text',
+        fmt.rgbContrast(r, g, b)
+      );
+    }
+  }
+
+  {
+    const highlight = await db.get(['highlight']),
+      [r, g, b, a] = highlight
+        .slice(5, -1)
+        .split(',')
+        .map((i) => parseFloat(i));
+    if (!(r === 0 && g === 0 && b === 0 && a === 0)) {
+      document.documentElement.style.setProperty('--light_plus--accent_highlight', highlight);
+      document.documentElement.style.setProperty(
+        '--light_plus--accent_highlight-shaded',
+        fmt.rgbLogShade(0.1, highlight)
+      );
+    }
+  }
+}
diff --git a/src/mods/light+/variables.css b/src/mods/light+/variables.css
new file mode 100644
index 0000000..60531ff
--- /dev/null
+++ b/src/mods/light+/variables.css
@@ -0,0 +1,137 @@
+/**
+ * notion-enhancer: light+
+ * (c) 2020 Lizishan
+ * (c) 2021 dragonwocky <thedragonring.bod@gmail.com> (https://dragonwocky.me/)
+ * (https://notion-enhancer.github.io/) under the MIT license
+ */
+
+:root.light {
+  --theme--accent_blue: var(--light_plus--accent_blue, rgb(46, 170, 220));
+  --theme--accent_blue-selection: var(
+    --light_plus--accent_blue-selection,
+    rgb(46, 170, 220, 0.25)
+  );
+  --theme--accent_blue-hover: var(--light_plus--accent_blue-hover, rgb(6, 156, 205));
+  --theme--accent_blue-active: var(--light_plus--accent_blue-active, rgb(0, 141, 190));
+  --theme--accent_blue-text: var(--light_plus--accent_blue-text, #fff);
+  --theme--accent_red: var(--light_plus--accent_red, #eb5757);
+  --theme--accent_red-button: var(--light_plus--accent_red-button, rgba(235, 87, 87, 0.1));
+  --theme--accent_red-text: var(--light_plus--accent_red-text, #fff);
+
+  --theme--scrollbar_thumb-hover: var(--light_plus--accent_highlight, #aeaca6);
+
+  --theme--ui_divider: var(--light_plus--accent_highlight, rgb(237, 237, 236));
+  --theme--ui_corner_action: var(--theme--bg_card);
+  --theme--ui_corner_action-hover: var(--theme--ui_interactive-hover);
+  --theme--ui_corner_action-active: var(--theme--ui_interactive-active);
+
+  --theme--icon: var(--light_plus--accent_highlight, rgba(55, 53, 47, 0.8));
+  --theme--icon_secondary: var(--light_plus--accent_highlight, rgba(55, 53, 47, 0.4));
+
+  --theme--text: var(--light_plus--accent_highlight, rgb(55, 43, 47));
+  --theme--text_secondary: var(--light_plus--accent_highlight-shaded, rgba(55, 43, 47, 0.6));
+
+  --theme--text_gray: rgba(151, 154, 155, 0.95);
+  --theme--text_brown: rgb(167, 126, 100);
+  --theme--text_orange: rgb(255, 134, 0);
+  --theme--text_yellow: rgb(255, 195, 0);
+  --theme--text_green: rgb(0, 171, 0);
+  --theme--text_blue: rgb(0, 121, 255);
+  --theme--text_purple: rgb(126, 0, 255);
+  --theme--text_pink: rgb(255, 0, 208);
+  --theme--text_red: rgb(255, 0, 0);
+
+  --theme--highlight_gray: rgb(234, 234, 234);
+  --theme--highlight_gray-text: rgb(17, 17, 17);
+  --theme--highlight_brown: rgb(206, 206, 206);
+  --theme--highlight_brown-text: rgb(85, 35, 1);
+  --theme--highlight_orange: rgb(254, 214, 155);
+  --theme--highlight_orange-text: rgb(199, 110, 0);
+  --theme--highlight_yellow: #fcffd8;
+  --theme--highlight_yellow-text: #ff8c22;
+  --theme--highlight_green: #d5fded;
+  --theme--highlight_green-text: #006a00;
+  --theme--highlight_blue: #e2f5ff;
+  --theme--highlight_blue-text: #00b2ff;
+  --theme--highlight_purple: #efe6ff;
+  --theme--highlight_purple-text: #8334ff;
+  --theme--highlight_pink: #ffe9f1;
+  --theme--highlight_pink-text: rgb(255, 0, 127);
+  --theme--highlight_red: rgb(248, 215, 218);
+  --theme--highlight_red-text: rgb(138, 0, 10);
+
+  --theme--callout_gray: #e2e3e5;
+  --theme--callout_gray-text: #383d41;
+  --theme--callout_brown: rgb(130, 118, 111);
+  --theme--callout_brown-text: rgb(85, 35, 1);
+  --theme--callout_orange: rgb(254, 214, 155);
+  --theme--callout_orange-text: rgb(255, 140, 0);
+  --theme--callout_yellow: #fcffd8;
+  --theme--callout_yellow-text: #c76e00;
+  --theme--callout_green: #d4edda;
+  --theme--callout_green-text: #155724;
+  --theme--callout_blue: #cce5ff;
+  --theme--callout_blue-text: #004085;
+  --theme--callout_purple: rgb(199, 178, 230);
+  --theme--callout_purple-text: rgb(90, 49, 148);
+  --theme--callout_pink: rgb(255, 206, 228);
+  --theme--callout_pink-text: rgb(255, 0, 127);
+  --theme--callout_red: #f8d7da;
+  --theme--callout_red-text: #721c24;
+
+  --theme--tag_default: rgb(234, 234, 234);
+  --theme--tag_light_gray: rgb(240, 240, 240);
+  --theme--tag_light_gray-text: rgb(65, 65, 65);
+  --theme--tag_gray: rgb(234, 234, 234);
+  --theme--tag_gray-text: rgb(17, 17, 17);
+  --theme--tag_brown: rgb(206, 206, 206);
+  --theme--tag_brown-text: rgb(85, 35, 1);
+  --theme--tag_orange: rgb(254, 214, 155);
+  --theme--tag_orange-text: rgb(199, 110, 0);
+  --theme--tag_yellow: #fcffd8;
+  --theme--tag_yellow-text: #ff8c22;
+  --theme--tag_green: #d5fded;
+  --theme--tag_green-text: #006a00;
+  --theme--tag_blue: #e2f5ff;
+  --theme--tag_blue-text: #00b2ff;
+  --theme--tag_purple: #efe6ff;
+  --theme--tag_purple-text: #8334ff;
+  --theme--tag_pink: #ffe9f1;
+  --theme--tag_pink-text: rgb(255, 0, 127);
+  --theme--tag_red: rgb(248, 215, 218);
+  --theme--tag_red-text: rgb(138, 0, 10);
+
+  --theme--board_light_gray: #EBEBED;
+  --theme--board_light_gray-text: #616366;
+  --theme--board_light_gray-card: var(--theme--tag_light_gray);
+  --theme--board_gray: #e2e3e5;
+  --theme--board_gray-text: #383d41;
+  --theme--board_gray-card: var(--theme--tag_gray);
+  --theme--board_brown: rgb(130, 118, 111);
+  --theme--board_brown-text: rgb(85, 35, 1);
+  --theme--board_brown-card: var(--theme--tag_brown);
+  --theme--board_orange: rgb(254, 214, 155);
+  --theme--board_orange-text: rgb(255, 140, 0);
+  --theme--board_orange-card: var(--theme--tag_orange);
+  --theme--board_yellow: #fcffd8;
+  --theme--board_yellow-text: #c76e00;
+  --theme--board_yellow-card: var(--theme--tag_yellow);
+  --theme--board_green: #d4edda;
+  --theme--board_green-text: #155724;
+  --theme--board_green-card: var(--theme--tag_green);
+  --theme--board_blue: #cce5ff;
+  --theme--board_blue-text: #004085;
+  --theme--board_blue-card: var(--theme--tag_blue);
+  --theme--board_purple: rgb(199, 178, 230);
+  --theme--board_purple-text: rgb(90, 49, 148);
+  --theme--board_purple-card: var(--theme--tag_purple);
+  --theme--board_pink: rgb(255, 206, 228);
+  --theme--board_pink-text: rgb(255, 0, 127);
+  --theme--board_pink-card: var(--theme--tag_pink);
+  --theme--board_red: #f8d7da;
+  --theme--board_red-text: #721c24;
+  --theme--board_red-card: var(--theme--tag_red);
+
+  --theme--code_inline: rgb(179, 39, 39);
+  --theme--code_inline-text: #e0dfe2;
+}
diff --git a/src/mods/material-ocean/material-ocean.png b/src/mods/material-ocean/material-ocean.png
new file mode 100644
index 0000000..838a9ca
Binary files /dev/null and b/src/mods/material-ocean/material-ocean.png differ
diff --git a/src/mods/material-ocean/mod.json b/src/mods/material-ocean/mod.json
new file mode 100644
index 0000000..00a46aa
--- /dev/null
+++ b/src/mods/material-ocean/mod.json
@@ -0,0 +1,23 @@
+{
+  "name": "material ocean",
+  "id": "69e7ccb2-4aef-484c-876d-3de1b433d2b9",
+  "version": "0.2.0",
+  "description": "an oceanic colour palette.",
+  "preview": "material-ocean.png",
+  "tags": ["theme", "dark"],
+  "authors": [
+    {
+      "name": "blacksuan19",
+      "email": "abubakaryagob@gmail.com",
+      "homepage": "http://github.com/blacksuan19",
+      "avatar": "https://avatars.githubusercontent.com/u/10248473"
+    }
+  ],
+  "css": {
+    "frame": ["variables.css"],
+    "client": ["variables.css"],
+    "menu": ["variables.css"]
+  },
+  "js": {},
+  "options": []
+}
diff --git a/src/mods/material-ocean/variables.css b/src/mods/material-ocean/variables.css
new file mode 100644
index 0000000..e8a3579
--- /dev/null
+++ b/src/mods/material-ocean/variables.css
@@ -0,0 +1,173 @@
+/**
+ * notion-enhancer: material ocean
+ * (c) 2020 Abubakar Yagoub <i@blacksuan19.me> (https://blacksuan19.tk)
+ * (https://notion-enhancer.github.io/) under the MIT license
+ */
+
+:root.dark {
+  --ocean--main: #0f111a;
+  --ocean--sec: #00010a;
+  --ocean--tet: #000108;
+  --ocean--accent: #ff4151;
+  --ocean--light_gray: #E9E9E9;
+  --ocean--gray: #e0e0e0;
+  --ocean--brown: #d8b6a6;
+  --ocean--orange: #fde3c0;
+  --ocean--yellow: #ebcb8b;
+  --ocean--green: #a3be8c;
+  --ocean--blue: #81a1c1;
+  --ocean--purple: #b48ead;
+  --ocean--pink: #ffc0cb;
+  --ocean--red: #bf616a;
+
+  --theme--accent_blue: var(--ocean--accent);
+  --theme--accent_blue-selection: rgba(255, 65, 81, 0.2);
+  --theme--accent_blue-hover: #fc3747;
+  --theme--accent_blue-active: #ff4d5c;
+  --theme--accent_blue-text: #fff;
+  --theme--accent_red: var(--ocean--accent);
+  --theme--accent_red-button: #ff41514b;
+  --theme--accent_red-text: #fff;
+
+  --theme--bg: var(--ocean--main);
+  --theme--bg_secondary: var(--ocean--sec);
+  --theme--bg_card: var(--ocean--sec);
+
+  --theme--scrollbar_track: transparent;
+  --theme--scrollbar_thumb: var(--ocean--sec);
+  --theme--scrollbar_thumb-hover: var(--ocean--accent);
+
+  --theme--ui_divider: rgba(255, 255, 255, 0.1);
+  --theme--ui_interactive-hover: rgb(0, 1, 8, 0.3);
+  --theme--ui_interactive-active: rgb(0, 1, 8, 0.6);
+  --theme--ui_toggle-off: #30313c;
+  --theme--ui_corner_action: var(--theme--bg_card);
+  --theme--ui_corner_action-hover: var(--theme--ui_interactive-hover);
+  --theme--ui_corner_action-active: var(--theme--ui_interactive-active);
+
+  --theme--icon: var(--ocean--gray);
+  --theme--icon_secondary: var(--ocean--gray);
+
+  --theme--text: #fff;
+  --theme--text_secondary: var(--ocean--gray);
+  --theme--text_gray: var(--ocean--gray);
+  --theme--text_brown: var(--ocean--brown);
+  --theme--text_orange: var(--ocean--orange);
+  --theme--text_yellow: var(--ocean--yellow);
+  --theme--text_green: var(--ocean--green);
+  --theme--text_blue: var(--ocean--blue);
+  --theme--text_purple: var(--ocean--purple);
+  --theme--text_pink: var(--ocean--pink);
+  --theme--text_red: var(--ocean--red);
+
+  --theme--highlight_gray: var(--ocean--gray);
+  --theme--highlight_gray-text: var(--ocean--main);
+  --theme--highlight_brown: var(--ocean--brown);
+  --theme--highlight_brown-text: var(--ocean--main);
+  --theme--highlight_orange: var(--ocean--orange);
+  --theme--highlight_orange-text: var(--ocean--main);
+  --theme--highlight_yellow: var(--ocean--yellow);
+  --theme--highlight_yellow-text: var(--ocean--main);
+  --theme--highlight_green: var(--ocean--green);
+  --theme--highlight_green-text: var(--ocean--main);
+  --theme--highlight_blue: var(--ocean--blue);
+  --theme--highlight_blue-text: var(--ocean--main);
+  --theme--highlight_purple: var(--ocean--purple);
+  --theme--highlight_purple-text: var(--ocean--main);
+  --theme--highlight_pink: var(--ocean--pink);
+  --theme--highlight_pink-text: var(--ocean--main);
+  --theme--highlight_red: var(--ocean--red);
+  --theme--highlight_red-text: var(--ocean--main);
+
+  --theme--callout_gray: #e0e0e089;
+  --theme--callout_gray-text: var(--ocean--main);
+  --theme--callout_brown: #d8b6a692;
+  --theme--callout_brown-text: var(--ocean--main);
+  --theme--callout_orange: #fde3c09f;
+  --theme--callout_orange-text: var(--ocean--main);
+  --theme--callout_yellow: #ffe6a6ad;
+  --theme--callout_yellow-text: var(--ocean--main);
+  --theme--callout_green: #a3be8ca3;
+  --theme--callout_green-text: var(--ocean--main);
+  --theme--callout_blue: #81a1c1a3;
+  --theme--callout_blue-text: var(--ocean--main);
+  --theme--callout_purple: #b48eada8;
+  --theme--callout_purple-text: var(--ocean--main);
+  --theme--callout_pink: #ffc0cbb1;
+  --theme--callout_pink-text: var(--ocean--main);
+  --theme--callout_red: #bf616a9e;
+  --theme--callout_red-text: var(--ocean--main);
+
+  --theme--tag_default: var(--ocean--gray);
+  --theme--tag_default-text: var(--ocean--main);
+  --theme--tag_light_gray: var(--ocean--light_gray);
+  --theme--tag_light_gray-text: var(--ocean--main);
+  --theme--tag_gray: var(--theme--highlight_gray);
+  --theme--tag_gray-text: var(--ocean--main);
+  --theme--tag_brown: var(--theme--highlight_brown);
+  --theme--tag_brown-text: var(--ocean--main);
+  --theme--tag_orange: var(--theme--highlight_orange);
+  --theme--tag_orange-text: var(--ocean--main);
+  --theme--tag_yellow: var(--theme--highlight_yellow);
+  --theme--tag_yellow-text: var(--ocean--main);
+  --theme--tag_green: var(--theme--highlight_green);
+  --theme--tag_green-text: var(--ocean--main);
+  --theme--tag_blue: var(--theme--highlight_blue);
+  --theme--tag_blue-text: var(--ocean--main);
+  --theme--tag_purple: var(--theme--highlight_purple);
+  --theme--tag_purple-text: var(--ocean--main);
+  --theme--tag_pink: var(--theme--highlight_pink);
+  --theme--tag_pink-text: var(--ocean--main);
+  --theme--tag_red: var(--theme--highlight_red);
+  --theme--tag_red-text: var(--ocean--main);
+
+  --theme--board_light_gray: var(--ocean--light_gray);
+  --theme--board_light_gray-text: var(--ocean--main);
+  --theme--board_light_gray-card: rgba(0, 0, 0, 0.075);
+  --theme--board_gray: var(--theme--highlight_gray);
+  --theme--board_gray-text: var(--theme--highlight_gray-text);
+  --theme--board_gray-card: rgba(0, 0, 0, 0.075);
+  --theme--board_brown: var(--theme--highlight_brown);
+  --theme--board_brown-text: var(--theme--highlight_brown-text);
+  --theme--board_brown-card: rgba(0, 0, 0, 0.075);
+  --theme--board_orange: var(--theme--highlight_orange);
+  --theme--board_orange-text: var(--theme--highlight_orange-text);
+  --theme--board_orange-card: rgba(0, 0, 0, 0.075);
+  --theme--board_yellow: var(--theme--highlight_yellow);
+  --theme--board_yellow-text: var(--theme--highlight_yellow-text);
+  --theme--board_yellow-card: rgba(0, 0, 0, 0.075);
+  --theme--board_green: var(--theme--highlight_green);
+  --theme--board_green-text: var(--theme--highlight_green-text);
+  --theme--board_green-card: rgba(0, 0, 0, 0.075);
+  --theme--board_blue: var(--theme--highlight_blue);
+  --theme--board_blue-text: var(--theme--highlight_blue-text);
+  --theme--board_blue-card: rgba(0, 0, 0, 0.075);
+  --theme--board_purple: var(--theme--highlight_purple);
+  --theme--board_purple-text: var(--theme--highlight_purple-text);
+  --theme--board_purple-card: rgba(0, 0, 0, 0.075);
+  --theme--board_pink: var(--theme--highlight_pink);
+  --theme--board_pink-text: var(--theme--highlight_pink-text);
+  --theme--board_pink-card: rgba(0, 0, 0, 0.075);
+  --theme--board_red: var(--theme--highlight_red);
+  --theme--board_red-text: var(--theme--highlight_red-text);
+  --theme--board_red-card: rgba(0, 0, 0, 0.075);
+
+  --theme--code_inline: var(--ocean--sec);
+  --theme--code_inline-text: #b3f5c8;
+
+  --theme--code: var(--ocean--sec);
+  --theme--code_function: var(--theme--text_blue);
+  --theme--code_keyword: var(--theme--text_pink);
+  --theme--code_tag: var(--theme--text_pink);
+  --theme--code_operator: var(--theme--text_yellow);
+  --theme--code_property: var(--theme--text_pink);
+  --theme--code_builtin: var(--theme--text_yellow);
+  --theme--code_attr-name: var(--theme--text_yellow);
+  --theme--code_comment: var(--theme--text_gray);
+  --theme--code_punctuation: var(--theme--text_gray);
+  --theme--code_doctype: var(--theme--text_gray);
+  --theme--code_number: var(--theme--text_purple);
+  --theme--code_selector: var(--theme--text_orange);
+  --theme--code_atrule: var(--theme--text_orange);
+  --theme--code_regex: var(--theme--text_yellow);
+}
diff --git a/src/mods/menu/client.css b/src/mods/menu/client.css
new file mode 100644
index 0000000..0109a3c
--- /dev/null
+++ b/src/mods/menu/client.css
@@ -0,0 +1,69 @@
+/**
+ * notion-enhancer: menu
+ * (c) 2021 dragonwocky <thedragonring.bod@gmail.com> (https://dragonwocky.me/)
+ * (https://notion-enhancer.github.io/) under the MIT license
+ */
+
+.enhancer--sidebarMenuLink {
+  user-select: none;
+  -webkit-user-select: none;
+  transition: background 20ms ease-in 0s;
+  cursor: pointer;
+  color: var(--theme--text_secondary);
+}
+.enhancer--sidebarMenuLink:hover {
+  background: var(--theme--ui_interactive-hover);
+}
+.enhancer--sidebarMenuLink svg {
+  width: 16px;
+  height: 16px;
+  margin-left: 2px;
+}
+.enhancer--sidebarMenuLink > div {
+  display: flex;
+  align-items: center;
+  min-height: 27px;
+  font-size: 14px;
+  padding: 2px 14px;
+  width: 100%;
+}
+.enhancer--sidebarMenuLink > div > :first-child {
+  flex-shrink: 0;
+  flex-grow: 0;
+  border-radius: 3px;
+  width: 22px;
+  height: 22px;
+  display: flex;
+  align-items: center;
+  justify-content: center;
+  margin-right: 8px;
+}
+.enhancer--sidebarMenuLink > div > :nth-child(2) {
+  flex: 1 1 auto;
+  white-space: nowrap;
+  overflow: hidden;
+  text-overflow: ellipsis;
+}
+
+.enhancer--sidebarMenuLink:active {
+  color: var(--theme--text);
+}
+.enhancer--sidebarMenuLink > div > .enhancer--notificationBubble {
+  display: flex;
+}
+.enhancer--sidebarMenuLink > div > .enhancer--notificationBubble > div {
+  display: inline-flex;
+  align-items: center;
+  justify-content: center;
+  width: 16px;
+  height: 16px;
+  font-size: 10px;
+  font-weight: 600;
+  border-radius: 3px;
+  color: var(--theme--accent_red-text);
+  background: var(--theme--accent_red);
+}
+.enhancer--sidebarMenuLink > div > .enhancer--notificationBubble > div > span {
+  margin-bottom: 1px;
+  margin-left: -0.5px;
+}
diff --git a/src/mods/menu/client.mjs b/src/mods/menu/client.mjs
new file mode 100644
index 0000000..62b06e7
--- /dev/null
+++ b/src/mods/menu/client.mjs
@@ -0,0 +1,48 @@
+/**
+ * notion-enhancer: menu
+ * (c) 2021 dragonwocky <thedragonring.bod@gmail.com> (https://dragonwocky.me/)
+ * (https://notion-enhancer.github.io/) under the MIT license
+ */
+
+'use strict';
+
+const notificationsURL = 'https://notion-enhancer.github.io/notifications.json';
+
+export default async function ({ env, fs, storage, registry, web }, db) {
+  web.addHotkeyListener(await db.get(['hotkey']), env.focusMenu);
+
+  const sidebarSelector = '.notion-sidebar-container .notion-sidebar > div:nth-child(3) > div > div:nth-child(2)';
+  await web.whenReady([sidebarSelector]);
+
+  const $sidebarLink = web.html`<div class="enhancer--sidebarMenuLink" role="button" tabindex="0">
+      <div>
+        <div>${await fs.getText('media/colour.svg')}</div>
+        <div><div>notion-enhancer</div></div>
+      </div>
+    </div>`;
+  $sidebarLink.addEventListener('click', env.focusMenu);
+
+  const notifications = {
+    cache: await storage.get(['notifications'], []),
+    provider: await fs.getJSON(notificationsURL),
+    count: (await registry.errors()).length,
+  };
+  for (const notification of notifications.provider) {
+    if (
+      !notifications.cache.includes(notification.id) &&
+      notification.version === env.version &&
+      (!notification.environments || notification.environments.includes(env.name))
+    ) {
+      notifications.count++;
+    }
+  }
+  if ((await storage.get(['last_read_changelog'])) !== env.version) notifications.count++;
+  if (notifications.count) {
+    web.render(
+      $sidebarLink.children[0],
+      web.html`<div class="enhancer--notificationBubble"><div><span>${notifications.count}</span></div></div>`
+    );
+  }
+
+  web.render(document.querySelector(sidebarSelector), $sidebarLink);
+}
diff --git a/src/mods/menu/components.mjs b/src/mods/menu/components.mjs
new file mode 100644
index 0000000..0e9d876
--- /dev/null
+++ b/src/mods/menu/components.mjs
@@ -0,0 +1,292 @@
+/**
+ * notion-enhancer: menu
+ * (c) 2021 dragonwocky <thedragonring.bod@gmail.com> (https://dragonwocky.me/)
+ * (https://notion-enhancer.github.io/) under the MIT license
+ */
+
+'use strict';
+
+import { fmt, web, registry, components } from '../../api/index.mjs';
+import { notifications } from './notifications.mjs';
+import '../../dep/jscolor.min.js';
+
+import '../../dep/markdown-it.min.js';
+const md = markdownit({ linkify: true });
+
+export const modComponents = {
+  preview: (url) => web.html`<img
+    class="mod-preview"
+    src="${web.escape(url)}"
+    alt=""
+  >`,
+  title: (title) => web.html`<h4 class="mod-title"><span>${web.escape(title)}</span></h4>`,
+  version: (version) => web.html`<span class="mod-version">v${web.escape(version)}</span>`,
+  tags: (tags) => {
+    if (!tags.length) return '';
+    return web.render(
+      web.html`<p class="mod-tags"></p>`,
+      tags.map((tag) => `#${web.escape(tag)}`).join(' ')
+    );
+  },
+  description: (description) => {
+    const $description = web.html`<p class="mod-description markdown-inline">
+      ${md.renderInline(description)}
+    </p>`;
+    $description.querySelectorAll('a').forEach((a) => {
+      a.target = '_blank';
+    });
+    return $description;
+  },
+  authors: (authors) => {
+    const author = (author) => web.html`<a
+      class="mod-author"
+      href="${web.escape(author.homepage)}"
+      target="_blank"
+    >
+      <img class="mod-author-avatar"
+        src="${web.escape(author.avatar)}" alt="${web.escape(author.name)}'s avatar"
+      > <span>${web.escape(author.name)}</span>
+    </a>`;
+    return web.render(web.html`<p class="mod-authors-container"></p>`, ...authors.map(author));
+  },
+  toggle: (label, checked) => {
+    const $label = web.html`<label tabindex="0" class="toggle-label">
+      <span>${web.escape(label)}</span>
+    </label>`,
+      $input = web.html`<input tabindex="-1" type="checkbox" class="toggle-check"
+        ${checked ? 'checked' : ''}>`,
+      $feature = web.html`<span class="toggle-box toggle-feature"></span>`;
+    $label.addEventListener('keyup', (event) => {
+      if (['Enter', ' '].includes(event.key)) $input.checked = !$input.checked;
+    });
+    return web.render($label, $input, $feature);
+  },
+};
+
+export const options = {
+  toggle: async (mod, opt) => {
+    const profileDB = await registry.profileDB(),
+      checked = await profileDB.get([mod.id, opt.key], opt.value),
+      $toggle = modComponents.toggle(opt.label, checked),
+      $tooltipIcon = web.html`${await components.feather('info', { class: 'input-tooltip' })}`,
+      $label = $toggle.children[0],
+      $input = $toggle.children[1];
+    if (opt.tooltip) {
+      $label.prepend($tooltipIcon);
+      components.addTooltip($tooltipIcon, opt.tooltip, {
+        offsetDirection: 'left',
+        maxLines: 3,
+      });
+    }
+    $input.addEventListener('change', async (_event) => {
+      await profileDB.set([mod.id, opt.key], $input.checked);
+      notifications.onChange();
+    });
+    return $toggle;
+  },
+
+  select: async (mod, opt) => {
+    const profileDB = await registry.profileDB(),
+      value = await profileDB.get([mod.id, opt.key], opt.values[0]),
+      $tooltipIcon = web.html`${await components.feather('info', { class: 'input-tooltip' })}`,
+      $label = web.render(
+        web.html`<label class="input-label"></label>`,
+        web.render(web.html`<p></p>`, opt.tooltip ? $tooltipIcon : '', opt.label)
+      ),
+      $options = opt.values.map(
+        (option) => web.raw`<option
+          class="select-option"
+          value="${web.escape(option)}"
+          ${option === value ? 'selected' : ''}
+        >${web.escape(option)}</option>`
+      ),
+      $select = web.html`<select class="input">
+        ${$options.join('')}
+      </select>`,
+      $icon = web.html`${await components.feather('chevron-down', { class: 'input-icon' })}`;
+    if (opt.tooltip)
+      components.addTooltip($tooltipIcon, opt.tooltip, {
+        offsetDirection: 'left',
+        maxLines: 3,
+      });
+    $select.addEventListener('change', async (_event) => {
+      await profileDB.set([mod.id, opt.key], $select.value);
+      notifications.onChange();
+    });
+    return web.render($label, $select, $icon);
+  },
+
+  text: async (mod, opt) => {
+    const profileDB = await registry.profileDB(),
+      value = await profileDB.get([mod.id, opt.key], opt.value),
+      $tooltipIcon = web.html`${await components.feather('info', { class: 'input-tooltip' })}`,
+      $label = web.render(
+        web.html`<label class="input-label"></label>`,
+        web.render(web.html`<p></p>`, opt.tooltip ? $tooltipIcon : '', opt.label)
+      ),
+      $input = web.html`<input type="text" class="input" value="${web.escape(value)}">`,
+      $icon = web.html`${await components.feather('type', { class: 'input-icon' })}`;
+    if (opt.tooltip)
+      components.addTooltip($tooltipIcon, opt.tooltip, {
+        offsetDirection: 'left',
+        maxLines: 3,
+      });
+    $input.addEventListener('change', async (_event) => {
+      await profileDB.set([mod.id, opt.key], $input.value);
+      notifications.onChange();
+    });
+    return web.render($label, $input, $icon);
+  },
+
+  number: async (mod, opt) => {
+    const profileDB = await registry.profileDB(),
+      value = await profileDB.get([mod.id, opt.key], opt.value),
+      $tooltipIcon = web.html`${await components.feather('info', { class: 'input-tooltip' })}`,
+      $label = web.render(
+        web.html`<label class="input-label"></label>`,
+        web.render(web.html`<p></p>`, opt.tooltip ? $tooltipIcon : '', opt.label)
+      ),
+      $input = web.html`<input type="number" class="input" value="${value}">`,
+      $icon = web.html`${await components.feather('hash', { class: 'input-icon' })}`;
+    if (opt.tooltip)
+      components.addTooltip($tooltipIcon, opt.tooltip, {
+        offsetDirection: 'left',
+        maxLines: 3,
+      });
+    $input.addEventListener('change', async (_event) => {
+      await profileDB.set([mod.id, opt.key], $input.value);
+      notifications.onChange();
+    });
+    return web.render($label, $input, $icon);
+  },
+
+  color: async (mod, opt) => {
+    const profileDB = await registry.profileDB(),
+      value = await profileDB.get([mod.id, opt.key], opt.value),
+      $tooltipIcon = web.html`${await components.feather('info', { class: 'input-tooltip' })}`,
+      $label = web.render(
+        web.html`<label class="input-label"></label>`,
+        web.render(web.html`<p></p>`, opt.tooltip ? $tooltipIcon : '', opt.label)
+      ),
+      $input = web.html`<input type="text" class="input">`,
+      $icon = web.html`${await components.feather('droplet', { class: 'input-icon' })}`,
+      paint = () => {
+        $input.style.background = $picker.toBackground();
+        const [r, g, b] = $picker
+          .toRGBAString()
+          .slice(5, -1)
+          .split(',')
+          .map((i) => parseInt(i));
+        $input.style.color = fmt.rgbContrast(r, g, b);
+        $input.style.padding = '';
+      },
+      $picker = new JSColor($input, {
+        value,
+        format: 'rgba',
+        previewSize: 0,
+        borderRadius: 3,
+        borderColor: 'var(--theme--ui_divider)',
+        controlBorderColor: 'var(--theme--ui_divider)',
+        backgroundColor: 'var(--theme--bg)',
+        onInput: paint,
+        onChange: paint,
+      });
+    if (opt.tooltip)
+      components.addTooltip($tooltipIcon, opt.tooltip, {
+        offsetDirection: 'left',
+        maxLines: 3,
+      });
+    $input.addEventListener('change', async (_event) => {
+      await profileDB.set([mod.id, opt.key], $input.value);
+      notifications.onChange();
+    });
+    paint();
+    return web.render($label, $input, $icon);
+  },
+
+  file: async (mod, opt) => {
+    const profileDB = await registry.profileDB(),
+      { filename } = (await profileDB.get([mod.id, opt.key], {})) || {},
+      $tooltipIcon = web.html`${await components.feather('info', { class: 'input-tooltip' })}`,
+      $label = web.render(
+        web.html`<label class="input-label"></label>`,
+        web.render(web.html`<p></p>`, opt.tooltip ? $tooltipIcon : '', opt.label)
+      ),
+      $pseudo = web.html`<span class="input"><span class="input-placeholder">Upload file...</span></span>`,
+      $input = web.html`<input type="file" class="hidden" accept=${web.escape(
+        opt.extensions.join(',')
+      )}>`,
+      $icon = web.html`${await components.feather('file', { class: 'input-icon' })}`,
+      $filename = web.html`<span>${web.escape(filename || 'none')}</span>`,
+      $latest = web.render(web.html`<button class="file-latest">Latest: </button>`, $filename);
+    if (opt.tooltip)
+      components.addTooltip($tooltipIcon, opt.tooltip, {
+        offsetDirection: 'left',
+        maxLines: 3,
+      });
+    $input.addEventListener('change', (event) => {
+      const file = event.target.files[0],
+        reader = new FileReader();
+      reader.onload = async (progress) => {
+        $filename.innerText = file.name;
+        await profileDB.set([mod.id, opt.key], {
+          filename: file.name,
+          content: progress.currentTarget.result,
+        });
+        notifications.onChange();
+      };
+      reader.readAsText(file);
+    });
+    $latest.addEventListener('click', (_event) => {
+      $filename.innerText = 'none';
+      profileDB.set([mod.id, opt.key], {});
+    });
+    return web.render(
+      web.html`<div></div>`,
+      web.render($label, $input, $pseudo, $icon),
+      $latest
+    );
+  },
+
+  hotkey: async (mod, opt) => {
+    const profileDB = await registry.profileDB(),
+      value = await profileDB.get([mod.id, opt.key], opt.value),
+      $tooltipIcon = web.html`${await components.feather('info', { class: 'input-tooltip' })}`,
+      $label = web.render(
+        web.html`<label class="input-label"></label>`,
+        web.render(web.html`<p></p>`, opt.tooltip ? $tooltipIcon : '', opt.label)
+      ),
+      $input = web.html`<input type="text" class="input" value="${web.escape(value)}">`,
+      $icon = web.html`${await components.feather('command', { class: 'input-icon' })}`;
+    if (opt.tooltip)
+      components.addTooltip($tooltipIcon, opt.tooltip, {
+        offsetDirection: 'left',
+        maxLines: 3,
+      });
+    $input.addEventListener('keydown', async (event) => {
+      event.preventDefault();
+      const pressed = [],
+        modifiers = {
+          metaKey: 'Meta',
+          ctrlKey: 'Control',
+          altKey: 'Alt',
+          shiftKey: 'Shift',
+        };
+      for (const modifier in modifiers) {
+        if (event[modifier]) pressed.push(modifiers[modifier]);
+      }
+      const empty = ['Backspace', 'Delete'].includes(event.key) && !pressed.length;
+      if (!empty && !pressed.includes(event.key)) {
+        let key = event.key;
+        if (key === ' ') key = 'Space';
+        if (key === '+') key = 'Plus';
+        if (key.length === 1) key = event.key.toUpperCase();
+        pressed.push(key);
+      }
+      $input.value = pressed.join('+');
+      await profileDB.set([mod.id, opt.key], $input.value);
+      notifications.onChange();
+    });
+    return web.render($label, $input, $icon);
+  },
+};
diff --git a/src/mods/menu/markdown.css b/src/mods/menu/markdown.css
new file mode 100644
index 0000000..2a23626
--- /dev/null
+++ b/src/mods/menu/markdown.css
@@ -0,0 +1,97 @@
+/**
+ * notion-enhancer: menu
+ * (c) 2021 dragonwocky <thedragonring.bod@gmail.com> (https://dragonwocky.me/)
+ * (https://notion-enhancer.github.io/) under the MIT license
+ */
+
+.markdown table {
+  border-spacing: 0;
+  border: 1px solid var(--theme--ui_divider);
+}
+.markdown table th {
+  text-align: left;
+}
+.markdown table th,
+.markdown table td {
+  padding: 5px 8px 6px;
+  border: 1px solid var(--theme--ui_divider);
+}
+.markdown h1 {
+  font-size: 1.875rem;
+  margin: 1rem 0 0.5rem 0;
+}
+.markdown h2 {
+  font-size: 1.5rem;
+  margin: 1rem 0 0.5rem 0;
+}
+.markdown h3 {
+  font-size: 1.25rem;
+  margin: 1rem 0 0.5rem 0;
+}
+.markdown h4 {
+  font-weight: bold;
+  margin: 0.5rem 0;
+}
+.markdown ul,
+.markdown ol {
+  padding-left: 1.25rem;
+}
+.markdown ul {
+  list-style: disc;
+}
+.markdown ol {
+  list-style: decimal;
+}
+.markdown li {
+  margin: 1px 0;
+}
+.markdown ol li {
+  padding-left: 0.25rem;
+}
+.markdown blockquote {
+  border-left: 2px solid currentColor;
+  padding-left: 0.75rem;
+  margin: 0.5rem 0;
+}
+.markdown hr {
+  border: 0.5px solid var(--theme--ui_divider);
+}
+.markdown-inline a,
+.markdown a {
+  opacity: 0.7;
+  text-decoration: none;
+  border-bottom: 0.05em solid var(--theme--text_secondary);
+}
+.markdown-inline a:hover,
+.markdown a:hover {
+  opacity: 0.9;
+}
+
+.markdown :not(pre) > code,
+.markdown-inline code {
+  padding: 0.2em 0.4em;
+  border-radius: 3px;
+  background: var(--theme--code_inline);
+  color: var(--theme--code_inline-text);
+}
+.markdown pre {
+  padding: 2em 1.25em;
+  border-radius: 3px;
+  tab-size: 2;
+  white-space: pre;
+  overflow-x: auto;
+  background: var(--theme--code);
+  color: var(--theme--code_plain);
+}
+.markdown pre,
+.markdown code,
+.markdown-inline code {
+  font-family: var(--theme--font_code);
+  font-size: 0.796875rem;
+  text-align: left;
+  word-spacing: normal;
+  word-break: normal;
+  word-wrap: normal;
+  hyphens: none;
+  line-height: 1.5;
+}
diff --git a/src/mods/menu/menu.css b/src/mods/menu/menu.css
new file mode 100644
index 0000000..5a11697
--- /dev/null
+++ b/src/mods/menu/menu.css
@@ -0,0 +1,25 @@
+/**
+ * notion-enhancer: menu
+ * (c) 2021 dragonwocky <thedragonring.bod@gmail.com> (https://dragonwocky.me/)
+ * (https://notion-enhancer.github.io/) under the MIT license
+ */
+
+::selection {
+  background: var(--theme--accent_blue-selection);
+}
+
+::-webkit-scrollbar {
+  width: 10px;
+  height: 10px;
+  background: transparent;
+}
+::-webkit-scrollbar-track,
+::-webkit-scrollbar-corner {
+  background: var(--theme--scrollbar_track) !important;
+}
+::-webkit-scrollbar-thumb {
+  background: var(--theme--scrollbar_thumb) !important;
+}
+::-webkit-scrollbar-thumb:hover {
+  background: var(--theme--scrollbar_thumb-hover) !important;
+}
diff --git a/src/mods/menu/menu.html b/src/mods/menu/menu.html
new file mode 100644
index 0000000..ec6337a
--- /dev/null
+++ b/src/mods/menu/menu.html
@@ -0,0 +1,11 @@
+<!DOCTYPE html>
+<html lang="en">
+  <head>
+    <meta charset="UTF-8" />
+    <meta name="viewport" content="width=device-width, initial-scale=1.0" />
+    <title>notion-enhancer menu</title>
+  </head>
+  <body>
+    <script src="./menu.mjs" type="module"></script>
+  </body>
+</html>
diff --git a/src/mods/menu/menu.mjs b/src/mods/menu/menu.mjs
new file mode 100644
index 0000000..ab8105b
--- /dev/null
+++ b/src/mods/menu/menu.mjs
@@ -0,0 +1,448 @@
+/**
+ * notion-enhancer: menu
+ * (c) 2021 dragonwocky <thedragonring.bod@gmail.com> (https://dragonwocky.me/)
+ * (https://notion-enhancer.github.io/) under the MIT license
+ */
+
+'use strict';
+
+import * as api from '../../api/index.mjs';
+import { notifications, $changelogModal } from './notifications.mjs';
+import { modComponents, options } from './components.mjs';
+import * as router from './router.mjs';
+import './styles.mjs';
+
+(async () => {
+  const { env, fs, storage, electron, registry, web, components } = api;
+
+  for (const mod of await registry.list((mod) => registry.enabled(mod.id))) {
+    for (let script of mod.js?.menu || []) {
+      script = await import(fs.localPath(`repo/${mod._dir}/${script}`));
+      script.default(api, await registry.db(mod.id));
+    }
+  }
+  const errors = await registry.errors();
+  if (errors.length) {
+    console.error('[notion-enhancer] registry errors:');
+    console.table(errors);
+    const $errNotification = await notifications.add({
+      icon: 'alert-circle',
+      message: 'Failed to load mods (check console).',
+      color: 'red',
+    });
+    if (['win32', 'linux', 'darwin'].includes(env.name)) {
+      $errNotification.addEventListener('click', () => electron.browser.openDevTools());
+    }
+  }
+
+  const db = await registry.db('a6621988-551d-495a-97d8-3c568bca2e9e'),
+    profileName = await registry.profileName(),
+    profileDB = await registry.profileDB();
+
+  web.addHotkeyListener(await db.get(['hotkey']), env.focusNotion);
+
+  globalThis.addEventListener('beforeunload', (_event) => {
+    // trigger input save
+    document.activeElement.blur();
+  });
+
+  const $main = web.html`<main class="main"></main>`,
+    $sidebar = web.html`<article class="sidebar"></article>`,
+    $options = web.html`<div class="options-container">
+    <p class="options-placeholder">Select a mod to view and configure its options.</p>
+  </div>`,
+    $profile = web.html`<button class="profile-trigger">
+    Profile: ${web.escape(profileName)}
+  </button>`;
+
+  // profile
+
+  let _$profileConfig;
+  const openProfileMenu = async () => {
+    if (!_$profileConfig) {
+      const profileNames = [
+          ...new Set([
+            ...Object.keys(await storage.get(['profiles'], { default: {} })),
+            profileName,
+          ]),
+        ],
+        $options = profileNames.map(
+          (profile) => web.raw`<option
+          class="select-option"
+          value="${web.escape(profile)}"
+          ${profile === profileName ? 'selected' : ''}
+        >${web.escape(profile)}</option>`
+        ),
+        $select = web.html`<select class="input">
+        <option class="select-option" value="--">-- new --</option>
+        ${$options.join('')}
+      </select>`,
+        $edit = web.html`<input
+        type="text"
+        class="input"
+        value="${web.escape(profileName)}"
+        pattern="/^[A-Za-z0-9_-]+$/"
+      >`,
+        $export = web.html`<button class="profile-export">
+        ${await components.feather('download', { class: 'profile-icon-action' })}
+      </button>`,
+        $import = web.html`<label class="profile-import">
+        <input type="file" class="hidden" accept="application/json">
+        ${await components.feather('upload', { class: 'profile-icon-action' })}
+      </label>`,
+        $save = web.html`<button class="profile-save">
+        ${await components.feather('save', { class: 'profile-icon-text' })} Save
+      </button>`,
+        $delete = web.html`<button class="profile-delete">
+        ${await components.feather('trash-2', { class: 'profile-icon-text' })} Delete
+      </button>`,
+        $error = web.html`<p class="profile-error"></p>`;
+
+      $export.addEventListener('click', async (_event) => {
+        const now = new Date(),
+          $a = web.html`<a
+          class="hidden"
+          download="notion-enhancer_${web.escape($select.value)}_${now.getFullYear()}-${
+            now.getMonth() + 1
+          }-${now.getDate()}.json"
+          href="data:text/plain;charset=utf-8,${encodeURIComponent(
+            JSON.stringify(await storage.get(['profiles', $select.value], {}), null, 2)
+          )}"
+        ></a>`;
+        web.render(document.body, $a);
+        $a.click();
+        $a.remove();
+      });
+
+      $import.addEventListener('change', (event) => {
+        const file = event.target.files[0],
+          reader = new FileReader();
+        reader.onload = async (progress) => {
+          try {
+            const profileUpload = JSON.parse(progress.currentTarget.result);
+            if (!profileUpload) throw Error;
+            await storage.set(['profiles', $select.value], profileUpload);
+            env.reload();
+          } catch {
+            web.render(web.empty($error), 'Invalid JSON uploaded.');
+          }
+        };
+        reader.readAsText(file);
+      });
+
+      $select.addEventListener('change', (_event) => {
+        if ($select.value === '--') {
+          $edit.value = '';
+        } else $edit.value = $select.value;
+      });
+
+      $save.addEventListener('click', async (_event) => {
+        if (profileNames.includes($edit.value) && $select.value !== $edit.value) {
+          web.render(
+            web.empty($error),
+            `The profile "${web.escape($edit.value)}" already exists.`
+          );
+          return false;
+        }
+        if (!$edit.value || !$edit.value.match(/^[A-Za-z0-9_-]+$/)) {
+          web.render(
+            web.empty($error),
+            'Profile names may not be empty & may only contain letters, numbers, hyphens and underscores.'
+          );
+          return false;
+        }
+        await storage.set(['currentprofile'], $edit.value);
+        if ($select.value === '--') {
+          await storage.set(['profiles', $edit.value], {});
+        } else if ($select.value !== $edit.value) {
+          await storage.set(
+            ['profiles', $edit.value],
+            await storage.get(['profiles', $select.value], {})
+          );
+          await storage.set(['profiles', $select.value], undefined);
+        }
+        env.reload();
+      });
+
+      $delete.addEventListener('click', async (_event) => {
+        await storage.set(['profiles', $select.value], undefined);
+        await storage.set(
+          ['currentprofile'],
+          profileNames.find((profile) => profile !== $select.value) || 'default'
+        );
+        env.reload();
+      });
+
+      _$profileConfig = web.render(
+        web.html`<div></div>`,
+        web.html`<p class="options-placeholder">
+        Profiles are used to switch entire configurations.<br>
+        Be careful - deleting a profile deletes all configuration
+        related to it.<br>
+      </p>`,
+        web.render(
+          web.html`<label class="input-label"></label>`,
+          $select,
+          web.html`${await components.feather('chevron-down', { class: 'input-icon' })}`
+        ),
+        web.render(
+          web.html`<label class="input-label"></label>`,
+          $edit,
+          web.html`${await components.feather('type', { class: 'input-icon' })}`
+        ),
+        web.render(
+          web.html`<p class="profile-actions"></p>`,
+          $export,
+          $import,
+          $save,
+          $delete
+        ),
+        $error
+      );
+    }
+    web.render(web.empty($options), _$profileConfig);
+  };
+  $profile.addEventListener('click', () => openSidebarMenu('profile'));
+
+  // mods
+
+  const $modLists = {},
+    generators = {
+      options: async (mod) => {
+        const $fragment = document.createDocumentFragment();
+        for (const opt of mod.options) {
+          if (!opt.environments.includes(env.name)) continue;
+          web.render($fragment, await options[opt.type](mod, opt));
+        }
+        if (!mod.options.length) {
+          web.render($fragment, web.html`<p class="options-placeholder">No options.</p>`);
+        }
+        return $fragment;
+      },
+      mod: async (mod) => {
+        const $mod = web.html`<div class="mod" data-id="${web.escape(mod.id)}"></div>`,
+          $toggle = modComponents.toggle('', await registry.enabled(mod.id));
+        $toggle.addEventListener('change', async (event) => {
+          if (event.target.checked && mod.tags.includes('theme')) {
+            const mode = mod.tags.includes('light') ? 'light' : 'dark',
+              id = mod.id,
+              mods = await registry.list(
+                async (mod) =>
+                  (await registry.enabled(mod.id)) &&
+                  mod.tags.includes('theme') &&
+                  mod.tags.includes(mode) &&
+                  mod.id !== id
+              );
+            for (const mod of mods) {
+              profileDB.set(['_mods', mod.id], false);
+              document.querySelector(
+                `[data-id="${web.escape(mod.id)}"] .toggle-check`
+              ).checked = false;
+            }
+          }
+          profileDB.set(['_mods', mod.id], event.target.checked);
+          notifications.onChange();
+        });
+        $mod.addEventListener('click', () => openSidebarMenu(mod.id));
+        return web.render(
+          web.html`<article class="mod-container"></article>`,
+          web.render(
+            $mod,
+            mod.preview
+              ? modComponents.preview(
+                  mod.preview.startsWith('http')
+                    ? mod.preview
+                    : fs.localPath(`repo/${mod._dir}/${mod.preview}`)
+                )
+              : '',
+            web.render(
+              web.html`<div class="mod-body"></div>`,
+              web.render(modComponents.title(mod.name), modComponents.version(mod.version)),
+              modComponents.tags(mod.tags),
+              modComponents.description(mod.description),
+              modComponents.authors(mod.authors),
+              mod.environments.includes(env.name) && !registry.core.includes(mod.id)
+                ? $toggle
+                : ''
+            )
+          )
+        );
+      },
+      modList: async (category, message = '') => {
+        if (!$modLists[category]) {
+          const $search = web.html`<input type="search" class="search"
+          placeholder="Search ('/' to focus)">`,
+            $list = web.html`<div class="mods-list"></div>`,
+            mods = await registry.list(
+              (mod) => mod.environments.includes(env.name) && mod.tags.includes(category)
+            );
+          web.addHotkeyListener(['/'], () => $search.focus());
+          $search.addEventListener('input', (_event) => {
+            const query = $search.value.toLowerCase();
+            for (const $mod of $list.children) {
+              const matches = !query || $mod.innerText.toLowerCase().includes(query);
+              $mod.classList[matches ? 'remove' : 'add']('hidden');
+            }
+          });
+          for (const mod of mods) {
+            mod.tags = mod.tags.filter((tag) => tag !== category);
+            web.render($list, await generators.mod(mod));
+            mod.tags.unshift(category);
+          }
+          $modLists[category] = web.render(
+            web.html`<div></div>`,
+            web.render(
+              web.html`<label class="search-container"></label>`,
+              $search,
+              web.html`${await components.feather('search', { class: 'input-icon' })}`
+            ),
+            message ? web.render(web.html`<p class="main-message"></p>`, message) : '',
+            $list
+          );
+        }
+        return $modLists[category];
+      },
+    };
+
+  async function openModMenu(id) {
+    let $mod;
+    for (const $list of Object.values($modLists)) {
+      $mod = $list.querySelector(`[data-id="${web.escape(id)}"]`);
+      if ($mod) break;
+    }
+    const mod = await registry.get(id);
+    if (!$mod || !mod || $mod.className === 'mod-selected') return;
+
+    $mod.className = 'mod-selected';
+    const fragment = [
+      web.render(modComponents.title(mod.name), modComponents.version(mod.version)),
+      modComponents.tags(mod.tags),
+      await generators.options(mod),
+    ];
+    web.render(web.empty($options), ...fragment);
+  }
+
+  // views
+
+  const $notionNavItem = web.html`<h1 class="nav-notion">
+    ${(await fs.getText('media/colour.svg')).replace(
+      /width="\d+" height="\d+"/,
+      `class="nav-notion-icon"`
+    )}
+    <span>notion-enhancer</span>
+  </h1>`;
+  $notionNavItem.addEventListener('click', env.focusNotion);
+
+  const $coreNavItem = web.html`<a href="?view=core" class="nav-item">core</a>`,
+    $extensionsNavItem = web.html`<a href="?view=extensions" class="nav-item">extensions</a>`,
+    $themesNavItem = web.html`<a href="?view=themes" class="nav-item">themes</a>`,
+    $integrationsNavItem = web.html`<a href="?view=integrations" class="nav-item">integrations</a>`,
+    $changelogNavItem = web.html`<button class="nav-item nav-changelog">
+    ${await components.feather('clock', { class: 'nav-changelog-icon' })}
+  </button>`;
+  components.addTooltip($changelogNavItem, '**Update changelog & welcome message**');
+  $changelogNavItem.addEventListener('click', () => {
+    $changelogModal.scrollTop = 0;
+    $changelogModal.classList.add('modal-visible');
+  });
+
+  web.render(
+    document.body,
+    web.render(
+      web.html`<div class="body-container"></div>`,
+      web.render(
+        web.html`<div class="content-container"></div>`,
+        web.render(
+          web.html`<nav class="nav"></nav>`,
+          $notionNavItem,
+          $coreNavItem,
+          $extensionsNavItem,
+          $themesNavItem,
+          $integrationsNavItem,
+          web.html`<a href="https://notion-enhancer.github.io" target="_blank" class="nav-item">docs</a>`,
+          web.html`<a href="https://discord.gg/sFWPXtA" target="_blank" class="nav-item">community</a>`,
+          $changelogNavItem
+        ),
+        $main
+      ),
+      web.render($sidebar, $profile, $options)
+    )
+  );
+
+  function selectNavItem($item) {
+    for (const $selected of document.querySelectorAll('.nav-item-selected')) {
+      $selected.className = 'nav-item';
+    }
+    $item.className = 'nav-item-selected';
+  }
+
+  await generators.modList(
+    'core',
+    `Core mods provide the basics required for
+   all other extensions and themes to work. They
+   can't be disabled, but they can be configured
+   - just click on a mod to access its options.`
+  );
+  router.addView('core', async () => {
+    web.empty($main);
+    selectNavItem($coreNavItem);
+    return web.render($main, await generators.modList('core'));
+  });
+
+  await generators.modList(
+    'extension',
+    `Extensions build on the functionality and layout of
+   the Notion client, modifying and interacting with
+   existing interfaces.`
+  );
+  router.addView('extensions', async () => {
+    web.empty($main);
+    selectNavItem($extensionsNavItem);
+    return web.render($main, await generators.modList('extension'));
+  });
+
+  await generators.modList(
+    'theme',
+    `Themes change Notion's colour scheme.
+   Dark themes will only work when Notion is in dark mode,
+   and light themes will only work when Notion is in light mode.
+   Only one theme of each mode can be enabled at a time.`
+  );
+  router.addView('themes', async () => {
+    web.empty($main);
+    selectNavItem($themesNavItem);
+    return web.render($main, await generators.modList('theme'));
+  });
+
+  await generators.modList(
+    'integration',
+    web.html`<span class="danger">Integrations are extensions that use an unofficial API
+   to access and modify content. They are used just like
+   normal extensions, but may be more dangerous to use.</span>`
+  );
+  router.addView('integrations', async () => {
+    web.empty($main);
+    selectNavItem($integrationsNavItem);
+    return web.render($main, await generators.modList('integration'));
+  });
+
+  router.setDefaultView('extensions');
+
+  router.addQueryListener('id', openSidebarMenu);
+  function openSidebarMenu(id) {
+    if (!id) return;
+    id = web.escape(id);
+
+    const deselectedMods = `.mod-selected:not([data-id="${id}"])`;
+    for (const $list of Object.values($modLists)) {
+      for (const $selected of $list.querySelectorAll(deselectedMods)) {
+        $selected.className = 'mod';
+      }
+    }
+    router.updateQuery(`?id=${id}`);
+
+    if (id === 'profile') {
+      openProfileMenu();
+    } else openModMenu(id);
+  }
+})();
diff --git a/src/mods/menu/mod.json b/src/mods/menu/mod.json
new file mode 100644
index 0000000..7689da9
--- /dev/null
+++ b/src/mods/menu/mod.json
@@ -0,0 +1,31 @@
+{
+  "name": "menu",
+  "id": "a6621988-551d-495a-97d8-3c568bca2e9e",
+  "version": "0.11.0",
+  "description": "the enhancer's graphical menu, related buttons and shortcuts.",
+  "tags": ["core"],
+  "authors": [
+    {
+      "name": "dragonwocky",
+      "email": "thedragonring.bod@gmail.com",
+      "homepage": "https://dragonwocky.me/",
+      "avatar": "https://dragonwocky.me/avatar.jpg"
+    }
+  ],
+  "css": {
+    "client": ["client.css"],
+    "menu": ["menu.css", "markdown.css"]
+  },
+  "js": {
+    "client": ["client.mjs"]
+  },
+  "options": [
+    {
+      "type": "hotkey",
+      "key": "hotkey",
+      "label": "toggle focus hotkey",
+      "tooltip": "**switches between notion & the enhancer menu**",
+      "value": "Ctrl+Alt+E"
+    }
+  ]
+}
diff --git a/src/mods/menu/notifications.mjs b/src/mods/menu/notifications.mjs
new file mode 100644
index 0000000..faf884b
--- /dev/null
+++ b/src/mods/menu/notifications.mjs
@@ -0,0 +1,146 @@
+/**
+ * notion-enhancer: menu
+ * (c) 2021 dragonwocky <thedragonring.bod@gmail.com> (https://dragonwocky.me/)
+ * (https://notion-enhancer.github.io/) under the MIT license
+ */
+
+import { env, fs, storage, web, components } from '../../api/index.mjs';
+import { tw } from './styles.mjs';
+
+import '../../dep/markdown-it.min.js';
+const md = markdownit({ linkify: true });
+
+const notificationsURL = 'https://notion-enhancer.github.io/notifications.json';
+export const notifications = {
+  $container: web.html`<div class="notifications-container"></div>`,
+  async add({ icon, message, id = undefined, color = undefined, link = undefined }) {
+    const $notification = link
+        ? web.html`<a
+          href="${web.escape(link)}"
+          class="${tw`notification-${color || 'default'}`}"
+          role="alert"
+          target="_blank"
+        ></a>`
+        : web.html`<p
+          class="${tw`notification-${color || 'default'}`}"
+          role="alert"
+          tabindex="0"
+        ></p>`,
+      resolve = async () => {
+        if (id !== undefined) {
+          notifications.cache.push(id);
+          await storage.set(['notifications'], notifications.cache);
+        }
+        $notification.remove();
+      };
+    $notification.addEventListener('click', resolve);
+    $notification.addEventListener('keyup', (event) => {
+      if (['Enter', ' '].includes(event.key)) resolve();
+    });
+    web.render(
+      notifications.$container,
+      web.render(
+        $notification,
+        web.html`<span class="notification-text markdown-inline">
+          ${md.renderInline(message)}
+        </span>`,
+        web.html`${await components.feather(icon, { class: 'notification-icon' })}`
+      )
+    );
+    return $notification;
+  },
+  _onChange: false,
+  async onChange() {
+    if (this._onChange) return;
+    this._onChange = true;
+    const $notification = await this.add({
+      icon: 'refresh-cw',
+      message: 'Reload to apply changes.',
+    });
+    $notification.addEventListener('click', env.reload);
+  },
+};
+
+(async () => {
+  notifications.cache = await storage.get(['notifications'], []);
+  notifications.provider = await fs.getJSON(notificationsURL);
+
+  web.render(document.body, notifications.$container);
+  for (const notification of notifications.provider) {
+    const cached = notifications.cache.includes(notification.id),
+      versionMatches = notification.version === env.version,
+      envMatches = !notification.environments || notification.environments.includes(env.name);
+    if (!cached && versionMatches && envMatches) notifications.add(notification);
+  }
+})();
+
+export const $changelogModal = web.render(
+  web.html`<div class="modal" role="dialog" aria-modal="true">
+    <div class="modal-overlay" aria-hidden="true"></div>
+  </div>`
+);
+
+(async () => {
+  const $changelogModalButton = web.html`<button type="button" class="modal-button">
+    Accept & Continue
+  </button>`;
+  $changelogModalButton.addEventListener('click', async () => {
+    $changelogModal.classList.remove('modal-visible');
+    await storage.set(['last_read_changelog'], env.version);
+  });
+
+  web.render(
+    $changelogModal,
+    web.render(
+      web.html`<div class="modal-box"></div>`,
+      web.html`<div class="modal-body">
+        <div class="modal-title">
+          ${(await fs.getText('media/colour.svg')).replace(
+            /width="\d+" height="\d+"/,
+            `class="modal-title-icon"`
+          )}
+          <div>
+            <h1 class="modal-title-heading">
+              notion-enhancer v${env.version}
+            </h1>
+            <p class="modal-title-description">
+              an enhancer/customiser for the all-in-one productivity workspace notion.so
+            </p>
+          </div>
+        </div>
+        <div class="modal-content">
+          <p>
+            Welcome to the notion-enhancer! For help getting started, check out the
+            <a href="https://notion-enhancer.github.io/getting-started/basic-usage/" class="link" target="_blank">
+            basic usage</a> guide. If you've upgraded from a previous version of the notion-enhancer, you can see
+            what's new <a href="https://notion-enhancer.github.io/about/changelog/" class="link">here</a>.
+          </p>
+          <p>
+            If you spot a bug or have a new feature idea, have a read through the
+            <a href="https://notion-enhancer.github.io/about/contributing/" class="link">Contributing</a>
+            guide to learn how & where to talk to us about it. For extra support, come join our
+            <a href="https://discord.com/invite/sFWPXtA" class="link" target="_blank">Discord community</a>.
+          </p>
+          <p>
+            Maintaining and updating the notion-enhancer does take a lot of time and work,
+            so if you'd like to support future development
+            <a href="https://github.com/sponsors/dragonwocky" class="important-link" target="_blank">
+            please consider making a donation</a>.
+          </p>
+          <p>
+            By clicking &quot;Accept & Continue&quot; below you agree to the notion-enhancer's
+            <a href="https://notion-enhancer.github.io/about/privacy-policy/" class="link">Privacy Policy</a> and
+            <a href="https://notion-enhancer.github.io/about/terms-and-conditions/" class="link">Terms & Conditions</a>.
+          </p>
+        </div>
+      </div>`,
+      web.render(web.html`<div class="modal-actions"></div>`, $changelogModalButton)
+    )
+  );
+
+  const lastReadChangelog = await storage.get(['last_read_changelog']);
+  web.render(document.body, $changelogModal);
+  if (lastReadChangelog !== env.version) {
+    $changelogModal.classList.add('modal-visible');
+  }
+})();
diff --git a/src/mods/menu/router.mjs b/src/mods/menu/router.mjs
new file mode 100644
index 0000000..2eb88cc
--- /dev/null
+++ b/src/mods/menu/router.mjs
@@ -0,0 +1,88 @@
+/**
+ * notion-enhancer: menu
+ * (c) 2021 dragonwocky <thedragonring.bod@gmail.com> (https://dragonwocky.me/)
+ * (https://notion-enhancer.github.io/) under the MIT license
+ */
+
+'use strict';
+
+import { web } from '../../api/index.mjs';
+
+const _queryListeners = new Set();
+
+export function addView(name, loadFunc) {
+  const handlerFunc = (newView) => {
+    if (newView === name) return loadFunc();
+    return false;
+  };
+  _queryListeners.add({ param: 'view', viewName: name, handlerFunc });
+  handlerFunc(web.queryParams().get('view'), null);
+}
+export function removeView(name) {
+  const view = [..._queryListeners].find((view) => view.viewName === name);
+  if (view) _queryListeners.delete(view);
+}
+export async function setDefaultView(viewName) {
+  const viewList = [..._queryListeners].filter((q) => q.viewName).map((v) => v.viewName);
+  if (!viewList.includes(web.queryParams().get('view'))) {
+    updateQuery(`?view=${viewName}`, true);
+  }
+}
+
+export function addQueryListener(param, handlerFunc) {
+  _queryListeners.add({ param: param, handlerFunc });
+  handlerFunc(web.queryParams().get(param), null);
+}
+export function removeQueryListener(handlerFunc) {
+  const listener = [..._queryListeners].find((view) => view.handlerFunc === handlerFunc);
+  if (listener) _queryListeners.delete(listener);
+}
+
+export const updateQuery = (search, replace = false) => {
+  let query = web.queryParams();
+  for (const [key, val] of new URLSearchParams(search)) {
+    query.set(key, val);
+  }
+  query = `?${query.toString()}`;
+  if (location.search !== query) {
+    if (replace) {
+      window.history.replaceState(null, null, query);
+    } else {
+      window.history.pushState(null, null, query);
+    }
+    triggerQueryListeners();
+  }
+};
+
+function router(event) {
+  event.preventDefault();
+  const anchor = event.path
+    ? event.path.find((anchor) => anchor.nodeName === 'A')
+    : event.target;
+  updateQuery(anchor.getAttribute('href'));
+}
+
+let queryCache = '';
+async function triggerQueryListeners() {
+  if (location.search === queryCache) return;
+  const newQuery = web.queryParams(),
+    oldQuery = new URLSearchParams(queryCache);
+  queryCache = location.search;
+  for (const listener of _queryListeners) {
+    const newParam = newQuery.get(listener.param),
+      oldParam = oldQuery.get(listener.param);
+    if (newParam !== oldParam) listener.handlerFunc(newParam, oldParam);
+  }
+}
+
+window.addEventListener('popstate', triggerQueryListeners);
+
+web.addDocumentObserver(
+  (mutation) => {
+    mutation.target.querySelectorAll('a[href^="?"]').forEach((a) => {
+      a.removeEventListener('click', router);
+      a.addEventListener('click', router);
+    });
+  },
+  ['a[href^="?"]']
+);
diff --git a/src/mods/menu/styles.mjs b/src/mods/menu/styles.mjs
new file mode 100644
index 0000000..0ce7925
--- /dev/null
+++ b/src/mods/menu/styles.mjs
@@ -0,0 +1,182 @@
+/**
+ * notion-enhancer: menu
+ * (c) 2021 dragonwocky <thedragonring.bod@gmail.com> (https://dragonwocky.me/)
+ * (https://notion-enhancer.github.io/) under the MIT license
+ */
+
+'use strict';
+
+// css-in-js for better component generation
+
+import { tw, apply, setup } from '../../dep/twind.mjs';
+import { content } from '../../dep/twind-content.mjs';
+
+const pseudoContent = content('""'),
+  mapColorVariables = (color) => ({
+    'text': `var(--theme--text_${color})`,
+    'highlight': `var(--theme--highlight_${color})`,
+    'highlight-text': `var(--theme--highlight_${color}-text)`,
+    'callout': `var(--theme--callout_${color})`,
+    'callout-text': `var(--theme--callout_${color}-text)`,
+    'tag': `var(--theme--tag_${color})`,
+    'tag-text': `var(--theme--tag_${color}-text)`,
+    'board': `var(--theme--board_${color})`,
+    'board-text': `var(--theme--board_${color}-text)`,
+    'board-card': `var(--theme--board_${color}-card)`,
+    'board-card_text': `var(--theme--board_${color}-card_text)`,
+  });
+
+const customClasses = {
+  'notifications-container': apply`absolute bottom-0 right-0 px-4 py-3 max-w-full w-96 z-10`,
+  'notification': ([color = 'default']) =>
+    apply`p-2 border group hover:(filter brightness-125) ${
+      color === 'default'
+        ? 'bg-tag text-tag-text border-divider'
+        : `bg-${color}-tag text-${color}-tag-text border-${color}-text`
+    } flex items-center rounded-full mt-3 shadow-md cursor-pointer`,
+  'notification-text': apply`text-xs mx-2 flex-auto font-semibold group-hover:(filter brightness-75)`,
+  'notification-icon': apply`fill-current opacity-75 h-4 w-4 mx-2`,
+  'body-container': apply`flex w-full h-full overflow-hidden`,
+  'sidebar': apply`h-full w-96 max-w-3/7 flex-shrink-0 px-4 pt-3 pb-16 overflow-y-auto flex flex-col
+    bg-notion-secondary border-l border-divider`,
+  'content-container': apply`h-full w-full flex flex-col`,
+  'nav': apply`px-4 mx-2.5 py-1 flex flex-wrap items-center border-b border-divider
+    justify-center xl:justify-start`,
+  'nav-notion': apply`flex items-center font-semibold text-xl cursor-pointer select-none my-4
+    w-full justify-center xl:(mr-4 w-auto justify-start)`,
+  'nav-notion-icon': apply`h-6 w-6 mr-2.5`,
+  'nav-item': apply`mr-2 px-3 py-2 rounded-md text-sm font-medium
+    hover:bg-interactive-hover focus:bg-interactive-active mb-2 xl:(mt-1 mb-0)`,
+  'nav-item-selected': apply`nav-item ring-1 ring-divider bg-notion-secondary
+    hover:bg-notion-secondary focus:bg-notion-secondary`,
+  'nav-changelog': apply`xl:ml-auto focus:outline-none`,
+  'nav-changelog-icon': apply`w-4 h-4`,
+  'main': apply`transition px-4 py-3 overflow-y-auto flex-grow`,
+  'main-message': apply`mx-2.5 my-2.5 px-px text-sm text-foreground-secondary text-justify`,
+  'mods-list': apply`flex flex-wrap`,
+  'mod-container': apply`w-full md:w-1/2 lg:w-1/3 xl:w-1/4 2xl:w-1/5 px-2.5 py-2.5 box-border`,
+  'mod': apply`relative h-full w-full flex flex-col overflow-hidden rounded-lg shadow-lg
+    bg-notion-secondary border border-divider cursor-pointer`,
+  'mod-selected': apply`mod ring ring-accent-blue-active`,
+  'mod-body': apply`px-4 py-3 flex flex-col flex-auto children:cursor-pointer`,
+  'mod-preview': apply`object-cover w-full h-32`,
+  'mod-title': apply`mb-2 text-xl font-semibold tracking-tight flex items-center`,
+  'mod-version': apply`mt-px ml-3 p-1 font-normal text-xs leading-none bg-tag text-tag-text rounded`,
+  'mod-tags': apply`text-foreground-secondary mb-2 text-xs`,
+  'mod-description': apply`mb-2 text-sm`,
+  'mod-authors-container': apply`text-sm font-medium`,
+  'mod-author': apply`flex items-center mb-2`,
+  'mod-author-avatar': apply`inline object-cover w-5 h-5 rounded-full mr-2`,
+  'profile-trigger': apply`block px-4 py-3 mb-2 rounded-md text-sm text-left font-semibold shadow-inner
+    hover:bg-accent-red-button border border-accent-red text-accent-red focus:(outline-none bg-accent-red-button)`,
+  'profile-actions': apply`flex`,
+  'profile-save': apply`text-sm px-3 py-2 font-medium mt-2 bg-accent-blue text-accent-blue-text rounded-md flex-grow
+    hover:bg-accent-blue-hover focus:(bg-accent-blue-active outline-none) text-center`,
+  'profile-delete': apply`profile-trigger px-3 py-2 mb-0 ml-2 mt-2 text-center font-medium`,
+  'profile-export': apply`profile-save mr-2`,
+  'profile-import': apply`profile-save mr-2`,
+  'profile-error': apply`text-xs mt-2 text-red-text`,
+  'profile-icon-action': apply`w-4 h-4 -mt-1 inline-block`,
+  'profile-icon-text': apply`w-4 h-4 -mt-1 inline-block mr-1`,
+  'options-container': apply`px-4 py-3 shadow-inner rounded-lg bg-notion border border-divider space-y-3`,
+  'options-placeholder': apply`text-sm text-foreground-secondary`,
+  'toggle-box': apply`w-9 h-5 p-0.5 flex items-center bg-toggle-off rounded-full duration-300 ease-in-out cursor-pointer`,
+  'toggle-label': apply`relative text-sm flex w-full mt-auto`,
+  'toggle-check': apply`appearance-none ml-auto checked:sibling:(bg-toggle-on after::translate-x-4)`,
+  'toggle-feature': apply`after::(${pseudoContent} w-4 h-4 bg-toggle-feature rounded-full duration-300) cursor-pointer`,
+  'input-label': apply`block text-sm mt-2 relative`,
+  'input': apply`transition block w-full mt-2 pl-3 pr-14 py-2 text-sm rounded-md flex bg-input text-foreground
+    appearance-none placeholder-foreground-secondary ring-1 ring-divider focus:(outline-none ring ring-accent-blue-active)`,
+  'input-tooltip': apply`h-4 w-4 -mt-1 inline-block mr-2`,
+  'input-icon': apply`absolute w-11 h-9 right-0 bottom-0 py-2 px-3 bg-notion-secondary rounded-r-md text-icon`,
+  'input-placeholder': apply`text-foreground-secondary`,
+  'select-option': apply`bg-notion-secondary`,
+  'file-latest': apply`block w-full text-left text-foreground-secondary text-xs mt-2 hover:line-through cursor-pointer`,
+  'search-container': apply`block mx-2.5 my-2.5 relative`,
+  'search': apply`input pr-12`,
+  'important-link': apply`text-accent-red border-b border-accent-red opacity-80 hover:opacity-100`,
+  'danger': apply`text-red-text`,
+  'link': apply`no-underline border-b border-foreground-secondary opacity-70 hover:opacity-90`,
+  'modal': apply`fixed flex z-10 inset-0 overflow-y-auto min-h-screen text-center
+    ease-out duration-300 transition-opacity opacity-0 pointer-events-none`,
+  'modal-visible': {
+    '@apply': apply`ease-in duration-200 opacity-100 pointer-events-auto`,
+    '& .modal-box': apply`ease-out duration-300 opacity-100 scale-100`,
+  },
+  'modal-overlay': apply`fixed inset-0 bg-black bg-opacity-50 transition-opacity`,
+  'modal-box': apply`inline-block rounded-lg text-left overflow-hidden shadow-xl
+    transform transition-all m-auto align-middle
+    ease-in duration-200 opacity-0 scale-95`,
+  'modal-body': apply`bg-notion-secondary p-6 pt-4 max-w-xl w-full`,
+  'modal-actions': apply`bg-notion py-3 px-6 flex flex-row-reverse`,
+  'modal-title': apply`flex`,
+  'modal-title-icon': apply`w-20 mr-6`,
+  'modal-title-heading': apply`text-xl leading-6 font-medium`,
+  'modal-title-description': apply`mt-2 text-sm text-foreground-secondary`,
+  'modal-content': {
+    '@apply': apply`mt-4 text-sm`,
+    'p': apply`mt-2`,
+  },
+  'modal-button': apply`w-full inline-flex justify-center rounded-md text-base font-medium shadow-sm px-4 py-2
+    not-focus:hover:bg-interactive-hover focus:bg-interactive-active focus:outline-none`,
+};
+
+setup({
+  preflight: {
+    html: apply`w-full h-full`,
+    body: apply`w-full h-full bg-notion font-sans text-foreground`,
+  },
+  theme: {
+    fontFamily: {
+      sans: ['var(--theme--font_sans)'],
+      mono: ['var(--theme--font_code)'],
+    },
+    colors: {
+      'black': 'rgba(0,0,0,var(--tw-bg-opacity));',
+      'notion': 'var(--theme--bg)',
+      'notion-secondary': 'var(--theme--bg_secondary)',
+      'notion-card': 'var(--theme--bg_card)',
+      'divider': 'var(--theme--ui_divider)',
+      'input': 'var(--theme--ui_input)',
+      'icon': 'var(--theme--icon)',
+      'icon-secondary': 'var(--theme--icon_secondary)',
+      'foreground': 'var(--theme--text)',
+      'foreground-secondary': 'var(--theme--text_secondary)',
+      'interactive-hover': 'var(--theme--ui_interactive-hover)',
+      'interactive-active': 'var(--theme--ui_interactive-active)',
+      'tag': 'var(--theme--tag_default)',
+      'tag-text': 'var(--theme--tag_default-text)',
+      'toggle': {
+        'on': 'var(--theme--ui_toggle-on)',
+        'off': 'var(--theme--ui_toggle-off)',
+        'feature': 'var(--theme--ui_toggle-feature)',
+      },
+      'accent': {
+        'blue': 'var(--theme--accent_blue)',
+        'blue-hover': 'var(--theme--accent_blue-hover)',
+        'blue-active': 'var(--theme--accent_blue-active)',
+        'blue-text': 'var(--theme--accent_blue-text)',
+        'red': 'var(--theme--accent_red)',
+        'red-button': 'var(--theme--accent_red-button)',
+        'red-text': 'var(--theme--accent_red-text)',
+      },
+      'gray': mapColorVariables('gray'),
+      'brown': mapColorVariables('brown'),
+      'orange': mapColorVariables('orange'),
+      'yellow': mapColorVariables('yellow'),
+      'green': mapColorVariables('green'),
+      'blue': mapColorVariables('blue'),
+      'purple': mapColorVariables('purple'),
+      'pink': mapColorVariables('pink'),
+      'red': mapColorVariables('red'),
+    },
+    extend: {
+      maxWidth: { '3/7': 'calc((3 / 7) * 100%);' },
+    },
+  },
+  plugins: customClasses,
+});
+
+tw`hidden ${Object.keys(customClasses).join(' ')}`;
+
+export { tw };
diff --git a/src/mods/neutral/app.css b/src/mods/neutral/app.css
new file mode 100644
index 0000000..7a3c3b5
--- /dev/null
+++ b/src/mods/neutral/app.css
@@ -0,0 +1,48 @@
+/**
+ * notion-enhancer: neutral
+ * (c) 2020 Arecsu
+ * (c) 2021 dragonwocky <thedragonring.bod@gmail.com> (https://dragonwocky.me/)
+ * (https://notion-enhancer.github.io/) under the MIT license
+ */
+
+.notion-dark-theme [placeholder='Heading 1'],
+.notion-dark-theme [placeholder='Heading 2'],
+.notion-dark-theme [placeholder='Heading 3'] {
+  padding: 3px 1px !important;
+}
+
+/* hide sidebar "new page" button */
+.notion-dark-theme .notion-sidebar > [style*='flex: 0 0 auto; margin-top: auto;'] {
+  display: none !important;
+}
+
+/* 1.3 supreme ratio. https://www.modularscale.com/ */
+.notion-collection_view_page-block > div[placeholder='Untitled'],
+.notion-frame .notion-page-block > div[placeholder='Untitled'],
+.notion-overlay-container .notion-page-block > div[placeholder='Untitled'] {
+  font-size: 33px !important;
+}
+[placeholder='Heading 1'] {
+  font-size: 2.2rem !important;
+}
+[placeholder='Heading 2'] {
+  font-size: 1.687rem !important;
+}
+[placeholder='Heading 3'] {
+  font-size: 1.3rem !important;
+}
+.notion-frame .notion-scroller.vertical.horizontal .notion-page-content,
+.notion-overlay-container .notion-scroller.vertical .notion-page-content {
+  font-size: 15px !important;
+}
+.notion-frame
+  .notion-scroller.vertical.horizontal
+  .notion-page-content[style*='font-size: 14px'],
+.notion-overlay-container
+  .notion-scroller.vertical
+  .notion-page-content[style*='font-size: 14px'] {
+  font-size: 13.5px !important;
+}
+.notion-code-block [placeholder=' '] {
+  font-size: 0.9em !important;
+}
diff --git a/src/mods/neutral/mod.json b/src/mods/neutral/mod.json
new file mode 100644
index 0000000..dc17747
--- /dev/null
+++ b/src/mods/neutral/mod.json
@@ -0,0 +1,23 @@
+{
+  "name": "neutral",
+  "id": "c4435543-4705-4d68-8cf7-d11c342f8089",
+  "version": "0.2.0",
+  "description": "smoother colours and text sizing, designed to be more pleasing to the eye.",
+  "preview": "neutral.png",
+  "tags": ["theme", "dark"],
+  "authors": [
+    {
+      "name": "arecsu",
+      "email": "alejandro9r@gmail.com",
+      "homepage": "https://github.com/Arecsu",
+      "avatar": "https://avatars.githubusercontent.com/u/12679098"
+    }
+  ],
+  "css": {
+    "frame": ["variables.css"],
+    "client": ["variables.css", "app.css"],
+    "menu": ["variables.css"]
+  },
+  "js": {},
+  "options": []
+}
diff --git a/src/mods/neutral/neutral.png b/src/mods/neutral/neutral.png
new file mode 100644
index 0000000..7e68fb7
Binary files /dev/null and b/src/mods/neutral/neutral.png differ
diff --git a/src/mods/neutral/variables.css b/src/mods/neutral/variables.css
new file mode 100644
index 0000000..0e7b76f
--- /dev/null
+++ b/src/mods/neutral/variables.css
@@ -0,0 +1,141 @@
+/**
+ * notion-enhancer: neutral
+ * (c) 2020 Arecsu
+ * (c) 2021 dragonwocky <thedragonring.bod@gmail.com> (https://dragonwocky.me/)
+ * (https://notion-enhancer.github.io/) under the MIT license
+ */
+
+:root.dark {
+  --theme--accent_blue: #404040;
+  --theme--accent_blue-selection: #52525244;
+  --theme--accent_blue-hover: #6d6d6d;
+  --theme--accent_blue-active: #cacaca;
+  --theme--accent_red: #ce535f;
+  --theme--accent_red-button: #8c3d3dad;
+
+  --theme--bg: #131313;
+  --theme--bg_secondary: #161616;
+  --theme--bg_card: #181818;
+
+  --theme--scrollbar_track: transparent;
+  --theme--scrollbar_thumb: #232425;
+  --theme--scrollbar_thumb-hover: #373838;
+
+  --theme--ui_shadow: rgba(15, 15, 15, 0.5);
+  --theme--ui_divider: rgba(78, 78, 78, 0.7);
+  --theme--ui_interactive-hover: rgb(29, 29, 29);
+  --theme--ui_interactive-active: rgba(29, 29, 29, 0.7);
+  --theme--ui_input: #1d1d1d;
+  --theme--ui_corner_action: var(--theme--bg_card);
+  --theme--ui_corner_action-hover: var(--theme--ui_interactive-hover);
+  --theme--ui_corner_action-active: var(--theme--ui_interactive-active);
+
+  --theme--icon: #dadada;
+  --theme--icon_secondary: #dadadac0;
+
+  --theme--text: #dadada;
+  --theme--text_secondary: #dadadac0;
+  --theme--text_gray: #858585;
+  --theme--text_brown: #484848;
+  --theme--text_orange: #ec9873;
+  --theme--text_yellow: #e2c06f;
+  --theme--text_green: #92b178;
+  --theme--text_blue: #719cca;
+  --theme--text_purple: #ab82bb;
+  --theme--text_pink: #d285aa;
+  --theme--text_red: #ce535f;
+
+  --theme--highlight_gray: #585858;
+  --theme--highlight_brown: #333333;
+  --theme--highlight_orange: #9a5a3f;
+  --theme--highlight_yellow: #b58a46;
+  --theme--highlight_green: #657953;
+  --theme--highlight_blue: #355475;
+  --theme--highlight_purple: #775186;
+  --theme--highlight_pink: #8e4b63;
+  --theme--highlight_red: #8c3d3d;
+
+  --theme--callout_gray: #585858;
+  --theme--callout_brown: #333333;
+  --theme--callout_orange: #9a5a3f;
+  --theme--callout_yellow: #b58a46;
+  --theme--callout_green: #657953;
+  --theme--callout_blue: #355475;
+  --theme--callout_purple: #775186;
+  --theme--callout_pink: #8e4b63;
+  --theme--callout_red: #8c3d3d;
+
+  --theme--tag-text: var(--theme--text);
+  --theme--tag_default: var(--theme--highlight_gray);
+  --theme--tag_light_gray: #8A8A8A;
+  --theme--tag_gray: var(--theme--highlight_gray);
+  --theme--tag_brown: var(--theme--highlight_brown);
+  --theme--tag_orange: var(--theme--highlight_orange);
+  --theme--tag_yellow: var(--theme--highlight_yellow);
+  --theme--tag_green: var(--theme--highlight_green);
+  --theme--tag_blue: var(--theme--highlight_blue);
+  --theme--tag_purple: var(--theme--highlight_purple);
+  --theme--tag_pink: var(--theme--highlight_pink);
+  --theme--tag_red: var(--theme--highlight_red);
+
+  --theme--board_light_gray: rgba(112, 112, 112, 0.175);
+  --theme--board_light_gray-text: #AAAAAA;
+  --theme--board_light_gray-card: var(--theme--tag_light_gray);
+  --theme--board_light_gray-card_text: var(--theme--tag_light_gray-text);
+  --theme--board_gray: rgba(88, 88, 88, 0.175);
+  --theme--board_gray-text: var(--theme--text_gray);
+  --theme--board_gray-card: var(--theme--tag_gray);
+  --theme--board_gray-card_text: var(--theme--tag_gray-text);
+  --theme--board_brown: rgb(51, 51, 51, 0.175);
+  --theme--board_brown-text: var(--theme--text_brown);
+  --theme--board_brown-card: var(--theme--tag_brown);
+  --theme--board_brown-card_text: var(--theme--tag_brown-text);
+  --theme--board_orange: rgb(154, 90, 63, 0.175);
+  --theme--board_orange-text: var(--theme--text_orange);
+  --theme--board_orange-card: var(--theme--tag_orange);
+  --theme--board_orange-card_text: var(--theme--tag_orange-text);
+  --theme--board_yellow: rgb(181, 138, 70, 0.175);
+  --theme--board_yellow-text: var(--theme--text_yellow);
+  --theme--board_yellow-card: var(--theme--tag_yellow);
+  --theme--board_yellow-card_text: var(--theme--tag_yellow-text);
+  --theme--board_green: rgb(101, 121, 83, 0.175);
+  --theme--board_green-text: var(--theme--text_green);
+  --theme--board_green-card: var(--theme--tag_green);
+  --theme--board_green-card_text: var(--theme--tag_green-text);
+  --theme--board_blue: rgb(53, 84, 117, 0.175);
+  --theme--board_blue-text: var(--theme--text_blue);
+  --theme--board_blue-card: var(--theme--tag_blue);
+  --theme--board_blue-card_text: var(--theme--tag_blue-text);
+  --theme--board_purple: rgb(119, 81, 134, 0.175);
+  --theme--board_purple-text: var(--theme--text_purple);
+  --theme--board_purple-card: var(--theme--tag_purple);
+  --theme--board_purple-card_text: var(--theme--tag_purple-text);
+  --theme--board_pink: rgb(142, 75, 99, 0.175);
+  --theme--board_pink-text: var(--theme--text_pink);
+  --theme--board_pink-card: var(--theme--tag_pink);
+  --theme--board_pink-card_text: var(--theme--tag_pink-text);
+  --theme--board_red: rgb(140, 61, 61, 0.175);
+  --theme--board_red-text: var(--theme--text_red);
+  --theme--board_red-card: var(--theme--tag_red);
+  --theme--board_red-card_text: var(--theme--tag_red-text);
+
+  --theme--code_inline: #333333;
+  --theme--code_inline-text: var(--theme--text);
+
+  --theme--code: #0e0e0e;
+  --theme--code_plain: var(--theme--text);
+  --theme--code_function: var(--theme--text_blue);
+  --theme--code_keyword: var(--theme--text_pink);
+  --theme--code_tag: var(--theme--text_pink);
+  --theme--code_operator: var(--theme--text_yellow);
+  --theme--code_important: var(--theme--text_yellow);
+  --theme--code_property: var(--theme--text_pink);
+  --theme--code_builtin: var(--theme--text_yellow);
+  --theme--code_attr-name: var(--theme--text_yellow);
+  --theme--code_comment: var(--theme--text_gray);
+  --theme--code_punctuation: var(--theme--text_gray);
+  --theme--code_doctype: var(--theme--text_gray);
+  --theme--code_number: var(--theme--text_purple);
+  --theme--code_string: var(--theme--text_orange);
+  --theme--code_attr-value: var(--theme--text_orange);
+}
diff --git a/src/mods/nord/mod.json b/src/mods/nord/mod.json
new file mode 100644
index 0000000..67f266f
--- /dev/null
+++ b/src/mods/nord/mod.json
@@ -0,0 +1,28 @@
+{
+  "name": "nord",
+  "id": "d64ad391-1494-4112-80ae-0a3b6f4b0c3f",
+  "version": "0.2.0",
+  "description": "an arctic, north-bluish color palette.",
+  "preview": "nord.png",
+  "tags": ["theme", "dark"],
+  "authors": [
+    {
+      "name": "Artic Ice Studio",
+      "email": "development@arcticicestudio.com",
+      "homepage": "https://www.nordtheme.com/",
+      "avatar": "https://avatars.githubusercontent.com/u/7836623"
+    },
+    {
+      "name": "MANNNNEN",
+      "homepage": "https://github.com/MANNNNEN",
+      "avatar": "https://avatars.githubusercontent.com/u/35939149"
+    }
+  ],
+  "css": {
+    "frame": ["variables.css"],
+    "client": ["variables.css"],
+    "menu": ["variables.css"]
+  },
+  "js": {},
+  "options": []
+}
diff --git a/src/mods/nord/nord.png b/src/mods/nord/nord.png
new file mode 100644
index 0000000..008a6ca
Binary files /dev/null and b/src/mods/nord/nord.png differ
diff --git a/src/mods/nord/variables.css b/src/mods/nord/variables.css
new file mode 100644
index 0000000..7aaa8da
--- /dev/null
+++ b/src/mods/nord/variables.css
@@ -0,0 +1,160 @@
+/**
+ * notion-enhancer: dracula
+ * (c) 2016 Artic Ice Studio
+ * (c) 2020 MANNNNEN
+ * (c) 2021 dragonwocky <thedragonring.bod@gmail.com> (https://dragonwocky.me/)
+ * (https://notion-enhancer.github.io/) under the MIT license
+ */
+
+:root.dark {
+  --nord--dark1: #2e3440;
+  --nord--dark2: #3b4252;
+  --nord--dark3: #434c5e;
+  --nord--dark4: #4c566a;
+  --nord--light1: #d8dee9;
+  --nord--light2: #e5e9f0;
+  --nord--light3: #eceff4;
+  --nord--frost1: #8fbcbb;
+  --nord--frost2: #88c0d0;
+  --nord--frost3: #81a1c1;
+  --nord--frost4: #5e81ac;
+  --nord--red: #bf616a;
+  --nord--orange: #d08770;
+  --nord--yellow: #ebcb8b;
+  --nord--green: #a3be8c;
+  --nord--purple: #b48ead;
+
+  --theme--accent_blue: var(--nord--frost2);
+  --theme--accent_blue-selection: rgb(136 192 208 / 50%);
+  --theme--accent_blue-hover: var(--nord--frost1);
+  --theme--accent_blue-active: var(--nord--frost2);
+  --theme--accent_red: var(--nord--red);
+  --theme--accent_red-button: rgba(235, 87, 87, 0.2);
+
+  --theme--bg: var(--nord--dark1);
+  --theme--bg_secondary: var(--nord--dark2);
+  --theme--bg_card: var(--nord--dark2);
+
+  --theme--scrollbar_track: transparent;
+  --theme--scrollbar_thumb: var(--nord--dark3);
+  --theme--scrollbar_thumb-hover: var(--nord--dark4);
+
+  --theme--ui_divider: rgba(255, 255, 255, 0.1);
+  --theme--ui_interactive-hover: var(--nord--dark4);
+  --theme--ui_interactive-active: #4c566ade;
+  --theme--ui_toggle-off: var(--nord--dark4);
+  --theme--ui_toggle-feature: var(--nord--light1);
+  --theme--ui_corner_action: var(--theme--bg_card);
+  --theme--ui_corner_action-hover: var(--theme--ui_interactive-hover);
+  --theme--ui_corner_action-active: var(--theme--ui_interactive-active);
+
+  --theme--icon: var(--nord--light1);
+  --theme--icon_secondary: var(--nord--light1);
+
+  --theme--text: var(--nord--light1);
+  --theme--text_secondary: var(--nord--light1);
+
+  --theme--text_gray: rgba(151, 154, 155, 0.95);
+  --theme--text_brown: rgb(147, 114, 100);
+  --theme--text_orange: var(--nord--orange);
+  --theme--text_yellow: var(--nord--yellow);
+  --theme--text_green: var(--nord--green);
+  --theme--text_blue: var(--nord--frost3);
+  --theme--text_purple: var(--nord--purple);
+  --theme--text_pink: rgb(193 106 153);
+  --theme--text_red: var(--nord--red);
+
+  --theme--highlight_gray: rgb(69, 75, 78);
+  --theme--highlight_brown: rgb(67, 64, 64);
+  --theme--highlight_orange: var(--nord--orange);
+  --theme--highlight_yellow: var(--nord--yellow);
+  --theme--highlight_yellow-text: var(--nord--dark1);
+  --theme--highlight_green: var(--nord--green);
+  --theme--highlight_blue: var(--nord--frost3);
+  --theme--highlight_purple: var(--nord--purple);
+  --theme--highlight_pink: rgb(193 106 153);
+  --theme--highlight_red: var(--nord--red);
+
+  --theme--callout_gray: rgb(69, 75, 78);
+  --theme--callout_brown: rgb(67, 64, 64);
+  --theme--callout_orange: var(--nord--orange);
+  --theme--callout_yellow: var(--nord--yellow);
+  --theme--callout_yellow-text: var(--nord--dark1);
+  --theme--callout_green: var(--nord--green);
+  --theme--callout_blue: var(--nord--frost3);
+  --theme--callout_purple: var(--nord--purple);
+  --theme--callout_pink: rgb(193 106 153);
+  --theme--callout_red: var(--nord--red);
+
+  --theme--tag_default: rgba(151, 154, 155, 0.5);
+  --theme--tag_light_gray: rgba(182, 184, 185, 0.5);
+  --theme--tag_gray: rgba(151, 154, 155, 0.5);
+  --theme--tag_brown: rgba(147, 114, 100, 0.5);
+  --theme--tag_orange: rgba(255, 163, 68, 0.5);
+  --theme--tag_yellow: rgba(255, 220, 73, 0.5);
+  --theme--tag_green: rgba(77, 171, 154, 0.5);
+  --theme--tag_blue: rgba(82, 156, 202, 0.5);
+  --theme--tag_purple: rgba(154, 109, 215, 0.5);
+  --theme--tag_pink: rgba(226, 85, 161, 0.5);
+  --theme--tag_red: rgba(255, 115, 105, 0.5);
+
+  --theme--board_light_gray: rgba(69, 75, 78, 0.3);
+  --theme--board_light_gray-card: var(--theme--tag_light_gray);
+  --theme--board_light_gray-card_text: var(--theme--tag_light_gray-text);
+  --theme--board_light_gray-text: rgba(161, 162, 163, 0.95);
+  --theme--board_gray: rgba(69, 75, 78, 0.3);
+  --theme--board_gray-card: var(--theme--tag_gray);
+  --theme--board_gray-card_text: var(--theme--tag_gray-text);
+  --theme--board_gray-text: var(--theme--text_gray);
+  --theme--board_brown: rgba(67, 64, 64, 0.3);
+  --theme--board_brown-card: var(--theme--tag_brown);
+  --theme--board_brown-card_text: var(--theme--tag_brown-text);
+  --theme--board_brown-text: var(--theme--text_brown);
+  --theme--board_orange: rgba(89, 74, 58, 0.3);
+  --theme--board_orange-card: var(--theme--tag_orange);
+  --theme--board_orange-card_text: var(--theme--tag_orange-text);
+  --theme--board_orange-text: var(--theme--text_orange);
+  --theme--board_yellow: rgba(89, 86, 59, 0.3);
+  --theme--board_yellow-card: var(--theme--tag_yellow);
+  --theme--board_yellow-card_text: var(--theme--tag_yellow-text);
+  --theme--board_yellow-text: var(--theme--text_yellow);
+  --theme--board_green: rgba(53, 76, 75, 0.3);
+  --theme--board_green-card: var(--theme--tag_green);
+  --theme--board_green-card_text: var(--theme--tag_green-text);
+  --theme--board_green-text: var(--theme--text_green);
+  --theme--board_blue: rgba(54, 73, 84, 0.3);
+  --theme--board_blue-card: var(--theme--tag_blue);
+  --theme--board_blue-card_text: var(--theme--tag_blue-text);
+  --theme--board_blue-text: var(--theme--text_blue);
+  --theme--board_purple: rgba(68, 63, 87, 0.3);
+  --theme--board_purple-card: var(--theme--tag_purple);
+  --theme--board_purple-card_text: var(--theme--tag_purple-text);
+  --theme--board_purple-text: var(--theme--text_purple);
+  --theme--board_pink: rgba(83, 59, 76, 0.3);
+  --theme--board_pink-card: var(--theme--tag_pink);
+  --theme--board_pink-card_text: var(--theme--tag_pink-text);
+  --theme--board_pink-text: var(--theme--text_pink);
+  --theme--board_red: rgba(89, 65, 65, 0.3);
+  --theme--board_red-card: var(--theme--tag_red);
+  --theme--board_red-card_text: var(--theme--tag_red-text);
+  --theme--board_red-text: var(--theme--text_red);
+
+  --theme--code_inline: rgba(135, 131, 120, 0.15);
+  --theme--code_inline-text: var(--nord--red);
+
+  --theme--code: var(--theme--bg_card);
+  --theme--code_function: var(--theme--text_blue);
+  --theme--code_keyword: var(--theme--text_pink);
+  --theme--code_tag: var(--theme--text_pink);
+  --theme--code_operator: var(--theme--text_yellow);
+  --theme--code_important: var(--theme--text_yellow);
+  --theme--code_property: var(--theme--text_pink);
+  --theme--code_builtin: var(--theme--text_yellow);
+  --theme--code_attr-name: var(--theme--text_yellow);
+  --theme--code_comment: var(--theme--text_gray);
+  --theme--code_punctuation: var(--theme--text_gray);
+  --theme--code_doctype: var(--theme--text_gray);
+  --theme--code_number: var(--theme--text_purple);
+  --theme--code_string: var(--theme--text_orange);
+  --theme--code_attr-value: var(--theme--text_orange);
+}
diff --git a/src/mods/outliner/client.css b/src/mods/outliner/client.css
new file mode 100644
index 0000000..a37d938
--- /dev/null
+++ b/src/mods/outliner/client.css
@@ -0,0 +1,47 @@
+/**
+ * notion-enhancer: outliner
+ * (c) 2020 CloudHill <rl.cloudhill@gmail.com> (https://github.com/CloudHill)
+ * (c) 2021 dragonwocky <thedragonring.bod@gmail.com> (https://dragonwocky.me/)
+ * (https://notion-enhancer.github.io/) under the MIT license
+ */
+
+#outliner--notice {
+  color: var(--theme--text_secondary);
+  font-size: 14px;
+  margin-top: 0;
+  margin-bottom: 1rem;
+}
+
+.outliner--header {
+  position: relative;
+  margin: 0 -1rem;
+  padding: 0 1rem;
+  display: block;
+  font-size: 14px;
+  line-height: 2.2;
+  white-space: nowrap;
+  overflow: hidden;
+  user-select: none;
+  text-overflow: ellipsis;
+  text-decoration: none;
+  text-indent: var(--outliner--indent);
+  color: inherit;
+  cursor: pointer !important;
+  transition: background 20ms ease-in;
+}
+.outliner--header:hover {
+  background: var(--theme--ui_interactive-hover);
+}
+
+.outliner--header:empty::after {
+  color: var(--theme--text_secondary);
+  content: attr(placeholder);
+}
+
+/* indentation lines */
+.outliner--header:not([style='--outliner--indent:0px;'])::before {
+  content: '';
+  height: 100%;
+  position: absolute;
+  left: calc((1rem + var(--outliner--indent)) - 11px);
+}
diff --git a/src/mods/outliner/client.mjs b/src/mods/outliner/client.mjs
new file mode 100644
index 0000000..73942fd
--- /dev/null
+++ b/src/mods/outliner/client.mjs
@@ -0,0 +1,90 @@
+/**
+ * notion-enhancer: outliner
+ * (c) 2020 CloudHill <rl.cloudhill@gmail.com> (https://github.com/CloudHill)
+ * (c) 2021 dragonwocky <thedragonring.bod@gmail.com> (https://dragonwocky.me/)
+ * (https://notion-enhancer.github.io/) under the MIT license
+ */
+
+export default async function ({ web, components }, db) {
+  const dbNoticeText = 'Open a page to see its table of contents.',
+    pageNoticeText = 'Click on a heading to jump to it.',
+    $notice = web.html`<p id="outliner--notice">${dbNoticeText}</p>`;
+
+  const $headingList = web.html`<div></div>`;
+
+  let viewFocused = false,
+    $page;
+  await components.addPanelView({
+    id: '87e077cc-5402-451c-ac70-27cc4ae65546',
+    icon: web.html`<svg xmlns="http://www.w3.org/2000/svg" width="24" height="24" viewBox="0 0 24 24">
+      <circle cx="5" cy="7" r="2.8"/>
+      <circle cx="5" cy="17" r="2.79"/>
+      <path d="M21,5.95H11c-0.55,0-1-0.45-1-1v0c0-0.55,0.45-1,1-1h10c0.55,0,1,0.45,1,1v0C22,5.5,21.55,5.95,21,5.95z"/>
+      <path d="M17,10.05h-6c-0.55,0-1-0.45-1-1v0c0-0.55,0.45-1,1-1h6c0.55,0,1,0.45,1,1v0C18,9.6,17.55,10.05,17,10.05z"/>
+      <path d="M21,15.95H11c-0.55,0-1-0.45-1-1v0c0-0.55,0.45-1,1-1h10c0.55,0,1,0.45,1,1v0C22,15.5,21.55,15.95,21,15.95z" />
+      <path d="M17,20.05h-6c-0.55,0-1-0.45-1-1v0c0-0.55,0.45-1,1-1h6c0.55,0,1,0.45,1,1v0C18,19.6,17.55,20.05,17,20.05z"/>
+    </svg>`,
+    title: 'Outliner',
+    $content: web.render(web.html`<div></div>`, $notice, $headingList),
+    onFocus: () => {
+      viewFocused = true;
+      $page = document.getElementsByClassName('notion-page-content')[0];
+      updateHeadings();
+    },
+    onBlur: () => {
+      viewFocused = false;
+    },
+  });
+  await web.whenReady();
+
+  function updateHeadings() {
+    if (!$page) return;
+    $notice.innerText = pageNoticeText;
+    $headingList.style.display = '';
+    const $headerBlocks = $page.querySelectorAll('[class^="notion-"][class*="header-block"]'),
+      $fragment = web.html`<div></div>`;
+    let depth = 0,
+      indent = 0;
+    for (const $header of $headerBlocks) {
+      const id = $header.dataset.blockId.replace(/-/g, ''),
+        placeholder = $header.querySelector('[placeholder]').getAttribute('placeholder'),
+        headerDepth = +[...placeholder].reverse()[0];
+      if (depth && depth < headerDepth) {
+        indent += 18;
+      } else if (depth > headerDepth) {
+        indent = Math.max(indent - 18, 0);
+      }
+      depth = headerDepth;
+      const $outlineHeader = web.render(
+        web.html`<a href="#${id}" class="outliner--header"
+              placeholder="${web.escape(placeholder)}"
+              style="--outliner--indent:${indent}px;"></a>`,
+        $header.innerText
+      );
+      $outlineHeader.addEventListener('click', (event) => {
+        location.hash = '';
+      });
+      web.render($fragment, $outlineHeader);
+    }
+    if ($fragment.innerHTML !== $headingList.innerHTML) {
+      web.render(web.empty($headingList), ...$fragment.children);
+    }
+  }
+  const pageObserver = () => {
+    if (!viewFocused) return;
+    if (document.contains($page)) {
+      updateHeadings();
+    } else {
+      $page = document.querySelector('.notion-page-content');
+      if (!$page) {
+        $notice.innerText = dbNoticeText;
+        $headingList.style.display = 'none';
+      } else updateHeadings();
+    }
+  };
+  web.addDocumentObserver(pageObserver, [
+    '.notion-page-content',
+    '.notion-collection_view_page-block',
+  ]);
+  pageObserver();
+}
diff --git a/src/mods/outliner/mod.json b/src/mods/outliner/mod.json
new file mode 100644
index 0000000..2ebbb48
--- /dev/null
+++ b/src/mods/outliner/mod.json
@@ -0,0 +1,23 @@
+{
+  "name": "outliner",
+  "id": "87e077cc-5402-451c-ac70-27cc4ae65546",
+  "version": "0.4.0",
+  "description": "adds a table of contents to the side panel.",
+  "preview": "outliner.png",
+  "tags": ["extension", "panel"],
+  "authors": [
+    {
+      "name": "CloudHill",
+      "email": "rh.cloudhill@gmail.com",
+      "homepage": "https://github.com/CloudHill",
+      "avatar": "https://avatars.githubusercontent.com/u/54142180"
+    }
+  ],
+  "js": {
+    "client": ["client.mjs"]
+  },
+  "css": {
+    "client": ["client.css"]
+  },
+  "options": []
+}
diff --git a/src/mods/outliner/outliner.png b/src/mods/outliner/outliner.png
new file mode 100644
index 0000000..925ee6c
Binary files /dev/null and b/src/mods/outliner/outliner.png differ
diff --git a/src/mods/pastel-dark/app.css b/src/mods/pastel-dark/app.css
new file mode 100644
index 0000000..9664dd3
--- /dev/null
+++ b/src/mods/pastel-dark/app.css
@@ -0,0 +1,72 @@
+/**
+ * notion-enhancer: pastel dark
+ * (c) 2020 u/zenith_illinois
+ * (c) 2021 dragonwocky <thedragonring.bod@gmail.com> (https://dragonwocky.me/)
+ * (https://notion-enhancer.github.io/) under the MIT license
+ */
+
+.notion-dark-theme img[src*='/images/onboarding/use-case-note.png'],
+.notion-dark-theme img[src*='/images/onboarding/team-features-illustration.png'] {
+  filter: invert(1) !important;
+}
+.notion-dark-theme img[src*='/images/onboarding/checked.svg'] {
+  filter: hue-rotate(45deg) !important;
+}
+.notion-dark-theme
+  img[style*='display: block; object-fit: cover; border-radius: 100%; width: 90px; height: 90px;'],
+.notion-dark-theme
+  img[style*='display: block; object-fit: cover; border-radius: 3px; width: 56.832px; height: 56.832px; transition: opacity 100ms ease-out 0s;'] {
+  transition: filter 0.4s ease !important;
+}
+.notion-dark-theme
+  img[style*='display: block; object-fit: cover; border-radius: 100%; width: 90px; height: 90px;']:hover,
+.notion-dark-theme
+  img[style*='display: block; object-fit: cover; border-radius: 3px; width: 56.832px; height: 56.832px; transition: opacity 100ms ease-out 0s;']:hover {
+  filter: brightness(1.2);
+}
+
+.notion-dark-theme .notion-token-remove-button[role*='button'][tabindex*='0']:hover,
+.notion-dark-theme .notion-record-icon {
+  background: transparent !important;
+}
+
+.notion-dark-theme .notion-focusable:focus-within,
+.notion-dark-theme .notion-to_do-block > div > div > div[style*='background:'],
+.notion-dark-theme div[role='button'],
+[style*='height: 4px;'] > .notion-selectable.notion-collection_view_page-block > *,
+.notion-dark-theme .notion-calendar-view-day[style*='background: rgb(235, 87, 87);'],
+.DayPicker-Day--today,
+.notion-dark-theme
+  .DayPicker:not(.DayPicker--interactionDisabled)
+  .DayPicker-Day--outside:hover,
+.notion-dark-theme
+  .DayPicker:not(.DayPicker--interactionDisabled)
+  .DayPicker-Day:not(.DayPicker-Day--disabled):not(.DayPicker-Day--value)
+  .DayPicker-Day.DayPicker-Day--start.DayPicker-Day--selected,
+.notion-dark-theme .DayPicker-Day.DayPicker-Day--range.DayPicker-Day--start,
+.notion-dark-theme .DayPicker-Day.DayPicker-Day--range.DayPicker-Day--end {
+  transition: color 0.4s ease, background 0.4s ease, box-shadow 0.4s ease !important;
+}
+
+.notion-dark-theme :not(.notion-code-block) > * > [style*='background: rgb(63, 68, 71);'],
+.notion-dark-theme
+  .notion-code-block
+  [style*='background: rgb(63, 68, 71);']
+  .notion-code-block,
+.notion-dark-theme
+  [style*='background: rgb(80, 85, 88);'][style*='color: rgba(255, 255, 255, 0.7)'],
+.notion-dark-theme
+  [style*='background: rgb(80, 85, 88);'][style*='width: 18px;'][style*='height: 18px;'],
+.notion-dark-theme
+  [style*='box-shadow: rgba(15, 15, 15, 0.1) 0px 0px 0px 1px, rgba(15, 15, 15, 0.2) 0px 5px 10px, rgba(15, 15, 15, 0.4) 0px 15px 40px;'],
+.notion-dark-theme [style*='background: rgba(151, 154, 155, 0.5);'],
+.notion-dark-theme [style*='background: rgba(147, 114, 100, 0.5)'],
+.notion-dark-theme [style*='background: rgba(255, 163, 68, 0.5)'],
+.notion-dark-theme [style*='background: rgba(255, 220, 73, 0.5)'],
+.notion-dark-theme [style*='background: rgba(77, 171, 154, 0.5)'],
+.notion-dark-theme [style*='background: rgba(82, 156, 202, 0.5)'],
+.notion-dark-theme [style*='background: rgba(154, 109, 215, 0.5)'],
+.notion-dark-theme [style*='background: rgba(226, 85, 161, 0.5)'],
+.notion-dark-theme [style*='background: rgba(255, 115, 105, 0.5)'] {
+  box-shadow: 0 2px 4px rgb(0 0 0 / 66%) !important;
+}
diff --git a/src/mods/pastel-dark/mod.json b/src/mods/pastel-dark/mod.json
new file mode 100644
index 0000000..ba6058b
--- /dev/null
+++ b/src/mods/pastel-dark/mod.json
@@ -0,0 +1,22 @@
+{
+  "name": "pastel dark",
+  "id": "ed48c585-4a0d-4756-a3e6-9ae662732dac",
+  "version": "0.2.0",
+  "description": "a smooth-transition true dark theme with a hint of pastel.",
+  "preview": "pastel-dark.png",
+  "tags": ["theme", "dark"],
+  "authors": [
+    {
+      "name": "zenith_illinois",
+      "homepage": "https://www.reddit.com/user/zenith_illinois/",
+      "avatar": "https://www.redditstatic.com/avatars/defaults/v2/avatar_default_5.png"
+    }
+  ],
+  "css": {
+    "frame": ["variables.css"],
+    "client": ["variables.css", "app.css"],
+    "menu": ["variables.css"]
+  },
+  "js": {},
+  "options": []
+}
diff --git a/src/mods/pastel-dark/pastel-dark.png b/src/mods/pastel-dark/pastel-dark.png
new file mode 100644
index 0000000..e6dc5a4
Binary files /dev/null and b/src/mods/pastel-dark/pastel-dark.png differ
diff --git a/src/mods/pastel-dark/variables.css b/src/mods/pastel-dark/variables.css
new file mode 100644
index 0000000..81f697a
--- /dev/null
+++ b/src/mods/pastel-dark/variables.css
@@ -0,0 +1,147 @@
+/**
+ * notion-enhancer: pastel dark
+ * (c) 2020 u/zenith_illinois
+ * (c) 2021 dragonwocky <thedragonring.bod@gmail.com> (https://dragonwocky.me/)
+ * (https://notion-enhancer.github.io/) under the MIT license
+ */
+
+:root.dark {
+  --theme--accent_blue: #b887f7;
+  --theme--accent_blue-selection: rgba(184, 135, 247, 0.3);
+  --theme--accent_blue-hover: #08d7c2;
+  --theme--accent_blue-active: #b887f7;
+  --theme--accent_red: #08d7c2;
+  --theme--accent_red-button: #08d7c226;
+
+  --theme--bg: #0b0b0b;
+  --theme--bg_secondary: #0f0f0f;
+  --theme--bg_card: #141414;
+
+  --theme--scrollbar_track: transparent;
+  --theme--scrollbar_thumb: #141414;
+  --theme--scrollbar_thumb-hover: #1b1b1b;
+
+  --theme--ui_divider: rgba(255, 255, 255, 0.1);
+  --theme--ui_interactive-hover: #15161c;
+  --theme--ui_interactive-active: #18191c;
+  --theme--ui_toggle-off: #b1aeab;
+  --theme--ui_corner_action: var(--theme--bg_card);
+  --theme--ui_corner_action-hover: var(--theme--ui_interactive-hover);
+  --theme--ui_corner_action-active: var(--theme--ui_interactive-active);
+
+  --theme--icon: #ffffff;
+  --theme--icon_secondary: #909090;
+
+  --theme--text: #ffffff;
+  --theme--text_secondary: #909090;
+  --theme--text_gray: #b1aeab;
+  --theme--text_brown: #d8b6a6;
+  --theme--text_orange: #fde3c0;
+  --theme--text_yellow: #fcde93;
+  --theme--text_green: #b3f5c8;
+  --theme--text_blue: #bfe0fd;
+  --theme--text_purple: #dac7fa;
+  --theme--text_pink: #f7b8dc;
+  --theme--text_red: #f8acb4;
+
+  --theme--highlight_gray: #b1aeab;
+  --theme--highlight_gray-text: rgb(55, 53, 47);
+  --theme--highlight_brown: #d8b6a6;
+  --theme--highlight_brown-text: rgb(55, 53, 47);
+  --theme--highlight_orange: #fde3c0;
+  --theme--highlight_orange-text: rgb(55, 53, 47);
+  --theme--highlight_yellow: #fcde93;
+  --theme--highlight_yellow-text: rgb(55, 53, 47);
+  --theme--highlight_green: #b3f5c8;
+  --theme--highlight_green-text: rgb(55, 53, 47);
+  --theme--highlight_blue: #bfe0fd;
+  --theme--highlight_blue-text: rgb(55, 53, 47);
+  --theme--highlight_purple: #dac7fa;
+  --theme--highlight_purple-text: rgb(55, 53, 47);
+  --theme--highlight_pink: #f7b8dc;
+  --theme--highlight_pink-text: rgb(55, 53, 47);
+  --theme--highlight_red: #f8acb4;
+  --theme--highlight_red-text: rgb(55, 53, 47);
+
+  --theme--callout_gray: #c2c1c089;
+  --theme--callout_brown: #dacec992;
+  --theme--callout_orange: #fff0dc9f;
+  --theme--callout_yellow: #ffe6a6ad;
+  --theme--callout_green: #c8fdd9a3;
+  --theme--callout_blue: #d1e9ffa3;
+  --theme--callout_purple: #e3d3ffa8;
+  --theme--callout_pink: #fdcce8b1;
+  --theme--callout_red: #ffc8ce9e;
+
+  --theme--tag_light_gray: #C8C6C4;
+  --theme--tag_light_gray-text: rgb(55, 53, 47);
+  --theme--tag_gray: #b1aeab;
+  --theme--tag_gray-text: rgb(55, 53, 47);
+  --theme--tag_brown: #d8b6a6;
+  --theme--tag_brown-text: rgb(55, 53, 47);
+  --theme--tag_orange: #fde3c0;
+  --theme--tag_orange-text: rgb(55, 53, 47);
+  --theme--tag_yellow: #fcde93;
+  --theme--tag_yellow-text: rgb(55, 53, 47);
+  --theme--tag_green: #b3f5c8;
+  --theme--tag_green-text: rgb(55, 53, 47);
+  --theme--tag_blue: #bfe0fd;
+  --theme--tag_blue-text: rgb(55, 53, 47);
+  --theme--tag_purple: #dac7fa;
+  --theme--tag_purple-text: rgb(55, 53, 47);
+  --theme--tag_pink: #f7b8dc;
+  --theme--tag_pink-text: rgb(55, 53, 47);
+  --theme--tag_red: #f8acb4;
+  --theme--tag_red-text: rgb(55, 53, 47);
+
+  --theme--board_light_gray: #D4D4D389;
+  --theme--board_light_gray-text: #C8C6C4;
+  --theme--board_light_gray-card: rgb(255, 255, 255, 0.2);
+  --theme--board_gray: #c2c1c089;
+  --theme--board_gray-text: #b1aeab;
+  --theme--board_gray-card: rgb(255, 255, 255, 0.2);
+  --theme--board_brown: #dacec992;
+  --theme--board_brown-text: #d8b6a6;
+  --theme--board_brown-card: rgb(255, 255, 255, 0.2);
+  --theme--board_orange: #fff0dc9f;
+  --theme--board_orange-text: #fde3c0;
+  --theme--board_orange-card: rgb(255, 255, 255, 0.2);
+  --theme--board_yellow: #ffe6a6ad;
+  --theme--board_yellow-text: #fcde93;
+  --theme--board_yellow-card: rgb(255, 255, 255, 0.2);
+  --theme--board_green: #c8fdd9a3;
+  --theme--board_green-text: #b3f5c8;
+  --theme--board_green-card: rgb(255, 255, 255, 0.2);
+  --theme--board_blue: #d1e9ffa3;
+  --theme--board_blue-text: #bfe0fd;
+  --theme--board_blue-card: rgb(255, 255, 255, 0.2);
+  --theme--board_purple: #e3d3ffa8;
+  --theme--board_purple-text: #dac7fa;
+  --theme--board_purple-card: rgb(255, 255, 255, 0.2);
+  --theme--board_pink: #fdcce8b1;
+  --theme--board_pink-text: #f7b8dc;
+  --theme--board_pink-card: rgb(255, 255, 255, 0.2);
+  --theme--board_red: #ffc8ce9e;
+  --theme--board_red-text: #f8acb4;
+  --theme--board_red-card: rgb(255, 255, 255, 0.2);
+
+  --theme--code_inline: rgb(8, 8, 8);
+  --theme--code_inline-text: #b3f5c8;
+
+  --theme--code: #0f0f0f;
+  --theme--code_plain: var(--theme--text);
+  --theme--code_function: var(--theme--text_blue);
+  --theme--code_keyword: var(--theme--text_pink);
+  --theme--code_tag: var(--theme--text_pink);
+  --theme--code_operator: var(--theme--text_yellow);
+  --theme--code_important: var(--theme--text_yellow);
+  --theme--code_property: var(--theme--text_pink);
+  --theme--code_builtin: var(--theme--text_yellow);
+  --theme--code_attr-name: var(--theme--text_yellow);
+  --theme--code_comment: var(--theme--text_gray);
+  --theme--code_punctuation: var(--theme--text_gray);
+  --theme--code_doctype: var(--theme--text_gray);
+  --theme--code_number: var(--theme--text_purple);
+  --theme--code_string: var(--theme--text_orange);
+  --theme--code_attr-value: var(--theme--text_orange);
+}
diff --git a/src/mods/pinky-boom/mod.json b/src/mods/pinky-boom/mod.json
new file mode 100644
index 0000000..f6e1f74
--- /dev/null
+++ b/src/mods/pinky-boom/mod.json
@@ -0,0 +1,22 @@
+{
+  "name": "pinky boom",
+  "id": "b5f43232-391b-415a-9099-4334dc6c7b55",
+  "version": "0.2.0",
+  "description": "pinkify your life.",
+  "preview": "pinky-boom.png",
+  "tags": ["theme", "light"],
+  "authors": [
+    {
+      "name": "mugiwarafx",
+      "homepage": "https://github.com/mugiwarafx",
+      "avatar": "https://avatars.githubusercontent.com/u/58401248"
+    }
+  ],
+  "css": {
+    "frame": ["variables.css"],
+    "client": ["variables.css"],
+    "menu": ["variables.css"]
+  },
+  "js": {},
+  "options": []
+}
diff --git a/src/mods/pinky-boom/pinky-boom.png b/src/mods/pinky-boom/pinky-boom.png
new file mode 100644
index 0000000..04473f0
Binary files /dev/null and b/src/mods/pinky-boom/pinky-boom.png differ
diff --git a/src/mods/pinky-boom/variables.css b/src/mods/pinky-boom/variables.css
new file mode 100644
index 0000000..a5eefdc
--- /dev/null
+++ b/src/mods/pinky-boom/variables.css
@@ -0,0 +1,151 @@
+/**
+ * notion-enhancer: pinky boom
+ * (c) 2020 mugiwarafx
+ * (c) 2021 dragonwocky <thedragonring.bod@gmail.com> (https://dragonwocky.me/)
+ * (https://notion-enhancer.github.io/) under the MIT license
+ */
+
+:root.light {
+  --pinky_boom--brown: #a52a2a80;
+  --pinky_boom--orange: #ffa60080;
+  --pinky_boom--yellow: #ffff0080;
+  --pinky_boom--green: #00ff0080;
+  --pinky_boom--blue: #00ffff80;
+  --pinky_boom--purple: #9b00ff80;
+  --pinky_boom--pink: #ff149180;
+  --pinky_boom--red: #ff000080;
+
+  --theme--accent_blue: deeppink;
+  --theme--accent_blue-selection: rgba(255, 20, 145, 0.2);
+  --theme--accent_blue-hover: rgb(255, 57, 163);
+  --theme--accent_blue-active: rgb(255, 48, 158);
+  --theme--accent_red: deeppink;
+  --theme--accent_red-button: rgba(255, 20, 145, 0.2);
+
+  --theme--bg: #fdf0f4;
+  --theme--bg_secondary: #fce4ec;
+  --theme--bg_card: #ffd5e4;
+
+  --theme--scrollbar_track: transparent;
+  --theme--scrollbar_thumb: #f8bbd0;
+  --theme--scrollbar_thumb-hover: #f48fb1;
+
+  --theme--ui_shadow: #ff89c842;
+  --theme--ui_divider: #ffbbdf;
+  --theme--ui_interactive-hover: #fcb9d0;
+  --theme--ui_interactive-active: #ffccdc;
+  --theme--ui_toggle-off: #ffc9e6;
+  --theme--ui_corner_action: var(--theme--bg_card);
+  --theme--ui_corner_action-hover: var(--theme--ui_interactive-hover);
+  --theme--ui_corner_action-active: var(--theme--ui_interactive-active);
+
+  --theme--icon: #56002e;
+  --theme--icon_secondary: rgba(255, 20, 145, 0.75);
+
+  --theme--text: #56002e;
+  --theme--text_secondary: rgba(255, 20, 145, 0.75);
+
+  --theme--text_gray: rgb(155, 154, 151);
+  --theme--text_brown: rgb(100, 71, 58);
+  --theme--text_orange: rgb(217, 115, 13);
+  --theme--text_yellow: rgb(223, 171, 1);
+  --theme--text_green: rgb(15, 123, 108);
+  --theme--text_blue: rgb(11, 110, 153);
+  --theme--text_purple: var(--pinky_boom--purple);
+  --theme--text_pink: var(--pinky_boom--deep-pink);
+  --theme--text_red: rgb(224, 62, 62);
+
+  --theme--highlight_gray: rgba(128, 128, 128, 0.25);
+  --theme--highlight_brown: var(--pinky_boom--brown);
+  --theme--highlight_orange: var(--pinky_boom--orange);
+  --theme--highlight_orange-text: black;
+  --theme--highlight_yellow: var(--pinky_boom--yellow);
+  --theme--highlight_yellow-text: black;
+  --theme--highlight_green: var(--pinky_boom--green);
+  --theme--highlight_green-text: black;
+  --theme--highlight_blue: var(--pinky_boom--blue);
+  --theme--highlight_blue-text: black;
+  --theme--highlight_purple: var(--pinky_boom--purple);
+  --theme--highlight_purple-text: white;
+  --theme--highlight_pink: var(--pinky_boom--pink);
+  --theme--highlight_pink-text: white;
+  --theme--highlight_red: var(--pinky_boom--red);
+
+  --theme--callout_gray: rgba(128, 128, 128, 0.25);
+  --theme--callout_gray-text: black;
+  --theme--callout_brown: var(--pinky_boom--brown);
+  --theme--callout_brown-text: white;
+  --theme--callout_orange: var(--pinky_boom--orange);
+  --theme--callout_orange-text: black;
+  --theme--callout_yellow: var(--pinky_boom--yellow);
+  --theme--callout_yellow-text: black;
+  --theme--callout_green: var(--pinky_boom--green);
+  --theme--callout_green-text: black;
+  --theme--callout_blue: var(--pinky_boom--blue);
+  --theme--callout_blue-text: black;
+  --theme--callout_purple: var(--pinky_boom--purple);
+  --theme--callout_purple-text: white;
+  --theme--callout_pink: var(--pinky_boom--pink);
+  --theme--callout_pink-text: white;
+  --theme--callout_red: var(--pinky_boom--red);
+  --theme--callout_red-text: white;
+
+  --theme--board_light_gray: rgba(166, 166, 166, 0.5);
+  --theme--board_light_gray-text: white;
+  --theme--board_light_gray-card: rgba(166, 166, 166, 0.25);
+  --theme--board_gray: rgba(128, 128, 128, 0.5);
+  --theme--board_gray-text: white;
+  --theme--board_gray-card: rgba(128, 128, 128, 0.25);
+  --theme--board_brown: var(--pinky_boom--brown);
+  --theme--board_brown-text: white;
+  --theme--board_brown-card: var(--pinky_boom--brown);
+  --theme--board_orange: var(--pinky_boom--orange);
+  --theme--board_orange-text: white;
+  --theme--board_orange-card: var(--pinky_boom--orange);
+  --theme--board_yellow: var(--pinky_boom--yellow);
+  --theme--board_yellow-text: white;
+  --theme--board_yellow-card: var(--pinky_boom--yellow);
+  --theme--board_green: var(--pinky_boom--green);
+  --theme--board_green-text: white;
+  --theme--board_green-card: var(--pinky_boom--green);
+  --theme--board_blue: var(--pinky_boom--blue);
+  --theme--board_blue-text: white;
+  --theme--board_blue-card: var(--pinky_boom--blue);
+  --theme--board_purple: var(--pinky_boom--purple);
+  --theme--board_purple-text: white;
+  --theme--board_purple-card: var(--pinky_boom--purple);
+  --theme--board_pink: var(--pinky_boom--pink);
+  --theme--board_pink-text: white;
+  --theme--board_pink-card: var(--pinky_boom--pink);
+  --theme--board_red: var(--pinky_boom--red);
+  --theme--board_red-text: white;
+  --theme--board_red-card: var(--pinky_boom--red);
+
+  --theme--tag_default: #ffc9e6;
+  --theme--tag_light_gray: rgba(166, 166, 166, 0.25);
+  --theme--tag_light_gray-text: black;
+  --theme--tag_gray: rgba(128, 128, 128, 0.25);
+  --theme--tag_gray-text: black;
+  --theme--tag_brown: var(--pinky_boom--brown);
+  --theme--tag_brown-text: white;
+  --theme--tag_orange: var(--pinky_boom--orange);
+  --theme--tag_orange-text: black;
+  --theme--tag_yellow: var(--pinky_boom--yellow);
+  --theme--tag_yellow-text: black;
+  --theme--tag_green: var(--pinky_boom--green);
+  --theme--tag_green-text: black;
+  --theme--tag_blue: var(--pinky_boom--blue);
+  --theme--tag_blue-text: black;
+  --theme--tag_purple: var(--pinky_boom--purple);
+  --theme--tag_purple-text: white;
+  --theme--tag_pink: var(--pinky_boom--pink);
+  --theme--tag_pink-text: white;
+  --theme--tag_red: var(--pinky_boom--red);
+  --theme--tag_red-text: white;
+
+  --theme--code_inline: var(--theme--code);
+  --theme--code_inline-text: var(--theme--text);
+
+  --theme--code: var(--theme--bg_secondary);
+  --theme--code_punctuation: #ff46a8;
+}
diff --git a/src/mods/playful-purple/mod.json b/src/mods/playful-purple/mod.json
new file mode 100644
index 0000000..ce4c4af
--- /dev/null
+++ b/src/mods/playful-purple/mod.json
@@ -0,0 +1,27 @@
+{
+  "name": "playful purple",
+  "id": "ae7862a9-5dbe-4f2c-9931-940f3ba5015d",
+  "version": "0.2.0",
+  "description": "a purple-shaded theme with bright highlights.",
+  "preview": "playful-purple.png",
+  "tags": ["theme", "dark"],
+  "authors": [
+    {
+      "name": "Lizishan",
+      "homepage": "https://www.reddit.com/user/Lizishan",
+      "avatar": "https://styles.redditmedia.com/t5_110nz4/styles/profileIcon_h1m3b16exoi51.jpg"
+    },
+    {
+      "name": "LVL100ShrekCultist",
+      "homepage": "https://www.reddit.com/user/LVL100ShrekCultist/",
+      "avatar": "https://styles.redditmedia.com/t5_2js69j/styles/profileIcon_jvnzmo30fyq41.jpg"
+    }
+  ],
+  "css": {
+    "frame": ["variables.css"],
+    "client": ["variables.css"],
+    "menu": ["variables.css"]
+  },
+  "js": {},
+  "options": []
+}
diff --git a/src/mods/playful-purple/playful-purple.png b/src/mods/playful-purple/playful-purple.png
new file mode 100644
index 0000000..43930cf
Binary files /dev/null and b/src/mods/playful-purple/playful-purple.png differ
diff --git a/src/mods/playful-purple/variables.css b/src/mods/playful-purple/variables.css
new file mode 100644
index 0000000..cb0d704
--- /dev/null
+++ b/src/mods/playful-purple/variables.css
@@ -0,0 +1,152 @@
+/**
+ * notion-enhancer: playful dark
+ * (c) 2020 Lizishan
+ * (c) 2021 dragonwocky <thedragonring.bod@gmail.com> (https://dragonwocky.me/)
+ * (https://notion-enhancer.github.io/) under the MIT license
+ */
+
+:root.dark {
+  --theme--accent_blue: rgb(117, 65, 200);
+  --theme--accent_blue-selection: #9500ff1e;
+  --theme--accent_blue-hover: rgb(110, 48, 211);
+  --theme--accent_blue-active: rgb(117, 65, 200);
+  --theme--accent_red: rgb(150, 84, 226);
+  --theme--accent_red-button: rgba(150, 84, 226, 0.5);
+
+  --theme--bg: #1e1c26;
+  --theme--bg_secondary: #24222c;
+  --theme--bg_card: #19181f;
+
+  --theme--scrollbar_track: transparent;
+  --theme--scrollbar_thumb: #221f29;
+  --theme--scrollbar_thumb-hover: #312d3c;
+
+  --theme--ui_divider: rgba(148, 148, 184, 0.5);
+  --theme--ui_interactive-hover: #282632;
+  --theme--ui_interactive-active: #2b293a;
+  --theme--ui_toggle-off: rgb(20, 0, 51);
+  --theme--ui_corner_action: var(--theme--bg_card);
+  --theme--ui_corner_action-hover: var(--theme--ui_interactive-hover);
+  --theme--ui_corner_action-active: var(--theme--ui_interactive-active);
+
+  --theme--icon: #978ec7;
+  --theme--icon_secondary: #978ec7;
+
+  --theme--text: rgb(239, 235, 255);
+  --theme--text_secondary: #978ec7;
+
+  --theme--text_brown: rgb(177, 144, 131);
+  --theme--text_green: rgb(66, 222, 137);
+  --theme--text_blue: rgb(0, 157, 255);
+  --theme--text_purple: rgb(162, 94, 255);
+  --theme--text_red: rgb(240, 52, 38);
+
+  --theme--highlight_gray: rgb(234, 234, 234);
+  --theme--highlight_gray-text: rgb(17, 17, 17);
+  --theme--highlight_brown: rgb(206, 206, 206);
+  --theme--highlight_brown-text: rgb(85, 35, 1);
+  --theme--highlight_orange: rgb(254, 214, 155);
+  --theme--highlight_orange-text: rgb(199, 110, 0);
+  --theme--highlight_yellow: #fcffd8;
+  --theme--highlight_yellow-text: #ff8c22;
+  --theme--highlight_green: #d5fded;
+  --theme--highlight_green-text: #006a00;
+  --theme--highlight_blue: #e2f5ff;
+  --theme--highlight_blue-text: #00b2ff;
+  --theme--highlight_purple: #efe6ff;
+  --theme--highlight_purple-text: #8334ff;
+  --theme--highlight_pink: #ffe9f1;
+  --theme--highlight_pink-text: rgb(255, 0, 127);
+  --theme--highlight_red: rgb(251, 228, 228);
+  --theme--highlight_red-text: rgb(138, 0, 10);
+
+  --theme--callout_gray: #e2e3e5;
+  --theme--callout_gray-text: #383d41;
+  --theme--callout_brown: rgb(130, 118, 111);
+  --theme--callout_brown-text: rgb(85, 35, 1);
+  --theme--callout_orange: rgb(254, 214, 155);
+  --theme--callout_orange-text: rgb(255, 140, 0);
+  --theme--callout_yellow: #fcffd8;
+  --theme--callout_yellow-text: #c76e00;
+  --theme--callout_green: #d4edda;
+  --theme--callout_green-text: #155724;
+  --theme--callout_blue: #cce5ff;
+  --theme--callout_blue-text: #004085;
+  --theme--callout_purple: rgb(199, 178, 230);
+  --theme--callout_purple-text: rgb(90, 49, 148);
+  --theme--callout_pink: rgb(255, 206, 228);
+  --theme--callout_pink-text: rgb(255, 0, 127);
+  --theme--callout_red: #f8d7da;
+  --theme--callout_red-text: #721c24;
+
+  --theme--tag_default: rgb(234, 234, 234);
+  --theme--tag_default-text: rgb(17, 17, 17);
+  --theme--tag_light_gray: rgb(240, 240, 240);
+  --theme--tag_light_gray-text: rgb(88, 88, 88);
+  --theme--tag_gray: rgb(234, 234, 234);
+  --theme--tag_gray-text: rgb(17, 17, 17);
+  --theme--tag_brown: rgb(206, 206, 206);
+  --theme--tag_brown-text: rgb(85, 35, 1);
+  --theme--tag_orange: rgb(254, 214, 155);
+  --theme--tag_orange-text: rgb(199, 110, 0);
+  --theme--tag_yellow: #fcffd8;
+  --theme--tag_yellow-text: #ff8c22;
+  --theme--tag_green: #d5fded;
+  --theme--tag_green-text: #006a00;
+  --theme--tag_blue: #e2f5ff;
+  --theme--tag_blue-text: #00b2ff;
+  --theme--tag_purple: #efe6ff;
+  --theme--tag_purple-text: #8334ff;
+  --theme--tag_pink: #ffe9f1;
+  --theme--tag_pink-text: rgb(255, 0, 127);
+  --theme--tag_red: rgb(251, 228, 228);
+  --theme--tag_red-text: rgb(138, 0, 10);
+
+  --theme--board_light_gray: #EBEBED;
+  --theme--board_light_gray-text: #74777A;
+  --theme--board_light_gray-card: var(--theme--tag_light_gray);
+  --theme--board_light_gray-card_text: var(--theme--tag_light_gray-text);
+  --theme--board_gray: #e2e3e5;
+  --theme--board_gray-text: #383d41;
+  --theme--board_gray-card: var(--theme--tag_gray);
+  --theme--board_gray-card_text: var(--theme--tag_gray-text);
+  --theme--board_brown: rgb(130, 118, 111);
+  --theme--board_brown-text: rgb(85, 35, 1);
+  --theme--board_brown-card: var(--theme--tag_brown);
+  --theme--board_brown-card_text: var(--theme--tag_brown-text);
+  --theme--board_orange: rgb(254, 214, 155);
+  --theme--board_orange-text: rgb(255, 140, 0);
+  --theme--board_orange-card: var(--theme--tag_orange);
+  --theme--board_orange-card_text: var(--theme--tag_orange-text);
+  --theme--board_yellow: #fcffd8;
+  --theme--board_yellow-text: #c76e00;
+  --theme--board_yellow-card: var(--theme--tag_yellow);
+  --theme--board_yellow-card_text: var(--theme--tag_yellow-text);
+  --theme--board_green: #d4edda;
+  --theme--board_green-text: #155724;
+  --theme--board_green-card: var(--theme--tag_green);
+  --theme--board_green-card_text: var(--theme--tag_green-text);
+  --theme--board_blue: #cce5ff;
+  --theme--board_blue-text: #004085;
+  --theme--board_blue-card: var(--theme--tag_blue);
+  --theme--board_blue-card_text: var(--theme--tag_blue-text);
+  --theme--board_purple: rgb(199, 178, 230);
+  --theme--board_purple-text: rgb(90, 49, 148);
+  --theme--board_purple-card: var(--theme--tag_purple);
+  --theme--board_purple-card_text: var(--theme--tag_purple-text);
+  --theme--board_pink: rgb(255, 206, 228);
+  --theme--board_pink-text: rgb(255, 0, 127);
+  --theme--board_pink-card: var(--theme--tag_pink);
+  --theme--board_pink-card_text: var(--theme--tag_pink-text);
+  --theme--board_red: #f8d7da;
+  --theme--board_red-text: #721c24;
+  --theme--board_red-card: var(--theme--tag_red);
+  --theme--board_red-card_text: var(--theme--tag_red-text);
+
+  --theme--code_inline: rgb(179, 39, 39);
+  --theme--code_inline-text: #e0dfe2;
+
+  --theme--code: var(--theme--bg_card);
+  --theme--code_function: rgb(179, 146, 240);
+  --theme--code_number: hsl(159, 69%, 39%);
+}
diff --git a/src/mods/quick-note/client.mjs b/src/mods/quick-note/client.mjs
new file mode 100644
index 0000000..89a7d66
--- /dev/null
+++ b/src/mods/quick-note/client.mjs
@@ -0,0 +1,33 @@
+/**
+ * notion-enhancer: quick note
+ * (c) 2021 dragonwocky <thedragonring.bod@gmail.com> (https://dragonwocky.me/)
+ * (https://notion-enhancer.github.io/) under the MIT license
+ */
+
+'use strict';
+
+export default async function ({ web, components, notion }, db) {
+  const targetDbId = await db.get(['target_db']);
+  if (!targetDbId) return;
+
+  const newQuickNote = async () => {
+    try {
+      const { collection_id } = await notion.get(targetDbId),
+        noteID = await notion.create(
+          {
+            recordValue: {
+              properties: { title: [[`quick note: ${new Date().toLocaleString()}`]] },
+            },
+            recordType: 'page',
+          },
+          { parentID: collection_id, parentTable: 'collection' }
+        );
+      location.assign(`https://www.notion.so/${noteID.replace(/-/g, '')}`);
+    } catch {
+      alert('quick note failed: target database id did not match any known databases');
+    }
+  };
+
+  await components.addCornerAction(await components.feather('feather'), newQuickNote);
+  web.addHotkeyListener(await db.get(['hotkey']), newQuickNote);
+}
diff --git a/src/mods/quick-note/mod.json b/src/mods/quick-note/mod.json
new file mode 100644
index 0000000..5166a3f
--- /dev/null
+++ b/src/mods/quick-note/mod.json
@@ -0,0 +1,35 @@
+{
+  "name": "quick note",
+  "id": "5d7c1677-6f6d-4fb5-8d6f-5067bcd0e24c",
+  "version": "0.1.0",
+  "description": "adds a hotkey & a button in the bottom right corner to jump to a new page in a notes database (target database id must be set).",
+  "preview": "quick-note.png",
+  "tags": ["integration", "shortcut"],
+  "authors": [
+    {
+      "name": "dragonwocky",
+      "email": "thedragonring.bod@gmail.com",
+      "homepage": "https://dragonwocky.me/",
+      "avatar": "https://dragonwocky.me/avatar.jpg"
+    }
+  ],
+  "css": {},
+  "js": {
+    "client": ["client.mjs"]
+  },
+  "options": [
+    {
+      "type": "text",
+      "key": "target_db",
+      "label": "target database id",
+      "tooltip": "**the uuid of the database in which pages should be created** (the bit after the '/' in the database url, e.g. edbafbd8bb7045cab1408aadaf4edf9d)",
+      "value": ""
+    },
+    {
+      "type": "hotkey",
+      "key": "hotkey",
+      "label": "hotkey",
+      "value": "Ctrl+Alt+="
+    }
+  ]
+}
diff --git a/src/mods/quick-note/quick-note.png b/src/mods/quick-note/quick-note.png
new file mode 100644
index 0000000..faa3ad5
Binary files /dev/null and b/src/mods/quick-note/quick-note.png differ
diff --git a/src/mods/registry.json b/src/mods/registry.json
new file mode 100644
index 0000000..6093766
--- /dev/null
+++ b/src/mods/registry.json
@@ -0,0 +1,47 @@
+[
+  "menu",
+  "theming",
+  "components",
+
+  "tweaks",
+  "font-chooser",
+
+  "integrated-titlebar",
+  "tray",
+  "tabs",
+  "always-on-top",
+  "view-scale",
+
+  "outliner",
+  "scroll-to-top",
+  "indentation-lines",
+  "right-to-left",
+  "simpler-databases",
+  "emoji-sets",
+  "bypass-preview",
+  "topbar-icons",
+  "word-counter",
+  "code-line-numbers",
+  "calendar-scroll",
+  "collapsible-properties",
+  "weekly-view",
+  "truncated-titles",
+  "focus-mode",
+  "global-block-links",
+
+  "icon-sets",
+  "quick-note",
+
+  "material-ocean",
+  "cherry-cola",
+  "dark+",
+  "light+",
+  "dracula",
+  "pastel-dark",
+  "neutral",
+  "nord",
+  "gruvbox-dark",
+  "gruvbox-light",
+  "playful-purple",
+  "pinky-boom"
+]
diff --git a/src/mods/right-to-left/client.css b/src/mods/right-to-left/client.css
new file mode 100644
index 0000000..3597fcc
--- /dev/null
+++ b/src/mods/right-to-left/client.css
@@ -0,0 +1,26 @@
+/**
+ * notion-enhancer: right to left
+ * (c) 2021 obahareth <omar@omar.engineer> (https://omar.engineer)
+ * (c) 2021 dragonwocky <thedragonring.bod@gmail.com> (https://dragonwocky.me/)
+ * (https://notion-enhancer.github.io/) under the MIT license
+ */
+
+.notion-page-content
+  .notion-table_of_contents-block
+  > div
+  > div
+  > a
+  > div
+  > div[style*='margin-left: 24px'] {
+  margin-inline-start: 24px;
+}
+
+.notion-page-content
+  .notion-table_of_contents-block
+  > div
+  > div
+  > a
+  > div
+  > div[style*='margin-left: 48px'] {
+  margin-inline-start: 48px;
+}
diff --git a/src/mods/right-to-left/client.mjs b/src/mods/right-to-left/client.mjs
new file mode 100644
index 0000000..decba98
--- /dev/null
+++ b/src/mods/right-to-left/client.mjs
@@ -0,0 +1,50 @@
+/**
+ * notion-enhancer: right to left
+ * (c) 2021 obahareth <omar@omar.engineer> (https://omar.engineer)
+ * (c) 2021 dragonwocky <thedragonring.bod@gmail.com> (https://dragonwocky.me/)
+ * (https://notion-enhancer.github.io/) under the MIT license
+ */
+
+'use strict';
+
+export default async function ({ web }, db) {
+  const pageContentSelector = `
+      .notion-page-content >
+        div[data-block-id]:not([dir]):not(.notion-column_list-block):not(.notion-collection_view_page-block),
+      [placeholder="Untitled"]:not([dir]),
+      .notion-column-block > div[data-block-id]:not([dir]),
+      .notion-collection_view-block:not([dir]),
+      .notion-table-view:not([dir]),
+      .notion-board-view:not([dir]),
+      .notion-gallery-view:not([dir])`,
+    listItemSelector = `
+      div[placeholder="List"]:not([style*="text-align: start"]),
+      div[placeholder="To-do"]:not([style*="text-align: start"]),
+      div[placeholder="Toggle"]:not([style*="text-align: start"])`,
+    inlineEquationSelector =
+      '.notion-text-equation-token .katex-html:not([style*="direction: rtl;"])';
+
+  const autoAlignText = () => {
+    document
+      .querySelectorAll(pageContentSelector)
+      .forEach(($block) => $block.setAttribute('dir', 'auto'));
+    document.querySelectorAll(listItemSelector).forEach(($item) => {
+      $item.style['text-align'] = 'start';
+    });
+    document.querySelectorAll(inlineEquationSelector).forEach(($equation) => {
+      $equation.style.direction = 'rtl';
+      $equation.style.display = 'inline-flex';
+      $equation.style.flexDirection = 'row-reverse';
+      for (const $symbol of $equation.children) {
+        $symbol.style.direction = 'ltr';
+      }
+    });
+  };
+  web.addDocumentObserver(autoAlignText, [
+    pageContentSelector,
+    listItemSelector,
+    inlineEquationSelector,
+  ]);
+  await web.whenReady();
+  autoAlignText();
+}
diff --git a/src/mods/right-to-left/mod.json b/src/mods/right-to-left/mod.json
new file mode 100644
index 0000000..1a1d396
--- /dev/null
+++ b/src/mods/right-to-left/mod.json
@@ -0,0 +1,23 @@
+{
+  "name": "right to left",
+  "id": "b28ee2b9-4d34-4e36-be8a-ab5be3d79f51",
+  "version": "1.5.0",
+  "description": "enables auto rtl/ltr text direction detection.",
+  "preview": "right-to-left.jpg",
+  "tags": ["extension", "usability"],
+  "authors": [
+    {
+      "name": "obahareth",
+      "email": "omar@omar.engineer",
+      "homepage": "https://omar.engineer",
+      "avatar": "https://avatars.githubusercontent.com/u/3428118"
+    }
+  ],
+  "js": {
+    "client": ["client.mjs"]
+  },
+  "css": {
+    "client": ["client.css"]
+  },
+  "options": []
+}
diff --git a/src/mods/right-to-left/right-to-left.jpg b/src/mods/right-to-left/right-to-left.jpg
new file mode 100644
index 0000000..38956ed
Binary files /dev/null and b/src/mods/right-to-left/right-to-left.jpg differ
diff --git a/src/mods/scroll-to-top/client.mjs b/src/mods/scroll-to-top/client.mjs
new file mode 100644
index 0000000..396984e
--- /dev/null
+++ b/src/mods/scroll-to-top/client.mjs
@@ -0,0 +1,43 @@
+/**
+ * notion-enhancer: scroll to top
+ * (c) 2021 CloudHill <rl.cloudhill@gmail.com> (https://github.com/CloudHill)
+ * (c) 2021 dragonwocky <thedragonring.bod@gmail.com> (https://dragonwocky.me/)
+ * (https://notion-enhancer.github.io/) under the MIT license
+ */
+
+'use strict';
+
+export default async function ({ web, components }, db) {
+  const scrollStyle = (await db.get(['smooth'])) ? 'smooth' : 'auto',
+    $scrollButton = await components.addCornerAction(
+      await components.feather('chevron-up'),
+      () => {
+        document.querySelector('.notion-frame > .notion-scroller').scroll({
+          top: 0,
+          left: 0,
+          behavior: scrollStyle,
+        });
+      }
+    );
+
+  let $scroller;
+  const topDistancePx = +(await db.get(['top_distance_px'])),
+    topDistancePercent = 0.01 * (await db.get(['top_distance_percent'])),
+    adjustButtonVisibility = async () => {
+      if (!$scroller) return;
+      $scrollButton.classList.add('hidden');
+      const scrolledDistance =
+        $scroller.scrollTop >= topDistancePx ||
+        $scroller.scrollTop >=
+          ($scroller.scrollHeight - $scroller.clientHeight) * topDistancePercent;
+      if (scrolledDistance) $scrollButton.classList.remove('hidden');
+    };
+  web.addDocumentObserver(() => {
+    $scroller = document.querySelector('.notion-frame > .notion-scroller');
+    $scroller.removeEventListener('scroll', adjustButtonVisibility);
+    $scroller.addEventListener('scroll', adjustButtonVisibility);
+  }, ['.notion-frame > .notion-scroller']);
+  adjustButtonVisibility();
+
+  if (topDistancePx && topDistancePercent) $scrollButton.classList.add('hidden');
+}
diff --git a/src/mods/scroll-to-top/mod.json b/src/mods/scroll-to-top/mod.json
new file mode 100644
index 0000000..cf57cd8
--- /dev/null
+++ b/src/mods/scroll-to-top/mod.json
@@ -0,0 +1,42 @@
+{
+  "name": "scroll to top",
+  "id": "0a958f5a-17c5-48b5-8713-16190cae1959",
+  "version": "0.3.0",
+  "description": "adds an arrow in the bottom right corner to scroll back to the top of a page.",
+  "preview": "scroll-to-top.png",
+  "tags": ["extension", "shortcut"],
+  "authors": [
+    {
+      "name": "CloudHill",
+      "email": "rh.cloudhill@gmail.com",
+      "homepage": "https://github.com/CloudHill",
+      "avatar": "https://avatars.githubusercontent.com/u/54142180"
+    }
+  ],
+  "css": {},
+  "js": {
+    "client": ["client.mjs"]
+  },
+  "options": [
+    {
+      "type": "toggle",
+      "key": "smooth",
+      "label": "smooth scrolling",
+      "value": true
+    },
+    {
+      "type": "number",
+      "key": "top_distance_px",
+      "label": "distance scrolled until button shown (px)",
+      "tooltip": "**the distance in pixels that must be scrolled down before the button appears**",
+      "value": 5000
+    },
+    {
+      "type": "number",
+      "key": "top_distance_percent",
+      "label": "distance scrolled until button shown (%)",
+      "tooltip": "**the percentage of the page that must be scrolled down before the button appears**",
+      "value": 80
+    }
+  ]
+}
diff --git a/src/mods/scroll-to-top/scroll-to-top.png b/src/mods/scroll-to-top/scroll-to-top.png
new file mode 100644
index 0000000..0f1c55c
Binary files /dev/null and b/src/mods/scroll-to-top/scroll-to-top.png differ
diff --git a/src/mods/simpler-databases/client.css b/src/mods/simpler-databases/client.css
new file mode 100644
index 0000000..eeb47e8
--- /dev/null
+++ b/src/mods/simpler-databases/client.css
@@ -0,0 +1,429 @@
+/**
+ * notion-enhancer: simpler databases
+ * (c) 2020 CloudHill <rl.cloudhill@gmail.com> (https://github.com/CloudHill)
+ * (c) 2021 dragonwocky <thedragonring.bod@gmail.com> (https://dragonwocky.me/)
+ * (https://notion-enhancer.github.io/) under the MIT license
+ */
+
+.simpler_databases--config_button:hover {
+  background: linear-gradient(
+      var(--theme--ui_interactive-hover),
+      var(--theme--ui_interactive-hover)
+    ),
+    linear-gradient(var(--theme--bg), var(--theme--bg));
+}
+.simpler_databases--config_button svg {
+  width: 12px;
+  height: 12px;
+  fill: var(--theme--icon_secondary);
+}
+.notion-collection_view-block[data-simpler-db-tweaks]:not([data-simpler-db-tweaks*='[icon]']):not([data-simpler-db-tweaks*='[title]']):not([data-simpler-db-tweaks*='[toggle]']):not([data-simpler-db-tweaks*='[views']):not([data-simpler-db-tweaks*='[toolbar]'])
+  [style*=' height: 42px;']
+  > :last-child {
+  position: absolute;
+  top: 4px;
+  right: 0;
+  z-index: 99;
+  pointer-events: auto;
+}
+.notion-collection_view-block[data-simpler-db-tweaks]:not([data-simpler-db-tweaks*='[icon]']):not([data-simpler-db-tweaks*='[title]']):not([data-simpler-db-tweaks*='[toggle]']):not([data-simpler-db-tweaks*='[views']):not([data-simpler-db-tweaks*='[toolbar]'])
+  .simpler_databases--config_button {
+  box-shadow: var(--theme--ui_shadow, rgba(15, 15, 15, 0.05)) 0px 0px 0px 1px,
+    var(--theme--ui_shadow, rgba(15, 15, 15, 0.1)) 0px 3px 6px,
+    var(--theme--ui_shadow, rgba(15, 15, 15, 0.2)) 0px 9px 24px !important;
+}
+.notion-collection_view-block[data-simpler-db-tweaks]:not([data-simpler-db-tweaks*='[icon]']):not([data-simpler-db-tweaks*='[title]']):not([data-simpler-db-tweaks*='[toggle]']):not([data-simpler-db-tweaks*='[views']):not([data-simpler-db-tweaks*='[toolbar]'])
+  .simpler_databases--config_button:not(:hover) {
+  background: var(--theme--bg);
+}
+
+.simpler_databases--overlay_container {
+  position: fixed;
+  top: 0;
+  right: 0;
+  bottom: 0;
+  left: 0;
+  z-index: 999;
+  overflow: hidden;
+}
+
+.simpler_databases--config_menu {
+  position: relative;
+  width: 220px;
+  max-height: 70vh;
+  padding: 8px 0;
+  border-radius: 3px;
+  box-shadow: var(--theme--ui_shadow, rgba(15, 15, 15, 0.05)) 0px 0px 0px 1px,
+    var(--theme--ui_shadow, rgba(15, 15, 15, 0.1)) 0px 3px 6px,
+    var(--theme--ui_shadow, rgba(15, 15, 15, 0.2)) 0px 9px 24px;
+  background: var(--theme--bg_card);
+  overflow: hidden auto;
+}
+
+.simpler_databases--config_item-toggle,
+.simpler_databases--config_item-input {
+  display: flex;
+  align-items: center;
+  width: 100%;
+  min-height: 28px;
+  font-size: 14px;
+  line-height: 1.2;
+  user-select: none;
+}
+.simpler_databases--config_item-toggle {
+  cursor: pointer;
+}
+.simpler_databases--config_item-toggle:hover,
+.simpler_databases--config_item-toggle:focus {
+  background: var(--theme--ui_interactive-hover);
+}
+.simpler_databases--config_item-input {
+  padding: 6px 0;
+}
+
+.simpler_databases--config_title {
+  margin: 0 14px;
+  min-width: 0;
+  flex: 1 1 auto;
+  white-space: nowrap;
+  overflow: hidden;
+  text-overflow: ellipsis;
+}
+
+.simpler_databases--config_toggle {
+  flex-shrink: 0;
+  position: relative;
+  height: 14px;
+  width: 26px;
+  margin-left: auto;
+  margin-right: 14px;
+  padding: 2px;
+  border-radius: 44px;
+  cursor: pointer;
+  user-select: none;
+  box-sizing: content-box;
+  background: var(--theme--ui_toggle-off);
+  transition: background 200ms ease 0s, box-shadow 200ms ease 0s;
+}
+.simpler_databases--config_toggle[data-toggled='true'] {
+  background: var(--theme--ui_toggle-on);
+}
+.simpler_databases--config_toggle::before {
+  content: '';
+  position: absolute;
+  width: 14px;
+  height: 14px;
+  border-radius: 44px;
+  background: var(--theme--ui_toggle-feature);
+  transition: transform 200ms ease-out 0s, background 200ms ease-out 0s;
+}
+.simpler_databases--config_toggle[data-toggled='true']::before {
+  transform: translateX(12px);
+}
+
+.simpler_databases--config_input {
+  display: flex;
+  align-items: center;
+  height: 28px;
+  margin: 0 14px;
+  padding: 3px 6px;
+  background: var(--theme--ui_input);
+  box-shadow: var(--theme--ui_shadow) 0px 0px 0px 1px inset;
+  border-radius: 3px;
+  font-size: 14px;
+  line-height: 20px;
+  cursor: text;
+  width: 100%;
+}
+.simpler_databases--config_input input {
+  font-size: inherit;
+  line-height: inherit;
+  border: none;
+  background: none;
+  width: 100%;
+  display: block;
+  resize: none;
+  padding: 0;
+}
+
+.simpler_databases--config_divider {
+  border-bottom: 1px solid var(--theme--ui_divider);
+  width: 100%;
+  margin: 6px 0;
+}
+
+.notion-collection_view-block[data-simpler-db-tweaks*='[config-open]']
+  [style*=' height: 42px;']
+  > :not(:first-child) {
+  opacity: 1 !important;
+}
+
+/* TWEAKS */
+
+/* Toggle */
+.simpler_databases--toggle {
+  flex-shrink: 0;
+  width: 24px;
+  height: 24px;
+  display: flex;
+  align-items: center;
+  justify-content: center;
+  border-radius: 3px;
+  cursor: pointer;
+  transition: background 20ms ease-in 0s;
+}
+.simpler_databases--toggle svg {
+  width: 12px;
+  height: 12px;
+  transform: rotateZ(180deg);
+  transition: transform 200ms ease-out 0s;
+}
+.simpler_databases--toggle:hover {
+  background: var(--theme--ui_interactive-hover);
+}
+
+.notion-collection_view-block[data-simpler-db-tweaks*='[toggle]'][data-simpler-db-toggle-hidden='true']
+  .simpler_databases--toggle
+  svg {
+  transform: rotateZ(90deg);
+}
+
+.notion-collection_view-block[data-simpler-db-tweaks*='[toggle]'] > div > .notion-scroller {
+  transition: height 200ms ease-in, opacity 200ms ease-in;
+}
+.notion-collection_view-block[data-simpler-db-tweaks*='[toggle]'][data-simpler-db-toggle-hidden='true']
+  > div
+  > .notion-scroller {
+  opacity: 0;
+  height: 0 !important;
+}
+
+.notion-collection_view-block[data-simpler-db-tweaks*='[toggle]'][data-simpler-db-toggle-hidden='true']
+  [data-simpler-db-hide-items]
+  [class$='view']
+  > .notion-collection_view-block,
+.notion-collection_view-block[data-simpler-db-tweaks*='[toggle]'][data-simpler-db-toggle-hidden='true']
+  [data-simpler-db-hide-items]
+  .notion-collection-item {
+  display: none !important;
+}
+
+/* Title */
+
+.notion-collection_view-block[data-simpler-db-tweaks]:not([data-simpler-db-tweaks*='[title]'])
+  [style*=' height: 42px;']
+  > [style*='white-space: nowrap; overflow: hidden;']
+  [placeholder] {
+  display: none !important;
+}
+
+/* Icons + Link Arrows */
+
+.notion-collection_view-block[data-simpler-db-tweaks]:not([data-simpler-db-tweaks*='[icon]'])
+  [style*=' height: 42px;']
+  a
+  :first-child[style*='margin-right: 6px'] {
+  display: none !important;
+}
+
+/* Views */
+
+.notion-collection_view-block[data-simpler-db-tweaks]:not([data-simpler-db-tweaks*='[views]'])
+  [style*=' height: 42px;']
+  > [role='button'] {
+  display: none !important;
+}
+
+/* Toolbar */
+
+.notion-collection_view-block[data-simpler-db-tweaks]:not([data-simpler-db-tweaks*='[toolbar]'])
+  .simpler_databases--config_button
+  ~ * {
+  display: none !important;
+}
+
+/* Header - table, calendar */
+
+.notion-collection_view-block[data-simpler-db-tweaks]:not([data-simpler-db-tweaks*='[header_row]'])
+  .notion-table-view
+  > .notion-collection_view-block
+  > :first-child,
+.notion-collection_view-block[data-simpler-db-tweaks]:not([data-simpler-db-tweaks*='[header_row]'])
+  .notion-table-view
+  > .notion-collection_view-block
+  > :first-child
+  + div {
+  display: none !important;
+}
+
+.notion-collection_view-block[data-simpler-db-tweaks]:not([data-simpler-db-tweaks*='[header_row]'])
+  .notion-table-view
+  .notion-collection_view-block
+  > [style*='height: 34px']
+  + div {
+  border-top: 1px solid var(--theme--ui_divider);
+}
+
+/* New Item - table, board, timeline, list, gallery */
+
+.notion-collection_view-block[data-simpler-db-tweaks]:not([data-simpler-db-tweaks*='[new_item]'])
+  .notion-table-view-add-row,
+.notion-collection_view-block[data-simpler-db-tweaks]:not([data-simpler-db-tweaks*='[new_item]'])
+  .notion-board-view
+  .notion-board-group
+  > [role='button']:not(.notion-collection-item),
+.notion-collection_view-block[data-simpler-db-tweaks]:not([data-simpler-db-tweaks*='[new_item]'])
+  .notion-timeline-item-row:last-child,
+.notion-collection_view-block[data-simpler-db-tweaks]:not([data-simpler-db-tweaks*='[new_item]'])
+  .notion-list-view
+  > .notion-collection_view-block
+  > [role='button']:not(.notion-collection-item),
+.notion-collection_view-block[data-simpler-db-tweaks]:not([data-simpler-db-tweaks*='[new_item]'])
+  .notion-gallery-view
+  > .notion-collection_view-block
+  [style*='grid']
+  > [role='button'] {
+  display: none !important;
+}
+.notion-collection_view-block[data-simpler-db-tweaks]:not([data-simpler-db-tweaks*='[new_item]'])
+  .notion-timeline-view
+  > [style*='padding-bottom: 34px;'] {
+  padding-bottom: 0 !important;
+}
+
+/* Calc Row - table, timeline */
+
+.notion-collection_view-block[data-simpler-db-tweaks]:not([data-simpler-db-tweaks*='[calc_row]'])
+  .notion-table-view-add-row
+  ~ div:not(.notion-selectable-halo):not([role='button']),
+.notion-collection_view-block[data-simpler-db-tweaks]:not([data-simpler-db-tweaks*='[calc_row]'])
+  .notion-timeline-view
+  > [style*='z-index: 4;']:last-child {
+  display: none !important;
+}
+
+/* Hidden Columns - board */
+
+.notion-collection_view-block[data-simpler-db-tweaks]:not([data-simpler-db-tweaks*='[hidden_column]'])
+  .notion-board-view
+  > .notion-collection_view-block
+  [style*='width: 220px;'] {
+  display: none !important;
+}
+
+/* Add Group - board */
+
+.notion-collection_view-block[data-simpler-db-tweaks]:not([data-simpler-db-tweaks*='[add_group]'])
+  .notion-board-view
+  > .notion-collection_view-block
+  [style*='width: 180px;'] {
+  display: none !important;
+}
+
+/* New Column - table */
+
+.notion-collection_view-block[data-simpler-db-tweaks]:not([data-simpler-db-tweaks*='[new_column]'])
+  .notion-table-view-add-column,
+.notion-collection_view-block[data-simpler-db-tweaks]:not([data-simpler-db-tweaks*='[new_column]'])
+  .notion-table-view
+  .notion-collection-item
+  > [style*='width: 32px;'] {
+  display: none !important;
+}
+.notion-collection_view-block[data-simpler-db-tweaks]:not([data-simpler-db-tweaks*='[new_column]'])
+  .notion-table-view-add-row
+  + [style*='padding-right: 32px;'] {
+  padding-right: 0 !important;
+}
+
+/* Full Width - table */
+
+.notion-collection_view-block[data-simpler-db-tweaks]:not([data-simpler-db-tweaks*='[full_width]'])
+  .notion-table-view
+  > .notion-collection_view-block {
+  max-width: fit-content;
+}
+.notion-collection_view-block[data-simpler-db-tweaks]:not([data-simpler-db-tweaks*='[full_width]'])
+  .notion-table-view
+  .notion-collection_view-block
+  > [style*='min-width'] {
+  min-width: 0 !important;
+}
+.notion-collection_view-block[data-simpler-db-tweaks]:not([data-simpler-db-tweaks*='[full_width]'])
+  .notion-table-view
+  .notion-collection-item {
+  width: fit-content;
+}
+.notion-collection_view-block[data-simpler-db-tweaks]:not([data-simpler-db-tweaks*='[full_width]'])
+  .notion-table-view
+  .notion-collection_view-block
+  > [style*='height: 34px']
+  + div,
+.notion-collection_view-block[data-simpler-db-tweaks]:not([data-simpler-db-tweaks*='[full_width]'])
+  .notion-table-view
+  .notion-collection_view-block
+  > :first-child {
+  border-left: 1px solid var(--theme--ui_divider);
+}
+
+/* COMPOUND TWEAKS */
+
+/* Title and Link disabled > Hide title container */
+.notion-collection_view-block[data-simpler-db-tweaks]:not([data-simpler-db-tweaks*='[icon]']):not([data-simpler-db-tweaks*='[title]'])
+  [style*=' height: 42px;']
+  > [style*='white-space: nowrap; overflow: hidden;'] {
+  display: none !important;
+}
+
+/* New Row and Calc Row disabled > Add bottom border - table */
+.notion-collection_view-block[data-simpler-db-tweaks]:not([data-simpler-db-tweaks*='[calc_row]']):not([data-simpler-db-tweaks*='[new_item]'])
+  .notion-table-view
+  .notion-collection_view-block
+  > [style*='height: 34px']
+  + div {
+  border-bottom: 1px solid var(--theme--ui_divider);
+}
+
+/* New Column enabled with Full Width disabled > Add right border - table */
+.notion-collection_view-block[data-simpler-db-tweaks][data-simpler-db-tweaks*='[new_column]']:not([data-simpler-db-tweaks*='[full_width]'])
+  .notion-table-view
+  .notion-collection_view-block
+  > [style*='height: 34px']
+  + div,
+.notion-collection_view-block[data-simpler-db-tweaks][data-simpler-db-tweaks*='[new_column]']:not([data-simpler-db-tweaks*='[full_width]'])
+  .notion-table-view
+  .notion-collection_view-block
+  > :first-child {
+  border-right: 1px solid var(--theme--ui_divider);
+}
+
+/* REMOVE DATABASE HEADER < Title, Link, Toggle, Views, and Toolbar disabled */
+
+/* Hide Header */
+.notion-collection_view-block[data-simpler-db-tweaks]:not([data-simpler-db-tweaks*='[icon]']):not([data-simpler-db-tweaks*='[title]']):not([data-simpler-db-tweaks*='[toggle]']):not([data-simpler-db-tweaks*='[views']):not([data-simpler-db-tweaks*='[toolbar]'])
+  [style*='min-height: 42px'] {
+  min-height: 0 !important;
+  max-height: 0;
+  pointer-events: none;
+}
+.notion-collection_view-block[data-simpler-db-tweaks]:not([data-simpler-db-tweaks*='[icon]']):not([data-simpler-db-tweaks*='[title]']):not([data-simpler-db-tweaks*='[toggle]']):not([data-simpler-db-tweaks*='[views']):not([data-simpler-db-tweaks*='[toolbar]'])
+  [style*='height: 42px'] {
+  overflow: visible !important;
+}
+
+/* Hide Top Border */
+.notion-collection_view-block[data-simpler-db-tweaks]:not([data-simpler-db-tweaks*='[icon]']):not([data-simpler-db-tweaks*='[title]']):not([data-simpler-db-tweaks*='[toggle]']):not([data-simpler-db-tweaks*='[views']):not([data-simpler-db-tweaks*='[toolbar]'])
+  :not(.notion-table-view)
+  > .notion-collection_view-block
+  > [style*='box-shadow'] {
+  box-shadow: none !important;
+}
+.notion-collection_view-block[data-simpler-db-tweaks]:not([data-simpler-db-tweaks*='[icon]']):not([data-simpler-db-tweaks*='[title]']):not([data-simpler-db-tweaks*='[toggle]']):not([data-simpler-db-tweaks*='[views']):not([data-simpler-db-tweaks*='[toolbar]'])
+  :not(.notion-table-view)
+  > .notion-collection_view-block[style*='border-top'],
+.notion-collection_view-block[data-simpler-db-tweaks]:not([data-simpler-db-tweaks*='[icon]']):not([data-simpler-db-tweaks*='[title]']):not([data-simpler-db-tweaks*='[toggle]']):not([data-simpler-db-tweaks*='[views']):not([data-simpler-db-tweaks*='[toolbar]'])
+  :not(.notion-table-view)
+  > .notion-collection_view-block
+  > [style*='border-top'] {
+  border-top: none !important;
+}
diff --git a/src/mods/simpler-databases/client.mjs b/src/mods/simpler-databases/client.mjs
new file mode 100644
index 0000000..c82a6c9
--- /dev/null
+++ b/src/mods/simpler-databases/client.mjs
@@ -0,0 +1,452 @@
+/**
+ * notion-enhancer: simpler databases
+ * (c) 2020 CloudHill <rl.cloudhill@gmail.com> (https://github.com/CloudHill)
+ * (c) 2021 dragonwocky <thedragonring.bod@gmail.com> (https://dragonwocky.me/)
+ * (https://notion-enhancer.github.io/) under the MIT license
+ */
+
+export default async function ({ web, components }, db) {
+  const collectionViewSelector =
+      '.notion-collection_view-block[style*="width"][style*="max-width"]',
+    collectionAddNewSelector = '.notion-collection-view-item-add',
+    collectionToolbarSelector = '[style*=" height: 42px"]',
+    linkedCollectionTitleSelector = `${collectionToolbarSelector} > a [placeholder]`,
+    viewContainerSelector = '.notion-scroller [class$="view"]',
+    configButtonClass = 'simpler_databases--config_button',
+    configButtonSvg = web.raw`<svg viewBox="0 0 14 14">
+      <path d="M14,7.77 L14,6.17 L12.06,5.53 L11.61,4.44 L12.49,2.6 L11.36,1.47
+        L9.55,2.38 L8.46,1.93 L7.77,0.01 L6.17,0.01 L5.54,1.95 L4.43,2.4 L2.59,1.52
+        L1.46,2.65 L2.37,4.46 L1.92,5.55 L0,6.23 L0,7.82 L1.94,8.46 L2.39,9.55
+        L1.51,11.39 L2.64,12.52 L4.45,11.61 L5.54,12.06 L6.23,13.98 L7.82,13.98
+        L8.45,12.04 L9.56,11.59 L11.4,12.47 L12.53,11.34 L11.61,9.53 L12.08,8.44
+        L14,7.75 L14,7.77 Z M7,10 C5.34,10 4,8.66 4,7 C4,5.34 5.34,4 7,4 C8.66,4
+        10,5.34 10,7 C10,8.66 8.66,10 7,10 Z" />
+      </svg>`,
+    overlayContainerClass = 'simpler_databases--overlay_container',
+    configMenuClass = 'simpler_databases--config_menu',
+    configDividerClass = 'simpler_databases--config_divider',
+    configItemClass = 'simpler_databases--config_item',
+    configTitleClass = 'simpler_databases--config_title',
+    configToggleClass = 'simpler_databases--config_toggle',
+    configInputClassName = 'simpler_databases--config_input notion-focusable',
+    configOpenCollectionSelector =
+      '.notion-collection_view-block[data-simpler-db-tweaks*="[config-open]"]',
+    collectionToggleClass = 'simpler_databases--toggle',
+    notionAppSelector = '.notion-app-inner';
+
+  const replaceTitle = ($collection, state) => {
+      const $title = $collection.querySelector(linkedCollectionTitleSelector),
+        blockId = $collection.dataset.blockId;
+      if (!$title) return;
+      if (!$title.dataset.originalTitle && state) {
+        $title.dataset.originalTitle = $title.innerText;
+      }
+
+      if (!$title.titleObserver) {
+        if (!state) return;
+        $title.titleObserver = new MutationObserver(async () => {
+          const customTitle = await db.get(['collections', blockId, 'replace_title'], false);
+          if (customTitle && $title.innerText !== customTitle) $title.innerText = customTitle;
+        });
+      } else $title.titleObserver.disconnect();
+
+      if (state) {
+        // observe
+        $title.innerText = state;
+        $title.titleObserver.observe($title, { characterData: true, childList: true });
+      } else {
+        // reset
+        $title.titleObserver.disconnect();
+        $title.innerText = $title.dataset.originalTitle;
+        delete $title.dataset.originalTitle;
+      }
+    },
+    insertToggle = async ($collection, state) => {
+      const datasetKey = 'simplerDbToggleHidden',
+        blockId = $collection.dataset.blockId,
+        $toolbar = $collection.querySelector(collectionToolbarSelector);
+      if (!$toolbar) return;
+
+      const $collectionView = $collection.querySelector('.notion-scroller'),
+        hideCollection = () => {
+          $collectionView.style.height = $collectionView.offsetHeight + 'px';
+          requestAnimationFrame(() => {
+            $collection.dataset[datasetKey] = true;
+            setTimeout(() => ($collectionView.dataset.simplerDbHideItems = 'true'), 200); // hide drag handles
+          });
+        },
+        showCollection = () => {
+          $collection.dataset[datasetKey] = false;
+          $collectionView.style.height = '';
+          $collectionView.style.height = $collectionView.offsetHeight + 'px';
+          $collection.dataset[datasetKey] = true;
+
+          delete $collectionView.dataset.simplerDbHideItems;
+          requestAnimationFrame(() => {
+            $collection.dataset[datasetKey] = false;
+            setTimeout(() => ($collectionView.style.height = ''), 200);
+          });
+        };
+
+      if (!$collection.dataset[datasetKey]) {
+        const storedState = await db.get(['collections', blockId, 'toggle_hidden'], false);
+        if (storedState) {
+          hideCollection();
+        }
+      }
+
+      let $toggle = $toolbar.querySelector(`.${collectionToggleClass}`);
+      if ($toggle) {
+        if (!state) $toggle.remove();
+        return;
+      } else if (state) {
+        $toggle = web.html`
+          <div class="${collectionToggleClass}">
+            <svg viewBox="0 0 100 100"><polygon points="5.9,88.2 50,11.8 94.1,88.2" /></svg>
+          </div>
+        `;
+        $toggle.addEventListener('click', async () => {
+          const hide = !($collection.dataset[datasetKey] === 'true');
+          await db.set(['collections', blockId, 'toggle_hidden'], hide);
+          if (hide) {
+            hideCollection();
+          } else showCollection();
+        });
+        $toolbar.prepend($toggle);
+      }
+    };
+
+  const menuItems = [
+    {
+      key: 'replace_title',
+      name: 'Replace title...',
+      type: 'input',
+      linkedOnly: true,
+      default: '',
+      action: replaceTitle,
+    },
+    {
+      key: 'icon',
+      name: 'Icon',
+      type: 'toggle',
+      default: true,
+    },
+    {
+      key: 'title',
+      name: 'Title',
+      type: 'toggle',
+      default: true,
+    },
+    {
+      key: 'toggle',
+      name: 'Toggle',
+      type: 'toggle',
+      default: false,
+      action: insertToggle,
+    },
+    {
+      key: 'views',
+      name: 'Views',
+      type: 'toggle',
+      default: true,
+    },
+    {
+      key: 'toolbar',
+      name: 'Toolbar',
+      type: 'toggle',
+      default: true,
+    },
+    {
+      key: 'divider',
+      views: ['table', 'board', 'timeline', 'list', 'gallery'],
+    },
+    {
+      key: 'header_row',
+      name: 'Header row',
+      type: 'toggle',
+      default: true,
+      views: ['table'],
+    },
+    {
+      key: 'new_item',
+      name: 'New row',
+      type: 'toggle',
+      default: true,
+      views: ['table', 'timeline'],
+    },
+    {
+      key: 'new_item',
+      name: 'New item',
+      type: 'toggle',
+      default: true,
+      views: ['board', 'list', 'gallery'],
+    },
+    {
+      key: 'calc_row',
+      name: 'Calculation row',
+      type: 'toggle',
+      default: true,
+      views: ['table', 'timeline'],
+    },
+    {
+      key: 'divider',
+      views: ['table', 'board'],
+    },
+    {
+      key: 'hidden_column',
+      name: 'Hidden columns',
+      type: 'toggle',
+      default: true,
+      views: ['board'],
+    },
+    {
+      key: 'add_group',
+      name: 'Add group',
+      type: 'toggle',
+      default: true,
+      views: ['board'],
+    },
+    {
+      key: 'new_column',
+      name: 'New column',
+      type: 'toggle',
+      default: true,
+      views: ['table'],
+    },
+    {
+      key: 'full_width',
+      name: 'Full width',
+      type: 'toggle',
+      default: true,
+      views: ['table'],
+    },
+  ];
+
+  const isLinked = ($collection) => !!$collection.querySelector(linkedCollectionTitleSelector),
+    getViewType = ($collection) =>
+      $collection.querySelector(viewContainerSelector)?.className.split('-')[1],
+    setTweakState = ($collection, key, state) => {
+      const datasetKey = 'simplerDbTweaks';
+      if (!$collection.dataset[datasetKey]) $collection.dataset[datasetKey] = '';
+
+      key = web.escape(key);
+      const isActive = $collection.dataset[datasetKey].includes(`[${key}]`);
+
+      if (state && !isActive) {
+        $collection.dataset[datasetKey] += `[${key}]`;
+      } else if (!state && isActive) {
+        const prev = $collection.dataset[datasetKey];
+        $collection.dataset[datasetKey] = prev.replace(`[${key}]`, '');
+      }
+    };
+
+  const clickItem = (event) => {
+      event.stopPropagation();
+      const focusedItem = event.target.closest(`[class^="${configItemClass}"]`);
+      if (focusedItem) focusedItem.click();
+    },
+    focusNextItem = (event) => {
+      event.stopPropagation();
+      event.preventDefault();
+      const $focusedItem = event.target.closest(`[class^="${configItemClass}"]`);
+      if (!$focusedItem) return;
+      let $targetItem = $focusedItem.nextElementSibling;
+      if (!$targetItem) $targetItem = $focusedItem.parentElement.firstElementChild;
+      if ($targetItem.classList.contains(configDividerClass)) {
+        $targetItem = $targetItem.nextElementSibling;
+      }
+      const $input = $targetItem.querySelector('input');
+      if ($input) {
+        $input.focus();
+      } else $targetItem.focus();
+    },
+    focusPrevItem = (event) => {
+      event.stopPropagation();
+      event.preventDefault();
+      const $focusedItem = event.target.closest(`[class^="${configItemClass}"]`);
+      if (!$focusedItem) return;
+      let $targetItem = $focusedItem.previousElementSibling;
+      if (!$targetItem) $targetItem = $focusedItem.parentElement.lastElementChild;
+      if ($targetItem.classList.contains(configDividerClass)) {
+        $targetItem = $targetItem.previousElementSibling;
+      }
+      const $input = $targetItem.querySelector('input');
+      if ($input) {
+        $input.focus();
+      } else $targetItem.focus();
+    },
+    keyListeners = [
+      {
+        keys: ['Escape'],
+        listener: (event) => {
+          event.stopPropagation();
+          hideConfig();
+        },
+        opts: { listenInInput: true, keydown: true },
+      },
+      {
+        keys: [' '],
+        listener: (event) => clickItem(event),
+        opts: { keydown: true },
+      },
+      {
+        keys: ['Enter'],
+        listener: (event) => clickItem(event),
+        opts: { keydown: true },
+      },
+      {
+        keys: ['ArrowDown'],
+        listener: focusNextItem,
+        opts: { listenInInput: true, keydown: true },
+      },
+      {
+        keys: ['ArrowUp'],
+        listener: focusPrevItem,
+        opts: { listenInInput: true, keydown: true },
+      },
+      {
+        keys: ['Tab'],
+        listener: focusNextItem,
+        opts: { listenInInput: true, keydown: true },
+      },
+      {
+        keys: ['Shift', 'Tab'],
+        listener: focusPrevItem,
+        opts: { listenInInput: true, keydown: true },
+      },
+    ];
+
+  const renderConfigItem = async ($collection, menuItem) => {
+      if (menuItem.key === 'divider')
+        return web.html`<div class="${configDividerClass}"></div>`;
+
+      const blockId = $collection.dataset.blockId,
+        storedState = await db.get(['collections', blockId, menuItem.key], menuItem.default),
+        $item = web.html`<div class="${configItemClass}-${menuItem.type}"></div>`;
+
+      switch (menuItem.type) {
+        case 'toggle':
+          const $label = web.html`<div class="${configTitleClass}">${menuItem.name}</div>`,
+            $toggle = web.html`<div class="${configToggleClass}"
+              data-toggled="${storedState || false}"></div>`;
+          web.render($item, $label, $toggle);
+          $item.setAttribute('tabindex', 0);
+          $item.addEventListener('click', async (e) => {
+            e.stopPropagation();
+            const newState = !($toggle.dataset.toggled === 'true');
+            $toggle.dataset.toggled = newState;
+            await db.set(['collections', blockId, menuItem.key], newState);
+            setTweakState($collection, menuItem.key, newState);
+            if (menuItem.action) menuItem.action($collection, newState);
+          });
+          break;
+
+        case 'input':
+          const $input = web.html`<div class="${configInputClassName}">
+            <input placeholder="${menuItem.name}" type="text"
+              value="${web.escape(storedState) || ''}">
+          </div>`;
+          web.render($item, $input);
+          $item.addEventListener('click', (e) => e.stopPropagation());
+          if (menuItem.action) {
+            $input.firstElementChild.addEventListener('input', async (e) => {
+              e.stopPropagation();
+              const newState = e.target.value;
+              await db.set(['collections', blockId, menuItem.key], newState);
+              menuItem.action($collection, newState);
+            });
+          }
+          break;
+      }
+      return $item;
+    },
+    renderConfig = async ($collection, $button) => {
+      if (document.querySelector(`.${overlayContainerClass}`)) return;
+
+      const collectionViewType = getViewType($collection);
+      if (!collectionViewType) return;
+
+      const $overlay = web.html`<div class="${overlayContainerClass}"></div>`;
+      $overlay.addEventListener('click', hideConfig);
+      web.render(document.querySelector(notionAppSelector), $overlay);
+
+      const $config = web.html`<div class="${configMenuClass}"></div>`,
+        viewMenuItems = menuItems.filter(
+          (item) =>
+            (!item.views || item.views.includes(collectionViewType)) &&
+            (!item.linkedOnly || isLinked($collection))
+        ),
+        $menuItemElements = await Promise.all(
+          viewMenuItems.map((item) => renderConfigItem($collection, item))
+        );
+      web.render($config, ...$menuItemElements);
+      const $firstMenuItem =
+        $config.firstElementChild.getElementsByTagName('input')[0] ||
+        $config.firstElementChild;
+
+      const $position = web.html`
+        <div style="position: fixed;">
+          <div style="position: relative; pointer-events: auto;"></div>
+        </div>
+      `;
+      $position.firstElementChild.appendChild($config);
+      web.render($overlay, $position);
+
+      const rect = $button.getBoundingClientRect();
+      $position.style.left =
+        Math.min(rect.left + rect.width / 2, window.innerWidth - ($config.offsetWidth + 14)) +
+        'px';
+      $position.style.top =
+        Math.min(
+          rect.top + rect.height / 2,
+          window.innerHeight - ($config.offsetHeight + 14)
+        ) + 'px';
+
+      setTweakState($collection, 'config-open', true);
+      for (const { keys, listener, opts } of keyListeners) {
+        web.addHotkeyListener(keys, listener, opts);
+      }
+      await $config.animate([{ opacity: 0 }, { opacity: 1 }], { duration: 200 }).finished;
+      $firstMenuItem.focus();
+    };
+  async function hideConfig() {
+    const $overlay = document.querySelector(`.${overlayContainerClass}`),
+      $collection = document.querySelector(configOpenCollectionSelector);
+    if (!$overlay) return;
+
+    $overlay.removeEventListener('click', hideConfig);
+    for (const { listener } of keyListeners) web.removeHotkeyListener(listener);
+
+    await document
+      .querySelector(`.${configMenuClass}`)
+      .animate([{ opacity: 1 }, { opacity: 0 }], { duration: 200 }).finished;
+    setTweakState($collection, 'config-open', false);
+    $overlay.remove();
+  }
+
+  const simplifyCollection = async () => {
+    for (const $collection of document.querySelectorAll(collectionViewSelector)) {
+      const blockId = $collection.dataset.blockId,
+        $addNew = $collection.querySelector(collectionAddNewSelector);
+      if ($collection.querySelector(`.${configButtonClass}`) || !$addNew) continue;
+
+      const $configButton = $addNew.previousElementSibling.cloneNode();
+      $configButton.className = configButtonClass;
+      $configButton.innerHTML = configButtonSvg;
+      $configButton.addEventListener('click', () => {
+        renderConfig($collection, $configButton);
+      });
+      $addNew.parentElement.prepend($configButton);
+
+      for (const item of menuItems) {
+        if (item.key === 'divider') continue;
+        const state = await db.get(['collections', blockId, item.key], item.default);
+        if ((item.type !== 'input' && !item.linkedOnly) || isLinked($collection)) {
+          setTweakState($collection, item.key, state);
+        }
+        if (state && item.action) item.action($collection, state);
+      }
+    }
+  };
+  web.addDocumentObserver(simplifyCollection, [collectionViewSelector]);
+}
diff --git a/src/mods/simpler-databases/mod.json b/src/mods/simpler-databases/mod.json
new file mode 100644
index 0000000..62d45e3
--- /dev/null
+++ b/src/mods/simpler-databases/mod.json
@@ -0,0 +1,23 @@
+{
+  "name": "simpler databases",
+  "id": "752933b5-1258-44e3-b49a-61b4885f8bda",
+  "version": "0.2.0",
+  "description": "adds a menu to inline databases to toggle ui elements.",
+  "preview": "simpler-databases.jpg",
+  "tags": ["extension", "layout"],
+  "authors": [
+    {
+      "name": "CloudHill",
+      "email": "rh.cloudhill@gmail.com",
+      "homepage": "https://github.com/CloudHill",
+      "avatar": "https://avatars.githubusercontent.com/u/54142180"
+    }
+  ],
+  "js": {
+    "client": ["client.mjs"]
+  },
+  "css": {
+    "client": ["client.css"]
+  },
+  "options": []
+}
diff --git a/src/mods/simpler-databases/simpler-databases.jpg b/src/mods/simpler-databases/simpler-databases.jpg
new file mode 100644
index 0000000..eec09ae
Binary files /dev/null and b/src/mods/simpler-databases/simpler-databases.jpg differ
diff --git a/src/mods/tabs/client.mjs b/src/mods/tabs/client.mjs
new file mode 100644
index 0000000..9373351
--- /dev/null
+++ b/src/mods/tabs/client.mjs
@@ -0,0 +1,82 @@
+/**
+ * notion-enhancer: theming
+ * (c) 2021 dragonwocky <thedragonring.bod@gmail.com> (https://dragonwocky.me/)
+ * (https://notion-enhancer.github.io/) under the MIT license
+ */
+
+'use strict';
+
+export default async function ({ web, electron }, db) {
+  const newTabHotkey = await db.get(['new_tab']),
+    closeTabHotkey = await db.get(['close_tab']),
+    restoreTabHotkey = await db.get(['restore_tab']),
+    selectTabModifier = await db.get(['select_modifier']),
+    prevTabHotkey = await db.get(['prev_tab']),
+    nextTabHotkey = await db.get(['next_tab']);
+  web.addHotkeyListener(newTabHotkey, () => {
+    electron.sendMessageToHost('new-tab');
+  });
+  web.addHotkeyListener(restoreTabHotkey, () => {
+    electron.sendMessageToHost('restore-tab');
+  });
+  web.addHotkeyListener(closeTabHotkey, () => electron.sendMessageToHost('close-tab'));
+  for (let i = 1; i < 10; i++) {
+    web.addHotkeyListener([selectTabModifier, i.toString()], () => {
+      electron.sendMessageToHost('select-tab', i);
+    });
+  }
+  web.addHotkeyListener(prevTabHotkey, () => {
+    electron.sendMessageToHost('select-prev-tab')
+  });
+  web.addHotkeyListener(nextTabHotkey, () => {
+    electron.sendMessageToHost('select-next-tab')
+  }); 
+
+  const breadcrumbSelector =
+      '.notion-topbar > div > [class="notranslate"] > .notion-focusable:last-child',
+    imgIconSelector = `${breadcrumbSelector} .notion-record-icon img:not(.notion-emoji)`,
+    emojiIconSelector = `${breadcrumbSelector} .notion-record-icon img.notion-emoji`,
+    nativeIconSelector = `${breadcrumbSelector} .notion-record-icon [role="image"]`,
+    titleSelector = `${breadcrumbSelector} > :not(.notion-record-icon)`,
+    viewSelector = '.notion-collection-view-select';
+
+  let title = '',
+    icon = '';
+  const notionSetWindowTitle = __electronApi.setWindowTitle,
+    getIcon = () => {
+      const $imgIcon = document.querySelector(imgIconSelector),
+        $emojiIcon = document.querySelector(emojiIconSelector),
+        $nativeIcon = document.querySelector(nativeIconSelector);
+      if ($imgIcon) {
+        return `url("${$imgIcon.src}") 0 / 100%`;
+      }
+      if ($emojiIcon) {
+        return $emojiIcon.style.background.replace(
+          /url\("\/images/,
+          'url("notion://www.notion.so/images'
+        );
+      }
+      if ($nativeIcon) return $nativeIcon.ariaLabel;
+      return '';
+    },
+    updateTitle = (newTitle = title) => {
+      if (!newTitle) return;
+      title = newTitle;
+      icon = getIcon();
+      electron.sendMessageToHost('set-tab-title', title);
+      electron.sendMessageToHost('set-tab-icon', icon);
+      notionSetWindowTitle(title);
+    };
+  __electronApi.setWindowTitle = (newTitle) => updateTitle(newTitle);
+  document.addEventListener('focus', updateTitle);
+  electron.onMessage('trigger-title-update', () => updateTitle());
+
+  await web.whenReady([titleSelector]);
+  const $title = document.querySelector(titleSelector),
+    $view = document.querySelector(viewSelector);
+  if (!title && $title) {
+    if ($view) {
+      updateTitle(`${$title.innerText} | ${$view.innerText}`);
+    } else updateTitle($title.innerText);
+  }
+}
diff --git a/src/mods/tabs/createWindow.cjs b/src/mods/tabs/createWindow.cjs
new file mode 100644
index 0000000..bda9a95
--- /dev/null
+++ b/src/mods/tabs/createWindow.cjs
@@ -0,0 +1,23 @@
+/**
+ * notion-enhancer: tabs
+ * (c) 2021 dragonwocky <thedragonring.bod@gmail.com> (https://dragonwocky.me/)
+ * (https://notion-enhancer.github.io/) under the MIT license
+ */
+
+'use strict';
+
+module.exports = async function (api, db, __exports, __eval) {
+  const notionCreateWindow = __exports.createWindow;
+  __exports.createWindow = (relativeUrl = '', args) => {
+    const windows = api.electron.getNotionWindows();
+    // '/' is used to create new windows intentionally
+    if (relativeUrl && relativeUrl !== '/' && windows.length) {
+      const window = api.electron.getFocusedNotionWindow() || windows[0];
+      window.webContents.send('notion-enhancer:open-tab', {
+        notionUrl: `notion://www.notion.so${relativeUrl}`,
+      });
+      return window;
+    }
+    return notionCreateWindow(relativeUrl, args);
+  };
+};
diff --git a/src/mods/tabs/main.cjs b/src/mods/tabs/main.cjs
new file mode 100644
index 0000000..9900eee
--- /dev/null
+++ b/src/mods/tabs/main.cjs
@@ -0,0 +1,37 @@
+/**
+ * notion-enhancer: tabs
+ * (c) 2021 dragonwocky <thedragonring.bod@gmail.com> (https://dragonwocky.me/)
+ * (https://notion-enhancer.github.io/) under the MIT license
+ */
+
+'use strict';
+
+module.exports = async function ({}, db, __exports, __eval) {
+  const electron = require('electron');
+  electron.ipcMain.on('notion-enhancer:close-tab', (event, { window, id }) => {
+    electron.webContents.fromId(window).send('notion-enhancer:close-tab', id);
+  });
+
+  __eval(`
+    const notionHandleActivate = handleActivate;
+    handleActivate = (relativeUrl) => {
+      const api = require('notion-enhancer/api/index.cjs'),
+        { BrowserWindow } = require('electron'),
+        windows = api.electron.getNotionWindows(),
+        electronWindows = BrowserWindow.getAllWindows();
+      if (relativeUrl && windows.length) {
+        const win = api.electron.getFocusedNotionWindow() || windows[0];
+        win.webContents.send('notion-enhancer:open-tab', {
+          notionUrl: \`notion://www.notion.so\$\{relativeUrl\}\`,
+        });
+        win.show();
+        win.focus();
+      } else if (relativeUrl && electronWindows.length && !windows.length) {
+        // enhancer menu is open: prevent override
+        const { createWindow } = api.electron.notionRequire('main/createWindow'),
+          win = createWindow(relativeUrl);
+        win.focus();
+      } else notionHandleActivate(relativeUrl);
+    };
+  `);
+};
diff --git a/src/mods/tabs/mod.json b/src/mods/tabs/mod.json
new file mode 100644
index 0000000..0d3004b
--- /dev/null
+++ b/src/mods/tabs/mod.json
@@ -0,0 +1,96 @@
+{
+  "name": "tabs",
+  "id": "e1692c29-475e-437b-b7ff-3eee872e1a42",
+  "environments": ["linux", "win32", "darwin"],
+  "version": "0.3.0",
+  "description": "open multiple notion pages in a single window.",
+  "preview": "tabs.jpg",
+  "tags": ["extension", "app"],
+  "authors": [
+    {
+      "name": "dragonwocky",
+      "email": "thedragonring.bod@gmail.com",
+      "homepage": "https://dragonwocky.me/",
+      "avatar": "https://dragonwocky.me/avatar.jpg"
+    }
+  ],
+  "css": {
+    "frame": ["tabs.css"]
+  },
+  "js": {
+    "client": ["client.mjs"],
+    "electron": [
+      { "source": "main.cjs", "target": "main/main.js" },
+      { "source": "systemMenu.cjs", "target": "main/systemMenu.js" },
+      { "source": "createWindow.cjs", "target": "main/createWindow.js" },
+      { "source": "rendererIndex.cjs", "target": "renderer/index.js" }
+    ]
+  },
+  "options": [
+    {
+      "type": "toggle",
+      "key": "remember_last_open",
+      "label": "remember last open tabs",
+      "tooltip": "**a continue-where-you-left-off experience** (reopens recently active tabs after an app relaunch)",
+      "value": true
+    },
+    {
+      "type": "select",
+      "key": "label_type",
+      "label": "tab labels",
+      "values": ["page icon & title", "page icon only", "page title only"]
+    },
+    {
+      "type": "select",
+      "key": "layout_style",
+      "label": "tab layout",
+      "values": ["traditional tabbed", "rectangular", "bubble", "compact"]
+    },
+    {
+      "type": "select",
+      "key": "select_modifier",
+      "label": "tab select modifier",
+      "tooltip": "**usage: Modifier+1 to Modifier+9, Modifier+ArrowLeft and Modifier+ArrowRight**",
+      "values": [
+        "Alt",
+        "Command",
+        "Control",
+        "Super",
+        "Alt+Shift",
+        "Command+Shift",
+        "Control+Shift",
+        "Super+Shift"
+      ]
+    },
+    {
+      "type": "hotkey",
+      "key": "prev_tab",
+      "label": "previous tab hotkey",
+      "value": "Control+Shift+Tab"
+    },
+    {
+      "type": "hotkey",
+      "key": "next_tab",
+      "label": "next tab hotkey",
+      "value": "Control+Tab"
+    },
+    {
+      "type": "hotkey",
+      "key": "new_tab",
+      "label": "new tab hotkey",
+      "value": "Control+T"
+    },
+    {
+      "type": "hotkey",
+      "key": "close_tab",
+      "label": "close tab hotkey",
+      "value": "Control+W"
+    },
+    {
+      "type": "hotkey",
+      "key": "restore_tab",
+      "label": "restore previously opened tab hotkey",
+      "value": "Control+Shift+T"
+    }
+  ]
+}
diff --git a/src/mods/tabs/rendererIndex.cjs b/src/mods/tabs/rendererIndex.cjs
new file mode 100644
index 0000000..8a5a5b1
--- /dev/null
+++ b/src/mods/tabs/rendererIndex.cjs
@@ -0,0 +1,142 @@
+/**
+ * notion-enhancer: tabs
+ * (c) 2021 dragonwocky <thedragonring.bod@gmail.com> (https://dragonwocky.me/)
+ * (https://notion-enhancer.github.io/) under the MIT license
+ */
+
+'use strict';
+
+module.exports = async function (api, db, __exports, __eval) {
+  const url = require('url'),
+    electron = require('electron'),
+    electronWindow = electron.remote.getCurrentWindow(),
+    { components, web, env } = api;
+
+  window['__start'] = async () => {
+    // display:none; to prevent content flash while css loads
+    document.body.style.display = 'none';
+
+    const tabCache = new Map(),
+      Tab = await require('./tab.cjs')(api, db, tabCache);
+    document.body.dataset.tabLabels = await db.get(['label_type']);
+    document.body.dataset.tabStyle = await db.get(['layout_style']);
+
+    const $header = web.html`<header></header>`,
+      $tabs = web.html`<div id="tabs"></div>`,
+      $newTab = web.html`<div class="new-tab">${await components.feather('plus')}</div>`,
+      $root = document.querySelector('#root'),
+      $windowActions = web.html`<div id="window-actions"></div>`;
+    document.body.prepend(web.render($header, $tabs, $newTab, $windowActions));
+
+    // make space for native window buttons on mac
+    if (env.name === 'darwin') $tabs.style.paddingLeft = '72px';
+
+    $newTab.addEventListener('click', () => new Tab($tabs, $root));
+    electron.ipcRenderer.on('notion-enhancer:close-tab', (event, id) => {
+      const tab = tabCache.get(id);
+      if (tab) tab.close();
+    });
+    electron.ipcRenderer.on(
+      'notion-enhancer:open-tab',
+      (event, opts) => new Tab($tabs, $root, opts)
+    );
+
+    const rememberLastOpen = await db.get(['remember_last_open']),
+      openTabs = await db.get(['last_open_tabs_cache']);
+    if (rememberLastOpen && openTabs && Array.isArray(openTabs)) {
+      for (const tab of openTabs) {
+        new Tab($tabs, $root, { ...tab, cancelAnimation: true });
+      }
+    } else {
+      new Tab($tabs, $root, {
+        notionUrl: url.parse(window.location.href, true).query.path,
+        cancelAnimation: true,
+      });
+    }
+    window.addEventListener('beforeunload', () => {
+      const openTabs = [...$tabs.children]
+        .filter(($tab) => tabCache.get($tab.id))
+        .map(($tab) => {
+          const tab = tabCache.get($tab.id);
+          return {
+            notionUrl: tab.$notion.src,
+            icon: tab.icon,
+            title: tab.title,
+          };
+        });
+      db.set(['last_open_tabs_cache'], openTabs);
+    });
+
+    let $draggedTab;
+    const $dragIndicator = web.html`<span class="drag-indicator"></span>`,
+      getDragTarget = ($el) => {
+        while (!$el.matches('.tab, header, body')) $el = $el.parentElement;
+        if ($el.matches('header')) $el = $el.firstElementChild;
+        return $el.matches('#tabs, .tab') ? $el : undefined;
+      },
+      resetDraggedTabs = () => {
+        if ($draggedTab) {
+          $dragIndicator.remove();
+          $draggedTab.style.opacity = '';
+          $draggedTab = undefined;
+        }
+      };
+    $header.addEventListener('dragstart', (event) => {
+      $draggedTab = getDragTarget(event.target);
+      $draggedTab.style.opacity = 0.5;
+      const tab = tabCache.get($draggedTab.id);
+      event.dataTransfer.setData(
+        'text',
+        JSON.stringify({
+          window: electronWindow.webContents.id,
+          tab: $draggedTab.id,
+          icon: tab.$tabIcon.innerText || tab.$tabIcon.style.background,
+          title: tab.$tabTitle.innerText,
+          url: tab.$notion.src,
+        })
+      );
+    });
+    $header.addEventListener('dragover', (event) => {
+      const $target = getDragTarget(event.target);
+      if ($target) {
+        if ($target.matches('#tabs')) {
+          $target.after($dragIndicator);
+        } else if ($target.matches('#tabs > :first-child')) {
+          $tabs.before($dragIndicator);
+        } else $target.before($dragIndicator);
+        event.preventDefault();
+      }
+    });
+    document.addEventListener('drop', (event) => {
+      const eventData = JSON.parse(event.dataTransfer.getData('text')),
+        $target = getDragTarget(event.target) || $tabs,
+        sameWindow = eventData.window === electronWindow.webContents.id,
+        tabMovement =
+          !sameWindow ||
+          ($target &&
+            $target !== $draggedTab &&
+            $target !== $draggedTab.nextElementSibling &&
+            ($target.matches('#tabs') ? $target.lastElementChild !== $draggedTab : true));
+      if (!sameWindow) {
+        electron.ipcRenderer.send('notion-enhancer:close-tab', {
+          window: eventData.window,
+          id: eventData.tab,
+        });
+        const transferred = new Tab($tabs, $root, {
+          notionUrl: eventData.url,
+          cancelAnimation: true,
+          icon: eventData.icon,
+          title: eventData.title,
+        });
+        $draggedTab = transferred.$tab;
+      }
+      if (tabMovement) {
+        if ($target.matches('#tabs')) {
+          $target.append($draggedTab);
+        } else $target.before($draggedTab);
+      }
+      resetDraggedTabs();
+    });
+    $header.addEventListener('dragend', (event) => resetDraggedTabs());
+  };
+};
diff --git a/src/mods/tabs/systemMenu.cjs b/src/mods/tabs/systemMenu.cjs
new file mode 100644
index 0000000..9460cff
--- /dev/null
+++ b/src/mods/tabs/systemMenu.cjs
@@ -0,0 +1,20 @@
+/**
+ * notion-enhancer: tabs
+ * (c) 2021 dragonwocky <thedragonring.bod@gmail.com> (https://dragonwocky.me/)
+ * (https://notion-enhancer.github.io/) under the MIT license
+ */
+
+'use strict';
+
+module.exports = async function ({}, db, __exports, __eval) {
+  const notionSetupSystemMenu = __exports.setupSystemMenu;
+  __exports.setupSystemMenu = (locale) => {
+    const { Menu } = require('electron'),
+      template = notionSetupSystemMenu(locale);
+    for (const category of template) {
+      category.submenu = category.submenu.filter((item) => item.role !== 'close');
+    }
+    Menu.setApplicationMenu(Menu.buildFromTemplate(template));
+    return template;
+  };
+};
diff --git a/src/mods/tabs/tab.cjs b/src/mods/tabs/tab.cjs
new file mode 100644
index 0000000..4e44cc0
--- /dev/null
+++ b/src/mods/tabs/tab.cjs
@@ -0,0 +1,296 @@
+/**
+ * notion-enhancer: tabs
+ * (c) 2021 dragonwocky <thedragonring.bod@gmail.com> (https://dragonwocky.me/)
+ * (https://notion-enhancer.github.io/) under the MIT license
+ */
+
+'use strict';
+
+let focusedTab;
+
+module.exports = async function (api, db, tabCache = new Map()) {
+  const { components, web, fmt, fs } = api,
+    electron = require('electron'),
+    electronWindow = electron.remote.getCurrentWindow(),
+    notionIpc = api.electron.notionRequire('helpers/notionIpc'),
+    xIcon = await components.feather('x');
+
+  return class Tab {
+    id = fmt.uuidv4();
+
+    $notion = web.html`
+      <webview class="notion-webview" partition="persist:notion"
+        preload="file://${fs.notionPath('renderer/preload.js')}"
+        webpreferences="spellcheck=yes, enableremotemodule=yes"
+      ></webview>
+    `;
+    $search = web.html`
+      <webview class="search-webview" partition="persist:notion"
+        preload="file://${fs.notionPath('renderer/search.js')}"
+        src="file:///${fs.notionPath('renderer/search.html')}"
+        webpreferences="spellcheck=no, enableremotemodule=yes"
+      ></webview>
+    `;
+
+    $tabIcon = web.html`<span class="tab-icon"></span>`;
+    $svgIconPlaceholder = web.html`<svg viewBox="0 0 30 30">
+        <g><path d="M16,1H4v28h22V11L16,1z M16,3.828L23.172,11H16V3.828z M24,27H6V3h8v10h10V27z
+          M8,17h14v-2H8V17z M8,21h14v-2H8V21z M8,25h14v-2H8V25z"></path></g>
+      </svg>
+    `;
+    $tabTitle = web.html`<span class="tab-title"></span>`;
+    $closeTab = web.html`<span class="tab-close">${xIcon}</span>`;
+    $tab = web.render(
+      web.html`<div class="tab" draggable="true" id="${this.id}"></div>`,
+      this.$tabIcon,
+      this.$svgIconPlaceholder,
+      this.$tabTitle,
+      this.$closeTab
+    );
+
+    constructor(
+      $tabList,
+      $tabContainer,
+      {
+        notionUrl = 'notion://www.notion.so/',
+        cancelAnimation = false,
+        icon = '',
+        title = 'notion.so',
+        cache = tabCache,
+      } = {}
+    ) {
+      this.tabCache = cache;
+      this.$tabList = $tabList;
+      this.$tabContainer = $tabContainer;
+
+      this.$notion.src = notionUrl;
+      this.setTitle(title);
+      this.setIcon(icon);
+      this.tabCache.set(this.$tab.id, this);
+
+      electronWindow.on('focus', () => {
+        if (focusedTab === this) this.$notion.focus();
+      });
+      this.$tab.addEventListener('click', (event) => {
+        if (event.target !== this.$closeTab && !this.$closeTab.contains(event.target)) {
+          this.focus();
+        }
+      });
+      this.$closeTab.addEventListener('click', () => this.close());
+
+      this.open(cancelAnimation);
+      this.addNotionListeners();
+      return this;
+    }
+
+    open(cancelAnimation = false) {
+      this.closed = false;
+      web.render(this.$tabList, this.$tab);
+      web.render(this.$tabContainer, this.$search);
+      web.render(this.$tabContainer, this.$notion);
+      if (!cancelAnimation) {
+        this.$tab.animate([{ width: '0px' }, { width: `${this.$tab.clientWidth}px` }], {
+          duration: 100,
+          easing: 'ease-in',
+        }).finished;
+      }
+      this.focus();
+    }
+    async focus() {
+      document.querySelectorAll('.notion-webview, .search-webview').forEach(($webview) => {
+        if (![this.$notion, this.$search].includes($webview)) $webview.style.display = '';
+      });
+      document.querySelectorAll('.tab.current').forEach(($tab) => {
+        if ($tab !== this.$tab) $tab.classList.remove('current');
+      });
+      this.$tab.classList.add('current');
+      this.$notion.style.display = 'flex';
+      this.$search.style.display = 'flex';
+      if (this.domReady) this.focusNotion();
+      focusedTab = this;
+    }
+    async close() {
+      const $sibling = this.$tab.nextElementSibling || this.$tab.previousElementSibling;
+      if ($sibling) {
+        this.closed = Date.now();
+        if (!focusedTab || focusedTab === this) $sibling.click();
+        const width = `${this.$tab.clientWidth}px`;
+        this.$tab.style.width = 0;
+        this.$tab.style.pointerEvents = 'none';
+        await this.$tab.animate([{ width }, { width: '0px' }], {
+          duration: 100,
+          easing: 'ease-out',
+        }).finished;
+        this.$tab.remove();
+        this.$notion.remove();
+        this.$search.remove();
+        this.$tab.style.width = '';
+        this.$tab.style.pointerEvents = '';
+        this.domReady = false;
+      } else electronWindow.close();
+    }
+
+    title = '';
+    setTitle(title) {
+      this.title = title;
+      this.$tabTitle.innerText = title;
+    }
+    icon = '';
+    setIcon(icon) {
+      this.icon = icon;
+      if (icon.startsWith('url(')) {
+        // img
+        this.$tabIcon.style.background = icon;
+        this.$tabIcon.innerText = '';
+      } else {
+        // unicode (native)
+        this.$tabIcon.innerText = icon;
+        this.$tabIcon.style.background = '';
+      }
+    }
+
+    webContents() {
+      return electron.remote.webContents.fromId(this.$notion.getWebContentsId());
+    }
+    focusNotion() {
+      document.activeElement?.blur?.();
+      this.$notion.blur();
+      this.$notion.focus();
+      requestAnimationFrame(() => {
+        notionIpc.sendIndexToNotion(this.$notion, 'notion-enhancer:trigger-title-update');
+      });
+    }
+    focusSearch() {
+      document.activeElement?.blur?.();
+      this.$search.blur();
+      this.$search.focus();
+    }
+
+    domReady = false;
+    addNotionListeners() {
+      const fromNotion = (channel, listener) =>
+          notionIpc.receiveIndexFromNotion.addListener(this.$notion, channel, listener),
+        fromSearch = (channel, listener) =>
+          notionIpc.receiveIndexFromSearch.addListener(this.$search, channel, listener),
+        toSearch = (channel, data) => notionIpc.sendIndexToSearch(this.$search, channel, data);
+
+      this.$notion.addEventListener('dom-ready', () => {
+        if (focusedTab === this) this.focus();
+        this.domReady = true;
+
+        const navigateHistory = (event, cmd) => {
+          const swipe = event === 'swipe',
+            back = swipe ? cmd === 'left' : cmd === 'browser-backward',
+            fwd = swipe ? cmd === 'right' : cmd === 'browser-forward';
+          if (back && this.$notion.canGoBack()) this.$notion.goBack();
+          if (fwd && this.$notion.canGoForward()) this.$notion.goForward();
+        };
+        electronWindow.addListener('app-command', (e, cmd) => navigateHistory('app-cmd', cmd));
+        electronWindow.addListener('swipe', (e, dir) => navigateHistory('swipe', dir));
+
+        this.webContents().addListener('found-in-page', (event, result) => {
+          const matches = result
+            ? { count: result.matches, index: result.activeMatchOrdinal }
+            : { count: 0, index: 0 };
+          toSearch('search:result', matches);
+        });
+      });
+
+      notionIpc.proxyAllMainToNotion(this.$notion);
+
+      fromNotion('search:start', () => this.startSearch());
+      fromNotion('search:stop', () => this.stopSearch());
+      fromNotion('search:set-theme', (theme) => toSearch('search:set-theme', theme));
+      fromSearch('search:clear', () => this.clearSearch());
+      fromSearch('search:stop', () => this.stopSearch());
+      fromSearch('search:next', (query) => this.searchNext(query));
+      fromSearch('search:prev', (query) => this.searchPrev(query));
+
+      fromNotion('zoom', (zoomFactor) => {
+        this.webContents().setZoomFactor(zoomFactor);
+      });
+
+      fromNotion('notion-enhancer:set-tab-title', (title) => this.setTitle(title));
+      fromNotion('notion-enhancer:set-tab-icon', (icon) => this.setIcon(icon));
+
+      fromNotion(
+        'notion-enhancer:new-tab',
+        () => new this.constructor(this.$tabList, this.$tabContainer)
+      );
+      fromNotion('notion-enhancer:close-tab', () => this.close());
+      fromNotion('notion-enhancer:restore-tab', () => {
+        const tab = [...this.tabCache.values()]
+          .filter((tab) => tab.closed)
+          .sort((a, b) => b.closed - a.closed)[0];
+        if (tab) tab.open();
+      });
+      fromNotion('notion-enhancer:select-tab', (i) => {
+        const $tab = i === 9 ? this.$tabList.lastElementChild : this.$tabList.children[i - 1];
+        if ($tab) $tab.click();
+      });
+      fromNotion('notion-enhancer:select-prev-tab', () => {
+        if (this.$tabList.count == 1) {
+          return;
+        }
+        const $sibling = this.$tab.previousElementSibling;
+        if ($sibling) {
+          $sibling.click();
+        }
+        else {
+          let $tab = this.$tabList.lastElementChild;
+          if ($tab) {
+            $tab.click();
+          }
+        }
+      });
+      fromNotion('notion-enhancer:select-next-tab', () => {
+        if (this.$tabList.count == 1) {
+          return;
+        }
+        const $sibling = this.$tab.nextElementSibling;
+        if ($sibling) {
+          $sibling.click();
+        }
+        else {
+          let $tab = this.$tabList.children[0]
+          if ($tab) {
+            $tab.click();
+          }
+        }
+      });
+    }
+
+    #firstQuery = true;
+    startSearch() {
+      this.$search.classList.add('search-active');
+      this.focusSearch();
+      notionIpc.sendIndexToSearch(this.$search, 'search:start');
+      notionIpc.sendIndexToNotion(this.$search, 'search:started');
+    }
+    clearSearch() {
+      this.#firstQuery = true;
+      this.webContents().stopFindInPage('clearSelection');
+    }
+    stopSearch() {
+      this.$search.classList.remove('search-active');
+      this.focusNotion();
+      this.clearSearch();
+      notionIpc.sendIndexToSearch(this.$search, 'search:reset');
+      notionIpc.sendIndexToNotion(this.$notion, 'search:stopped');
+    }
+    searchNext(query) {
+      this.webContents().findInPage(query, {
+        forward: true,
+        findNext: !this.#firstQuery,
+      });
+      this.#firstQuery = false;
+    }
+    searchPrev(query) {
+      this.webContents().findInPage(query, {
+        forward: false,
+        findNext: !this.#firstQuery,
+      });
+      this.#firstQuery = false;
+    }
+  };
+};
diff --git a/src/mods/tabs/tabs.css b/src/mods/tabs/tabs.css
new file mode 100644
index 0000000..3b81480
--- /dev/null
+++ b/src/mods/tabs/tabs.css
@@ -0,0 +1,236 @@
+/**
+ * notion-enhancer: tabs
+ * (c) 2021 dragonwocky <thedragonring.bod@gmail.com> (https://dragonwocky.me/)
+ * (https://notion-enhancer.github.io/) under the MIT license
+ */
+
+* {
+  box-sizing: border-box;
+}
+
+html,
+body {
+  height: 100%;
+  width: 100%;
+  margin: 0;
+  padding: 0;
+  background: var(--theme--bg) !important;
+  overflow: hidden;
+}
+
+body {
+  display: flex !important;
+  flex-direction: column;
+}
+
+header {
+  display: flex;
+  background: var(--theme--bg_secondary);
+  border-bottom: 1px solid var(--theme--ui_divider);
+  width: 100%;
+  padding: 0.5em;
+  user-select: none;
+  -webkit-app-region: drag;
+  z-index: 3;
+  font-size: 16px;
+}
+
+#tabs {
+  display: flex;
+  overflow: hidden;
+}
+.tab {
+  display: flex;
+  flex-grow: 1;
+  flex-shrink: 1;
+  width: 14em;
+  max-width: 14em;
+  overflow: hidden;
+  padding: 0.4em 0.6em;
+
+  color: var(--theme--text_secondary);
+  background: var(--theme--bg);
+  font-family: var(--theme--font_sans);
+  font-weight: 500;
+  border: none;
+  -webkit-app-region: no-drag;
+}
+.tab:hover {
+  background: var(--theme--ui_interactive-hover);
+}
+.tab.current {
+  background: var(--theme--ui_interactive-active);
+}
+
+.drag-indicator {
+  z-index: 1;
+  width: 0.125em;
+  margin: 0 -0.0625em;
+  background: var(--theme--accent_blue-selection);
+}
+
+.tab-title {
+  white-space: nowrap;
+  overflow: hidden;
+  margin-right: 0.25em;
+}
+.tab-icon {
+  margin-right: 0.375em;
+  flex-shrink: 0;
+}
+.tab-icon[style*='background'] {
+  width: 0.875em;
+  height: 0.875em;
+  align-self: center;
+  margin-right: 0.5em;
+}
+.tab-icon:not([style*='background']):empty,
+.tab-icon + svg {
+  display: none;
+}
+.tab-icon:not([style*='background']):empty + svg {
+  /* placeholder icon */
+  flex-shrink: 0;
+  display: inline-block;
+  margin: 1px 0.5em 0 0;
+  width: 1.125em;
+  height: 1.125em;
+  display: block;
+  backface-visibility: hidden;
+  fill: var(--theme--icon_secondary);
+}
+
+.new-tab,
+.tab-close {
+  transition: background 20ms ease-in 0s;
+  cursor: pointer;
+  display: inline-flex;
+  align-items: center;
+  justify-content: center;
+  flex-shrink: 0;
+  border-radius: 0.1875em;
+  height: 1.25em;
+  width: 1.25em;
+  padding: 0 0.25px 0 0;
+
+  align-self: center;
+  border: none;
+  background: transparent;
+  -webkit-app-region: no-drag;
+}
+.new-tab svg,
+.tab-close svg {
+  width: 0.875em;
+  height: 0.875em;
+  fill: var(--theme--icon_secondary);
+  color: var(--theme--icon_secondary);
+}
+.new-tab:focus,
+.new-tab:hover,
+.tab-close:focus,
+.tab-close:hover {
+  background: var(--theme--ui_interactive-hover);
+}
+.new-tab:active,
+.tab-close:active {
+  background: var(--theme--ui_interactive-active);
+}
+
+.new-tab {
+  margin: 0 3em 0 0.375em;
+}
+.tab-close {
+  margin-left: auto;
+}
+
+#window-actions {
+  display: flex;
+  align-items: center;
+  margin-left: auto;
+}
+#window-actions > * {
+  -webkit-app-region: no-drag;
+}
+
+[data-tab-labels='page title only'] .tab-icon {
+  display: none;
+}
+[data-tab-labels='page icon only'] .tab {
+  width: 4em;
+  max-width: 4em;
+}
+[data-tab-labels='page icon only'] .tab-title {
+  display: none;
+}
+
+[data-tab-style='rectangular'] .new-tab,
+[data-tab-style='traditional tabbed'] .new-tab {
+  margin-bottom: -0.25em;
+}
+[data-tab-style='rectangular'] .tab-close,
+[data-tab-style='traditional tabbed'] .tab-close {
+  align-self: auto;
+}
+[data-tab-style='rectangular'] .drag-indicator,
+[data-tab-style='traditional tabbed'] .drag-indicator,
+[data-tab-style='rectangular'] #tabs {
+  margin-bottom: -0.5em;
+}
+[data-tab-style='rectangular'] .tab {
+  padding: 0.6em 0.6em 0.8em 0.6em;
+}
+[data-tab-style='traditional tabbed'] header {
+  padding-top: 0.6875em;
+}
+[data-tab-style='traditional tabbed'] #tabs {
+  margin: -0.1875em 0 -0.5em 0;
+}
+[data-tab-style='traditional tabbed'] .tab {
+  border-top-left-radius: 0.875em;
+  border-top-right-radius: 0.875em;
+  padding: 0.6em;
+}
+[data-tab-style='bubble'] .tab {
+  border-radius: 0.375em;
+}
+[data-tab-style='bubble'] .tab:not(:first-child) {
+  margin-left: 0.5em;
+}
+[data-tab-style='bubble'] .drag-indicator {
+  margin: 0 -0.3125em 0 0.1875em;
+}
+[data-tab-style='bubble'] .drag-indicator:first-child {
+  margin: 0 0.187em 0 -0.312em;
+}
+[data-tab-style='compact'] header {
+  padding: 0;
+  font-size: 14px;
+}
+[data-tab-style='compact'] #window-actions {
+  transform: scale(0.8);
+  margin-right: -0.35em;
+}
+
+#root {
+  flex-grow: 1;
+}
+.notion-webview {
+  width: 100%;
+  height: 100%;
+  display: none;
+}
+.search-webview {
+  width: 100%;
+  height: 60px;
+  display: none;
+  transition: transform 70ms ease-in;
+  transform: translateY(-100%);
+  pointer-events: none;
+  position: absolute;
+  z-index: 2;
+}
+.search-webview.search-active {
+  transition: transform 70ms ease-out;
+  transform: translateY(0%);
+  pointer-events: auto;
+}
diff --git a/src/mods/tabs/tabs.jpg b/src/mods/tabs/tabs.jpg
new file mode 100644
index 0000000..2c9d0ab
Binary files /dev/null and b/src/mods/tabs/tabs.jpg differ
diff --git a/src/mods/theming/_mapColors.js b/src/mods/theming/_mapColors.js
new file mode 100644
index 0000000..9798198
--- /dev/null
+++ b/src/mods/theming/_mapColors.js
@@ -0,0 +1,545 @@
+/**
+ * notion-enhancer: theming
+ * (c) 2021 dragonwocky <thedragonring.bod@gmail.com> (https://dragonwocky.me/)
+ * (https://notion-enhancer.github.io/) under the MIT license
+ */
+
+// a development tool used for generating color variables
+// and the contents of colors.css
+
+// included for posterity/updates
+// -- not executed by the enhancer at runtime
+
+const lightGray = {
+  'light': {
+    'tag': 'rgba(227, 226, 224, 0.5)',
+    'tag-text': 'rgb(50, 48, 44)',
+    'board': 'rgba(249, 249, 245, 0.5)',
+    'board-card': 'white',
+    'board-card_text': 'inherit',
+    'board-text': 'rgba(145, 145, 142, 0.5)',
+  },
+  'dark': {
+    'tag': 'rgba(71, 76, 80, 0.7)',
+    'tag-text': 'rgba(255, 255, 255, 0.88)',
+    'board': 'rgba(51, 55, 59, 0.7)',
+    'board-card': 'rgba(60, 65, 68, 0.7)',
+    'board-card_text': 'inherit',
+    'board-text': 'rgba(107, 112, 116, 0.7)',
+  },
+};
+
+const colors = {
+  'gray': {
+    'light': {
+      'text': 'rgba(120, 119, 116, 1)',
+      'highlight': 'rgba(241, 241, 239, 1)',
+      'highlight-text': 'currentColor',
+      'callout': 'rgb(241, 241, 239)',
+      'callout-text': 'currentColor',
+      'tag': 'rgb(227, 226, 224)',
+      'tag-text': 'rgb(50, 48, 44)',
+      'board': 'rgba(247, 247, 245, 0.7)',
+      'board-card': 'white',
+      'board-card_text': 'inherit',
+      'board-text': 'rgb(145, 145, 142)',
+    },
+    'dark': {
+      'text': 'rgba(159, 164, 169, 1)',
+      'highlight': 'rgba(60, 65, 68, 1)',
+      'highlight-text': 'currentColor',
+      'callout': 'rgb(60, 65, 68)',
+      'callout-text': 'currentColor',
+      'tag': 'rgb(71, 76, 80)',
+      'tag-text': 'rgba(255, 255, 255, 0.88)',
+      'board': 'rgb(51, 55, 59)',
+      'board-card': 'rgb(60, 65, 68)',
+      'board-card_text': 'inherit',
+      'board-text': 'rgb(107, 112, 116)',
+    },
+  },
+  'brown': {
+    'light': {
+      'text': 'rgba(159, 107, 83, 1)',
+      'highlight': 'rgba(244, 238, 238, 1)',
+      'highlight-text': 'currentColor',
+      'callout': 'rgb(244, 238, 238)',
+      'callout-text': 'currentColor',
+      'tag': 'rgb(238, 224, 218)',
+      'tag-text': 'rgb(68, 42, 30)',
+      'board': 'rgba(250, 246, 245, 0.7)',
+      'board-card': 'white',
+      'board-card_text': 'inherit',
+      'board-text': 'rgb(187, 132, 108)',
+    },
+    'dark': {
+      'text': 'rgba(212, 150, 117, 1)',
+      'highlight': 'rgba(76, 61, 53, 1)',
+      'highlight-text': 'currentColor',
+      'callout': 'rgb(76, 61, 53)',
+      'callout-text': 'currentColor',
+      'tag': 'rgb(92, 71, 61)',
+      'tag-text': 'rgba(255, 255, 255, 0.88)',
+      'board': 'rgb(59, 54, 51)',
+      'board-card': 'rgb(76, 61, 53)',
+      'board-card_text': 'inherit',
+      'board-text': 'rgb(155, 98, 69)',
+    },
+  },
+  'orange': {
+    'light': {
+      'text': 'rgba(217, 115, 13, 1)',
+      'highlight': 'rgba(251, 236, 221, 1)',
+      'highlight-text': 'currentColor',
+      'callout': 'rgb(251, 236, 221)',
+      'callout-text': 'currentColor',
+      'tag': 'rgb(250, 222, 201)',
+      'tag-text': 'rgb(73, 41, 14)',
+      'board': 'rgba(252, 245, 242, 0.7)',
+      'board-card': 'white',
+      'board-card_text': 'inherit',
+      'board-text': 'rgb(215, 129, 58)',
+    },
+    'dark': {
+      'text': 'rgba(217, 133, 56, 1)',
+      'highlight': 'rgba(85, 59, 41, 1)',
+      'highlight-text': 'currentColor',
+      'callout': 'rgb(85, 59, 41)',
+      'callout-text': 'currentColor',
+      'tag': 'rgb(136, 84, 44)',
+      'tag-text': 'rgba(255, 255, 255, 0.88)',
+      'board': 'rgb(61, 54, 49)',
+      'board-card': 'rgb(85, 59, 41)',
+      'board-text': 'rgb(168, 92, 30)',
+    },
+  },
+  'yellow': {
+    'light': {
+      'text': 'rgba(203, 145, 47, 1)',
+      'highlight': 'rgba(251, 243, 219, 1)',
+      'highlight-text': 'currentColor',
+      'callout': 'rgb(251, 243, 219)',
+      'callout-text': 'currentColor',
+      'tag': 'rgb(253, 236, 200)',
+      'tag-text': 'rgb(64, 44, 27)',
+      'board': 'rgba(250, 247, 237, 0.7)',
+      'board-card': 'white',
+      'board-card_text': 'inherit',
+      'board-text': 'rgb(203, 148, 51)',
+    },
+    'dark': {
+      'text': 'rgba(201, 145, 38, 1)',
+      'highlight': 'rgba(79, 64, 41, 1)',
+      'highlight-text': 'currentColor',
+      'callout': 'rgb(79, 64, 41)',
+      'callout-text': 'currentColor',
+      'tag': 'rgb(146, 118, 63)',
+      'tag-text': 'rgba(255, 255, 255, 0.88)',
+      'board': 'rgb(56, 55, 49)',
+      'board-card': 'rgb(79, 64, 41)',
+      'board-card_text': 'inherit',
+      'board-text': 'rgb(137, 107, 42)',
+    },
+  },
+  'green': {
+    'light': {
+      'text': 'rgba(68, 131, 97, 1)',
+      'highlight': 'rgba(237, 243, 236, 1)',
+      'highlight-text': 'currentColor',
+      'callout': 'rgb(237, 243, 236)',
+      'callout-text': 'currentColor',
+      'tag': 'rgb(219, 237, 219)',
+      'tag-text': 'rgb(28, 56, 41)',
+      'board': 'rgba(244, 248, 243, 0.7)',
+      'board-card': 'white',
+      'board-card_text': 'inherit',
+      'board-text': 'rgb(108, 155, 125)',
+    },
+    'dark': {
+      'text': 'rgba(113, 178, 131, 1)',
+      'highlight': 'rgba(46, 68, 58, 1)',
+      'highlight-text': 'currentColor',
+      'callout': 'rgb(46, 68, 58)',
+      'callout-text': 'currentColor',
+      'tag': 'rgb(50, 82, 65)',
+      'tag-text': 'rgba(255, 255, 255, 0.88)',
+      'board': 'rgb(49, 57, 53)',
+      'board-card': 'rgb(46, 68, 58)',
+      'board-card_text': 'inherit',
+      'board-text': 'rgb(61, 124, 86)',
+    },
+  },
+  'blue': {
+    'light': {
+      'text': 'rgba(51, 126, 169, 1)',
+      'highlight': 'rgba(231, 243, 248, 1)',
+      'highlight-text': 'currentColor',
+      'callout': 'rgb(231, 243, 248)',
+      'callout-text': 'currentColor',
+      'tag': 'rgb(211, 229, 239)',
+      'tag-text': 'rgb(24, 51, 71)',
+      'board': 'rgba(241, 248, 251, 0.7)',
+      'board-card': 'white',
+      'board-card_text': 'inherit',
+      'board-text': 'rgb(91, 151, 189)',
+    },
+    'dark': {
+      'text': 'rgba(102, 170, 218, 1)',
+      'highlight': 'rgba(45, 66, 86, 1)',
+      'highlight-text': 'currentColor',
+      'callout': 'rgb(45, 66, 86)',
+      'callout-text': 'currentColor',
+      'tag': 'rgb(42, 78, 107)',
+      'tag-text': 'rgba(255, 255, 255, 0.88)',
+      'board': 'rgb(49, 56, 64)',
+      'board-card': 'rgb(45, 66, 86)',
+      'board-card_text': 'inherit',
+      'board-text': 'rgb(46, 117, 164)',
+    },
+  },
+  'purple': {
+    'light': {
+      'text': 'rgba(144, 101, 176, 1)',
+      'highlight': 'rgba(244, 240, 247, 0.8)',
+      'highlight-text': 'currentColor',
+      'callout': 'rgba(244, 240, 247, 0.8)',
+      'callout-text': 'currentColor',
+      'tag': 'rgb(232, 222, 238)',
+      'tag-text': 'rgb(65, 36, 84)',
+      'board': 'rgba(249, 246, 252, 0.7)',
+      'board-card': 'white',
+      'board-card_text': 'inherit',
+      'board-text': 'rgb(167, 130, 195)',
+    },
+    'dark': {
+      'text': 'rgba(176, 152, 217, 1)',
+      'highlight': 'rgba(69, 58, 91, 1)',
+      'highlight-text': 'currentColor',
+      'callout': 'rgb(69, 58, 91)',
+      'callout-text': 'currentColor',
+      'tag': 'rgb(83, 68, 116)',
+      'tag-text': 'rgba(255, 255, 255, 0.88)',
+      'board': 'rgb(57, 53, 65)',
+      'board-card': 'rgb(69, 58, 91)',
+      'board-card_text': 'inherit',
+      'board-text': 'rgb(123, 96, 180)',
+    },
+  },
+  'pink': {
+    'light': {
+      'text': 'rgba(193, 76, 138, 1)',
+      'highlight': 'rgba(249, 238, 243, 0.8)',
+      'highlight-text': 'currentColor',
+      'callout': 'rgba(249, 238, 243, 0.8)',
+      'callout-text': 'currentColor',
+      'tag': 'rgb(245, 224, 233)',
+      'tag-text': 'rgb(76, 35, 55)',
+      'board': 'rgba(251, 245, 251, 0.7)',
+      'board-card': 'white',
+      'board-card_text': 'inherit',
+      'board-text': 'rgb(205, 116, 159)',
+    },
+    'dark': {
+      'text': 'rgba(223, 132, 209, 1)',
+      'highlight': 'rgba(81, 56, 77, 1)',
+      'highlight-text': 'currentColor',
+      'callout': 'rgb(81, 56, 77)',
+      'callout-text': 'currentColor',
+      'tag': 'rgb(106, 59, 99)',
+      'tag-text': 'rgba(255, 255, 255, 0.88)',
+      'board': 'rgb(60, 53, 58)',
+      'board-card': 'rgb(81, 56, 77)',
+      'board-card_text': 'inherit',
+      'board-text': 'rgb(169, 76, 157)',
+    },
+  },
+  'red': {
+    'light': {
+      'text': 'rgba(212, 76, 71, 1)',
+      'highlight': 'rgba(253, 235, 236, 1)',
+      'highlight-text': 'currentColor',
+      'callout': 'rgb(253, 235, 236)',
+      'callout-text': 'currentColor',
+      'tag': 'rgb(255, 226, 221)',
+      'tag-text': 'rgb(93, 23, 21)',
+      'board': 'rgba(253, 245, 243, 0.7)',
+      'board-card': 'white',
+      'board-card_text': 'inherit',
+      'board-text': 'rgb(225, 111, 100)',
+    },
+    'dark': {
+      'text': 'rgba(234, 135, 140, 1)',
+      'highlight': 'rgba(94, 52, 54, 1)',
+      'highlight-text': 'currentColor',
+      'callout': 'rgb(94, 52, 54)',
+      'callout-text': 'currentColor',
+      'tag': 'rgb(122, 54, 59)',
+      'tag-text': 'rgba(255, 255, 255, 0.88)',
+      'board': 'rgb(66, 51, 51)',
+      'board-card': 'rgb(94, 52, 54)',
+      'board-card_text': 'inherit',
+      'board-text': 'rgb(194, 65, 82)',
+    },
+  },
+};
+
+function css() {
+  const rgb = (color) =>
+      color.startsWith('rgba') && color.endsWith(', 1)')
+        ? `rgb(${color.slice(5, -4)})`
+        : color,
+    notCallout = ":not([style*='border-radius'])",
+    notBoardCard = ":not([style*='box-shadow'])",
+    isTag =
+      "[style*='align-items: center;'][style*='border-radius: 3px; padding-left: '][style*='line-height: 120%;']",
+    isTagPalette = "[style*='border-radius: 3px;'][style*='width: 18px; height: 18px;']",
+    isHighlightPalette =
+      "[style*='align-items: center; justify-content: center; width: 22px; height: 22px;'][style*='border-radius: 3px; font-weight: 500;']";
+  let css = '';
+
+  // generate light gray separately
+  css += `
+
+    /* light gray */
+
+    .notion-body:not(.dark) [style*='background: ${lightGray.light['tag']}']${isTag},
+    .notion-body.dark [style*='background: ${lightGray.dark['tag']}']${isTag} {
+      background: var(--theme--tag_light_gray) !important;
+      color: var(--theme--tag_light_gray-text) !important;
+    }
+
+    .notion-body:not(.dark) [style*='background: ${
+      lightGray.light['tag']
+    }']${isTagPalette},
+    .notion-body.dark [style*='background: ${
+      lightGray.dark['board-text']
+    }']${isTagPalette} {
+      background: var(--theme--tag_light_gray) !important;
+      color: var(--theme--tag_light_gray-text) !important;
+    }
+
+    .notion-body:not(.dark)
+      .notion-board-group[style*='background-color: ${lightGray.light['board']}'],
+    .notion-body.dark
+      .notion-board-group[style*='background-color: ${lightGray.dark['board']}'],
+    .notion-body:not(.dark) .notion-board-view > .notion-selectable > :first-child > :nth-child(2)
+      [style*='background-color: ${lightGray.light['board']}'],
+    .notion-body.dark .notion-board-view > .notion-selectable > :first-child > :nth-child(2)
+      [style*='background-color: ${lightGray.dark['board']}'] {
+      background: var(--theme--board_light_gray) !important;
+      color: var(--theme--board_light_gray-text) !important;
+    }
+    .notion-body:not(.dark)
+      .notion-board-group[style*='background-color: ${lightGray.light['board']}']
+      > [data-block-id] > [rel='noopener noreferrer'],
+    .notion-body.dark
+      .notion-board-group[style*='background-color: ${lightGray.dark['board']}']
+      > [data-block-id] > [rel='noopener noreferrer'] {
+      background: var(--theme--board_light_gray-card) !important;
+      color: var(--theme--board_light_gray-card_text) !important;
+    }
+    .notion-body.dark
+      .notion-board-group[style*='background-color: ${lightGray.dark['board']}']
+      > [data-block-id] > [rel='noopener noreferrer'] [placeholder="Untitled"] {
+      -webkit-text-fill-color: var(--theme--board_light_gray-card_text, var(--theme--board_light_gray-text)) !important;
+    }
+    .notion-body:not(.dark)
+      .notion-board-group[style*='background-color: ${lightGray.light['board']}']
+      > [data-block-id] > [rel='noopener noreferrer'] > .notion-focusable:hover {
+      background: rgba(255, 255, 255, 0.2) !important;
+    }
+    .notion-body.dark
+      .notion-board-group[style*='background-color: ${lightGray.dark['board']}']
+      > [data-block-id] > [rel='noopener noreferrer'] > .notion-focusable:hover {
+      background: rgba(0, 0, 0, 0.1) !important;
+    }
+    .notion-body:not(.dark) .notion-board-view
+      [style*='color: ${lightGray.light['board-text']}'],
+    .notion-body.dark .notion-board-view [style*='color: ${lightGray.dark['board-text']}'],
+    .notion-body:not(.dark) .notion-board-view
+      [style*='fill: ${lightGray.light['board-text']}'],
+    .notion-body.dark .notion-board-view [style*='fill: ${lightGray.dark['board-text']}'] {
+      color: var(--theme--board_light_gray-text) !important;
+      fill: var(--theme--board_light_gray-text) !important;
+    }
+  `;
+
+  // generate the rest of the colours
+  for (const c in colors) {
+    css += `
+
+    /* ${c} */
+
+    .notion-body:not(.dark) [style*='color: ${rgb(colors[c].light['text'])}'],
+    .notion-body:not(.dark) [style*='color:${colors[c].light['text']}'],
+    .notion-body.dark [style*='color: ${rgb(colors[c].dark['text'])}'],
+    .notion-body.dark [style*='color:${colors[c].dark['text']}'] {
+      color: var(--theme--text_${c}) !important;
+      fill: var(--theme--text_${c}) !important;
+    }
+
+
+    .notion-body:not(.dark) [style*='background: ${
+      colors[c].light['highlight']
+    }']${notCallout}${notBoardCard},
+    .notion-body:not(.dark) [style*='background:${
+      colors[c].light['highlight']
+    }']${notCallout}${notBoardCard},
+    .notion-body:not(.dark) [style*='background: ${rgb(
+      colors[c].light['highlight']
+    )}']${notCallout}${notBoardCard},
+    .notion-body:not(.dark) [style*='background:${rgb(
+      colors[c].light['highlight']
+    )}']${notCallout}${notBoardCard},
+    .notion-body:not(.dark) [style*='background-color: ${
+      colors[c].light['highlight']
+    }']${notCallout}${notBoardCard},
+    .notion-body.dark [style*='background: ${
+      colors[c].dark['highlight']
+    }']${notCallout}${notBoardCard},
+    .notion-body.dark [style*='background:${
+      colors[c].dark['highlight']
+    }']${notCallout}${notBoardCard},
+    .notion-body.dark [style*='background: ${rgb(
+      colors[c].dark['highlight']
+    )}']${notCallout}${notBoardCard},
+    .notion-body.dark [style*='background:${rgb(
+      colors[c].dark['highlight']
+    )}']${notCallout}${notBoardCard},
+    .notion-body.dark [style*='background-color: ${
+      colors[c].dark['highlight']
+    }']${notCallout}${notBoardCard} {
+      background: var(--theme--highlight_${c}) !important;
+      color: var(--theme--highlight_${c}-text) !important;
+    }
+
+    .notion-body:not(.dark) .notion-callout-block > div
+      > [style*='background: ${colors[c].light['callout']}'],
+    .notion-body.dark .notion-callout-block > div
+      > [style*='background: ${colors[c].dark['callout']}'] {
+      background: var(--theme--callout_${c}) !important;
+      color: var(--theme--callout_${c}-text) !important;
+    }
+    .notion-body:not(.dark) [style*='background: ${colors[c].light['tag']}']${isTag},
+    .notion-body.dark [style*='background: ${colors[c].dark['tag']}']${isTag} {
+      background: var(--theme--tag_${c}) !important;
+      color: var(--theme--tag_${c}-text) !important;
+    }
+
+    .notion-body:not(.dark) [style*='background: ${
+      colors[c].light['callout']
+    }']${isHighlightPalette},
+    .notion-body.dark [style*='background: ${
+      colors[c].dark['callout']
+    }']${isHighlightPalette} {
+      background: var(--theme--highlight_${c}) !important;
+      color: var(--theme--highlight_${c}-text) !important;
+    }
+    .notion-body:not(.dark) [style*='background: ${
+      colors[c].light['tag']
+    }']${isTagPalette},
+    .notion-body.dark [style*='background: ${
+      colors[c].dark['board-text']
+    }']${isTagPalette} {
+      background: var(--theme--tag_${c}) !important;
+      color: var(--theme--tag_${c}-text) !important;
+    }
+
+    .notion-body:not(.dark)
+      .notion-board-group[style*='background-color: ${colors[c].light['board']}'],
+    .notion-body.dark
+      .notion-board-group[style*='background-color: ${colors[c].dark['board']}'],
+    .notion-body:not(.dark) .notion-board-view > .notion-selectable > :first-child > :nth-child(2)
+      [style*='background-color: ${colors[c].light['board']}'],
+    .notion-body.dark .notion-board-view > .notion-selectable > :first-child > :nth-child(2)
+      [style*='background-color: ${colors[c].dark['board']}'] {
+      background: var(--theme--board_${c}) !important;
+      color: var(--theme--board_${c}-text) !important;
+    }
+    .notion-body:not(.dark)
+      .notion-board-group[style*='background-color: ${colors[c].light['board']}']
+      > [data-block-id] > [rel='noopener noreferrer'],
+    .notion-body.dark
+      .notion-board-group[style*='background-color: ${colors[c].dark['board']}']
+      > [data-block-id] > [rel='noopener noreferrer'] {
+      background: var(--theme--board_${c}-card) !important;
+      color: var(--theme--board_${c}-card_text) !important;
+    }
+    .notion-body.dark
+      .notion-board-group[style*='background-color: ${colors[c].dark['board']}']
+      > [data-block-id] > [rel='noopener noreferrer'] [placeholder="Untitled"] {
+      -webkit-text-fill-color: var(--theme--board_${c}-card_text, var(--theme--board_${c}-text)) !important;
+    }
+    .notion-body:not(.dark)
+      .notion-board-group[style*='background-color: ${colors[c].light['board']}']
+      > [data-block-id] > [rel='noopener noreferrer'] > .notion-focusable:hover {
+      background: rgba(255, 255, 255, 0.2) !important;
+    }
+    .notion-body.dark
+      .notion-board-group[style*='background-color: ${colors[c].dark['board']}']
+      > [data-block-id] > [rel='noopener noreferrer'] > .notion-focusable:hover {
+      background: rgba(0, 0, 0, 0.1) !important;
+    }
+    .notion-body:not(.dark) .notion-board-view
+      [style*='color: ${colors[c].light['board-text']}'],
+    .notion-body.dark .notion-board-view [style*='color: ${
+      colors[c].dark['board-text']
+    }'],
+    .notion-body:not(.dark) .notion-board-view
+      [style*='fill: ${colors[c].light['board-text']}'],
+    .notion-body.dark .notion-board-view [style*='fill: ${
+      colors[c].dark['board-text']
+    }'] {
+      color: var(--theme--board_${c}-text) !important;
+      fill: var(--theme--board_${c}-text) !important;
+    }
+  `;
+  }
+  return css;
+}
+
+// 'light' or 'dark'
+function vars(mode) {
+  // order in which variables will appear
+  const sets = {
+    'text': '',
+    'highlight': '',
+    'callout': '',
+    // tag_default has the same color in light and dark
+    'tag': '--theme--tag_default: rgba(206, 205, 202, 0.5);\n--theme--tag_default-text: var(--theme--text);\n',
+    'board': ''
+  };
+
+  // light gray separately
+  for (let key in lightGray[mode]) {
+    const prefix = key.split('-')[0],
+      value = lightGray[mode][key];
+    if (!sets[prefix]) sets[prefix] = '';
+    key = [`--theme--${prefix}_light_gray`, ...key.split('-').slice(1)].join('-');
+    sets[prefix] += `${key}: ${value};\n`;
+  }
+
+  // other colors
+  for (const color in colors) {
+    for (let key in colors[color][mode]) {
+      const prefix = key.split('-')[0],
+        value = colors[color][mode][key];
+      if (!sets[prefix]) sets[prefix] = '';
+      key = [`--theme--${prefix}_${color}`, ...key.split('-').slice(1)].join('-');
+      sets[prefix] += `${key}: ${value};\n`;
+    }
+  }
+  let vars = '';
+  for (const set in sets) {
+    vars += `\n${sets[set]}`;
+  }
+  return vars;
+}
+
+if (process.argv.includes('css')) {
+  console.log(css());
+} else if (process.argv.includes('light')) {
+  console.log(vars('light'));
+} else if (process.argv.includes('dark')) {
+  console.log(vars('dark'));
+}
diff --git a/src/mods/theming/client.mjs b/src/mods/theming/client.mjs
new file mode 100644
index 0000000..88060be
--- /dev/null
+++ b/src/mods/theming/client.mjs
@@ -0,0 +1,58 @@
+/**
+ * notion-enhancer: theming
+ * (c) 2021 dragonwocky <thedragonring.bod@gmail.com> (https://dragonwocky.me/)
+ * (https://notion-enhancer.github.io/) under the MIT license
+ */
+
+'use strict';
+
+export default async function ({ web, registry, storage, electron }, db) {
+  const enabledThemes = await registry.list(
+    async (m) => (await registry.enabled(m.id)) && m.tags.includes('theme')
+  );
+  if (enabledThemes.length || (await db.get(['force_load']))) {
+    // only override colors if theme is enable for perf
+    web.loadStylesheet('repo/theming/theme.css');
+    web.loadStylesheet('repo/theming/colors.css');
+  }
+
+  const updateTheme = async () => {
+    if (document.visibilityState !== 'visible' && !document.hasFocus()) return;
+    const isDark =
+        document.querySelector('.notion-dark-theme') ||
+        document.querySelector('.notion-body.dark'),
+      isLight = document.querySelector('.notion-light-theme'),
+      mode = isDark ? 'dark' : isLight ? 'light' : '';
+    if (!mode) return;
+    await storage.set(['theme'], mode);
+    document.documentElement.classList.add(mode);
+    document.documentElement.classList.remove(mode === 'light' ? 'dark' : 'light');
+    electron.sendMessage('update-theme');
+    const searchThemeVars = [
+      'bg',
+      'text',
+      'icon',
+      'icon_secondary',
+      'accent_blue',
+      'accent_blue-text',
+      'accent_blue-hover',
+      'accent_blue-active',
+      'ui_shadow',
+      'ui_divider',
+      'ui_input',
+      'ui_interactive-hover',
+      'ui_interactive-active',
+    ].map((key) => [
+      key,
+      window.getComputedStyle(document.documentElement).getPropertyValue(`--theme--${key}`),
+    ]);
+    electron.sendMessage('set-search-theme', searchThemeVars);
+  };
+  web.addDocumentObserver((mutation) => {
+    const potentialThemeChange = mutation.target.matches?.('html, body, .notion-app-inner');
+    if (potentialThemeChange && document.hasFocus()) updateTheme();
+  });
+  updateTheme();
+  document.addEventListener('visibilitychange', updateTheme);
+  document.addEventListener('focus', updateTheme);
+}
diff --git a/src/mods/theming/colors.css b/src/mods/theming/colors.css
new file mode 100644
index 0000000..d615c01
--- /dev/null
+++ b/src/mods/theming/colors.css
@@ -0,0 +1,1218 @@
+/**
+ * notion-enhancer: theming
+ * (c) 2021 dragonwocky <thedragonring.bod@gmail.com> (https://dragonwocky.me/)
+ * (https://notion-enhancer.github.io/) under the MIT license
+ */
+
+/* light gray */
+
+.notion-body:not(.dark)
+  [style*='background: rgba(227, 226, 224, 0.5)'][style*='align-items: center;'][style*='border-radius: 3px; padding-left: '][style*='line-height: 120%;'],
+.notion-body.dark
+  [style*='background: rgba(71, 76, 80, 0.7)'][style*='align-items: center;'][style*='border-radius: 3px; padding-left: '][style*='line-height: 120%;'] {
+  background: var(--theme--tag_light_gray) !important;
+  color: var(--theme--tag_light_gray-text) !important;
+}
+
+.notion-body:not(.dark)
+  [style*='background: rgba(227, 226, 224, 0.5)'][style*='border-radius: 3px;'][style*='width: 18px; height: 18px;'],
+.notion-body.dark
+  [style*='background: rgba(107, 112, 116, 0.7)'][style*='border-radius: 3px;'][style*='width: 18px; height: 18px;'] {
+  background: var(--theme--tag_light_gray) !important;
+  color: var(--theme--tag_light_gray-text) !important;
+}
+
+.notion-body:not(.dark)
+  .notion-board-group[style*='background-color: rgba(249, 249, 245, 0.5)'],
+.notion-body.dark .notion-board-group[style*='background-color: rgba(51, 55, 59, 0.7)'],
+.notion-body:not(.dark)
+  .notion-board-view
+  > .notion-selectable
+  > :first-child
+  > :nth-child(2)
+  [style*='background-color: rgba(249, 249, 245, 0.5)'],
+.notion-body.dark
+  .notion-board-view
+  > .notion-selectable
+  > :first-child
+  > :nth-child(2)
+  [style*='background-color: rgba(51, 55, 59, 0.7)'] {
+  background: var(--theme--board_light_gray) !important;
+  color: var(--theme--board_light_gray-text) !important;
+}
+.notion-body:not(.dark)
+  .notion-board-group[style*='background-color: rgba(249, 249, 245, 0.5)']
+  > [data-block-id]
+  > [rel='noopener noreferrer'],
+.notion-body.dark
+  .notion-board-group[style*='background-color: rgba(51, 55, 59, 0.7)']
+  > [data-block-id]
+  > [rel='noopener noreferrer'] {
+  background: var(--theme--board_light_gray-card) !important;
+  color: var(--theme--board_light_gray-card_text) !important;
+}
+.notion-body.dark
+  .notion-board-group[style*='background-color: rgba(51, 55, 59, 0.7)']
+  > [data-block-id]
+  > [rel='noopener noreferrer']
+  [placeholder='Untitled'] {
+  -webkit-text-fill-color: var(
+    --theme--board_light_gray-card_text,
+    var(--theme--board_light_gray-text)
+  ) !important;
+}
+.notion-body:not(.dark)
+  .notion-board-group[style*='background-color: rgba(249, 249, 245, 0.5)']
+  > [data-block-id]
+  > [rel='noopener noreferrer']
+  > .notion-focusable:hover {
+  background: rgba(255, 255, 255, 0.2) !important;
+}
+.notion-body.dark
+  .notion-board-group[style*='background-color: rgba(51, 55, 59, 0.7)']
+  > [data-block-id]
+  > [rel='noopener noreferrer']
+  > .notion-focusable:hover {
+  background: rgba(0, 0, 0, 0.1) !important;
+}
+.notion-body:not(.dark) .notion-board-view [style*='color: rgba(145, 145, 142, 0.5)'],
+.notion-body.dark .notion-board-view [style*='color: rgba(107, 112, 116, 0.7)'],
+.notion-body:not(.dark) .notion-board-view [style*='fill: rgba(145, 145, 142, 0.5)'],
+.notion-body.dark .notion-board-view [style*='fill: rgba(107, 112, 116, 0.7)'] {
+  color: var(--theme--board_light_gray-text) !important;
+  fill: var(--theme--board_light_gray-text) !important;
+}
+
+/* gray */
+
+.notion-body:not(.dark) [style*='color: rgb(120, 119, 116)'],
+.notion-body:not(.dark) [style*='color:rgba(120, 119, 116, 1)'],
+.notion-body.dark [style*='color: rgb(159, 164, 169)'],
+.notion-body.dark [style*='color:rgba(159, 164, 169, 1)'] {
+  color: var(--theme--text_gray) !important;
+  fill: var(--theme--text_gray) !important;
+}
+
+.notion-body:not(.dark)
+  [style*='background: rgba(241, 241, 239, 1)']:not([style*='border-radius']):not([style*='box-shadow']),
+.notion-body:not(.dark)
+  [style*='background:rgba(241, 241, 239, 1)']:not([style*='border-radius']):not([style*='box-shadow']),
+.notion-body:not(.dark)
+  [style*='background: rgb(241, 241, 239)']:not([style*='border-radius']):not([style*='box-shadow']),
+.notion-body:not(.dark)
+  [style*='background:rgb(241, 241, 239)']:not([style*='border-radius']):not([style*='box-shadow']),
+.notion-body:not(.dark)
+  [style*='background-color: rgba(241, 241, 239, 1)']:not([style*='border-radius']):not([style*='box-shadow']),
+.notion-body.dark
+  [style*='background: rgba(60, 65, 68, 1)']:not([style*='border-radius']):not([style*='box-shadow']),
+.notion-body.dark
+  [style*='background:rgba(60, 65, 68, 1)']:not([style*='border-radius']):not([style*='box-shadow']),
+.notion-body.dark
+  [style*='background: rgb(60, 65, 68)']:not([style*='border-radius']):not([style*='box-shadow']),
+.notion-body.dark
+  [style*='background:rgb(60, 65, 68)']:not([style*='border-radius']):not([style*='box-shadow']),
+.notion-body.dark
+  [style*='background-color: rgba(60, 65, 68, 1)']:not([style*='border-radius']):not([style*='box-shadow']) {
+  background: var(--theme--highlight_gray) !important;
+  color: var(--theme--highlight_gray-text) !important;
+}
+
+.notion-body:not(.dark)
+  .notion-callout-block
+  > div
+  > [style*='background: rgb(241, 241, 239)'],
+.notion-body.dark .notion-callout-block > div > [style*='background: rgb(60, 65, 68)'] {
+  background: var(--theme--callout_gray) !important;
+  color: var(--theme--callout_gray-text) !important;
+}
+.notion-body:not(.dark)
+  [style*='background: rgb(227, 226, 224)'][style*='align-items: center;'][style*='border-radius: 3px; padding-left: '][style*='line-height: 120%;'],
+.notion-body.dark
+  [style*='background: rgb(71, 76, 80)'][style*='align-items: center;'][style*='border-radius: 3px; padding-left: '][style*='line-height: 120%;'] {
+  background: var(--theme--tag_gray) !important;
+  color: var(--theme--tag_gray-text) !important;
+}
+
+.notion-body:not(.dark)
+  [style*='background: rgb(241, 241, 239)'][style*='align-items: center; justify-content: center; width: 22px; height: 22px;'][style*='border-radius: 3px; font-weight: 500;'],
+.notion-body.dark
+  [style*='background: rgb(60, 65, 68)'][style*='align-items: center; justify-content: center; width: 22px; height: 22px;'][style*='border-radius: 3px; font-weight: 500;'] {
+  background: var(--theme--highlight_gray) !important;
+  color: var(--theme--highlight_gray-text) !important;
+}
+.notion-body:not(.dark)
+  [style*='background: rgb(227, 226, 224)'][style*='border-radius: 3px;'][style*='width: 18px; height: 18px;'],
+.notion-body.dark
+  [style*='background: rgb(107, 112, 116)'][style*='border-radius: 3px;'][style*='width: 18px; height: 18px;'] {
+  background: var(--theme--tag_gray) !important;
+  color: var(--theme--tag_gray-text) !important;
+}
+
+.notion-body:not(.dark)
+  .notion-board-group[style*='background-color: rgba(247, 247, 245, 0.7)'],
+.notion-body.dark .notion-board-group[style*='background-color: rgb(51, 55, 59)'],
+.notion-body:not(.dark)
+  .notion-board-view
+  > .notion-selectable
+  > :first-child
+  > :nth-child(2)
+  [style*='background-color: rgba(247, 247, 245, 0.7)'],
+.notion-body.dark
+  .notion-board-view
+  > .notion-selectable
+  > :first-child
+  > :nth-child(2)
+  [style*='background-color: rgb(51, 55, 59)'] {
+  background: var(--theme--board_gray) !important;
+  color: var(--theme--board_gray-text) !important;
+}
+.notion-body:not(.dark)
+  .notion-board-group[style*='background-color: rgba(247, 247, 245, 0.7)']
+  > [data-block-id]
+  > [rel='noopener noreferrer'],
+.notion-body.dark
+  .notion-board-group[style*='background-color: rgb(51, 55, 59)']
+  > [data-block-id]
+  > [rel='noopener noreferrer'] {
+  background: var(--theme--board_gray-card) !important;
+  color: var(--theme--board_gray-card_text) !important;
+}
+.notion-body.dark
+  .notion-board-group[style*='background-color: rgb(51, 55, 59)']
+  > [data-block-id]
+  > [rel='noopener noreferrer']
+  [placeholder='Untitled'] {
+  -webkit-text-fill-color: var(
+    --theme--board_gray-card_text,
+    var(--theme--board_gray-text)
+  ) !important;
+}
+.notion-body:not(.dark)
+  .notion-board-group[style*='background-color: rgba(247, 247, 245, 0.7)']
+  > [data-block-id]
+  > [rel='noopener noreferrer']
+  > .notion-focusable:hover {
+  background: rgba(255, 255, 255, 0.2) !important;
+}
+.notion-body.dark
+  .notion-board-group[style*='background-color: rgb(51, 55, 59)']
+  > [data-block-id]
+  > [rel='noopener noreferrer']
+  > .notion-focusable:hover {
+  background: rgba(0, 0, 0, 0.1) !important;
+}
+.notion-body:not(.dark) .notion-board-view [style*='color: rgb(145, 145, 142)'],
+.notion-body.dark .notion-board-view [style*='color: rgb(107, 112, 116)'],
+.notion-body:not(.dark) .notion-board-view [style*='fill: rgb(145, 145, 142)'],
+.notion-body.dark .notion-board-view [style*='fill: rgb(107, 112, 116)'] {
+  color: var(--theme--board_gray-text) !important;
+  fill: var(--theme--board_gray-text) !important;
+}
+
+/* brown */
+
+.notion-body:not(.dark) [style*='color: rgb(159, 107, 83)'],
+.notion-body:not(.dark) [style*='color:rgba(159, 107, 83, 1)'],
+.notion-body.dark [style*='color: rgb(212, 150, 117)'],
+.notion-body.dark [style*='color:rgba(212, 150, 117, 1)'] {
+  color: var(--theme--text_brown) !important;
+  fill: var(--theme--text_brown) !important;
+}
+
+.notion-body:not(.dark)
+  [style*='background: rgba(244, 238, 238, 1)']:not([style*='border-radius']):not([style*='box-shadow']),
+.notion-body:not(.dark)
+  [style*='background:rgba(244, 238, 238, 1)']:not([style*='border-radius']):not([style*='box-shadow']),
+.notion-body:not(.dark)
+  [style*='background: rgb(244, 238, 238)']:not([style*='border-radius']):not([style*='box-shadow']),
+.notion-body:not(.dark)
+  [style*='background:rgb(244, 238, 238)']:not([style*='border-radius']):not([style*='box-shadow']),
+.notion-body:not(.dark)
+  [style*='background-color: rgba(244, 238, 238, 1)']:not([style*='border-radius']):not([style*='box-shadow']),
+.notion-body.dark
+  [style*='background: rgba(76, 61, 53, 1)']:not([style*='border-radius']):not([style*='box-shadow']),
+.notion-body.dark
+  [style*='background:rgba(76, 61, 53, 1)']:not([style*='border-radius']):not([style*='box-shadow']),
+.notion-body.dark
+  [style*='background: rgb(76, 61, 53)']:not([style*='border-radius']):not([style*='box-shadow']),
+.notion-body.dark
+  [style*='background:rgb(76, 61, 53)']:not([style*='border-radius']):not([style*='box-shadow']),
+.notion-body.dark
+  [style*='background-color: rgba(76, 61, 53, 1)']:not([style*='border-radius']):not([style*='box-shadow']) {
+  background: var(--theme--highlight_brown) !important;
+  color: var(--theme--highlight_brown-text) !important;
+}
+
+.notion-body:not(.dark)
+  .notion-callout-block
+  > div
+  > [style*='background: rgb(244, 238, 238)'],
+.notion-body.dark .notion-callout-block > div > [style*='background: rgb(76, 61, 53)'] {
+  background: var(--theme--callout_brown) !important;
+  color: var(--theme--callout_brown-text) !important;
+}
+.notion-body:not(.dark)
+  [style*='background: rgb(238, 224, 218)'][style*='align-items: center;'][style*='border-radius: 3px; padding-left: '][style*='line-height: 120%;'],
+.notion-body.dark
+  [style*='background: rgb(92, 71, 61)'][style*='align-items: center;'][style*='border-radius: 3px; padding-left: '][style*='line-height: 120%;'] {
+  background: var(--theme--tag_brown) !important;
+  color: var(--theme--tag_brown-text) !important;
+}
+
+.notion-body:not(.dark)
+  [style*='background: rgb(244, 238, 238)'][style*='align-items: center; justify-content: center; width: 22px; height: 22px;'][style*='border-radius: 3px; font-weight: 500;'],
+.notion-body.dark
+  [style*='background: rgb(76, 61, 53)'][style*='align-items: center; justify-content: center; width: 22px; height: 22px;'][style*='border-radius: 3px; font-weight: 500;'] {
+  background: var(--theme--highlight_brown) !important;
+  color: var(--theme--highlight_brown-text) !important;
+}
+.notion-body:not(.dark)
+  [style*='background: rgb(238, 224, 218)'][style*='border-radius: 3px;'][style*='width: 18px; height: 18px;'],
+.notion-body.dark
+  [style*='background: rgb(155, 98, 69)'][style*='border-radius: 3px;'][style*='width: 18px; height: 18px;'] {
+  background: var(--theme--tag_brown) !important;
+  color: var(--theme--tag_brown-text) !important;
+}
+
+.notion-body:not(.dark)
+  .notion-board-group[style*='background-color: rgba(250, 246, 245, 0.7)'],
+.notion-body.dark .notion-board-group[style*='background-color: rgb(59, 54, 51)'],
+.notion-body:not(.dark)
+  .notion-board-view
+  > .notion-selectable
+  > :first-child
+  > :nth-child(2)
+  [style*='background-color: rgba(250, 246, 245, 0.7)'],
+.notion-body.dark
+  .notion-board-view
+  > .notion-selectable
+  > :first-child
+  > :nth-child(2)
+  [style*='background-color: rgb(59, 54, 51)'] {
+  background: var(--theme--board_brown) !important;
+  color: var(--theme--board_brown-text) !important;
+}
+.notion-body:not(.dark)
+  .notion-board-group[style*='background-color: rgba(250, 246, 245, 0.7)']
+  > [data-block-id]
+  > [rel='noopener noreferrer'],
+.notion-body.dark
+  .notion-board-group[style*='background-color: rgb(59, 54, 51)']
+  > [data-block-id]
+  > [rel='noopener noreferrer'] {
+  background: var(--theme--board_brown-card) !important;
+  color: var(--theme--board_brown-card_text) !important;
+}
+.notion-body.dark
+  .notion-board-group[style*='background-color: rgb(59, 54, 51)']
+  > [data-block-id]
+  > [rel='noopener noreferrer']
+  [placeholder='Untitled'] {
+  -webkit-text-fill-color: var(
+    --theme--board_brown-card_text,
+    var(--theme--board_brown-text)
+  ) !important;
+}
+.notion-body:not(.dark)
+  .notion-board-group[style*='background-color: rgba(250, 246, 245, 0.7)']
+  > [data-block-id]
+  > [rel='noopener noreferrer']
+  > .notion-focusable:hover {
+  background: rgba(255, 255, 255, 0.2) !important;
+}
+.notion-body.dark
+  .notion-board-group[style*='background-color: rgb(59, 54, 51)']
+  > [data-block-id]
+  > [rel='noopener noreferrer']
+  > .notion-focusable:hover {
+  background: rgba(0, 0, 0, 0.1) !important;
+}
+.notion-body:not(.dark) .notion-board-view [style*='color: rgb(187, 132, 108)'],
+.notion-body.dark .notion-board-view [style*='color: rgb(155, 98, 69)'],
+.notion-body:not(.dark) .notion-board-view [style*='fill: rgb(187, 132, 108)'],
+.notion-body.dark .notion-board-view [style*='fill: rgb(155, 98, 69)'] {
+  color: var(--theme--board_brown-text) !important;
+  fill: var(--theme--board_brown-text) !important;
+}
+
+/* orange */
+
+.notion-body:not(.dark) [style*='color: rgb(217, 115, 13)'],
+.notion-body:not(.dark) [style*='color:rgba(217, 115, 13, 1)'],
+.notion-body.dark [style*='color: rgb(217, 133, 56)'],
+.notion-body.dark [style*='color:rgba(217, 133, 56, 1)'] {
+  color: var(--theme--text_orange) !important;
+  fill: var(--theme--text_orange) !important;
+}
+
+.notion-body:not(.dark)
+  [style*='background: rgba(251, 236, 221, 1)']:not([style*='border-radius']):not([style*='box-shadow']),
+.notion-body:not(.dark)
+  [style*='background:rgba(251, 236, 221, 1)']:not([style*='border-radius']):not([style*='box-shadow']),
+.notion-body:not(.dark)
+  [style*='background: rgb(251, 236, 221)']:not([style*='border-radius']):not([style*='box-shadow']),
+.notion-body:not(.dark)
+  [style*='background:rgb(251, 236, 221)']:not([style*='border-radius']):not([style*='box-shadow']),
+.notion-body:not(.dark)
+  [style*='background-color: rgba(251, 236, 221, 1)']:not([style*='border-radius']):not([style*='box-shadow']),
+.notion-body.dark
+  [style*='background: rgba(85, 59, 41, 1)']:not([style*='border-radius']):not([style*='box-shadow']),
+.notion-body.dark
+  [style*='background:rgba(85, 59, 41, 1)']:not([style*='border-radius']):not([style*='box-shadow']),
+.notion-body.dark
+  [style*='background: rgb(85, 59, 41)']:not([style*='border-radius']):not([style*='box-shadow']),
+.notion-body.dark
+  [style*='background:rgb(85, 59, 41)']:not([style*='border-radius']):not([style*='box-shadow']),
+.notion-body.dark
+  [style*='background-color: rgba(85, 59, 41, 1)']:not([style*='border-radius']):not([style*='box-shadow']) {
+  background: var(--theme--highlight_orange) !important;
+  color: var(--theme--highlight_orange-text) !important;
+}
+
+.notion-body:not(.dark)
+  .notion-callout-block
+  > div
+  > [style*='background: rgb(251, 236, 221)'],
+.notion-body.dark .notion-callout-block > div > [style*='background: rgb(85, 59, 41)'] {
+  background: var(--theme--callout_orange) !important;
+  color: var(--theme--callout_orange-text) !important;
+}
+.notion-body:not(.dark)
+  [style*='background: rgb(250, 222, 201)'][style*='align-items: center;'][style*='border-radius: 3px; padding-left: '][style*='line-height: 120%;'],
+.notion-body.dark
+  [style*='background: rgb(136, 84, 44)'][style*='align-items: center;'][style*='border-radius: 3px; padding-left: '][style*='line-height: 120%;'] {
+  background: var(--theme--tag_orange) !important;
+  color: var(--theme--tag_orange-text) !important;
+}
+
+.notion-body:not(.dark)
+  [style*='background: rgb(251, 236, 221)'][style*='align-items: center; justify-content: center; width: 22px; height: 22px;'][style*='border-radius: 3px; font-weight: 500;'],
+.notion-body.dark
+  [style*='background: rgb(85, 59, 41)'][style*='align-items: center; justify-content: center; width: 22px; height: 22px;'][style*='border-radius: 3px; font-weight: 500;'] {
+  background: var(--theme--highlight_orange) !important;
+  color: var(--theme--highlight_orange-text) !important;
+}
+.notion-body:not(.dark)
+  [style*='background: rgb(250, 222, 201)'][style*='border-radius: 3px;'][style*='width: 18px; height: 18px;'],
+.notion-body.dark
+  [style*='background: rgb(168, 92, 30)'][style*='border-radius: 3px;'][style*='width: 18px; height: 18px;'] {
+  background: var(--theme--tag_orange) !important;
+  color: var(--theme--tag_orange-text) !important;
+}
+
+.notion-body:not(.dark)
+  .notion-board-group[style*='background-color: rgba(252, 245, 242, 0.7)'],
+.notion-body.dark .notion-board-group[style*='background-color: rgb(61, 54, 49)'],
+.notion-body:not(.dark)
+  .notion-board-view
+  > .notion-selectable
+  > :first-child
+  > :nth-child(2)
+  [style*='background-color: rgba(252, 245, 242, 0.7)'],
+.notion-body.dark
+  .notion-board-view
+  > .notion-selectable
+  > :first-child
+  > :nth-child(2)
+  [style*='background-color: rgb(61, 54, 49)'] {
+  background: var(--theme--board_orange) !important;
+  color: var(--theme--board_orange-text) !important;
+}
+.notion-body:not(.dark)
+  .notion-board-group[style*='background-color: rgba(252, 245, 242, 0.7)']
+  > [data-block-id]
+  > [rel='noopener noreferrer'],
+.notion-body.dark
+  .notion-board-group[style*='background-color: rgb(61, 54, 49)']
+  > [data-block-id]
+  > [rel='noopener noreferrer'] {
+  background: var(--theme--board_orange-card) !important;
+  color: var(--theme--board_orange-card_text) !important;
+}
+.notion-body.dark
+  .notion-board-group[style*='background-color: rgb(61, 54, 49)']
+  > [data-block-id]
+  > [rel='noopener noreferrer']
+  [placeholder='Untitled'] {
+  -webkit-text-fill-color: var(
+    --theme--board_orange-card_text,
+    var(--theme--board_orange-text)
+  ) !important;
+}
+.notion-body:not(.dark)
+  .notion-board-group[style*='background-color: rgba(252, 245, 242, 0.7)']
+  > [data-block-id]
+  > [rel='noopener noreferrer']
+  > .notion-focusable:hover {
+  background: rgba(255, 255, 255, 0.2) !important;
+}
+.notion-body.dark
+  .notion-board-group[style*='background-color: rgb(61, 54, 49)']
+  > [data-block-id]
+  > [rel='noopener noreferrer']
+  > .notion-focusable:hover {
+  background: rgba(0, 0, 0, 0.1) !important;
+}
+.notion-body:not(.dark) .notion-board-view [style*='color: rgb(215, 129, 58)'],
+.notion-body.dark .notion-board-view [style*='color: rgb(168, 92, 30)'],
+.notion-body:not(.dark) .notion-board-view [style*='fill: rgb(215, 129, 58)'],
+.notion-body.dark .notion-board-view [style*='fill: rgb(168, 92, 30)'] {
+  color: var(--theme--board_orange-text) !important;
+  fill: var(--theme--board_orange-text) !important;
+}
+
+/* yellow */
+
+.notion-body:not(.dark) [style*='color: rgb(203, 145, 47)'],
+.notion-body:not(.dark) [style*='color:rgba(203, 145, 47, 1)'],
+.notion-body.dark [style*='color: rgb(201, 145, 38)'],
+.notion-body.dark [style*='color:rgba(201, 145, 38, 1)'] {
+  color: var(--theme--text_yellow) !important;
+  fill: var(--theme--text_yellow) !important;
+}
+
+.notion-body:not(.dark)
+  [style*='background: rgba(251, 243, 219, 1)']:not([style*='border-radius']):not([style*='box-shadow']),
+.notion-body:not(.dark)
+  [style*='background:rgba(251, 243, 219, 1)']:not([style*='border-radius']):not([style*='box-shadow']),
+.notion-body:not(.dark)
+  [style*='background: rgb(251, 243, 219)']:not([style*='border-radius']):not([style*='box-shadow']),
+.notion-body:not(.dark)
+  [style*='background:rgb(251, 243, 219)']:not([style*='border-radius']):not([style*='box-shadow']),
+.notion-body:not(.dark)
+  [style*='background-color: rgba(251, 243, 219, 1)']:not([style*='border-radius']):not([style*='box-shadow']),
+.notion-body.dark
+  [style*='background: rgba(79, 64, 41, 1)']:not([style*='border-radius']):not([style*='box-shadow']),
+.notion-body.dark
+  [style*='background:rgba(79, 64, 41, 1)']:not([style*='border-radius']):not([style*='box-shadow']),
+.notion-body.dark
+  [style*='background: rgb(79, 64, 41)']:not([style*='border-radius']):not([style*='box-shadow']),
+.notion-body.dark
+  [style*='background:rgb(79, 64, 41)']:not([style*='border-radius']):not([style*='box-shadow']),
+.notion-body.dark
+  [style*='background-color: rgba(79, 64, 41, 1)']:not([style*='border-radius']):not([style*='box-shadow']) {
+  background: var(--theme--highlight_yellow) !important;
+  color: var(--theme--highlight_yellow-text) !important;
+}
+
+.notion-body:not(.dark)
+  .notion-callout-block
+  > div
+  > [style*='background: rgb(251, 243, 219)'],
+.notion-body.dark .notion-callout-block > div > [style*='background: rgb(79, 64, 41)'] {
+  background: var(--theme--callout_yellow) !important;
+  color: var(--theme--callout_yellow-text) !important;
+}
+.notion-body:not(.dark)
+  [style*='background: rgb(253, 236, 200)'][style*='align-items: center;'][style*='border-radius: 3px; padding-left: '][style*='line-height: 120%;'],
+.notion-body.dark
+  [style*='background: rgb(146, 118, 63)'][style*='align-items: center;'][style*='border-radius: 3px; padding-left: '][style*='line-height: 120%;'] {
+  background: var(--theme--tag_yellow) !important;
+  color: var(--theme--tag_yellow-text) !important;
+}
+
+.notion-body:not(.dark)
+  [style*='background: rgb(251, 243, 219)'][style*='align-items: center; justify-content: center; width: 22px; height: 22px;'][style*='border-radius: 3px; font-weight: 500;'],
+.notion-body.dark
+  [style*='background: rgb(79, 64, 41)'][style*='align-items: center; justify-content: center; width: 22px; height: 22px;'][style*='border-radius: 3px; font-weight: 500;'] {
+  background: var(--theme--highlight_yellow) !important;
+  color: var(--theme--highlight_yellow-text) !important;
+}
+.notion-body:not(.dark)
+  [style*='background: rgb(253, 236, 200)'][style*='border-radius: 3px;'][style*='width: 18px; height: 18px;'],
+.notion-body.dark
+  [style*='background: rgb(137, 107, 42)'][style*='border-radius: 3px;'][style*='width: 18px; height: 18px;'] {
+  background: var(--theme--tag_yellow) !important;
+  color: var(--theme--tag_yellow-text) !important;
+}
+
+.notion-body:not(.dark)
+  .notion-board-group[style*='background-color: rgba(250, 247, 237, 0.7)'],
+.notion-body.dark .notion-board-group[style*='background-color: rgb(56, 55, 49)'],
+.notion-body:not(.dark)
+  .notion-board-view
+  > .notion-selectable
+  > :first-child
+  > :nth-child(2)
+  [style*='background-color: rgba(250, 247, 237, 0.7)'],
+.notion-body.dark
+  .notion-board-view
+  > .notion-selectable
+  > :first-child
+  > :nth-child(2)
+  [style*='background-color: rgb(56, 55, 49)'] {
+  background: var(--theme--board_yellow) !important;
+  color: var(--theme--board_yellow-text) !important;
+}
+.notion-body:not(.dark)
+  .notion-board-group[style*='background-color: rgba(250, 247, 237, 0.7)']
+  > [data-block-id]
+  > [rel='noopener noreferrer'],
+.notion-body.dark
+  .notion-board-group[style*='background-color: rgb(56, 55, 49)']
+  > [data-block-id]
+  > [rel='noopener noreferrer'] {
+  background: var(--theme--board_yellow-card) !important;
+  color: var(--theme--board_yellow-card_text) !important;
+}
+.notion-body.dark
+  .notion-board-group[style*='background-color: rgb(56, 55, 49)']
+  > [data-block-id]
+  > [rel='noopener noreferrer']
+  [placeholder='Untitled'] {
+  -webkit-text-fill-color: var(
+    --theme--board_yellow-card_text,
+    var(--theme--board_yellow-text)
+  ) !important;
+}
+.notion-body:not(.dark)
+  .notion-board-group[style*='background-color: rgba(250, 247, 237, 0.7)']
+  > [data-block-id]
+  > [rel='noopener noreferrer']
+  > .notion-focusable:hover {
+  background: rgba(255, 255, 255, 0.2) !important;
+}
+.notion-body.dark
+  .notion-board-group[style*='background-color: rgb(56, 55, 49)']
+  > [data-block-id]
+  > [rel='noopener noreferrer']
+  > .notion-focusable:hover {
+  background: rgba(0, 0, 0, 0.1) !important;
+}
+.notion-body:not(.dark) .notion-board-view [style*='color: rgb(203, 148, 51)'],
+.notion-body.dark .notion-board-view [style*='color: rgb(137, 107, 42)'],
+.notion-body:not(.dark) .notion-board-view [style*='fill: rgb(203, 148, 51)'],
+.notion-body.dark .notion-board-view [style*='fill: rgb(137, 107, 42)'] {
+  color: var(--theme--board_yellow-text) !important;
+  fill: var(--theme--board_yellow-text) !important;
+}
+
+/* green */
+
+.notion-body:not(.dark) [style*='color: rgb(68, 131, 97)'],
+.notion-body:not(.dark) [style*='color:rgba(68, 131, 97, 1)'],
+.notion-body.dark [style*='color: rgb(113, 178, 131)'],
+.notion-body.dark [style*='color:rgba(113, 178, 131, 1)'] {
+  color: var(--theme--text_green) !important;
+  fill: var(--theme--text_green) !important;
+}
+
+.notion-body:not(.dark)
+  [style*='background: rgba(237, 243, 236, 1)']:not([style*='border-radius']):not([style*='box-shadow']),
+.notion-body:not(.dark)
+  [style*='background:rgba(237, 243, 236, 1)']:not([style*='border-radius']):not([style*='box-shadow']),
+.notion-body:not(.dark)
+  [style*='background: rgb(237, 243, 236)']:not([style*='border-radius']):not([style*='box-shadow']),
+.notion-body:not(.dark)
+  [style*='background:rgb(237, 243, 236)']:not([style*='border-radius']):not([style*='box-shadow']),
+.notion-body:not(.dark)
+  [style*='background-color: rgba(237, 243, 236, 1)']:not([style*='border-radius']):not([style*='box-shadow']),
+.notion-body.dark
+  [style*='background: rgba(46, 68, 58, 1)']:not([style*='border-radius']):not([style*='box-shadow']),
+.notion-body.dark
+  [style*='background:rgba(46, 68, 58, 1)']:not([style*='border-radius']):not([style*='box-shadow']),
+.notion-body.dark
+  [style*='background: rgb(46, 68, 58)']:not([style*='border-radius']):not([style*='box-shadow']),
+.notion-body.dark
+  [style*='background:rgb(46, 68, 58)']:not([style*='border-radius']):not([style*='box-shadow']),
+.notion-body.dark
+  [style*='background-color: rgba(46, 68, 58, 1)']:not([style*='border-radius']):not([style*='box-shadow']) {
+  background: var(--theme--highlight_green) !important;
+  color: var(--theme--highlight_green-text) !important;
+}
+
+.notion-body:not(.dark)
+  .notion-callout-block
+  > div
+  > [style*='background: rgb(237, 243, 236)'],
+.notion-body.dark .notion-callout-block > div > [style*='background: rgb(46, 68, 58)'] {
+  background: var(--theme--callout_green) !important;
+  color: var(--theme--callout_green-text) !important;
+}
+.notion-body:not(.dark)
+  [style*='background: rgb(219, 237, 219)'][style*='align-items: center;'][style*='border-radius: 3px; padding-left: '][style*='line-height: 120%;'],
+.notion-body.dark
+  [style*='background: rgb(50, 82, 65)'][style*='align-items: center;'][style*='border-radius: 3px; padding-left: '][style*='line-height: 120%;'] {
+  background: var(--theme--tag_green) !important;
+  color: var(--theme--tag_green-text) !important;
+}
+
+.notion-body:not(.dark)
+  [style*='background: rgb(237, 243, 236)'][style*='align-items: center; justify-content: center; width: 22px; height: 22px;'][style*='border-radius: 3px; font-weight: 500;'],
+.notion-body.dark
+  [style*='background: rgb(46, 68, 58)'][style*='align-items: center; justify-content: center; width: 22px; height: 22px;'][style*='border-radius: 3px; font-weight: 500;'] {
+  background: var(--theme--highlight_green) !important;
+  color: var(--theme--highlight_green-text) !important;
+}
+.notion-body:not(.dark)
+  [style*='background: rgb(219, 237, 219)'][style*='border-radius: 3px;'][style*='width: 18px; height: 18px;'],
+.notion-body.dark
+  [style*='background: rgb(61, 124, 86)'][style*='border-radius: 3px;'][style*='width: 18px; height: 18px;'] {
+  background: var(--theme--tag_green) !important;
+  color: var(--theme--tag_green-text) !important;
+}
+
+.notion-body:not(.dark)
+  .notion-board-group[style*='background-color: rgba(244, 248, 243, 0.7)'],
+.notion-body.dark .notion-board-group[style*='background-color: rgb(49, 57, 53)'],
+.notion-body:not(.dark)
+  .notion-board-view
+  > .notion-selectable
+  > :first-child
+  > :nth-child(2)
+  [style*='background-color: rgba(244, 248, 243, 0.7)'],
+.notion-body.dark
+  .notion-board-view
+  > .notion-selectable
+  > :first-child
+  > :nth-child(2)
+  [style*='background-color: rgb(49, 57, 53)'] {
+  background: var(--theme--board_green) !important;
+  color: var(--theme--board_green-text) !important;
+}
+.notion-body:not(.dark)
+  .notion-board-group[style*='background-color: rgba(244, 248, 243, 0.7)']
+  > [data-block-id]
+  > [rel='noopener noreferrer'],
+.notion-body.dark
+  .notion-board-group[style*='background-color: rgb(49, 57, 53)']
+  > [data-block-id]
+  > [rel='noopener noreferrer'] {
+  background: var(--theme--board_green-card) !important;
+  color: var(--theme--board_green-card_text) !important;
+}
+.notion-body.dark
+  .notion-board-group[style*='background-color: rgb(49, 57, 53)']
+  > [data-block-id]
+  > [rel='noopener noreferrer']
+  [placeholder='Untitled'] {
+  -webkit-text-fill-color: var(
+    --theme--board_green-card_text,
+    var(--theme--board_green-text)
+  ) !important;
+}
+.notion-body:not(.dark)
+  .notion-board-group[style*='background-color: rgba(244, 248, 243, 0.7)']
+  > [data-block-id]
+  > [rel='noopener noreferrer']
+  > .notion-focusable:hover {
+  background: rgba(255, 255, 255, 0.2) !important;
+}
+.notion-body.dark
+  .notion-board-group[style*='background-color: rgb(49, 57, 53)']
+  > [data-block-id]
+  > [rel='noopener noreferrer']
+  > .notion-focusable:hover {
+  background: rgba(0, 0, 0, 0.1) !important;
+}
+.notion-body:not(.dark) .notion-board-view [style*='color: rgb(108, 155, 125)'],
+.notion-body.dark .notion-board-view [style*='color: rgb(61, 124, 86)'],
+.notion-body:not(.dark) .notion-board-view [style*='fill: rgb(108, 155, 125)'],
+.notion-body.dark .notion-board-view [style*='fill: rgb(61, 124, 86)'] {
+  color: var(--theme--board_green-text) !important;
+  fill: var(--theme--board_green-text) !important;
+}
+
+/* blue */
+
+.notion-body:not(.dark) [style*='color: rgb(51, 126, 169)'],
+.notion-body:not(.dark) [style*='color:rgba(51, 126, 169, 1)'],
+.notion-body.dark [style*='color: rgb(102, 170, 218)'],
+.notion-body.dark [style*='color:rgba(102, 170, 218, 1)'] {
+  color: var(--theme--text_blue) !important;
+  fill: var(--theme--text_blue) !important;
+}
+
+.notion-body:not(.dark)
+  [style*='background: rgba(231, 243, 248, 1)']:not([style*='border-radius']):not([style*='box-shadow']),
+.notion-body:not(.dark)
+  [style*='background:rgba(231, 243, 248, 1)']:not([style*='border-radius']):not([style*='box-shadow']),
+.notion-body:not(.dark)
+  [style*='background: rgb(231, 243, 248)']:not([style*='border-radius']):not([style*='box-shadow']),
+.notion-body:not(.dark)
+  [style*='background:rgb(231, 243, 248)']:not([style*='border-radius']):not([style*='box-shadow']),
+.notion-body:not(.dark)
+  [style*='background-color: rgba(231, 243, 248, 1)']:not([style*='border-radius']):not([style*='box-shadow']),
+.notion-body.dark
+  [style*='background: rgba(45, 66, 86, 1)']:not([style*='border-radius']):not([style*='box-shadow']),
+.notion-body.dark
+  [style*='background:rgba(45, 66, 86, 1)']:not([style*='border-radius']):not([style*='box-shadow']),
+.notion-body.dark
+  [style*='background: rgb(45, 66, 86)']:not([style*='border-radius']):not([style*='box-shadow']),
+.notion-body.dark
+  [style*='background:rgb(45, 66, 86)']:not([style*='border-radius']):not([style*='box-shadow']),
+.notion-body.dark
+  [style*='background-color: rgba(45, 66, 86, 1)']:not([style*='border-radius']):not([style*='box-shadow']) {
+  background: var(--theme--highlight_blue) !important;
+  color: var(--theme--highlight_blue-text) !important;
+}
+
+.notion-body:not(.dark)
+  .notion-callout-block
+  > div
+  > [style*='background: rgb(231, 243, 248)'],
+.notion-body.dark .notion-callout-block > div > [style*='background: rgb(45, 66, 86)'] {
+  background: var(--theme--callout_blue) !important;
+  color: var(--theme--callout_blue-text) !important;
+}
+.notion-body:not(.dark)
+  [style*='background: rgb(211, 229, 239)'][style*='align-items: center;'][style*='border-radius: 3px; padding-left: '][style*='line-height: 120%;'],
+.notion-body.dark
+  [style*='background: rgb(42, 78, 107)'][style*='align-items: center;'][style*='border-radius: 3px; padding-left: '][style*='line-height: 120%;'] {
+  background: var(--theme--tag_blue) !important;
+  color: var(--theme--tag_blue-text) !important;
+}
+
+.notion-body:not(.dark)
+  [style*='background: rgb(231, 243, 248)'][style*='align-items: center; justify-content: center; width: 22px; height: 22px;'][style*='border-radius: 3px; font-weight: 500;'],
+.notion-body.dark
+  [style*='background: rgb(45, 66, 86)'][style*='align-items: center; justify-content: center; width: 22px; height: 22px;'][style*='border-radius: 3px; font-weight: 500;'] {
+  background: var(--theme--highlight_blue) !important;
+  color: var(--theme--highlight_blue-text) !important;
+}
+.notion-body:not(.dark)
+  [style*='background: rgb(211, 229, 239)'][style*='border-radius: 3px;'][style*='width: 18px; height: 18px;'],
+.notion-body.dark
+  [style*='background: rgb(46, 117, 164)'][style*='border-radius: 3px;'][style*='width: 18px; height: 18px;'] {
+  background: var(--theme--tag_blue) !important;
+  color: var(--theme--tag_blue-text) !important;
+}
+
+.notion-body:not(.dark)
+  .notion-board-group[style*='background-color: rgba(241, 248, 251, 0.7)'],
+.notion-body.dark .notion-board-group[style*='background-color: rgb(49, 56, 64)'],
+.notion-body:not(.dark)
+  .notion-board-view
+  > .notion-selectable
+  > :first-child
+  > :nth-child(2)
+  [style*='background-color: rgba(241, 248, 251, 0.7)'],
+.notion-body.dark
+  .notion-board-view
+  > .notion-selectable
+  > :first-child
+  > :nth-child(2)
+  [style*='background-color: rgb(49, 56, 64)'] {
+  background: var(--theme--board_blue) !important;
+  color: var(--theme--board_blue-text) !important;
+}
+.notion-body:not(.dark)
+  .notion-board-group[style*='background-color: rgba(241, 248, 251, 0.7)']
+  > [data-block-id]
+  > [rel='noopener noreferrer'],
+.notion-body.dark
+  .notion-board-group[style*='background-color: rgb(49, 56, 64)']
+  > [data-block-id]
+  > [rel='noopener noreferrer'] {
+  background: var(--theme--board_blue-card) !important;
+  color: var(--theme--board_blue-card_text) !important;
+}
+.notion-body.dark
+  .notion-board-group[style*='background-color: rgb(49, 56, 64)']
+  > [data-block-id]
+  > [rel='noopener noreferrer']
+  [placeholder='Untitled'] {
+  -webkit-text-fill-color: var(
+    --theme--board_blue-card_text,
+    var(--theme--board_blue-text)
+  ) !important;
+}
+.notion-body:not(.dark)
+  .notion-board-group[style*='background-color: rgba(241, 248, 251, 0.7)']
+  > [data-block-id]
+  > [rel='noopener noreferrer']
+  > .notion-focusable:hover {
+  background: rgba(255, 255, 255, 0.2) !important;
+}
+.notion-body.dark
+  .notion-board-group[style*='background-color: rgb(49, 56, 64)']
+  > [data-block-id]
+  > [rel='noopener noreferrer']
+  > .notion-focusable:hover {
+  background: rgba(0, 0, 0, 0.1) !important;
+}
+.notion-body:not(.dark) .notion-board-view [style*='color: rgb(91, 151, 189)'],
+.notion-body.dark .notion-board-view [style*='color: rgb(46, 117, 164)'],
+.notion-body:not(.dark) .notion-board-view [style*='fill: rgb(91, 151, 189)'],
+.notion-body.dark .notion-board-view [style*='fill: rgb(46, 117, 164)'] {
+  color: var(--theme--board_blue-text) !important;
+  fill: var(--theme--board_blue-text) !important;
+}
+
+/* purple */
+
+.notion-body:not(.dark) [style*='color: rgb(144, 101, 176)'],
+.notion-body:not(.dark) [style*='color:rgba(144, 101, 176, 1)'],
+.notion-body.dark [style*='color: rgb(176, 152, 217)'],
+.notion-body.dark [style*='color:rgba(176, 152, 217, 1)'] {
+  color: var(--theme--text_purple) !important;
+  fill: var(--theme--text_purple) !important;
+}
+
+.notion-body:not(.dark)
+  [style*='background: rgba(244, 240, 247, 0.8)']:not([style*='border-radius']):not([style*='box-shadow']),
+.notion-body:not(.dark)
+  [style*='background:rgba(244, 240, 247, 0.8)']:not([style*='border-radius']):not([style*='box-shadow']),
+.notion-body:not(.dark)
+  [style*='background: rgba(244, 240, 247, 0.8)']:not([style*='border-radius']):not([style*='box-shadow']),
+.notion-body:not(.dark)
+  [style*='background:rgba(244, 240, 247, 0.8)']:not([style*='border-radius']):not([style*='box-shadow']),
+.notion-body:not(.dark)
+  [style*='background-color: rgba(244, 240, 247, 0.8)']:not([style*='border-radius']):not([style*='box-shadow']),
+.notion-body.dark
+  [style*='background: rgba(69, 58, 91, 1)']:not([style*='border-radius']):not([style*='box-shadow']),
+.notion-body.dark
+  [style*='background:rgba(69, 58, 91, 1)']:not([style*='border-radius']):not([style*='box-shadow']),
+.notion-body.dark
+  [style*='background: rgb(69, 58, 91)']:not([style*='border-radius']):not([style*='box-shadow']),
+.notion-body.dark
+  [style*='background:rgb(69, 58, 91)']:not([style*='border-radius']):not([style*='box-shadow']),
+.notion-body.dark
+  [style*='background-color: rgba(69, 58, 91, 1)']:not([style*='border-radius']):not([style*='box-shadow']) {
+  background: var(--theme--highlight_purple) !important;
+  color: var(--theme--highlight_purple-text) !important;
+}
+
+.notion-body:not(.dark)
+  .notion-callout-block
+  > div
+  > [style*='background: rgba(244, 240, 247, 0.8)'],
+.notion-body.dark .notion-callout-block > div > [style*='background: rgb(69, 58, 91)'] {
+  background: var(--theme--callout_purple) !important;
+  color: var(--theme--callout_purple-text) !important;
+}
+.notion-body:not(.dark)
+  [style*='background: rgb(232, 222, 238)'][style*='align-items: center;'][style*='border-radius: 3px; padding-left: '][style*='line-height: 120%;'],
+.notion-body.dark
+  [style*='background: rgb(83, 68, 116)'][style*='align-items: center;'][style*='border-radius: 3px; padding-left: '][style*='line-height: 120%;'] {
+  background: var(--theme--tag_purple) !important;
+  color: var(--theme--tag_purple-text) !important;
+}
+
+.notion-body:not(.dark)
+  [style*='background: rgba(244, 240, 247, 0.8)'][style*='align-items: center; justify-content: center; width: 22px; height: 22px;'][style*='border-radius: 3px; font-weight: 500;'],
+.notion-body.dark
+  [style*='background: rgb(69, 58, 91)'][style*='align-items: center; justify-content: center; width: 22px; height: 22px;'][style*='border-radius: 3px; font-weight: 500;'] {
+  background: var(--theme--highlight_purple) !important;
+  color: var(--theme--highlight_purple-text) !important;
+}
+.notion-body:not(.dark)
+  [style*='background: rgb(232, 222, 238)'][style*='border-radius: 3px;'][style*='width: 18px; height: 18px;'],
+.notion-body.dark
+  [style*='background: rgb(123, 96, 180)'][style*='border-radius: 3px;'][style*='width: 18px; height: 18px;'] {
+  background: var(--theme--tag_purple) !important;
+  color: var(--theme--tag_purple-text) !important;
+}
+
+.notion-body:not(.dark)
+  .notion-board-group[style*='background-color: rgba(249, 246, 252, 0.7)'],
+.notion-body.dark .notion-board-group[style*='background-color: rgb(57, 53, 65)'],
+.notion-body:not(.dark)
+  .notion-board-view
+  > .notion-selectable
+  > :first-child
+  > :nth-child(2)
+  [style*='background-color: rgba(249, 246, 252, 0.7)'],
+.notion-body.dark
+  .notion-board-view
+  > .notion-selectable
+  > :first-child
+  > :nth-child(2)
+  [style*='background-color: rgb(57, 53, 65)'] {
+  background: var(--theme--board_purple) !important;
+  color: var(--theme--board_purple-text) !important;
+}
+.notion-body:not(.dark)
+  .notion-board-group[style*='background-color: rgba(249, 246, 252, 0.7)']
+  > [data-block-id]
+  > [rel='noopener noreferrer'],
+.notion-body.dark
+  .notion-board-group[style*='background-color: rgb(57, 53, 65)']
+  > [data-block-id]
+  > [rel='noopener noreferrer'] {
+  background: var(--theme--board_purple-card) !important;
+  color: var(--theme--board_purple-card_text) !important;
+}
+.notion-body.dark
+  .notion-board-group[style*='background-color: rgb(57, 53, 65)']
+  > [data-block-id]
+  > [rel='noopener noreferrer']
+  [placeholder='Untitled'] {
+  -webkit-text-fill-color: var(
+    --theme--board_purple-card_text,
+    var(--theme--board_purple-text)
+  ) !important;
+}
+.notion-body:not(.dark)
+  .notion-board-group[style*='background-color: rgba(249, 246, 252, 0.7)']
+  > [data-block-id]
+  > [rel='noopener noreferrer']
+  > .notion-focusable:hover {
+  background: rgba(255, 255, 255, 0.2) !important;
+}
+.notion-body.dark
+  .notion-board-group[style*='background-color: rgb(57, 53, 65)']
+  > [data-block-id]
+  > [rel='noopener noreferrer']
+  > .notion-focusable:hover {
+  background: rgba(0, 0, 0, 0.1) !important;
+}
+.notion-body:not(.dark) .notion-board-view [style*='color: rgb(167, 130, 195)'],
+.notion-body.dark .notion-board-view [style*='color: rgb(123, 96, 180)'],
+.notion-body:not(.dark) .notion-board-view [style*='fill: rgb(167, 130, 195)'],
+.notion-body.dark .notion-board-view [style*='fill: rgb(123, 96, 180)'] {
+  color: var(--theme--board_purple-text) !important;
+  fill: var(--theme--board_purple-text) !important;
+}
+
+/* pink */
+
+.notion-body:not(.dark) [style*='color: rgb(193, 76, 138)'],
+.notion-body:not(.dark) [style*='color:rgba(193, 76, 138, 1)'],
+.notion-body.dark [style*='color: rgb(223, 132, 209)'],
+.notion-body.dark [style*='color:rgba(223, 132, 209, 1)'] {
+  color: var(--theme--text_pink) !important;
+  fill: var(--theme--text_pink) !important;
+}
+
+.notion-body:not(.dark)
+  [style*='background: rgba(249, 238, 243, 0.8)']:not([style*='border-radius']):not([style*='box-shadow']),
+.notion-body:not(.dark)
+  [style*='background:rgba(249, 238, 243, 0.8)']:not([style*='border-radius']):not([style*='box-shadow']),
+.notion-body:not(.dark)
+  [style*='background: rgba(249, 238, 243, 0.8)']:not([style*='border-radius']):not([style*='box-shadow']),
+.notion-body:not(.dark)
+  [style*='background:rgba(249, 238, 243, 0.8)']:not([style*='border-radius']):not([style*='box-shadow']),
+.notion-body:not(.dark)
+  [style*='background-color: rgba(249, 238, 243, 0.8)']:not([style*='border-radius']):not([style*='box-shadow']),
+.notion-body.dark
+  [style*='background: rgba(81, 56, 77, 1)']:not([style*='border-radius']):not([style*='box-shadow']),
+.notion-body.dark
+  [style*='background:rgba(81, 56, 77, 1)']:not([style*='border-radius']):not([style*='box-shadow']),
+.notion-body.dark
+  [style*='background: rgb(81, 56, 77)']:not([style*='border-radius']):not([style*='box-shadow']),
+.notion-body.dark
+  [style*='background:rgb(81, 56, 77)']:not([style*='border-radius']):not([style*='box-shadow']),
+.notion-body.dark
+  [style*='background-color: rgba(81, 56, 77, 1)']:not([style*='border-radius']):not([style*='box-shadow']) {
+  background: var(--theme--highlight_pink) !important;
+  color: var(--theme--highlight_pink-text) !important;
+}
+
+.notion-body:not(.dark)
+  .notion-callout-block
+  > div
+  > [style*='background: rgba(249, 238, 243, 0.8)'],
+.notion-body.dark .notion-callout-block > div > [style*='background: rgb(81, 56, 77)'] {
+  background: var(--theme--callout_pink) !important;
+  color: var(--theme--callout_pink-text) !important;
+}
+.notion-body:not(.dark)
+  [style*='background: rgb(245, 224, 233)'][style*='align-items: center;'][style*='border-radius: 3px; padding-left: '][style*='line-height: 120%;'],
+.notion-body.dark
+  [style*='background: rgb(106, 59, 99)'][style*='align-items: center;'][style*='border-radius: 3px; padding-left: '][style*='line-height: 120%;'] {
+  background: var(--theme--tag_pink) !important;
+  color: var(--theme--tag_pink-text) !important;
+}
+
+.notion-body:not(.dark)
+  [style*='background: rgba(249, 238, 243, 0.8)'][style*='align-items: center; justify-content: center; width: 22px; height: 22px;'][style*='border-radius: 3px; font-weight: 500;'],
+.notion-body.dark
+  [style*='background: rgb(81, 56, 77)'][style*='align-items: center; justify-content: center; width: 22px; height: 22px;'][style*='border-radius: 3px; font-weight: 500;'] {
+  background: var(--theme--highlight_pink) !important;
+  color: var(--theme--highlight_pink-text) !important;
+}
+.notion-body:not(.dark)
+  [style*='background: rgb(245, 224, 233)'][style*='border-radius: 3px;'][style*='width: 18px; height: 18px;'],
+.notion-body.dark
+  [style*='background: rgb(169, 76, 157)'][style*='border-radius: 3px;'][style*='width: 18px; height: 18px;'] {
+  background: var(--theme--tag_pink) !important;
+  color: var(--theme--tag_pink-text) !important;
+}
+
+.notion-body:not(.dark)
+  .notion-board-group[style*='background-color: rgba(251, 245, 251, 0.7)'],
+.notion-body.dark .notion-board-group[style*='background-color: rgb(60, 53, 58)'],
+.notion-body:not(.dark)
+  .notion-board-view
+  > .notion-selectable
+  > :first-child
+  > :nth-child(2)
+  [style*='background-color: rgba(251, 245, 251, 0.7)'],
+.notion-body.dark
+  .notion-board-view
+  > .notion-selectable
+  > :first-child
+  > :nth-child(2)
+  [style*='background-color: rgb(60, 53, 58)'] {
+  background: var(--theme--board_pink) !important;
+  color: var(--theme--board_pink-text) !important;
+}
+.notion-body:not(.dark)
+  .notion-board-group[style*='background-color: rgba(251, 245, 251, 0.7)']
+  > [data-block-id]
+  > [rel='noopener noreferrer'],
+.notion-body.dark
+  .notion-board-group[style*='background-color: rgb(60, 53, 58)']
+  > [data-block-id]
+  > [rel='noopener noreferrer'] {
+  background: var(--theme--board_pink-card) !important;
+  color: var(--theme--board_pink-card_text) !important;
+}
+.notion-body.dark
+  .notion-board-group[style*='background-color: rgb(60, 53, 58)']
+  > [data-block-id]
+  > [rel='noopener noreferrer']
+  [placeholder='Untitled'] {
+  -webkit-text-fill-color: var(
+    --theme--board_pink-card_text,
+    var(--theme--board_pink-text)
+  ) !important;
+}
+.notion-body:not(.dark)
+  .notion-board-group[style*='background-color: rgba(251, 245, 251, 0.7)']
+  > [data-block-id]
+  > [rel='noopener noreferrer']
+  > .notion-focusable:hover {
+  background: rgba(255, 255, 255, 0.2) !important;
+}
+.notion-body.dark
+  .notion-board-group[style*='background-color: rgb(60, 53, 58)']
+  > [data-block-id]
+  > [rel='noopener noreferrer']
+  > .notion-focusable:hover {
+  background: rgba(0, 0, 0, 0.1) !important;
+}
+.notion-body:not(.dark) .notion-board-view [style*='color: rgb(205, 116, 159)'],
+.notion-body.dark .notion-board-view [style*='color: rgb(169, 76, 157)'],
+.notion-body:not(.dark) .notion-board-view [style*='fill: rgb(205, 116, 159)'],
+.notion-body.dark .notion-board-view [style*='fill: rgb(169, 76, 157)'] {
+  color: var(--theme--board_pink-text) !important;
+  fill: var(--theme--board_pink-text) !important;
+}
+
+/* red */
+
+.notion-body:not(.dark) [style*='color: rgb(212, 76, 71)'],
+.notion-body:not(.dark) [style*='color:rgba(212, 76, 71, 1)'],
+.notion-body.dark [style*='color: rgb(234, 135, 140)'],
+.notion-body.dark [style*='color:rgba(234, 135, 140, 1)'] {
+  color: var(--theme--text_red) !important;
+  fill: var(--theme--text_red) !important;
+}
+
+.notion-body:not(.dark)
+  [style*='background: rgba(253, 235, 236, 1)']:not([style*='border-radius']):not([style*='box-shadow']),
+.notion-body:not(.dark)
+  [style*='background:rgba(253, 235, 236, 1)']:not([style*='border-radius']):not([style*='box-shadow']),
+.notion-body:not(.dark)
+  [style*='background: rgb(253, 235, 236)']:not([style*='border-radius']):not([style*='box-shadow']),
+.notion-body:not(.dark)
+  [style*='background:rgb(253, 235, 236)']:not([style*='border-radius']):not([style*='box-shadow']),
+.notion-body:not(.dark)
+  [style*='background-color: rgba(253, 235, 236, 1)']:not([style*='border-radius']):not([style*='box-shadow']),
+.notion-body.dark
+  [style*='background: rgba(94, 52, 54, 1)']:not([style*='border-radius']):not([style*='box-shadow']),
+.notion-body.dark
+  [style*='background:rgba(94, 52, 54, 1)']:not([style*='border-radius']):not([style*='box-shadow']),
+.notion-body.dark
+  [style*='background: rgb(94, 52, 54)']:not([style*='border-radius']):not([style*='box-shadow']),
+.notion-body.dark
+  [style*='background:rgb(94, 52, 54)']:not([style*='border-radius']):not([style*='box-shadow']),
+.notion-body.dark
+  [style*='background-color: rgba(94, 52, 54, 1)']:not([style*='border-radius']):not([style*='box-shadow']) {
+  background: var(--theme--highlight_red) !important;
+  color: var(--theme--highlight_red-text) !important;
+}
+
+.notion-body:not(.dark)
+  .notion-callout-block
+  > div
+  > [style*='background: rgb(253, 235, 236)'],
+.notion-body.dark .notion-callout-block > div > [style*='background: rgb(94, 52, 54)'] {
+  background: var(--theme--callout_red) !important;
+  color: var(--theme--callout_red-text) !important;
+}
+.notion-body:not(.dark)
+  [style*='background: rgb(255, 226, 221)'][style*='align-items: center;'][style*='border-radius: 3px; padding-left: '][style*='line-height: 120%;'],
+.notion-body.dark
+  [style*='background: rgb(122, 54, 59)'][style*='align-items: center;'][style*='border-radius: 3px; padding-left: '][style*='line-height: 120%;'] {
+  background: var(--theme--tag_red) !important;
+  color: var(--theme--tag_red-text) !important;
+}
+
+.notion-body:not(.dark)
+  [style*='background: rgb(253, 235, 236)'][style*='align-items: center; justify-content: center; width: 22px; height: 22px;'][style*='border-radius: 3px; font-weight: 500;'],
+.notion-body.dark
+  [style*='background: rgb(94, 52, 54)'][style*='align-items: center; justify-content: center; width: 22px; height: 22px;'][style*='border-radius: 3px; font-weight: 500;'] {
+  background: var(--theme--highlight_red) !important;
+  color: var(--theme--highlight_red-text) !important;
+}
+.notion-body:not(.dark)
+  [style*='background: rgb(255, 226, 221)'][style*='border-radius: 3px;'][style*='width: 18px; height: 18px;'],
+.notion-body.dark
+  [style*='background: rgb(194, 65, 82)'][style*='border-radius: 3px;'][style*='width: 18px; height: 18px;'] {
+  background: var(--theme--tag_red) !important;
+  color: var(--theme--tag_red-text) !important;
+}
+
+.notion-body:not(.dark)
+  .notion-board-group[style*='background-color: rgba(253, 245, 243, 0.7)'],
+.notion-body.dark .notion-board-group[style*='background-color: rgb(66, 51, 51)'],
+.notion-body:not(.dark)
+  .notion-board-view
+  > .notion-selectable
+  > :first-child
+  > :nth-child(2)
+  [style*='background-color: rgba(253, 245, 243, 0.7)'],
+.notion-body.dark
+  .notion-board-view
+  > .notion-selectable
+  > :first-child
+  > :nth-child(2)
+  [style*='background-color: rgb(66, 51, 51)'] {
+  background: var(--theme--board_red) !important;
+  color: var(--theme--board_red-text) !important;
+}
+.notion-body:not(.dark)
+  .notion-board-group[style*='background-color: rgba(253, 245, 243, 0.7)']
+  > [data-block-id]
+  > [rel='noopener noreferrer'],
+.notion-body.dark
+  .notion-board-group[style*='background-color: rgb(66, 51, 51)']
+  > [data-block-id]
+  > [rel='noopener noreferrer'] {
+  background: var(--theme--board_red-card) !important;
+  color: var(--theme--board_red-card_text) !important;
+}
+.notion-body.dark
+  .notion-board-group[style*='background-color: rgb(66, 51, 51)']
+  > [data-block-id]
+  > [rel='noopener noreferrer']
+  [placeholder='Untitled'] {
+  -webkit-text-fill-color: var(
+    --theme--board_red-card_text,
+    var(--theme--board_red-text)
+  ) !important;
+}
+.notion-body:not(.dark)
+  .notion-board-group[style*='background-color: rgba(253, 245, 243, 0.7)']
+  > [data-block-id]
+  > [rel='noopener noreferrer']
+  > .notion-focusable:hover {
+  background: rgba(255, 255, 255, 0.2) !important;
+}
+.notion-body.dark
+  .notion-board-group[style*='background-color: rgb(66, 51, 51)']
+  > [data-block-id]
+  > [rel='noopener noreferrer']
+  > .notion-focusable:hover {
+  background: rgba(0, 0, 0, 0.1) !important;
+}
+.notion-body:not(.dark) .notion-board-view [style*='color: rgb(225, 111, 100)'],
+.notion-body.dark .notion-board-view [style*='color: rgb(194, 65, 82)'],
+.notion-body:not(.dark) .notion-board-view [style*='fill: rgb(225, 111, 100)'],
+.notion-body.dark .notion-board-view [style*='fill: rgb(194, 65, 82)'] {
+  color: var(--theme--board_red-text) !important;
+  fill: var(--theme--board_red-text) !important;
+}
diff --git a/src/mods/theming/electronSearch.css b/src/mods/theming/electronSearch.css
new file mode 100644
index 0000000..c1dcf0b
--- /dev/null
+++ b/src/mods/theming/electronSearch.css
@@ -0,0 +1,61 @@
+/**
+ * notion-enhancer: theming
+ * (c) 2021 dragonwocky <thedragonring.bod@gmail.com> (https://dragonwocky.me/)
+ * (https://notion-enhancer.github.io/) under the MIT license
+ */
+
+#container {
+  background: var(--theme--bg) !important;
+  box-shadow: var(--theme--ui_shadow, rgba(15, 15, 15, 0.05)) 0px 0px 0px 1px,
+    var(--theme--ui_shadow, rgba(15, 15, 15, 0.1)) 0px 3px 6px,
+    var(--theme--ui_shadow, rgba(15, 15, 15, 0.2)) 0px 9px 24px !important;
+}
+
+#container #results {
+  color: var(--theme--text) !important;
+}
+
+#container #prev,
+#container #next {
+  border-color: var(--theme--ui_divider) !important;
+}
+#container .enabled:focus,
+#container .enabled:hover {
+  background: var(--theme--ui_interactive-hover) !important;
+}
+#container .enabled:active {
+  background: var(--theme--ui_interactive-active) !important;
+}
+#container #prev svg,
+#container #next svg {
+  fill: var(--theme--icon_secondary) !important;
+}
+#container #button-separator {
+  background: var(--theme--ui_divider) !important;
+}
+
+#container #search-icon svg,
+#container #clear-icon svg {
+  fill: var(--theme--icon) !important;
+}
+#container #input-wrap #search {
+  background: var(--theme--ui_input) !important;
+  color: var(--theme--text) !important;
+}
+
+#container #done {
+  background: var(--theme--accent_blue) !important;
+  color: var(--theme--accent_blue-text) !important;
+}
+#container #done:focus,
+#container #done:hover {
+  background: var(--theme--accent_blue-hover) !important;
+}
+#container #done:active {
+  background: var(--theme--accent_blue-active) !important;
+}
+
+#container .enabled::after,
+#container #done::after {
+  background: transparent !important;
+}
diff --git a/src/mods/theming/frame.mjs b/src/mods/theming/frame.mjs
new file mode 100644
index 0000000..a02d873
--- /dev/null
+++ b/src/mods/theming/frame.mjs
@@ -0,0 +1,19 @@
+/**
+ * notion-enhancer: theming
+ * (c) 2021 dragonwocky <thedragonring.bod@gmail.com> (https://dragonwocky.me/)
+ * (https://notion-enhancer.github.io/) under the MIT license
+ */
+
+'use strict';
+
+export default async function ({ web, storage, electron }, db) {
+  await web.whenReady();
+
+  const updateTheme = async () => {
+    const mode = await storage.get(['theme'], 'light');
+    document.documentElement.classList.add(mode);
+    document.documentElement.classList.remove(mode === 'light' ? 'dark' : 'light');
+  };
+  electron.onMessage('update-theme', updateTheme);
+  updateTheme();
+}
diff --git a/src/mods/theming/main.cjs b/src/mods/theming/main.cjs
new file mode 100644
index 0000000..750623f
--- /dev/null
+++ b/src/mods/theming/main.cjs
@@ -0,0 +1,21 @@
+/**
+ * notion-enhancer: theming
+ * (c) 2021 dragonwocky <thedragonring.bod@gmail.com> (https://dragonwocky.me/)
+ * (https://notion-enhancer.github.io/) under the MIT license
+ */
+
+'use strict';
+
+module.exports = async function ({}, db, __exports, __eval) {
+  const electron = require('electron');
+  electron.ipcMain.on('notion-enhancer:update-theme', () => {
+    electron.webContents
+      .getAllWebContents()
+      .forEach((webContents) => webContents.send('notion-enhancer:update-theme'));
+  });
+  electron.ipcMain.on('notion-enhancer:set-search-theme', (event, theme) => {
+    electron.webContents
+      .getAllWebContents()
+      .forEach((webContents) => webContents.send('notion-enhancer:set-search-theme', theme));
+  });
+};
diff --git a/src/mods/theming/menu.mjs b/src/mods/theming/menu.mjs
new file mode 100644
index 0000000..7e65808
--- /dev/null
+++ b/src/mods/theming/menu.mjs
@@ -0,0 +1,26 @@
+/**
+ * notion-enhancer: theming
+ * (c) 2021 dragonwocky <thedragonring.bod@gmail.com> (https://dragonwocky.me/)
+ * (https://notion-enhancer.github.io/) under the MIT license
+ */
+
+'use strict';
+
+export default async function ({ web, registry, storage, electron }, db) {
+  await web.whenReady();
+
+  const updateTheme = async () => {
+    const mode = await storage.get(['theme'], 'light');
+    document.documentElement.classList.add(mode);
+    document.documentElement.classList.remove(mode === 'light' ? 'dark' : 'light');
+  };
+  document.addEventListener('visibilitychange', updateTheme);
+  electron.onMessage('update-theme', updateTheme);
+  updateTheme();
+
+  for (const mod of await registry.list((mod) => registry.enabled(mod.id))) {
+    for (const sheet of mod.css?.menu || []) {
+      web.loadStylesheet(`repo/${mod._dir}/${sheet}`);
+    }
+  }
+}
diff --git a/src/mods/theming/mod.json b/src/mods/theming/mod.json
new file mode 100644
index 0000000..dca8b51
--- /dev/null
+++ b/src/mods/theming/mod.json
@@ -0,0 +1,38 @@
+{
+  "name": "theming",
+  "id": "0f0bf8b6-eae6-4273-b307-8fc43f2ee082",
+  "version": "0.11.0",
+  "description": "the default theme variables, required by other themes & extensions.",
+  "tags": ["core"],
+  "authors": [
+    {
+      "name": "dragonwocky",
+      "email": "thedragonring.bod@gmail.com",
+      "homepage": "https://dragonwocky.me/",
+      "avatar": "https://dragonwocky.me/avatar.jpg"
+    }
+  ],
+  "css": {
+    "frame": ["variables.css"],
+    "client": ["variables.css", "prism.css", "patches.css"],
+    "menu": ["variables.css"]
+  },
+  "js": {
+    "frame": ["frame.mjs"],
+    "client": ["client.mjs"],
+    "menu": ["menu.mjs"],
+    "electron": [
+      { "source": "main.cjs", "target": "main/main.js" },
+      { "source": "rendererSearch.cjs", "target": "renderer/search.js" }
+    ]
+  },
+  "options": [
+    {
+      "type": "toggle",
+      "key": "force_load",
+      "label": "force load overrides",
+      "tooltip": "**override notion's colours even if no themes are enabled**",
+      "value": false
+    }
+  ]
+}
diff --git a/src/mods/theming/patches.css b/src/mods/theming/patches.css
new file mode 100644
index 0000000..7f307d8
--- /dev/null
+++ b/src/mods/theming/patches.css
@@ -0,0 +1,253 @@
+/**
+ * notion-enhancer: theming
+ * (c) 2021 dragonwocky <thedragonring.bod@gmail.com> (https://dragonwocky.me/)
+ * (https://notion-enhancer.github.io/) under the MIT license
+ */
+
+/** layout **/
+
+.notion-frame
+  > .notion-scroller.vertical.horizontal
+  > .pseudoSelection
+  > div
+  > div:nth-child(3)[style*='width: 900px'],
+.notion-frame
+  > .notion-scroller.vertical.horizontal
+  > .pseudoSelection
+  + div
+  > :nth-child(1)[style*='width: 900px'],
+.notion-frame
+  > .notion-scroller.vertical.horizontal
+  > :nth-child(2)
+  > :nth-child(2)[style*='display: flex; width: 100%; justify-content: center;']
+  > :nth-child(1)[style*='width: 900px'] {
+  width: var(--theme--page-width) !important;
+}
+.notion-frame
+  > .notion-scroller.vertical.horizontal
+  > .pseudoSelection
+  > div
+  > div:nth-child(3):not([style*='width: 900px']),
+.notion-frame
+  > .notion-scroller.vertical.horizontal
+  > .pseudoSelection
+  + div
+  > :nth-child(1):not([style*='width: 900px']),
+.notion-frame
+  > .notion-scroller.vertical.horizontal
+  > :nth-child(2)
+  > :nth-child(2)[style*='display: flex; width: 100%; justify-content: center;']
+  > :nth-child(1):not([style*='width: 900px']) {
+  width: var(--theme--page-width_full) !important;
+}
+.notion-page-content [style*='width: 100%; max-width:'][style*='align-self: center;'] {
+  max-width: 100% !important;
+}
+.notion-frame [style*='padding-right: calc(96px + env(safe-area-inset-right));'] {
+  padding-right: var(--theme--page-padding) !important;
+}
+.notion-frame [style*='padding-left: calc(96px + env(safe-area-inset-left));'] {
+  padding-left: var(--theme--page-padding) !important;
+}
+[style^='position: relative; width: 100%; display: flex; flex-direction: column; align-items: center; height: 30vh;'],
+[style^='position: relative; width: 100%; display: flex; flex-direction: column; align-items: center; height: 30vh;']
+  img {
+  height: var(--theme--page_banner-height) !important;
+  background: transparent !important;
+}
+
+.notion-peek-renderer > :nth-child(2) {
+  max-width: var(--theme--page_preview-width) !important;
+}
+.notion-peek-renderer
+  .notion-scroller.vertical
+  [style*='padding-left: calc(126px + env(safe-area-inset-left));'] {
+  padding-left: var(--theme--page_preview-padding) !important;
+}
+.notion-peek-renderer
+  .notion-scroller.vertical
+  [style*='padding-right: calc(126px + env(safe-area-inset-right));'] {
+  padding-right: var(--theme--page_preview-padding) !important;
+}
+.notion-peek-renderer
+  .notion-scroller.vertical
+  [style*='margin-left: calc(126px + env(safe-area-inset-left));'] {
+  margin-left: var(--theme--page_preview-padding) !important;
+}
+.notion-peek-renderer
+  .notion-scroller.vertical
+  [style*='margin-right: calc(126px + env(safe-area-inset-right));'] {
+  margin-right: var(--theme--page_preview-padding) !important;
+}
+.notion-peek-renderer .notion-page-content {
+  padding-left: var(--theme--page_preview-padding) !important;
+  padding-right: var(--theme--page_preview-padding) !important;
+  width: 100%;
+}
+.notion-peek-renderer
+  .notion-scroller.vertical
+  [style*='position: relative; width: 100%; display: flex; flex-direction: column; align-items: center; height: 20vh;'],
+.notion-peek-renderer
+  .notion-scroller.vertical
+  [style*='position: relative; width: 100%; display: flex; flex-direction: column; align-items: center; height: 20vh;']
+  img {
+  height: var(--theme--page_preview_banner-height) !important;
+  background: transparent !important;
+}
+
+.notion-topbar-action-buttons {
+  width: auto !important;
+}
+.notion-cursor-listener > [style*='z-index: 102'] {
+  z-index: 99 !important;
+}
+
+/* typography */
+
+[style*='Segoe UI'] {
+  font-family: var(--theme--font_sans) !important;
+}
+[style*='Georgia'] {
+  font-family: var(--theme--font_serif) !important;
+}
+[style*='iawriter-mono'] {
+  font-family: var(--theme--font_mono) !important;
+}
+[style*='SFMono-Regular'] {
+  font-family: var(--theme--font_code) !important;
+}
+
+/** remove white pixels in iframe corners **/
+
+.notion-page-content iframe {
+  border-radius: 0px !important;
+}
+
+/** scrollbars **/
+
+::-webkit-scrollbar-track,
+::-webkit-scrollbar-corner {
+  background: var(--theme--scrollbar_track) !important;
+}
+::-webkit-scrollbar-thumb {
+  background: var(--theme--scrollbar_thumb) !important;
+}
+::-webkit-scrollbar-thumb:hover {
+  background: var(--theme--scrollbar_thumb-hover) !important;
+}
+
+/** consistent corner button styling **/
+
+.notion-overlay-container
+  [style*='border-radius: 3px;'][style*='position: relative; max-width: calc(100vw - 24px); box-shadow: rgba(0, 0, 0, 0.3) 0px 1px 4px; overflow: hidden;'][style*='padding: 4px 8px; font-size: 12px; line-height: 1.4; font-weight: 500;'] {
+  background: var(--theme--ui_tooltip) !important;
+  box-shadow: var(--theme--ui_shadow) 0px 1px 4px !important;
+  color: var(--theme--ui_tooltip-title) !important;
+}
+.notion-overlay-container
+  [style*='border-radius: 3px;'][style*='position: relative; max-width: calc(100vw - 24px); box-shadow: rgba(0, 0, 0, 0.3) 0px 1px 4px; overflow: hidden;'][style*='padding: 4px 8px; font-size: 12px; line-height: 1.4; font-weight: 500;']
+  [style*='color: '] {
+  color: var(--theme--ui_tooltip-description) !important;
+}
+.onboarding-checklist-button > .graduationCap + .notion-focusable {
+  background: var(--theme--ui_tooltip) !important;
+}
+.onboarding-checklist-button .closeSmall {
+  fill: var(--theme--ui_tooltip-title) !important;
+}
+.graduationCap {
+  fill: var(--theme--icon) !important;
+}
+.notion-help-button,
+.onboarding-checklist-button {
+  opacity: 1 !important;
+  color: var(--theme--icon);
+  fill: var(--theme--icon);
+  background: var(--theme--ui_corner_action) !important;
+  box-shadow: var(--theme--ui_shadow, rgba(15, 15, 15, 0.15)) 0px 0px 0px 1px,
+    var(--theme--ui_shadow, rgba(15, 15, 15, 0.15)) 0px 2px 4px !important;
+  cursor: pointer;
+}
+.notion-help-button:hover,
+.onboarding-checklist-button:hover {
+  background: var(--theme--ui_corner_action-hover) !important;
+}
+.notion-help-button:active,
+.onboarding-checklist-button:active {
+  background: var(--theme--ui_corner_action-active) !important;
+}
+
+/* backgrounds */
+
+[style*='height: calc(100% + 17px); background:'][style*='width: 20px; margin-left: -20px; margin-top: -17px;'],
+.notion-board-view .notion-focusable[role='button'][style*='height: 33px; width: 35px'],
+.notion-board-view
+  > :first-child
+  > :first-child
+  > :last-child[style*='background'][style*='margin-left: 20px'],
+.notion-discussion-input > div > div[style*='background'],
+.notion-body.dark
+  .notion-default-overlay-container
+  [style*='grid-template-columns: [boolean-start] 60px [boolean-end property-start] 120px [property-end opererator-start] 110px [operator-end value-start] auto [value-end menu-start] 32px [menu-end];']
+  [style*='grid-column: property-start / value-end; background: rgba(255, 255, 255, 0.02);'],
+.notion-body:not(.dark)
+  .notion-default-overlay-container
+  [style*='grid-template-columns: [boolean-start] 60px [boolean-end property-start] 120px [property-end opererator-start] 110px [operator-end value-start] auto [value-end menu-start] 32px [menu-end];']
+  [style*='grid-column: property-start / value-end; background: rgba(0, 0, 0, 0.02);'],
+.notion-board-view [style*='width: 20px; margin-left: -20px; margin-top: -8px;'],
+.notion-page-block > div > div > div[style*='background-color: white;'],
+.line-numbers.notion-code-block + div .notion-focusable:not(:hover),
+.notion-overlay-container
+  [style*='position: relative; max-width: calc(100vw - 24px); box-shadow:']
+  > [style*='display: flex; align-items: center; padding: 8px 10px; width: 100%; background:'],
+.notion-default-overlay-container
+  > div:nth-child(3)
+  > div
+  > div:nth-child(2)
+  > div:nth-child(2)
+  > div
+  > div
+  > div
+  > div
+  > div
+  > div:nth-child(2)[style*='position: absolute; display: inline-flex; min-width: 100%; height: 32px; z-index: 1; background:'],
+.notion-default-overlay-container
+  > div:nth-child(2)
+  > div
+  > div:nth-child(2)
+  > div:nth-child(2)
+  > div
+  > div
+  > div
+  > div
+  > div
+  > div:nth-child(2)[style*='position: absolute; display: inline-flex; min-width: 100%; height: 32px; z-index: 1; background:'],
+.notion-frame .notion-scroller[style*='background:'],
+.notion-page-template-modal .notion-scroller[style*='background:'],
+.notion-peek-renderer .notion-scroller[style*='background:'],
+.notion-frame > div > div > div[style*='max-width: 100%'][style*='background-color'],
+.notion-peek-renderer
+  > div
+  > .notion-scroller
+  > div
+  > div[style*='max-width: 100%'][style*='background-color'],
+.notion-page-template-modal
+  > div
+  > .notion-scroller
+  > div
+  > div[style*='max-width: 100%'][style*='background-color'],
+.notion-selectable.notion-collection_view-block
+  .notion-board-view
+  > .notion-selectable.notion-collection_view-block
+  > :first-child
+  > [style*='width: 20px'],
+.notion-body.dark
+  [style*='background: linear-gradient(rgba(47, 52, 55, 0) 0px, rgb(47, 52, 55) 10px, rgb(47, 52, 55) 100%);'],
+.notion-body:not(.dark)
+  [style*='background: linear-gradient(rgba(255, 255, 255, 0) 0px, white 10px, white 100%);'],
+.notion-body.dark .notion-collection_view_page-block [style*='background: rgb(47, 52, 55);'],
+.notion-body:not(.dark)
+  .notion-collection_view_page-block
+  [style*='background: white;']:not([style*='box-shadow: rgba(15, 15, 15, 0.1) 0px 0px 0px 1px, rgba(15, 15, 15, 0.1) 0px 2px 4px;']) {
+  background: transparent !important;
+}
diff --git a/src/mods/theming/prism.css b/src/mods/theming/prism.css
new file mode 100644
index 0000000..42d82bc
--- /dev/null
+++ b/src/mods/theming/prism.css
@@ -0,0 +1,156 @@
+/**
+ * notion-enhancer: theming
+ * (c) 2021 dragonwocky <thedragonring.bod@gmail.com> (https://dragonwocky.me/)
+ * (https://notion-enhancer.github.io/) under the MIT license
+ */
+
+.token.property {
+  color: var(--theme--code_property) !important;
+}
+.token.tag {
+  color: var(--theme--code_tag) !important;
+}
+.token.boolean {
+  color: var(--theme--code_boolean) !important;
+}
+.token.number {
+  color: var(--theme--code_number) !important;
+}
+.token.constant {
+  color: var(--theme--code_constant) !important;
+}
+.token.symbol {
+  color: var(--theme--code_symbol) !important;
+}
+.token.deleted {
+  color: var(--theme--code_deleted) !important;
+}
+.token.selector {
+  color: var(--theme--code_selector) !important;
+}
+.token.attr-name {
+  color: var(--theme--code_attr-name) !important;
+}
+.token.string {
+  color: var(--theme--code_string) !important;
+}
+.token.char {
+  color: var(--theme--code_char) !important;
+}
+.token.builtin {
+  color: var(--theme--code_builtin) !important;
+}
+.token.inserted {
+  color: var(--theme--code_inserted) !important;
+}
+.token.operator {
+  color: var(--theme--code_operator) !important;
+}
+.token.entity {
+  color: var(--theme--code_entity) !important;
+}
+.token.url {
+  color: var(--theme--code_url) !important;
+}
+.token.variable {
+  color: var(--theme--code_variable) !important;
+}
+.token.comment {
+  color: var(--theme--code_comment) !important;
+}
+.token.cdata {
+  color: var(--theme--code_cdata) !important;
+}
+.token.prolog {
+  color: var(--theme--code_prolog) !important;
+}
+.token.doctype {
+  color: var(--theme--code_doctype) !important;
+}
+.token.atrule {
+  color: var(--theme--code_atrule) !important;
+}
+.token.attr-value {
+  color: var(--theme--code_attr-value) !important;
+}
+.token.keyword {
+  color: var(--theme--code_keyword) !important;
+}
+.token.regex {
+  color: var(--theme--code_regex) !important;
+}
+.token.important {
+  color: var(--theme--code_important) !important;
+}
+.token.function {
+  color: var(--theme--code_function) !important;
+}
+.token.class-name {
+  color: var(--theme--code_class-name) !important;
+}
+.token.parameter {
+  color: var(--theme--code_parameter) !important;
+}
+.token.decorator {
+  color: var(--theme--code_decorator) !important;
+}
+.token.id {
+  color: var(--theme--code_id) !important;
+}
+.token.class {
+  color: var(--theme--code_class) !important;
+}
+.token.pseudo-element {
+  color: var(--theme--code_pseudo-element) !important;
+}
+.token.pseudo-class {
+  color: var(--theme--code_pseudo-class) !important;
+}
+.token.attribute {
+  color: var(--theme--code_attribute) !important;
+}
+.token.value {
+  color: var(--theme--code_value) !important;
+}
+.token.unit {
+  color: var(--theme--code_unit) !important;
+}
+.token.punctuation {
+  color: var(--theme--code_punctuation) !important;
+  opacity: 0.7 !important;
+}
+.token.annotation {
+  color: var(--theme--code_annotation) !important;
+}
+
+.token.operator {
+  background: transparent !important;
+}
+.token.namespace {
+  opacity: 0.7 !important;
+}
+.token.important,
+.token.bold {
+  font-weight: bold !important;
+}
+.token.italic {
+  font-style: italic !important;
+}
+.token.entity {
+  cursor: help !important;
+}
+.token a {
+  color: inherit !important;
+}
+.token.punctuation.brace-hover,
+.token.punctuation.brace-selected {
+  outline: solid 1px !important;
+}
+
+.token.operator,
+.token.entity,
+.token.url,
+.language-css .token.string,
+.style .token.string {
+  background: none !important;
+}
diff --git a/src/mods/theming/rendererSearch.cjs b/src/mods/theming/rendererSearch.cjs
new file mode 100644
index 0000000..ed6a2cb
--- /dev/null
+++ b/src/mods/theming/rendererSearch.cjs
@@ -0,0 +1,18 @@
+/**
+ * notion-enhancer: theming
+ * (c) 2021 dragonwocky <thedragonring.bod@gmail.com> (https://dragonwocky.me/)
+ * (https://notion-enhancer.github.io/) under the MIT license
+ */
+
+'use strict';
+
+module.exports = async function ({ web, electron }, db, __exports, __eval) {
+  await web.whenReady();
+  web.loadStylesheet('repo/theming/electronSearch.css');
+
+  electron.onMessage('set-search-theme', (event, theme) => {
+    for (const [key, value] of theme) {
+      document.documentElement.style.setProperty(`--theme--${key}`, value);
+    }
+  });
+};
diff --git a/src/mods/theming/theme.css b/src/mods/theming/theme.css
new file mode 100644
index 0000000..4473a89
--- /dev/null
+++ b/src/mods/theming/theme.css
@@ -0,0 +1,773 @@
+/**
+ * notion-enhancer: theming
+ * (c) 2021 dragonwocky <thedragonring.bod@gmail.com> (https://dragonwocky.me/)
+ * (https://notion-enhancer.github.io/) under the MIT license
+ */
+
+/* backgrounds */
+
+.OnboardingHighlight + div > [style*='background-color'] {
+  background-color: rgba(0, 0, 0, 0.5) !important;
+}
+
+body,
+.notion-cursor-listener,
+.notion-frame,
+.notion-timeline-view,
+.notion-workspace-plan-choose,
+.notion-onboarding-popup,
+.notion-workspace-create,
+.notion-workspace-invite,
+.notion-scroller.vertical
+  > [style*='display: flex; justify-content: center; z-index: 3; flex-shrink: 0;'][style*='background: '],
+.notion-cursor-listener > div > :first-child[style*='z-index: 100;'],
+.notion-space-settings > div > div > div:nth-child(2) > div[style*='background'],
+.notion-body.dark .notion-collection_view_page-block > [style*='background: rgb(47, 52, 55)'],
+.notion-body.dark .notion-collection_view_page-block[style*='background: rgb(47, 52, 55)'],
+.notion-body:not(.dark) .notion-collection_view_page-block > [style*='background: white'],
+.notion-body:not(.dark) .notion-collection_view_page-block[style*='background: white'],
+.notion-body.dark .notion-collection_view-block > [style*='background: rgb(47, 52, 55)'],
+.notion-body.dark .notion-collection_view-block[style*='background: rgb(47, 52, 55)'],
+.notion-body:not(.dark) .notion-collection_view-block > [style*='background: white'],
+.notion-body:not(.dark) .notion-collection_view-block[style*='background: white'],
+.notion-body.dark .notion-timeline-view [style*='background: rgb(47, 52, 55)'],
+.notion-body:not(.dark)
+  .notion-timeline-view
+  [style*='background: white']:not(.notion-timeline-item),
+.notion-body:not(.dark) .notion-timeline-view [style*='background: rgb(253, 253, 253);'],
+.notion-updates-menu footer > div[style*='background'],
+:not(.notion-sidebar-container) > div > div > .notion-sidebar > :nth-child(2),
+:not(.notion-sidebar-container) > div > div > .notion-sidebar > :nth-child(3),
+:not(.notion-sidebar-container) > div > div > .notion-sidebar > :nth-child(3) > :nth-child(2),
+.notion-peek-renderer > div[style*='background'],
+.notion-peek-renderer > div[style*='background'] > :first-child,
+.notion-peek-renderer > div[style*='background'] > :first-child > div > :nth-child(3),
+.notion-page-template-modal,
+.notion-update-sidebar-tab-updates-header,
+.notion-update-sidebar-tab-updates-header + .notion-scroller,
+.notion-update-sidebar-tab-comments-header,
+.notion-update-sidebar-tab-comments-header + div,
+.notion-code-block > div > div > [style*='background: '][style$='padding-right: 105px;'],
+[style*='z-index: 84'] {
+  background: var(--theme--bg) !important;
+}
+.notion-timeline-item-row + div > div > div,
+.notion-timeline-view > :nth-child(2) > :first-child > div > div {
+  border: 1px solid var(--theme--bg) !important;
+  background: var(--theme--ui_toggle-off) !important;
+}
+.notion-timeline-item-row + div > div > div svg,
+.notion-timeline-view > :nth-child(2) > :first-child > div > div svg {
+  fill: var(--theme--bg) !important;
+}
+
+.notion-sidebar-container,
+.notion-sidebar > [style*='border-top-right-radius'],
+.notion-space-settings > div > div > div:first-child[style*='background'],
+.notion-body.dark .notion-collection_view_page-block [style*='background: rgb(55, 60, 63)'],
+.notion-body:not(.dark)
+  .notion-collection_view_page-block
+  [style*='background: rgb(247, 246, 243)'],
+.notion-body.dark .notion-collection_view-block [style*='background: rgb(55, 60, 63)'],
+.notion-body:not(.dark)
+  .notion-collection_view-block
+  [style*='background: rgb(247, 246, 243)'],
+.notion-body.dark .notion-timeline-view [style*='background: rgb(55, 60, 63)'],
+.notion-body:not(.dark) .notion-timeline-view [style*='background: rgb(247, 246, 243)'],
+.notion-space-settings
+  > div
+  > div
+  > div:nth-child(2)
+  table
+  td[style*='background:']:not([style*='background: transparent']),
+.notion-timeline-view > :first-child > div,
+.notion-body:not(.dark)
+  .notion-timeline-view
+  > div
+  > div
+  > [style*='background: rgb(247, 247, 247); border-radius: 11px;'],
+.notion-page-template-modal > :last-child,
+.notion-page-template-modal > :last-child > div > :last-child,
+.notion-embed-block .pseudoSelection,
+.notion-video-block .pseudoSelection,
+.notion-image-block .pseudoSelection,
+.notion-file-block .pseudoSelection,
+.notion-pdf-block .pseudoSelection,
+.notion-bookmark-block .pseudoSelection,
+.notion-miro-block .pseudoSelection,
+.notion-codepen-block .pseudoSelection,
+.notion-framer-block .pseudoSelection,
+.notion-figma-block .pseudoSelection,
+.notion-drive-block .pseudoSelection,
+.notion-gist-block .pseudoSelection,
+.notion-tweet-block .pseudoSelection,
+.notion-maps-block .pseudoSelection,
+.notion-replit-block .pseudoSelection,
+.notion-typeform-block .pseudoSelection,
+.notion-abstract-block .pseudoSelection,
+.notion-invision-block .pseudoSelection,
+.notion-loom-block .pseudoSelection,
+.notion-excalidraw-block .pseudoSelection,
+.notion-sketch-block .pseudoSelection,
+.notion-whimsical-block .pseudoSelection,
+.notion-equation-block > div > div,
+.notion-factory-block > div > div > div > div > [style*='background'][style*='margin-top'] {
+  background: var(--theme--bg_secondary) !important;
+}
+
+.notion-default-overlay-container
+  [style*='position: absolute; inset: 0px; background: rgba(15, 15, 15, 0.6);']:empty {
+  background: var(--theme--ui_shadow) !important;
+}
+
+.notion-body.dark
+  [style*='box-shadow: rgba(15, 15, 15, 0.1) 0px 0px 0px 1px, rgba(15, 15, 15, 0.2) 0px 3px 6px, rgba(15, 15, 15, 0.4) 0px 9px 24px;'],
+.notion-body:not(.dark)
+  [style*='box-shadow: rgba(15, 15, 15, 0.05) 0px 0px 0px 1px, rgba(15, 15, 15, 0.1) 0px 3px 6px, rgba(15, 15, 15, 0.2) 0px 9px 24px;'],
+.notion-body.dark
+  [style*='box-shadow: rgba(15, 15, 15, 0.1) 0px 0px 0px 1px, rgba(15, 15, 15, 0.2) 0px 3px 6px, rgba(15, 15, 15, 0.4) 0px 9px 24px;'],
+.notion-body:not(.dark)
+  [style*='box-shadow: rgba(15, 15, 15, 0.05) 0px 0px 0px 1px, rgba(15, 15, 15, 0.1) 0px 3px 6px, rgba(15, 15, 15, 0.2) 0px 9px 24px;'],
+[data-overlay]
+  > div
+  > [style*='position: relative; z-index: 1; box-shadow:'][style*='border-radius: 3px;'][style*='margin-bottom: 0px; top: 90px; overflow: hidden; width: 75%; max-width: 600px; min-height: 50px; max-height: 80vh;']:nth-child(2),
+.notion-overlay-container.notion-default-overlay-container
+  [style*='display: flex']
+  > [style*='position: relative; max-width:'][style*='overflow: hidden']
+  footer
+  > [style*='background-color:'],
+.notion-updates-menu > :first-child > div[style*='background'],
+#notion-app
+  > div
+  > div.notion-overlay-container.notion-default-overlay-container
+  > div:nth-child(2)
+  > div
+  > div:nth-child(2)[style*='margin-bottom: 0px; top: 90px; overflow: hidden; width: 75%;'],
+.notion-default-overlay-container
+  > div
+  > div:not(.notion-peek-renderer)
+  > [style*='box-shadow'],
+[style*='z-index:'][style*='box-shadow: '][style*='font-size: 12px;'][style*='min-height: 24px; overflow: hidden; pointer-events:'],
+:not(.notion-login)
+  > .notion-focusable[role='button'][tabindex='0'][style*='box-shadow:'][style*='background:'][style*='transition: background 20ms ease-in 0s; cursor: pointer;']:not([style*='rgb(46, 170, 220);']):not([style*='rgb(6, 156, 205);']):not([style*='rgb(0, 141, 190);']):not([style*='flex: 1 1 0%; white-space: nowrap; height: 26px; border-radius: 3px 0px 0px 3px;']):not([style*='rgb(225, 98, 89)']),
+.notion-text-action-menu > div > div,
+.notion-default-overlay-container
+  [style*='min-width: 300px;']
+  [style*='width: 240px']
+  > .notion-focusable:not(:hover),
+.notion-transclusion_reference-block > div > div > :nth-child(3),
+.notion-transclusion_container-block > div > div > :nth-child(3),
+.notion-page-block > div > div > div > .notion-focusable:not(:hover),
+.notion-workspace-create
+  [style*='font-size: 12px;']
+  + .notion-focusable[role='button']:not(:hover) {
+  background: var(--theme--bg_card) !important;
+  box-shadow: var(--theme--ui_shadow, rgba(15, 15, 15, 0.05)) 0px 0px 0px 1px,
+    var(--theme--ui_shadow, rgba(15, 15, 15, 0.1)) 0px 3px 6px,
+    var(--theme--ui_shadow, rgba(15, 15, 15, 0.2)) 0px 9px 24px !important;
+}
+[style*='z-index:'][style*='box-shadow: '][style*='font-size: 12px;'][style*='min-height: 24px; overflow: hidden; pointer-events:']
+  > .notion-focusable {
+  color: var(--theme--text) !important;
+}
+
+.notion-calendar-view
+  .notion-selectable.notion-page-block.notion-collection-item
+  > a[style*='background:'] {
+  background: var(--theme--bg_card) !important;
+  box-shadow: var(--theme--ui_shadow, rgba(15, 15, 15, 0.05)) 0px 0px 0px 1px,
+    var(--theme--ui_shadow, rgba(15, 15, 15, 0.1)) 0px 2px 4px !important;
+}
+
+.notion-media-menu > div > div > div[style*='background'],
+.notion-media-menu > div > div > div > div[style*='background']:not(.notion-focusable),
+.notion-body.dark
+  .notion-default-overlay-container
+  [style*='grid-template-columns: [boolean-start] 60px [boolean-end property-start] 120px [property-end opererator-start] 110px [operator-end value-start] auto [value-end menu-start] 32px [menu-end];'],
+.notion-focusable[style*='background: rgb(80, 85, 88);']:not(.notion-help-button):not(.onboarding-checklist-button),
+.notion-body:not(.dark)
+  .notion-default-overlay-container
+  [style*='grid-template-columns: [boolean-start] 60px [boolean-end property-start] 120px [property-end opererator-start] 110px [operator-end value-start] auto [value-end menu-start] 32px [menu-end];']
+  .notion-focusable[style*='background: white;'],
+.notion-timeline-item,
+.notion-collection-item > a {
+  background: var(--theme--bg_card) !important;
+}
+
+.notion-timeline-view
+  > div
+  > div
+  > [style*='height: 100%; background-image: linear-gradient(to right, '] {
+  background-image: linear-gradient(
+    to right,
+    var(--theme--bg) 20%,
+    transparent 100%
+  ) !important;
+}
+.notion-timeline-view
+  > div
+  > div
+  > [style*='height: 100%; background-image: linear-gradient(to left, '] {
+  background-image: linear-gradient(
+    to left,
+    var(--theme--bg) 20%,
+    transparent 100%
+  ) !important;
+}
+
+/** ui **/
+
+.notion-page-mention-token.notion-enable-hover:hover {
+  box-shadow: 0 0 0 3px var(--theme--ui_interactive-hover) !important;
+  background: var(--theme--ui_interactive-hover) !important;
+}
+
+.notion-to_do-block [style*='background: rgb(46, 170, 220);'],
+.notion-focusable
+  > [style*='width: 16px; height: 16px;'][style*='background: rgb(46, 170, 220);'],
+.notion-focusable > [style*='border-radius: 44px;'][style*='background: rgb(46, 170, 220);'] {
+  background: var(--theme--ui_toggle-on) !important;
+}
+.notion-body.dark
+  .notion-focusable
+  > [style*='border-radius: 44px;'][style*='background: rgba(202, 204, 206, 0.3);'],
+.notion-body:not(.dark)
+  .notion-focusable
+  > [style*='border-radius: 44px;'][style*='background: rgba(135, 131, 120, 0.3);'] {
+  background: var(--theme--ui_toggle-off) !important;
+}
+
+.notion-focusable
+  > [style*='width: 16px; height: 16px;'][style*='background: rgb(46, 170, 220);']
+  .check,
+.notion-to_do-block .check {
+  fill: var(--theme--ui_toggle-feature) !important;
+}
+.notion-focusable > [style*='border-radius: 44px;'] > div:empty {
+  background: var(--theme--ui_toggle-feature) !important;
+}
+
+.notion-body.dark [style*='background: rgba(255, 255, 255, 0.1)'],
+.notion-body:not(.dark) [style*='background: rgba(55, 53, 47, 0.08)'],
+.notion-focusable[style*='z-index:'][style*='box-shadow: '][style*='font-size: 12px;'][style*='min-height: 24px; overflow: hidden; pointer-events:']:hover,
+:not(.notion-login)
+  > .notion-focusable[role='button'][tabindex='0'][style*='box-shadow:'][style*='background:'][style*='transition: background 20ms ease-in 0s; cursor: pointer;']:not([style*='rgb(46, 170, 220);']):not([style*='rgb(6, 156, 205);']):not([style*='rgb(0, 141, 190);']):not([style*='flex: 1 1 0%; white-space: nowrap; height: 26px; border-radius: 3px 0px 0px 3px;']):not([style*='rgb(225, 98, 89)']):hover,
+[style*='z-index:'][style*='box-shadow: '][style*='font-size: 12px;'][style*='min-height: 24px; overflow: hidden; pointer-events:']
+  > .notion-focusable[style*='background']:hover,
+.notion-body:not(.dark)
+  .notion-default-overlay-container
+  [style*='grid-template-columns: [boolean-start] 60px [boolean-end property-start] 120px [property-end opererator-start] 110px [operator-end value-start] auto [value-end menu-start] 32px [menu-end];']
+  .notion-focusable[style*='background: rgb(239, 239, 238);'],
+.line-numbers.notion-code-block + div .notion-focusable:hover {
+  background: var(--theme--ui_interactive-hover) !important;
+  color: var(--theme--text) !important;
+  fill: var(--theme--text) !important;
+}
+.notion-body:not(.dark) [style*='background: rgba(55, 53, 47, 0.16)'],
+.notion-body.dark .notion-focusable[role='button'][style*='background: rgb(63, 68, 71);'],
+.notion-body:not(.dark)
+  .notion-focusable[role='button'][style*='background: rgba(55, 53, 47, 0.16)'],
+[style*='z-index:'][style*='box-shadow: '][style*='font-size: 12px;'][style*='min-height: 24px; overflow: hidden; pointer-events:']
+  > .notion-focusable[style*='background']:active,
+.notion-body:not(.dark)
+  .notion-default-overlay-container
+  [style*='grid-template-columns: [boolean-start] 60px [boolean-end property-start] 120px [property-end opererator-start] 110px [operator-end value-start] auto [value-end menu-start] 32px [menu-end];']
+  .notion-focusable[style*='background: rgb(233, 233, 231);'] {
+  background: var(--theme--ui_interactive-active) !important;
+  color: var(--theme--text) !important;
+  fill: var(--theme--text) !important;
+}
+.notion-body:not(.dark) [style*='background: rgba(55, 53, 47, 0.16)'] svg,
+.notion-body.dark .notion-focusable[role='button'][style*='background: rgb(63, 68, 71);'] svg {
+  color: var(--theme--text) !important;
+  fill: var(--theme--text) !important;
+}
+
+.notion-focusable-within,
+.notion-share-menu
+  .notion-block-permission-settings-public-access
+  + div
+  > div
+  > div
+  > div
+  > div
+  > .notion-focusable:first-child[role='button'][tabindex='0'][style*='user-select: none;'],
+.notion-overlay-container
+  > div:nth-child(2)
+  > div
+  > div:nth-child(2)
+  > div:nth-child(2)
+  > div
+  > div
+  > div
+  > div
+  > div
+  > div:nth-child(1)[style*='display: flex; width: 100%; position: relative; z-index: 2; padding: 6px 10px; font-size: 14px; background:'],
+.notion-overlay-container
+  > div:nth-child(3)
+  > div
+  > div:nth-child(2)
+  > div:nth-child(2)
+  > div
+  > div
+  > div
+  > div
+  > div
+  > div:nth-child(1)[style*='display: flex; width: 100%; position: relative; z-index: 2; padding: 6px 10px; font-size: 14px; background:'],
+#notion-app
+  > div
+  > div.notion-overlay-container.notion-default-overlay-container
+  > [data-overlay='true']
+  > div
+  > div:nth-child(2)
+  > div:nth-child(2)
+  > div
+  > div
+  > div
+  > div
+  > div:nth-child(1)
+  > div[style*='background'] {
+  background: var(--theme--ui_input) !important;
+}
+
+.notion-body.dark
+  [style*='border-radius: 20px; box-shadow: rgba(255, 255, 255, 0.07) 0px 0px 0px 2px inset;'],
+.notion-body:not(.dark)
+  [style*='border-radius: 20px; box-shadow: rgba(55, 53, 47, 0.09) 0px 0px 0px 2px inset;'] {
+  box-shadow: var(--theme--ui_divider) 0px 0px 0px 2px inset !important;
+}
+.notion-body.dark
+  [style*='box-shadow: rgba(255, 255, 255, 0.07) 0px 0px 0px 1px inset; border-radius: 3px;'],
+.notion-body:not(.dark)
+  [style*='box-shadow: rgba(55, 53, 47, 0.09) 0px 0px 0px 1px inset; border-radius: 3px;'],
+.notion-gallery-view
+  .notion-focusable[role='button'][style*='font-size: 14px; border-radius: 3px; box-shadow:']:last-child {
+  box-shadow: var(--theme--ui_divider) 0px 0px 0px 1px inset !important;
+}
+.notion-body.dark
+  [style*='border-radius: 3px; box-shadow: rgba(255, 255, 255, 0.1) 0px 0px 0px 1px;'],
+.notion-body:not(.dark)
+  [style*='border-radius: 3px; box-shadow: rgba(55, 53, 47, 0.1) 0px 0px 0px 1px;'] {
+  box-shadow: var(--theme--ui_divider) 0px 0px 0px 1px !important;
+}
+
+#notion-app
+  .DayPicker-Day--today:not(.DayPicker-Day--selected):not(.DayPicker-Day--value):not(.DayPicker-Day--start):not(.DayPicker-Day--end) {
+  color: var(--theme--accent_red-text) !important;
+}
+#notion-app
+  .DayPicker-Day--today:not(.DayPicker-Day--selected):not(.DayPicker-Day--value):not(.DayPicker-Day--start):not(.DayPicker-Day--end)::after,
+.notion-timeline-view [style*='background: rgb(211, 79, 67); width: 22px;'],
+.notion-timeline-view
+  [style*='width: 7px; height: 7px; background: rgb(211, 79, 67); border-radius: 100%;'] {
+  background: var(--theme--accent_red) !important;
+}
+#notion-app .DayPicker-Day.DayPicker-Day--range.DayPicker-Day--start,
+#notion-app .DayPicker-Day.DayPicker-Day--range.DayPicker-Day--end {
+  background-color: var(--theme--accent_blue) !important;
+}
+#notion-app .DayPicker-Day.DayPicker-Day--range:hover {
+  border-radius: 0 !important;
+}
+.notion-calendar-view-day[style*='background'] {
+  background-color: var(--theme--accent_red) !important;
+  color: var(--theme--accent_red-text) !important;
+}
+.DayPicker-Day--outside,
+.DayPicker-Weekday {
+  color: var(--theme--text_secondary) !important;
+}
+.notion-timeline-view [style*='height: 100%; border-right: 1px solid rgb(211, 79, 67);'] {
+  border-right: 1px solid var(--theme--accent_red) !important;
+}
+
+/* link underline */
+
+.notion-body.dark
+  [style*='background-image: linear-gradient(to right, rgba(255, 255, 255, 0.14) 0%, rgba(255, 255, 255, 0.14) 100%);'],
+.notion-body:not(.dark)
+  [style*='background-image: linear-gradient(to right, rgba(55, 53, 47, 0.16) 0%, rgba(55, 53, 47, 0.16) 100%);'] {
+  background-image: linear-gradient(
+    to right,
+    var(--theme--ui_divider) 0%,
+    var(--theme--ui_divider) 100%
+  ) !important;
+}
+
+/** dividers **/
+
+.notion-body.dark
+  .notion-page-content
+  .notranslate[style*='border-bottom: 1px solid rgba(255, 255, 255, 0.14);'],
+.notion-body:not(.dark)
+  .notion-page-content
+  .notranslate[style*='border-bottom: 1px solid rgba(55, 53, 47, 0.16);'] {
+  border-bottom: 1px solid var(--theme--ui_divider) !important;
+}
+
+.notion-body.dark [style*='border-top: 1px solid rgb(77, 81, 83)'],
+.notion-body.dark [style*='border-top: 1px solid rgb(63, 66, 69)'],
+.notion-body.dark [style*='border-top: 1px solid rgb(63, 66, 67)'],
+.notion-body.dark [style*='border-top: 1px solid rgb(60, 63, 67)'],
+.notion-body.dark [style*='border-top: 1px solid rgba(255, 255, 255, 0.14);'],
+.notion-body.dark [style*='border-top: 1px solid rgba(255, 255, 255, 0.07)'],
+.notion-body:not(.dark) [style*='border-top: 1px solid rgb(233, 233, 231)'],
+.notion-body:not(.dark) [style*='border-top: 1px solid rgb(237, 237, 236)'],
+.notion-body:not(.dark) [style*='border-top: 1px solid rgb(238, 238, 237)'],
+.notion-body:not(.dark) [style*='border-top: 1px solid rgba(55, 53, 47, 0.09)'],
+.notion-body:not(.dark) [style*='border-top: 1px solid rgba(55, 53, 47, 0.16)'] {
+  border-top: 1px solid var(--theme--ui_divider) !important;
+}
+.notion-body.dark [style*='border-bottom: 1px solid rgb(77, 81, 83)'],
+.notion-body.dark [style*='border-bottom: 1px solid rgb(63, 66, 69)'],
+.notion-body.dark [style*='border-bottom: 1px solid rgb(63, 66, 67)'],
+.notion-body.dark [style*='border-bottom: 1px solid rgb(60, 63, 67)'],
+.notion-body.dark [style*='border-bottom: 1px solid rgba(255, 255, 255, 0.14);'],
+.notion-body.dark [style*='border-bottom: 1px solid rgba(255, 255, 255, 0.07)'],
+.notion-body:not(.dark) [style*='border-bottom: 1px solid rgb(233, 233, 231)'],
+.notion-body:not(.dark) [style*='border-bottom: 1px solid rgb(237, 237, 236)'],
+.notion-body:not(.dark) [style*='border-bottom: 1px solid rgb(238, 238, 237)'],
+.notion-body:not(.dark) [style*='border-bottom: 1px solid rgba(55, 53, 47, 0.09)'],
+.notion-body:not(.dark) [style*='border-bottom: 1px solid rgba(55, 53, 47, 0.16)'] {
+  border-bottom: 1px solid var(--theme--ui_divider) !important;
+}
+.notion-body.dark [style*='border-right: 1px solid rgb(77, 81, 83)'],
+.notion-body.dark [style*='border-right: 1px solid rgb(63, 66, 69)'],
+.notion-body.dark [style*='border-right: 1px solid rgb(63, 66, 67)'],
+.notion-body.dark [style*='border-right: 1px solid rgb(60, 63, 67)'],
+.notion-body.dark [style*='border-right: 1px solid rgba(255, 255, 255, 0.14);'],
+.notion-body.dark [style*='border-right: 1px solid rgba(255, 255, 255, 0.07)'],
+.notion-body:not(.dark) [style*='border-right: 1px solid rgb(233, 233, 231)'],
+.notion-body:not(.dark) [style*='border-right: 1px solid rgb(237, 237, 236)'],
+.notion-body:not(.dark) [style*='border-right: 1px solid rgb(238, 238, 237)'],
+.notion-body:not(.dark) [style*='border-right: 1px solid rgba(55, 53, 47, 0.09)'],
+.notion-body:not(.dark) [style*='border-right: 1px solid rgba(55, 53, 47, 0.16)'] {
+  border-right: 1px solid var(--theme--ui_divider) !important;
+}
+.notion-body.dark [style*='border-left: 1px solid rgb(77, 81, 83)'],
+.notion-body.dark [style*='border-left: 1px solid rgb(63, 66, 69)'],
+.notion-body.dark [style*='border-left: 1px solid rgb(63, 66, 67)'],
+.notion-body.dark [style*='border-left: 1px solid rgb(60, 63, 67)'],
+.notion-body.dark [style*='border-left: 1px solid rgba(255, 255, 255, 0.14);'],
+.notion-body.dark [style*='border-left: 1px solid rgba(255, 255, 255, 0.07)'],
+.notion-body:not(.dark) [style*='border-left: 1px solid rgb(233, 233, 231)'],
+.notion-body:not(.dark) [style*='border-left: 1px solid rgb(237, 237, 236)'],
+.notion-body:not(.dark) [style*='border-left: 1px solid rgb(238, 238, 237)'],
+.notion-body:not(.dark) [style*='border-left: 1px solid rgba(55, 53, 47, 0.09)'],
+.notion-body:not(.dark) [style*='border-left: 1px solid rgba(55, 53, 47, 0.16)'] {
+  border-left: 1px solid var(--theme--ui_divider) !important;
+}
+.notion-body.dark [style*='border: 1px solid rgb(77, 81, 83)'],
+.notion-body.dark [style*='border: 1px solid rgb(63, 66, 69)'],
+.notion-body.dark [style*='border: 1px solid rgb(63, 66, 67)'],
+.notion-body.dark [style*='border: 1px solid rgb(60, 63, 67)'],
+.notion-body.dark [style*='border: 1px solid rgba(255, 255, 255, 0.14);'],
+.notion-body.dark [style*='border: 1px solid rgba(255, 255, 255, 0.07)'],
+.notion-body:not(.dark) [style*='border: 1px solid rgb(233, 233, 231)'],
+.notion-body:not(.dark) [style*='border: 1px solid rgb(237, 237, 236)'],
+.notion-body:not(.dark) [style*='border: 1px solid rgb(238, 238, 237)'],
+.notion-body:not(.dark) [style*='border: 1px solid rgba(55, 53, 47, 0.09)'],
+.notion-body:not(.dark) [style*='border: 1px solid rgba(55, 53, 47, 0.16)'] {
+  border: 1px solid var(--theme--ui_divider) !important;
+}
+.notion-body.dark [style*='border-color: 1px solid rgb(77, 81, 83)'],
+.notion-body.dark [style*='border-color: 1px solid rgb(63, 66, 69)'],
+.notion-body.dark [style*='border-color: 1px solid rgb(63, 66, 67)'],
+.notion-body.dark [style*='border-color: 1px solid rgb(60, 63, 67)'],
+.notion-body.dark [style*='border-color: 1px solid rgba(255, 255, 255, 0.14);'],
+.notion-body.dark [style*='border-color: 1px solid rgba(255, 255, 255, 0.07)'],
+.notion-body:not(.dark) [style*='border-color: 1px solid rgb(233, 233, 231)'],
+.notion-body:not(.dark) [style*='border-color: 1px solid rgb(237, 237, 236)'],
+.notion-body:not(.dark) [style*='border-color: 1px solid rgb(238, 238, 237)'],
+.notion-body:not(.dark) [style*='border-color: 1px solid rgba(55, 53, 47, 0.09)'],
+.notion-body:not(.dark) [style*='border-color: 1px solid rgba(55, 53, 47, 0.16)'],
+.notion-callout-block > div > :not([style*='border-color: transparent']) {
+  border-color: var(--theme--ui_divider) !important;
+}
+
+.notion-body.dark [style*='box-shadow: rgb(77, 81, 83) -1px 0px 0px'],
+.notion-body.dark [style*='box-shadow: rgba(255, 255, 255, 0.07) -1px 0px 0px'],
+.notion-body:not(.dark) [style*='box-shadow: rgb(233, 233, 231) -1px 0px 0px'],
+.notion-body:not(.dark) [style*='box-shadow: rgba(55, 53, 47, 0.09) -1px 0px 0px'],
+.notion-body.dark [style*='box-shadow: rgb(63, 66, 69) -1px 0px 0px'],
+.notion-body:not(.dark) [style*='box-shadow: rgb(237, 237, 236) -1px 0px 0px'] {
+  box-shadow: var(--theme--ui_divider) -1px 0px 0px !important;
+}
+.notion-body.dark [style*='box-shadow: rgb(77, 81, 83) 1px 0px 0px'],
+.notion-body.dark [style*='box-shadow: rgba(255, 255, 255, 0.07) 1px 0px 0px'],
+.notion-body:not(.dark) [style*='box-shadow: rgb(233, 233, 231) 1px 0px 0px'],
+.notion-body:not(.dark) [style*='box-shadow: rgba(55, 53, 47, 0.09) 1px 0px 0px'],
+.notion-body.dark [style*='box-shadow: rgb(63, 66, 69) 1px 0px 0px'],
+.notion-body:not(.dark) [style*='box-shadow: rgb(237, 237, 236) 1px 0px 0px'] {
+  box-shadow: var(--theme--ui_divider) 1px 0px 0px !important;
+}
+.notion-body.dark [style*='box-shadow: rgb(77, 81, 83) 0px -1px 0px'],
+.notion-body.dark [style*='box-shadow: rgba(255, 255, 255, 0.07) 0px -1px 0px'],
+.notion-body:not(.dark) [style*='box-shadow: rgb(233, 233, 231) 0px -1px 0px'],
+.notion-body:not(.dark) [style*='box-shadow: rgba(55, 53, 47, 0.09) 0px -1px 0px'],
+.notion-body.dark [style*='box-shadow: rgb(63, 66, 69) 0px -1px 0px'],
+.notion-body:not(.dark) [style*='box-shadow: rgb(237, 237, 236) 0px -1px 0px'] {
+  box-shadow: var(--theme--ui_divider) 0px -1px 0px !important;
+}
+.notion-body.dark [style*='box-shadow: rgb(77, 81, 83) 0px 1px 0px'],
+.notion-body.dark [style*='box-shadow: rgba(255, 255, 255, 0.07) 0px 1px 0px'],
+.notion-body:not(.dark) [style*='box-shadow: rgb(233, 233, 231) 0px 1px 0px'],
+.notion-body:not(.dark) [style*='box-shadow: rgba(55, 53, 47, 0.09) 0px 1px 0px'],
+.notion-body.dark [style*='box-shadow: rgb(63, 66, 69) 0px 1px 0px'],
+.notion-body:not(.dark) [style*='box-shadow: rgb(237, 237, 236) 0px 1px 0px'] {
+  box-shadow: var(--theme--ui_divider) 0px 1px 0px !important;
+}
+
+.notion-body.dark [style*='height: 1px;'][style*='background: rgba(255, 255, 255, 0.07);'],
+.notion-body:not(.dark) [style*='height: 1px;'][style*='background: rgba(55, 53, 47, 0.09);'] {
+  background: var(--theme--ui_divider) !important;
+}
+.notion-body.dark
+  [style*='box-shadow: rgb(47, 52, 55) -3px 0px 0px, rgb(63, 66, 69) 0px 1px 0px;'],
+.notion-body:not(.dark)
+  [style*='box-shadow: white -3px 0px 0px, rgb(233, 233, 231) 0px 1px 0px;'] {
+  box-shadow: var(--theme--ui_divider) 0px 1px 0px !important;
+}
+.notion-body.dark
+  .notion-collection_view_page-block
+  > [style*='box-shadow: rgb(47, 52, 55) -3px 0px 0px;'],
+.notion-body:not(.dark)
+  .notion-collection_view_page-block
+  > [style*='box-shadow: white -3px 0px 0px;'],
+.notion-body.dark
+  .notion-collection_view-block
+  > [style*='box-shadow: rgb(47, 52, 55) -3px 0px 0px;'],
+.notion-body:not(.dark)
+  .notion-collection_view-block
+  > [style*='box-shadow: white -3px 0px 0px;'] {
+  box-shadow: transparent -3px 0px 0px !important;
+}
+.notion-focusable[role='button'][style*='box-shadow: rgba(15, 15, 15, 0.1) 0px 0px 0px 1px;'] {
+  box-shadow: var(--theme--ui_divider) 0px 0px 0px 1px !important;
+}
+
+.notion-sidebar-container[style*='box-shadow:'] {
+  box-shadow: var(--theme--ui_divider) -2px 0px 0px 0px inset !important;
+}
+
+/** colours **/
+
+[style*='background: rgb(46, 170, 220)'] {
+  background: var(--theme--accent_blue) !important;
+  color: var(--theme--accent_blue-text) !important;
+}
+[style*='background: rgb(6, 156, 205);'] {
+  background: var(--theme--accent_blue-hover) !important;
+  color: var(--theme--accent_blue-text) !important;
+}
+[style*='background: rgb(0, 141, 190);'] {
+  background: var(--theme--accent_blue-active) !important;
+  color: var(--theme--accent_blue-text) !important;
+}
+[style*='background: rgb(46, 170, 220)'] .chevronDown,
+[style*='background: rgb(6, 156, 205);'] .chevronDown,
+[style*='background: rgb(0, 141, 190);'] .chevronDown {
+  fill: var(--theme--accent_blue-text) !important;
+}
+[style*='fill: rgb(46, 170, 220)'] {
+  fill: var(--theme--accent_blue) !important;
+}
+[style*=' color: rgb(46, 170, 220)'],
+[style^='color: rgb(46, 170, 220)'] {
+  color: var(--theme--accent_blue) !important;
+}
+[style*='background: rgba(46, 170, 220, 0.'],
+[style*='background-color: rgba(46, 170, 220, 0.'] {
+  background-color: var(--theme--accent_blue-selection) !important;
+}
+*::selection {
+  background: var(--theme--accent_blue-selection, rgba(26, 170, 220, 0.3)) !important;
+}
+.notion-page-mention-token::selection,
+.notion-selectable-halo {
+  background: var(--theme--accent_blue-selection, rgba(26, 170, 220, 0.2)) !important;
+}
+.notion-focusable-within:focus-within,
+.notion-focusable:focus-visible {
+  box-shadow: var(--theme--accent_blue-active, rgba(26, 170, 220, 0.7)) 0px 0px 0px 1px inset,
+    var(--theme--accent_blue-active, rgba(26, 170, 220, 0.4)) 0px 0px 0px 2px !important;
+}
+.notion-sidebar-switcher:focus-visible {
+  box-shadow: none !important;
+}
+.notion-onboarding-plan-type-team[style*='box-shadow: rgb(46, 170, 220)'],
+.notion-onboarding-plan-type-personal[style*='box-shadow: rgb(46, 170, 220)'] {
+  box-shadow: var(--theme--accent_blue) 0px 0px 0px 2px !important;
+}
+
+@keyframes pulsing-button-border {
+  0% {
+    border-color: var(--theme--accent_blue) !important;
+  }
+  50% {
+    border-color: rgba(255, 255, 255, 0) !important;
+  }
+  100% {
+    border-color: var(--theme--accent_blue) !important;
+  }
+}
+
+[style*='background-color: rgb(235, 87, 87); height: 28px; width: 28px;'],
+.notion-login [style*='background: rgb(225, 98, 89)'],
+.notion-login [style*='background: rgb(207, 83, 74)'],
+.notion-login [style*='background: rgb(191, 77, 69)'] {
+  background: var(--theme--accent_red) !important;
+  border-color: var(--theme--accent_red) !important;
+}
+[style*='background: rgb(235, 87, 87); color: white; border-radius: 3px;']:not([role='button']) {
+  background: var(--theme--accent_red) !important;
+  color: var(--theme--accent_red-text) !important;
+}
+[style*='color: rgb(235, 87, 87); border: 1px solid rgba(235, 87, 87, 0.5);'][role='button'] {
+  color: var(--theme--accent_red) !important;
+  border: 1px solid var(--theme--accent_red) !important;
+}
+.notion-focusable[style*='border-radius: 3px;'][style*='color: rgb(235, 87, 87);'][role='button'],
+[style*='font-size: 12px; font-weight: 600; color: rgb(235, 87, 87);'],
+[style*='flex-shrink: 0; margin-top: -1px; margin-right: 4px; fill: rgb(235, 87, 87);'],
+[style*='font-size: 12px;'] > [style*='pointer-events: none; color: rgb(235, 87, 87);'] {
+  color: var(--theme--accent_red) !important;
+  fill: var(--theme--accent_red) !important;
+}
+.notion-focusable[style*='border-radius: 3px;'][style*='background: rgba(235, 87, 87, 0.1);'][role='button']:hover {
+  background: var(--theme--accent_red-button) !important;
+}
+
+.notion-transclusion_container-block > div > div > div[style*='border: 2px'],
+.notion-transclusion_reference-block > div > div > div[style*='border: 2px'] {
+  border-color: var(--theme--accent_red, #e38676) !important;
+}
+
+.notion-text-mention-token[style*='color:#2EAADC;'] {
+  color: var(--theme--accent_blue) !important;
+}
+.notion-text-mention-token[style*='color:#EB5757;'],
+.notion-link:hover {
+  color: var(--theme--accent_red) !important;
+}
+
+.notion-body.dark [style*='fill: rgb(202, 204, 206)'],
+.notion-body:not(.dark) [style*='fill: rgba(55, 53, 47, 0.8)'] {
+  fill: var(--theme--icon) !important;
+}
+.notion-body.dark [style*='fill: rgba(202, 204, 206, 0.'],
+.notion-body.dark [style*='fill: rgba(255, 255, 255, 0.'],
+.notion-body:not(.dark) [style*='fill: rgba(25, 23, 17, 0.'],
+.notion-body:not(.dark) [style*='fill: rgb(55, 53, 47)'],
+.notion-body:not(.dark)
+  [style*='fill: rgba(55, 53, 47, 0.']:not([style*='fill: rgba(55, 53, 47, 0.8)']) {
+  fill: var(--theme--icon_secondary) !important;
+}
+.alarmClock,
+.notion-to_do-block .checkboxSquare[style*='fill: inherit'] {
+  fill: currentColor !important;
+}
+
+.notion-app-inner,
+.notion-page-content,
+.notion-selectable.notion-page-block .notion-focusable > [style*=';color:'],
+.notion-record-icon.notranslate.notion-focusable,
+.notion-topbar-share-menu.notion-focusable,
+.notion-collection-view-select.notion-focusable,
+.notion-body.dark [style*=' color: rgba(255, 255, 255, 0.9);'],
+.notion-body.dark [style^='color: rgba(255, 255, 255, 0.9);'],
+.notion-body:not(.dark) [style*=' color: rgb(55, 53, 47)'],
+.notion-body:not(.dark) [style^='color: rgb(55, 53, 47)'] {
+  color: var(--theme--text) !important;
+}
+.notion-body.dark [style*='border-bottom: 2px solid rgba(255, 255, 255, 0.9);'],
+.notion-body:not(.dark) [style*='border-bottom: 2px solid rgb(55, 53, 47);'] {
+  border-bottom: 2px solid var(--theme--text) !important;
+}
+.notion-body.dark [style*='caret-color: rgba(255, 255, 255, 0.9)'],
+.notion-body:not(.dark) [style*='caret-color: rgb(55, 53, 47)'] {
+  caret-color: var(--theme--text) !important;
+}
+.notion-body.dark [style*=' color: rgba(255, 255, 255, 0.6)'],
+.notion-body.dark [style^='color: rgba(255, 255, 255, 0.6)'],
+.notion-body.dark [style^='color:rgba(255, 255, 255, 0.6)'],
+.notion-body:not(.dark) [style*=' color: rgba(55, 53, 47, 0.6)'],
+.notion-body:not(.dark) [style^='color: rgba(55, 53, 47, 0.6)'],
+.notion-body:not(.dark) [style^='color:rgba(55, 53, 47, 0.6)'],
+.notion-sidebar-container > [style*='color'],
+.notion-gallery-view
+  .notion-focusable[role='button'][style*='font-size: 14px; border-radius: 3px; box-shadow:']:last-child
+  svg
+  + div,
+.notion-body.dark [style*=' color: rgba(255, 255, 255, 0.4)'],
+.notion-body.dark [style^='color: rgba(255, 255, 255, 0.4)'],
+.notion-body:not(.dark) [style*=' color: rgba(55, 53, 47, 0.4)'],
+.notion-body:not(.dark) [style^='color: rgba(55, 53, 47, 0.4)'],
+.notion-page-controls,
+.notion-page-details-controls,
+.notion-calendar-view-day {
+  color: var(--theme--text_secondary) !important;
+}
+
+.notion-page-mention-token__title {
+  border-bottom: 0.05em solid var(--theme--text_secondary) !important;
+}
+.notion-to_do-block [placeholder='To-do'][style*='text-decoration: line-through'] {
+  text-decoration: line-through var(--theme--text_secondary) !important;
+}
+.notion-body.dark [style*='-webkit-text-fill-color: rgba(255, 255, 255, 0.4)'],
+.notion-body:not(.dark) [style*='-webkit-text-fill-color: rgba(55, 53, 47, 0.4)'] {
+  -webkit-text-fill-color: var(--theme--text_secondary) !important;
+}
+.notion-body.dark [style*='border-color:rgba(255,255,255,0.4)'],
+.notion-body:not(.dark) [style*='border-color:rgba(55,53,47,0.4)'] {
+  border-color: var(--theme--text_secondary) !important;
+}
+
+/* make sure to change in _mapColors.js as well if colors ever change */
+.notion-body.dark [style*='background: rgb(80, 85, 88)']:not([role='button']),
+.notion-body.dark [style*='background-color: rgb(80, 85, 88)']:not([role='button']),
+.notion-body:not(.dark) [style*='background: rgba(206, 205, 202, 0.5)']:not([role='button']),
+.notion-body:not(.dark)
+  [style*='background-color: rgba(206, 205, 202, 0.5)']:not([role='button']),
+.notion-sidebar-container
+  .notion-sidebar
+  [style*='margin-top']
+  > .notion-focusable[style*='border-radius'] {
+  background: var(--theme--tag_default) !important;
+  color: var(--theme--tag_default-text) !important;
+}
+
+/** code **/
+
+.notion-page-content [style*='color:#EB5757']:not(.notion-text-mention-token) {
+  color: var(--theme--code_inline-text) !important;
+  background: var(--theme--code_inline) !important;
+}
+
+.notion-code-block > div > div {
+  background: var(--theme--code) !important;
+}
+.notion-code-block > div {
+  color: var(--theme--code_plain) !important;
+}
+
+/** simple tables **/
+
+.notion-table-selection-overlay [style*='border: 2px solid rgb(116, 182, 219);'] {
+  border: 2px solid var(--theme--accent_blue) !important;
+}
+.notion-table-row-selector,
+.notion-table-column-selector,
+.notion-table-block .notion-focusable [style*='background: rgba(55, 53, 47, 0.06);'] {
+  background: var(--theme--ui_interactive-hover) !important;
+}
+.notion-table-row [style*='background: rgb(116, 182, 219);'],
+.notion-table-row-selector[style*='background: rgb(116, 182, 219);'],
+.notion-table-column-selector[style*='background: rgb(116, 182, 219);'],
+.notion-table-block .notion-focusable [style*='background: rgb(116, 182, 219);'] {
+  background: var(--theme--accent_blue) !important;
+}
+.notion-table-row td[style*='background:'] {
+  background: var(--theme--bg_secondary) !important;
+}
diff --git a/src/mods/theming/variables.css b/src/mods/theming/variables.css
new file mode 100644
index 0000000..8ff0aad
--- /dev/null
+++ b/src/mods/theming/variables.css
@@ -0,0 +1,407 @@
+/**
+ * notion-enhancer: theming
+ * (c) 2021 dragonwocky <thedragonring.bod@gmail.com> (https://dragonwocky.me/)
+ * (https://notion-enhancer.github.io/) under the MIT license
+ */
+
+:root {
+  --theme--page-padding: calc(96px + env(safe-area-inset-left));
+  --theme--page-width: 900px;
+  --theme--page-width_full: 100%;
+  --theme--page_banner-height: 30vh;
+  --theme--page_preview-padding: 8rem;
+  --theme--page_preview-width: 977px;
+  --theme--page_preview_banner-height: 20vh;
+
+  --theme--font_sans: -apple-system, BlinkMacSystemFont, 'Segoe UI', Helvetica,
+    'Apple Color Emoji', Arial, sans-serif, 'Segoe UI Emoji', 'Segoe UI Symbol';
+  --theme--font_serif: Lyon-Text, Georgia, YuMincho, 'Yu Mincho', 'Hiragino Mincho ProN',
+    'Hiragino Mincho Pro', 'Songti TC', 'Songti SC', SimSun, 'Nanum Myeongjo', NanumMyeongjo,
+    Batang, serif;
+  --theme--font_mono: iawriter-mono, Nitti, Menlo, Courier, monospace;
+  --theme--font_code: SFMono-Regular, Consolas, 'Liberation Mono', Menlo, Courier, monospace;
+
+  --theme--accent_blue: rgb(46, 170, 220);
+  --theme--accent_blue-selection: rgb(46, 170, 220, 0.25);
+  --theme--accent_blue-hover: rgb(6, 156, 205);
+  --theme--accent_blue-active: rgb(0, 141, 190);
+  --theme--accent_blue-text: #fff;
+  --theme--accent_red: #eb5757;
+  --theme--accent_red-button: rgba(235, 87, 87, 0.1);
+  --theme--accent_red-text: #fff;
+}
+
+:root.light {
+  --theme--bg: #fff;
+  --theme--bg_secondary: rgb(247, 246, 243);
+  --theme--bg_card: #fff;
+
+  --theme--scrollbar_track: #edece9;
+  --theme--scrollbar_thumb: #d3d1cb;
+  --theme--scrollbar_thumb-hover: #aeaca6;
+
+  --theme--ui_shadow: rgba(15, 15, 15, 0.05);
+  --theme--ui_divider: rgb(237, 237, 236);
+  --theme--ui_interactive-hover: rgba(55, 53, 47, 0.08);
+  --theme--ui_interactive-active: rgba(55, 53, 47, 0.16);
+  --theme--ui_toggle-on: var(--theme--accent_blue);
+  --theme--ui_toggle-off: rgba(135, 131, 120, 0.3);
+  --theme--ui_toggle-feature: #fff;
+  --theme--ui_input: rgba(242, 241, 238, 0.6);
+  --theme--ui_tooltip: rgb(15, 15, 15);
+  --theme--ui_tooltip-title: rgba(255, 255, 255, 0.9);
+  --theme--ui_tooltip-description: rgba(206, 205, 202, 0.6);
+  --theme--ui_corner_action: white;
+  --theme--ui_corner_action-hover: rgb(239, 239, 238);
+  --theme--ui_corner_action-active: rgb(223, 223, 222);
+
+  --theme--icon: rgba(55, 53, 47, 0.8);
+  --theme--icon_secondary: rgba(55, 53, 47, 0.4);
+
+  --theme--text: rgb(55, 43, 47);
+  --theme--text_secondary: rgba(55, 43, 47, 0.6);
+
+  --theme--text_gray: rgba(120, 119, 116, 1);
+  --theme--text_brown: rgba(159, 107, 83, 1);
+  --theme--text_orange: rgba(217, 115, 13, 1);
+  --theme--text_yellow: rgba(203, 145, 47, 1);
+  --theme--text_green: rgba(68, 131, 97, 1);
+  --theme--text_blue: rgba(51, 126, 169, 1);
+  --theme--text_purple: rgba(144, 101, 176, 1);
+  --theme--text_pink: rgba(193, 76, 138, 1);
+  --theme--text_red: rgba(212, 76, 71, 1);
+
+  --theme--highlight_gray: rgba(241, 241, 239, 1);
+  --theme--highlight_gray-text: currentColor;
+  --theme--highlight_brown: rgba(244, 238, 238, 1);
+  --theme--highlight_brown-text: currentColor;
+  --theme--highlight_orange: rgba(251, 236, 221, 1);
+  --theme--highlight_orange-text: currentColor;
+  --theme--highlight_yellow: rgba(251, 243, 219, 1);
+  --theme--highlight_yellow-text: currentColor;
+  --theme--highlight_green: rgba(237, 243, 236, 1);
+  --theme--highlight_green-text: currentColor;
+  --theme--highlight_blue: rgba(231, 243, 248, 1);
+  --theme--highlight_blue-text: currentColor;
+  --theme--highlight_purple: rgba(244, 240, 247, 0.8);
+  --theme--highlight_purple-text: currentColor;
+  --theme--highlight_pink: rgba(249, 238, 243, 0.8);
+  --theme--highlight_pink-text: currentColor;
+  --theme--highlight_red: rgba(253, 235, 236, 1);
+  --theme--highlight_red-text: currentColor;
+
+  --theme--callout_gray: rgb(241, 241, 239);
+  --theme--callout_gray-text: currentColor;
+  --theme--callout_brown: rgb(244, 238, 238);
+  --theme--callout_brown-text: currentColor;
+  --theme--callout_orange: rgb(251, 236, 221);
+  --theme--callout_orange-text: currentColor;
+  --theme--callout_yellow: rgb(251, 243, 219);
+  --theme--callout_yellow-text: currentColor;
+  --theme--callout_green: rgb(237, 243, 236);
+  --theme--callout_green-text: currentColor;
+  --theme--callout_blue: rgb(231, 243, 248);
+  --theme--callout_blue-text: currentColor;
+  --theme--callout_purple: rgba(244, 240, 247, 0.8);
+  --theme--callout_purple-text: currentColor;
+  --theme--callout_pink: rgba(249, 238, 243, 0.8);
+  --theme--callout_pink-text: currentColor;
+  --theme--callout_red: rgb(253, 235, 236);
+  --theme--callout_red-text: currentColor;
+
+  --theme--tag_default: rgba(206, 205, 202, 0.5);
+  --theme--tag_default-text: var(--theme--text);
+  --theme--tag_light_gray: rgba(227, 226, 224, 0.5);
+  --theme--tag_light_gray-text: rgb(50, 48, 44);
+  --theme--tag_gray: rgb(227, 226, 224);
+  --theme--tag_gray-text: rgb(50, 48, 44);
+  --theme--tag_brown: rgb(238, 224, 218);
+  --theme--tag_brown-text: rgb(68, 42, 30);
+  --theme--tag_orange: rgb(250, 222, 201);
+  --theme--tag_orange-text: rgb(73, 41, 14);
+  --theme--tag_yellow: rgb(253, 236, 200);
+  --theme--tag_yellow-text: rgb(64, 44, 27);
+  --theme--tag_green: rgb(219, 237, 219);
+  --theme--tag_green-text: rgb(28, 56, 41);
+  --theme--tag_blue: rgb(211, 229, 239);
+  --theme--tag_blue-text: rgb(24, 51, 71);
+  --theme--tag_purple: rgb(232, 222, 238);
+  --theme--tag_purple-text: rgb(65, 36, 84);
+  --theme--tag_pink: rgb(245, 224, 233);
+  --theme--tag_pink-text: rgb(76, 35, 55);
+  --theme--tag_red: rgb(255, 226, 221);
+  --theme--tag_red-text: rgb(93, 23, 21);
+
+  --theme--board_light_gray: rgba(249, 249, 245, 0.5);
+  --theme--board_light_gray-card: white;
+  --theme--board_light_gray-card_text: inherit;
+  --theme--board_light_gray-text: rgba(145, 145, 142, 0.5);
+  --theme--board_gray: rgba(247, 247, 245, 0.7);
+  --theme--board_gray-card: white;
+  --theme--board_gray-card_text: inherit;
+  --theme--board_gray-text: rgb(145, 145, 142);
+  --theme--board_brown: rgba(250, 246, 245, 0.7);
+  --theme--board_brown-card: white;
+  --theme--board_brown-card_text: inherit;
+  --theme--board_brown-text: rgb(187, 132, 108);
+  --theme--board_orange: rgba(252, 245, 242, 0.7);
+  --theme--board_orange-card: white;
+  --theme--board_orange-card_text: inherit;
+  --theme--board_orange-text: rgb(215, 129, 58);
+  --theme--board_yellow: rgba(250, 247, 237, 0.7);
+  --theme--board_yellow-card: white;
+  --theme--board_yellow-card_text: inherit;
+  --theme--board_yellow-text: rgb(203, 148, 51);
+  --theme--board_green: rgba(244, 248, 243, 0.7);
+  --theme--board_green-card: white;
+  --theme--board_green-card_text: inherit;
+  --theme--board_green-text: rgb(108, 155, 125);
+  --theme--board_blue: rgba(241, 248, 251, 0.7);
+  --theme--board_blue-card: white;
+  --theme--board_blue-card_text: inherit;
+  --theme--board_blue-text: rgb(91, 151, 189);
+  --theme--board_purple: rgba(249, 246, 252, 0.7);
+  --theme--board_purple-card: white;
+  --theme--board_purple-card_text: inherit;
+  --theme--board_purple-text: rgb(167, 130, 195);
+  --theme--board_pink: rgba(251, 245, 251, 0.7);
+  --theme--board_pink-card: white;
+  --theme--board_pink-card_text: inherit;
+  --theme--board_pink-text: rgb(205, 116, 159);
+  --theme--board_red: rgba(253, 245, 243, 0.7);
+  --theme--board_red-card: white;
+  --theme--board_red-card_text: inherit;
+  --theme--board_red-text: rgb(225, 111, 100);
+
+  --theme--code_inline: rgba(135, 131, 120, 0.15);
+  --theme--code_inline-text: #eb5757;
+
+  --theme--code: #f7f6f3;
+  --theme--code_plain: var(--theme--text);
+  --theme--code_property: #905;
+  --theme--code_tag: var(--theme--code_property);
+  --theme--code_boolean: var(--theme--code_property);
+  --theme--code_number: var(--theme--code_property);
+  --theme--code_constant: var(--theme--code_property);
+  --theme--code_symbol: var(--theme--code_property);
+  --theme--code_deleted: var(--theme--code_property);
+  --theme--code_selector: #690;
+  --theme--code_attr-name: var(--theme--code_selector);
+  --theme--code_string: var(--theme--code_selector);
+  --theme--code_char: var(--theme--code_selector);
+  --theme--code_builtin: var(--theme--code_selector);
+  --theme--code_inserted: var(--theme--code_selector);
+  --theme--code_operator: #9a6e3a;
+  --theme--code_entity: var(--theme--code_operator);
+  --theme--code_url: var(--theme--code_operator);
+  --theme--code_variable: var(--theme--code_regex);
+  --theme--code_comment: slategray;
+  --theme--code_cdata: var(--theme--code_comment);
+  --theme--code_prolog: var(--theme--code_comment);
+  --theme--code_doctype: var(--theme--code_comment);
+  --theme--code_atrule: #07a;
+  --theme--code_attr-value: var(--theme--code_atrule);
+  --theme--code_keyword: var(--theme--code_atrule);
+  --theme--code_regex: #e90;
+  --theme--code_important: var(--theme--code_regex);
+  --theme--code_function: #dd4a68;
+  --theme--code_class-name: var(--theme--code_function);
+  --theme--code_parameter: var(--theme--code_plain);
+  --theme--code_decorator: var(--theme--code_plain);
+  --theme--code_id: var(--theme--code_plain);
+  --theme--code_class: var(--theme--code_plain);
+  --theme--code_pseudo-element: var(--theme--code_plain);
+  --theme--code_pseudo-class: var(--theme--code_plain);
+  --theme--code_attribute: var(--theme--code_plain);
+  --theme--code_value: var(--theme--code_plain);
+  --theme--code_unit: var(--theme--code_plain);
+  --theme--code_punctuation: #999;
+  --theme--code_annotation: var(--theme--code_plain);
+}
+
+:root.dark {
+  --theme--bg: rgb(47, 52, 55);
+  --theme--bg_secondary: rgb(55, 60, 63);
+  --theme--bg_card: rgb(63, 68, 71);
+
+  --theme--scrollbar_track: rgba(202, 204, 206, 0.04);
+  --theme--scrollbar_thumb: #474c50;
+  --theme--scrollbar_thumb-hover: rgba(202, 204, 206, 0.3);
+
+  --theme--ui_shadow: rgba(15, 15, 15, 0.15);
+  --theme--ui_divider: rgb(255, 255, 255, 0.07);
+  --theme--ui_interactive-hover: rgba(255, 255, 255, 0.1);
+  --theme--ui_interactive-active: rgb(63, 68, 71);
+  --theme--ui_toggle-on: var(--theme--accent_blue);
+  --theme--ui_toggle-off: rgba(202, 204, 206, 0.3);
+  --theme--ui_toggle-feature: #fff;
+  --theme--ui_input: rgba(15, 15, 15, 0.3);
+  --theme--ui_tooltip: rgb(202, 204, 206);
+  --theme--ui_tooltip-title: rgb(15, 15, 15);
+  --theme--ui_tooltip-description: rgba(47, 52, 55, 0.6);
+  --theme--ui_corner_action: rgb(80, 85, 88);
+  --theme--ui_corner_action-hover: rgb(98, 102, 104);
+  --theme--ui_corner_action-active: rgb(120, 123, 123);
+
+  --theme--icon: rgba(202, 204, 206);
+  --theme--icon_secondary: rgb(202, 204, 206, 0.6);
+
+  --theme--text: rgba(255, 255, 255, 0.9);
+  --theme--text_secondary: rgba(255, 255, 255, 0.6);
+
+  --theme--text_gray: rgba(159, 164, 169, 1);
+  --theme--text_brown: rgba(212, 150, 117, 1);
+  --theme--text_orange: rgba(217, 133, 56, 1);
+  --theme--text_yellow: rgba(201, 145, 38, 1);
+  --theme--text_green: rgba(113, 178, 131, 1);
+  --theme--text_blue: rgba(102, 170, 218, 1);
+  --theme--text_purple: rgba(176, 152, 217, 1);
+  --theme--text_pink: rgba(223, 132, 209, 1);
+  --theme--text_red: rgba(234, 135, 140, 1);
+
+  --theme--highlight_gray: rgba(60, 65, 68, 1);
+  --theme--highlight_gray-text: currentColor;
+  --theme--highlight_brown: rgba(76, 61, 53, 1);
+  --theme--highlight_brown-text: currentColor;
+  --theme--highlight_orange: rgba(85, 59, 41, 1);
+  --theme--highlight_orange-text: currentColor;
+  --theme--highlight_yellow: rgba(79, 64, 41, 1);
+  --theme--highlight_yellow-text: currentColor;
+  --theme--highlight_green: rgba(46, 68, 58, 1);
+  --theme--highlight_green-text: currentColor;
+  --theme--highlight_blue: rgba(45, 66, 86, 1);
+  --theme--highlight_blue-text: currentColor;
+  --theme--highlight_purple: rgba(69, 58, 91, 1);
+  --theme--highlight_purple-text: currentColor;
+  --theme--highlight_pink: rgba(81, 56, 77, 1);
+  --theme--highlight_pink-text: currentColor;
+  --theme--highlight_red: rgba(94, 52, 54, 1);
+  --theme--highlight_red-text: currentColor;
+
+  --theme--callout_gray: rgb(60, 65, 68);
+  --theme--callout_gray-text: currentColor;
+  --theme--callout_brown: rgb(76, 61, 53);
+  --theme--callout_brown-text: currentColor;
+  --theme--callout_orange: rgb(85, 59, 41);
+  --theme--callout_orange-text: currentColor;
+  --theme--callout_yellow: rgb(79, 64, 41);
+  --theme--callout_yellow-text: currentColor;
+  --theme--callout_green: rgb(46, 68, 58);
+  --theme--callout_green-text: currentColor;
+  --theme--callout_blue: rgb(45, 66, 86);
+  --theme--callout_blue-text: currentColor;
+  --theme--callout_purple: rgb(69, 58, 91);
+  --theme--callout_purple-text: currentColor;
+  --theme--callout_pink: rgb(81, 56, 77);
+  --theme--callout_pink-text: currentColor;
+  --theme--callout_red: rgb(94, 52, 54);
+  --theme--callout_red-text: currentColor;
+
+  --theme--tag_default: rgba(206, 205, 202, 0.5);
+  --theme--tag_default-text: var(--theme--text);
+  --theme--tag_light_gray: rgba(71, 76, 80, 0.7);
+  --theme--tag_light_gray-text: rgba(255, 255, 255, 0.88);
+  --theme--tag_gray: rgb(71, 76, 80);
+  --theme--tag_gray-text: rgba(255, 255, 255, 0.88);
+  --theme--tag_brown: rgb(92, 71, 61);
+  --theme--tag_brown-text: rgba(255, 255, 255, 0.88);
+  --theme--tag_orange: rgb(136, 84, 44);
+  --theme--tag_orange-text: rgba(255, 255, 255, 0.88);
+  --theme--tag_yellow: rgb(146, 118, 63);
+  --theme--tag_yellow-text: rgba(255, 255, 255, 0.88);
+  --theme--tag_green: rgb(50, 82, 65);
+  --theme--tag_green-text: rgba(255, 255, 255, 0.88);
+  --theme--tag_blue: rgb(42, 78, 107);
+  --theme--tag_blue-text: rgba(255, 255, 255, 0.88);
+  --theme--tag_purple: rgb(83, 68, 116);
+  --theme--tag_purple-text: rgba(255, 255, 255, 0.88);
+  --theme--tag_pink: rgb(106, 59, 99);
+  --theme--tag_pink-text: rgba(255, 255, 255, 0.88);
+  --theme--tag_red: rgb(122, 54, 59);
+  --theme--tag_red-text: rgba(255, 255, 255, 0.88);
+
+  --theme--board_light_gray: rgba(51, 55, 59, 0.7);
+  --theme--board_light_gray-card: rgba(60, 65, 68, 0.7);
+  --theme--board_light_gray-card_text: inherit;
+  --theme--board_light_gray-text: rgba(107, 112, 116, 0.7);
+  --theme--board_gray: rgb(51, 55, 59);
+  --theme--board_gray-card: rgb(60, 65, 68);
+  --theme--board_gray-card_text: inherit;
+  --theme--board_gray-text: rgb(107, 112, 116);
+  --theme--board_brown: rgb(59, 54, 51);
+  --theme--board_brown-card: rgb(76, 61, 53);
+  --theme--board_brown-card_text: inherit;
+  --theme--board_brown-text: rgb(155, 98, 69);
+  --theme--board_orange: rgb(61, 54, 49);
+  --theme--board_orange-card: rgb(85, 59, 41);
+  --theme--board_orange-text: rgb(168, 92, 30);
+  --theme--board_yellow: rgb(56, 55, 49);
+  --theme--board_yellow-card: rgb(79, 64, 41);
+  --theme--board_yellow-card_text: inherit;
+  --theme--board_yellow-text: rgb(137, 107, 42);
+  --theme--board_green: rgb(49, 57, 53);
+  --theme--board_green-card: rgb(46, 68, 58);
+  --theme--board_green-card_text: inherit;
+  --theme--board_green-text: rgb(61, 124, 86);
+  --theme--board_blue: rgb(49, 56, 64);
+  --theme--board_blue-card: rgb(45, 66, 86);
+  --theme--board_blue-card_text: inherit;
+  --theme--board_blue-text: rgb(46, 117, 164);
+  --theme--board_purple: rgb(57, 53, 65);
+  --theme--board_purple-card: rgb(69, 58, 91);
+  --theme--board_purple-card_text: inherit;
+  --theme--board_purple-text: rgb(123, 96, 180);
+  --theme--board_pink: rgb(60, 53, 58);
+  --theme--board_pink-card: rgb(81, 56, 77);
+  --theme--board_pink-card_text: inherit;
+  --theme--board_pink-text: rgb(169, 76, 157);
+  --theme--board_red: rgb(66, 51, 51);
+  --theme--board_red-card: rgb(94, 52, 54);
+  --theme--board_red-card_text: inherit;
+  --theme--board_red-text: rgb(194, 65, 82);
+
+  --theme--code_inline: rgba(135, 131, 120, 0.15);
+  --theme--code_inline-text: #eb5757;
+
+  --theme--code: rgb(63, 68, 71);
+  --theme--code_plain: var(--theme--text);
+  --theme--code_property: hsl(350, 40%, 70%);
+  --theme--code_tag: var(--theme--code_property);
+  --theme--code_boolean: var(--theme--code_property);
+  --theme--code_number: var(--theme--code_property);
+  --theme--code_constant: var(--theme--code_property);
+  --theme--code_symbol: var(--theme--code_property);
+  --theme--code_deleted: #f00;
+  --theme--code_selector: hsl(75, 70%, 60%);
+  --theme--code_attr-name: var(--theme--code_selector);
+  --theme--code_string: var(--theme--code_selector);
+  --theme--code_char: var(--theme--code_selector);
+  --theme--code_builtin: var(--theme--code_selector);
+  --theme--code_inserted: var(--theme--code_selector);
+  --theme--code_operator: hsl(40, 90%, 60%);
+  --theme--code_entity: var(--theme--code_operator);
+  --theme--code_url: var(--theme--code_operator);
+  --theme--code_variable: var(--theme--code_operator);
+  --theme--code_comment: hsl(30, 20%, 50%);
+  --theme--code_cdata: var(--theme--code_comment);
+  --theme--code_prolog: var(--theme--code_comment);
+  --theme--code_doctype: var(--theme--code_comment);
+  --theme--code_atrule: hsl(350, 40%, 70%);
+  --theme--code_attr-value: var(--theme--code_atrule);
+  --theme--code_keyword: var(--theme--code_atrule);
+  --theme--code_regex: #e90;
+  --theme--code_important: var(--theme--code_regex);
+  --theme--code_function: var(--theme--code_plain);
+  --theme--code_class-name: var(--theme--code_function);
+  --theme--code_parameter: var(--theme--code_plain);
+  --theme--code_decorator: var(--theme--code_plain);
+  --theme--code_id: var(--theme--code_plain);
+  --theme--code_class: var(--theme--code_plain);
+  --theme--code_pseudo-element: var(--theme--code_plain);
+  --theme--code_pseudo-class: var(--theme--code_plain);
+  --theme--code_attribute: var(--theme--code_plain);
+  --theme--code_value: var(--theme--code_plain);
+  --theme--code_unit: var(--theme--code_plain);
+  --theme--code_punctuation: var(--theme--code_plain);
+  --theme--code_annotation: var(--theme--code_plain);
+}
diff --git a/src/mods/topbar-icons/client.mjs b/src/mods/topbar-icons/client.mjs
new file mode 100644
index 0000000..0e57db2
--- /dev/null
+++ b/src/mods/topbar-icons/client.mjs
@@ -0,0 +1,59 @@
+/**
+ * notion-enhancer: topbar icons
+ * (c) 2020 CloudHill <rl.cloudhill@gmail.com> (https://github.com/CloudHill)
+ * (c) 2021 dragonwocky <thedragonring.bod@gmail.com> (https://dragonwocky.me/)
+ * (https://notion-enhancer.github.io/) under the MIT license
+ */
+
+'use strict';
+
+export default async function ({ web, components }, db) {
+  await web.whenReady(['.notion-topbar-action-buttons']);
+
+  const observeButton = (selector, label = '') => {
+    const updateButton = () => {
+      const $btns = document.querySelectorAll(selector);
+      $btns.forEach(($btn) => {
+        $btn.style.width = 'auto';
+        $btn.style.fontSize = '14px';
+        $btn.style.lineHeight = '1.2';
+        $btn.style.paddingLeft = '8px';
+        $btn.style.paddingRight = '8px';
+        const innerHTML = label || $btn.ariaLabel;
+        if ($btn.innerHTML !== innerHTML) $btn.innerHTML = innerHTML;
+      });
+    };
+    web.addDocumentObserver(updateButton, [selector]);
+    updateButton();
+  };
+
+  if ((await db.get(['share'])) === true) {
+    const selector = '.notion-topbar-share-menu',
+      label = await components.feather('share-2', {
+        style: 'width:16px;height:16px;color:var(--theme--icon);',
+      });
+    observeButton(selector, label);
+  }
+
+  if ((await db.get(['comments'])) === false) {
+    const selector = '.notion-topbar-comments-button';
+    observeButton(selector);
+  }
+
+  if ((await db.get(['updates'])) === false) {
+    const selector =
+      '.notion-topbar-updates-button, .notion-topbar-share-menu ~ [aria-label="Updates"]';
+    observeButton(selector);
+  }
+
+  if ((await db.get(['favorite'])) === false) {
+    const selector = '.notion-topbar-share-menu ~ [aria-label^="Fav"]';
+    observeButton(selector);
+  }
+
+  if ((await db.get(['more'])) === false) {
+    const selector = '.notion-topbar-more-button',
+      label = 'More';
+    observeButton(selector, label);
+  }
+}
diff --git a/src/mods/topbar-icons/mod.json b/src/mods/topbar-icons/mod.json
new file mode 100644
index 0000000..895872e
--- /dev/null
+++ b/src/mods/topbar-icons/mod.json
@@ -0,0 +1,57 @@
+{
+  "name": "topbar icons",
+  "id": "e0700ce3-a9ae-45f5-92e5-610ded0e348d",
+  "version": "0.3.0",
+  "description": "choose between text or icons for the topbar buttons.",
+  "preview": "topbar-icons.jpg",
+  "tags": ["extension", "customisation"],
+  "authors": [
+    {
+      "name": "CloudHill",
+      "email": "rh.cloudhill@gmail.com",
+      "homepage": "https://github.com/CloudHill",
+      "avatar": "https://avatars.githubusercontent.com/u/54142180"
+    }
+  ],
+  "js": {
+    "client": ["client.mjs"]
+  },
+  "css": {},
+  "options": [
+    {
+      "type": "toggle",
+      "key": "share",
+      "label": "share",
+      "tooltip": "**on = icon, off = text**",
+      "value": false
+    },
+    {
+      "type": "toggle",
+      "key": "comments",
+      "label": "comments",
+      "tooltip": "**on = icon, off = text**",
+      "value": true
+    },
+    {
+      "type": "toggle",
+      "key": "updates",
+      "label": "updates",
+      "tooltip": "**on = icon, off = text**",
+      "value": true
+    },
+    {
+      "type": "toggle",
+      "key": "favorite",
+      "label": "favorite",
+      "tooltip": "**on = icon, off = text**",
+      "value": true
+    },
+    {
+      "type": "toggle",
+      "key": "more",
+      "label": "more (3 dots)",
+      "tooltip": "**on = icon, off = text**",
+      "value": true
+    }
+  ]
+}
diff --git a/src/mods/topbar-icons/topbar-icons.jpg b/src/mods/topbar-icons/topbar-icons.jpg
new file mode 100644
index 0000000..04f8c75
Binary files /dev/null and b/src/mods/topbar-icons/topbar-icons.jpg differ
diff --git a/src/mods/tray/client.mjs b/src/mods/tray/client.mjs
new file mode 100644
index 0000000..051c743
--- /dev/null
+++ b/src/mods/tray/client.mjs
@@ -0,0 +1,17 @@
+/**
+ * notion-enhancer: tray
+ * (c) 2021 dragonwocky <thedragonring.bod@gmail.com> (https://dragonwocky.me/)
+ * (https://notion-enhancer.github.io/) under the MIT license
+ */
+
+export default async function ({ electron, env, web }, db) {
+  const runInBackground = await db.get(['run_in_background']);
+  if (!runInBackground) return;
+
+  // force new window creation on create new window hotkey
+  // hotkey is built into notion, so can't be changed,
+  // but is broken by this mod's window duplication prevention
+  web.addHotkeyListener([env.name === 'darwin' ? 'Meta' : 'Ctrl', 'Shift', 'N'], () =>
+    electron.sendMessage('create-new-window')
+  );
+}
diff --git a/src/mods/tray/createWindow.cjs b/src/mods/tray/createWindow.cjs
new file mode 100644
index 0000000..4589738
--- /dev/null
+++ b/src/mods/tray/createWindow.cjs
@@ -0,0 +1,58 @@
+/**
+ * notion-enhancer: tray
+ * (c) 2021 dragonwocky <thedragonring.bod@gmail.com> (https://dragonwocky.me/)
+ * (https://notion-enhancer.github.io/) under the MIT license
+ */
+
+'use strict';
+
+module.exports = async function (api, db, __exports, __eval) {
+  const electron = require('electron'),
+    urlHelpers = api.electron.notionRequire('helpers/urlHelpers'),
+    runInBackground = await db.get(['run_in_background']);
+  if (!runInBackground) return;
+
+  let appQuit = false;
+  electron.app.once('before-quit', () => {
+    appQuit = true;
+  });
+
+  const notionCreateWindow = __exports.createWindow;
+  __exports.createWindow = (relativeUrl = '', args) => {
+    const windows = api.electron.getNotionWindows();
+    if (windows.length) windows.forEach((win) => win.show());
+
+    if (relativeUrl || !windows.length) {
+      // hijack close event to hide instead
+      const window = notionCreateWindow(relativeUrl, args);
+      window.prependListener('close', (e) => {
+        const isLastWindow = electron.BrowserWindow.getAllWindows().length === 1;
+        if (!appQuit && isLastWindow) {
+          window.hide();
+          e.preventDefault();
+          throw new Error('<fake error>: prevent window close');
+        }
+      });
+
+      // no other windows yet + opened at startup = hide
+      const wasOpenedAtStartup =
+        process.argv.includes('--startup') ||
+        app.getLoginItemSettings({ args: ['--startup'] }).wasOpenedAtLogin;
+      if (!windows.length && wasOpenedAtStartup) {
+        window.once('ready-to-show', () => window.hide());
+      }
+
+      return window;
+    } else {
+      const window = api.electron.getFocusedNotionWindow() || windows[0];
+      // prevents duplicate windows on dock/taskbar click
+      window.focus();
+      if (relativeUrl) {
+        // handle requests passed via the notion:// protocol
+        // or ctrl+click
+        window.loadURL(urlHelpers.getIndexUrl(relativeUrl));
+      }
+      return window;
+    }
+  };
+};
diff --git a/src/mods/tray/main.cjs b/src/mods/tray/main.cjs
new file mode 100644
index 0000000..057161c
--- /dev/null
+++ b/src/mods/tray/main.cjs
@@ -0,0 +1,108 @@
+/**
+ * notion-enhancer: tray
+ * (c) 2021 dragonwocky <thedragonring.bod@gmail.com> (https://dragonwocky.me/)
+ * (https://notion-enhancer.github.io/) under the MIT license
+ */
+
+'use strict';
+
+let tray;
+
+module.exports = async function (api, db, __exports, __eval) {
+  const { env, registry } = api,
+    electron = require('electron'),
+    path = require('path'),
+    enhancerIcon = path.resolve(`${__dirname}/../../media/colour-x16.png`),
+    hotkey = await db.get(['hotkey']),
+    openAtStartup = await db.get(['startup']),
+    runInBackground = await db.get(['run_in_background']),
+    menuHotkey = await (
+      await registry.db('a6621988-551d-495a-97d8-3c568bca2e9e')
+    ).get(['hotkey']);
+
+  const toggleWindows = (checkFocus = true) => {
+    const windows = electron.BrowserWindow.getAllWindows();
+    if (runInBackground) {
+      // hide
+      if (windows.some((win) => (checkFocus ? win.isFocused() : true) && win.isVisible())) {
+        windows.forEach((win) => [win.isFocused() && win.blur(), win.hide()]);
+      } else windows.forEach((win) => win.show());
+    } else {
+      // minimize
+      if (windows.some((win) => (checkFocus ? win.isFocused() : true) && !win.isMinimized())) {
+        windows.forEach((win) => win.minimize());
+      } else windows.forEach((win) => win.restore());
+    }
+  };
+
+  await electron.app.whenReady();
+  electron.app.setLoginItemSettings({ openAtLogin: openAtStartup, args: ['--startup'] });
+
+  tray = new electron.Tray(enhancerIcon);
+  tray.setToolTip('notion-enhancer');
+  tray.on('click', () => toggleWindows(false));
+  electron.globalShortcut.register(hotkey, toggleWindows);
+
+  // connects to client hotkey listener
+  // manually forces new window creation
+  // since notion's default is broken by
+  // duplicate window prevention
+  const createWindow = () => {
+    const { createWindow } = api.electron.notionRequire('main/createWindow.js');
+    createWindow('/');
+  };
+  electron.ipcMain.on('notion-enhancer:create-new-window', createWindow);
+
+  const contextMenu = electron.Menu.buildFromTemplate([
+    {
+      type: 'normal',
+      label: 'notion-enhancer',
+      icon: enhancerIcon,
+      enabled: false,
+    },
+    { type: 'separator' },
+    {
+      type: 'normal',
+      label: 'docs',
+      click: () => electron.shell.openExternal('https://notion-enhancer.github.io/'),
+    },
+    {
+      type: 'normal',
+      label: 'source code',
+      click: () => electron.shell.openExternal('https://github.com/notion-enhancer/'),
+    },
+    {
+      type: 'normal',
+      label: 'community',
+      click: () => electron.shell.openExternal('https://discord.gg/sFWPXtA'),
+    },
+    {
+      type: 'normal',
+      label: 'enhancements menu',
+      accelerator: menuHotkey,
+      click: env.focusMenu,
+    },
+    { type: 'separator' },
+    {
+      type: 'normal',
+      label: 'toggle visibility',
+      accelerator: hotkey,
+      click: toggleWindows,
+    },
+    {
+      type: 'normal',
+      label: 'new window',
+      click: createWindow,
+      accelerator: 'CmdOrCtrl+Shift+N',
+    },
+    {
+      label: 'relaunch',
+      click: env.reload,
+    },
+    {
+      label: 'quit',
+      role: 'quit',
+    },
+  ]);
+  tray.setContextMenu(contextMenu);
+};
diff --git a/src/mods/tray/mod.json b/src/mods/tray/mod.json
new file mode 100644
index 0000000..7e3cc02
--- /dev/null
+++ b/src/mods/tray/mod.json
@@ -0,0 +1,47 @@
+{
+  "name": "tray",
+  "id": "f96f4a73-21af-4e3f-a68f-ab4976b020da",
+  "environments": ["linux", "win32", "darwin"],
+  "version": "0.11.0",
+  "description": "adds an icon to the system tray/menubar for extra app/window management features (e.g. open on startup, a global hotkey).",
+  "preview": "tray.jpg",
+  "tags": ["extension", "app"],
+  "authors": [
+    {
+      "name": "dragonwocky",
+      "email": "thedragonring.bod@gmail.com",
+      "homepage": "https://dragonwocky.me/",
+      "avatar": "https://dragonwocky.me/avatar.jpg"
+    }
+  ],
+  "css": {},
+  "js": {
+    "client": ["client.mjs"],
+    "electron": [
+      { "source": "main.cjs", "target": "main/main.js" },
+      { "source": "createWindow.cjs", "target": "main/createWindow.js" }
+    ]
+  },
+  "options": [
+    {
+      "type": "toggle",
+      "key": "startup",
+      "label": "open notion on startup",
+      "tooltip": "**if the 'run notion in the background' option is also enabled, the app will open in the background on startup** (this option may require relaunching the app BEFORE restarting your system to properly take effect)",
+      "value": false
+    },
+    {
+      "type": "toggle",
+      "key": "run_in_background",
+      "label": "run notion in the background",
+      "tooltip": "**pressing the close button or toggling window visibility will hide the app, running notion in the background** (instead of quitting or minimizing it)",
+      "value": true
+    },
+    {
+      "type": "hotkey",
+      "key": "hotkey",
+      "label": "toggle window visibility hotkey",
+      "value": "Ctrl+Shift+A"
+    }
+  ]
+}
diff --git a/src/mods/tray/tray.jpg b/src/mods/tray/tray.jpg
new file mode 100644
index 0000000..af425b0
Binary files /dev/null and b/src/mods/tray/tray.jpg differ
diff --git a/src/mods/truncated-titles/client.mjs b/src/mods/truncated-titles/client.mjs
new file mode 100644
index 0000000..b0fe2d6
--- /dev/null
+++ b/src/mods/truncated-titles/client.mjs
@@ -0,0 +1,66 @@
+/**
+ * notion-enhancer: truncated titles
+ * (c) 2021 admiraldus (https://github.com/admiraldus)
+ * (c) 2021 dragonwocky <thedragonring.bod@gmail.com> (https://dragonwocky.me/)
+ * (https://notion-enhancer.github.io/) under the MIT license
+ */
+
+export default async function ({ web, components }, db) {
+  const enhanceTableTitles = await db.get(['tables']),
+    enhanceTimelineItems = await db.get(['timelines']),
+    tableCellSelector = '.notion-table-view-header-cell',
+    tableTitleSelector = `${tableCellSelector} div[style*="text-overflow"]`,
+    timelineItemSelector = '.notion-timeline-item',
+    $elements = [];
+
+  const addTooltips = () => {
+    if (enhanceTableTitles) {
+      document.querySelectorAll(tableTitleSelector).forEach(($tableTitle) => {
+        if ($elements.includes($tableTitle)) return;
+
+        if ($tableTitle.scrollWidth > $tableTitle.clientWidth) {
+          components.addTooltip(
+            $tableTitle.parentElement.parentElement.parentElement,
+            web.html`<span><b>${web.escape($tableTitle.innerText)}</b></span>`,
+            750
+          );
+          $elements.push($tableTitle);
+        }
+      });
+    }
+
+    if (enhanceTimelineItems) {
+      document.querySelectorAll(timelineItemSelector).forEach(($timelineItem) => {
+        const $title = $timelineItem.nextElementSibling.firstElementChild;
+        $title.style.position = 'absolute';
+        $title.style.left = $timelineItem.style.left;
+
+        if ($elements.includes($timelineItem)) return;
+        $elements.push($timelineItem);
+
+        $title.style.width = $timelineItem.clientWidth + 'px';
+        $title.firstElementChild.firstElementChild.style.maxWidth =
+          $timelineItem.clientWidth + 'px';
+        $timelineItem.addEventListener('mouseover', (event) => {
+          $title.style.width = '100%';
+          $title.firstElementChild.firstElementChild.style.maxWidth = '400px';
+        });
+        $timelineItem.addEventListener('mouseout', async (event) => {
+          if (!$timelineItem.matches(':hover')) {
+            $title.style.width = $timelineItem.clientWidth + 'px';
+            $title.firstElementChild.firstElementChild.style.maxWidth =
+              $timelineItem.clientWidth + 'px';
+          }
+        });
+      });
+    }
+  };
+
+  await web.whenReady();
+  addTooltips();
+  web.addDocumentObserver(addTooltips, [
+    tableCellSelector,
+    timelineItemSelector,
+    `${timelineItemSelector} + div > :first-child`,
+  ]);
+}
diff --git a/src/mods/truncated-titles/mod.json b/src/mods/truncated-titles/mod.json
new file mode 100644
index 0000000..eb2cf39
--- /dev/null
+++ b/src/mods/truncated-titles/mod.json
@@ -0,0 +1,33 @@
+{
+  "name": "truncated titles",
+  "id": "1794c0bd-7b96-46ad-aa0b-fc4bd76fc7fb",
+  "version": "0.2.0",
+  "description": "see the full text of a truncated title on hover.",
+  "preview": "truncated-titles.jpg",
+  "tags": ["extension", "layout"],
+  "authors": [
+    {
+      "name": "admiraldus",
+      "homepage": "https://github.com/admiraldus",
+      "avatar": "https://raw.githubusercontent.com/admiraldus/admiraldus/main/module.gif"
+    }
+  ],
+  "js": {
+    "client": ["client.mjs"]
+  },
+  "css": {},
+  "options": [
+    {
+      "type": "toggle",
+      "key": "tables",
+      "label": "table titles",
+      "value": true
+    },
+    {
+      "type": "toggle",
+      "key": "timelines",
+      "label": "timeline items",
+      "value": true
+    }
+  ]
+}
diff --git a/src/mods/truncated-titles/truncated-titles.jpg b/src/mods/truncated-titles/truncated-titles.jpg
new file mode 100644
index 0000000..94a1cdb
Binary files /dev/null and b/src/mods/truncated-titles/truncated-titles.jpg differ
diff --git a/src/mods/tweaks/client.css b/src/mods/tweaks/client.css
new file mode 100644
index 0000000..dac5ef4
--- /dev/null
+++ b/src/mods/tweaks/client.css
@@ -0,0 +1,132 @@
+/**
+ * notion-enhancer: tweaks
+ * (c) 2021 dragonwocky <thedragonring.bod@gmail.com> (https://dragonwocky.me/)
+ * (c) 2020 arecsu
+ * (https://notion-enhancer.github.io/) under the MIT license
+ */
+
+.enhancer--tweak-responsive_breakpoint
+  .notion-column_list-block
+  [style='display: flex;']
+  > div {
+  width: 100% !important;
+}
+.enhancer--tweak-responsive_breakpoint .notion-column_list-block [style='display: flex;'] {
+  flex-direction: column !important;
+}
+.enhancer--tweak-responsive_breakpoint .notion-app-inner,
+.enhancer--tweak-full_width_pages .notion-app-inner {
+  --theme--page-width: 100%;
+  --theme--page-padding: calc(48px + env(safe-area-inset-left));
+}
+
+.enhancer--tweak-normalise_table_scroll
+  .notion-frame
+  .notion-page-content
+  .notion-collection_view-block,
+.enhancer--tweak-normalise_table_scroll .notion-peek-renderer .notion-collection_view-block,
+.enhancer--tweak-normalise_table_scroll
+  .notion-page-template-modal
+  .notion-collection_view-block,
+.enhancer--tweak-normalise_table_dscroll .notion-collection-view-body .notion-table-view {
+  width: 100% !important;
+  padding: 0 !important;
+}
+.enhancer--tweak-normalise_table_scroll
+  .notion-collection_view-block
+  > [contenteditable]
+  > .notion-scroller
+  > [class$='view'][style*='padding'],
+.enhancer--tweak-normalise_table_scroll
+  .notion-collection_view-block
+  > :first-child[style*='padding-right'] {
+  padding: 1px !important;
+}
+
+.enhancer--tweak-snappy_transitions * {
+  animation-duration: 0s !important;
+  transition-duration: 0s !important;
+}
+.enhancer--tweak-snappy_transitions .notion-selectable-halo {
+  opacity: 1 !important;
+}
+
+.enhancer--tweak-hide_help .notion-help-button {
+  display: none !important;
+}
+
+.enhancer--tweak-hide_slash_for_commands [contenteditable]:empty:after {
+  content: ' ' !important;
+}
+
+.enhancer--tweak-thicker_bold .notion-page-content span[style*='font-weight:600'] {
+  font-weight: 700 !important;
+}
+
+.enhancer--tweak-spaced_lines .notion-page-content .notion-selectable.notion-text-block {
+  line-height: 1.65 !important;
+  margin-top: 0.75em !important;
+}
+
+.enhancer--tweak-condensed_bullets .notion-selectable.notion-bulleted_list-block {
+  margin-top: -1.5px !important;
+  margin-bottom: -1.5px !important;
+}
+
+.enhancer--tweak-bracketed_links .notion-link-token span {
+  border-bottom: none !important;
+}
+.enhancer--tweak-bracketed_links .notion-link-token:before {
+  content: '[[';
+  opacity: 0.7;
+  transition: opacity 100ms ease-in;
+}
+.enhancer--tweak-bracketed_links .notion-link-token:after {
+  content: ']]';
+  opacity: 0.7;
+  transition: opacity 100ms ease-in;
+}
+.enhancer--tweak-bracketed_links .notion-link-token:hover::before,
+.enhancer--tweak-bracketed_links .notion-link-token:hover::after {
+  opacity: 1;
+}
+
+.enhancer--tweak-accented_links .notion-link-token {
+  color: var(--theme--accent_blue) !important;
+}
+.enhancer--tweak-accented_links .notion-link-token span[style*='border-bottom:0.05em'] {
+  opacity: 1 !important;
+  border-color: var(--theme--accent_blue) !important;
+}
+
+.enhancer--tweak-quotation_marks
+  .notion-quote-block
+  [style*='border-left: 3px solid currentcolor;'] {
+  position: relative;
+  padding-left: 24px !important;
+  padding-right: 18px !important;
+}
+.enhancer--tweak-quotation_marks .notion-quote-block [placeholder='Empty quote']::before,
+.enhancer--tweak-quotation_marks .notion-quote-block [placeholder='Empty quote']::after {
+  font-family: Georgia, serif;
+  font-size: 24px;
+  font-weight: bold;
+  position: absolute;
+}
+.enhancer--tweak-quotation_marks .notion-quote-block [placeholder='Empty quote']::before {
+  content: '\201C';
+  left: 8px;
+  top: -2px;
+}
+.enhancer--tweak-quotation_marks .notion-quote-block [placeholder='Empty quote']::after {
+  content: '\201D';
+  right: 2px;
+  bottom: -2px;
+}
+
+.enhancer--tweak-img_alignment-left .notion-image-block {
+  align-self: start !important;
+}
+.enhancer--tweak-img_alignment-right .notion-image-block {
+  align-self: end !important;
+}
diff --git a/src/mods/tweaks/client.mjs b/src/mods/tweaks/client.mjs
new file mode 100644
index 0000000..66a2660
--- /dev/null
+++ b/src/mods/tweaks/client.mjs
@@ -0,0 +1,55 @@
+/**
+ * notion-enhancer: tweaks
+ * (c) 2021 dragonwocky <thedragonring.bod@gmail.com> (https://dragonwocky.me/)
+ * (https://notion-enhancer.github.io/) under the MIT license
+ */
+
+'use strict';
+
+export default async function ({ web }, db) {
+  const cssInsert = await db.get(['insert.css']);
+  if (cssInsert?.filename) {
+    document.head.append(
+      web.html`<style id="enhancer--tweak-${cssInsert.filename}">${cssInsert.content}</style>`
+    );
+  }
+
+  const responsiveBreakpointPx = +(await db.get(['tweak.responsive_breakpoint_px'])),
+    responsiveBreakpointPercent =
+      screen.width * 0.01 * (await db.get(['tweak.responsive_breakpoint_percent'])),
+    addResponsiveBreakpoint = () => {
+      document.body.classList.remove('enhancer--tweak-responsive_breakpoint');
+      if (
+        window.innerWidth <= responsiveBreakpointPx ||
+        window.innerWidth <= responsiveBreakpointPercent
+      ) {
+        document.body.classList.add('enhancer--tweak-responsive_breakpoint');
+      }
+    };
+  window.addEventListener('resize', addResponsiveBreakpoint);
+  addResponsiveBreakpoint();
+
+  const tweaks = [
+    'full_width_pages',
+    'normalise_table_scroll',
+    'hide_help',
+    'hide_slash_for_commands',
+    'snappy_transitions',
+    'thicker_bold',
+    'spaced_lines',
+    'condensed_bullets',
+    'bracketed_links',
+    'accented_links',
+    'quotation_marks',
+  ];
+  for (const tweak of tweaks) {
+    if (await db.get([`tweak.${tweak}`])) {
+      document.body.classList.add(`enhancer--tweak-${tweak}`);
+    }
+  }
+
+  const imgAlignment = await db.get(['tweak.img_alignment']);
+  if (imgAlignment !== 'center') {
+    document.body.classList.add(`enhancer--tweak-img_alignment-${imgAlignment}`);
+  }
+}
diff --git a/src/mods/tweaks/mod.json b/src/mods/tweaks/mod.json
new file mode 100644
index 0000000..b57e912
--- /dev/null
+++ b/src/mods/tweaks/mod.json
@@ -0,0 +1,124 @@
+{
+  "name": "tweaks",
+  "id": "5174a483-c88d-4bf8-a95f-35cd330b76e2",
+  "version": "0.2.0",
+  "description": "common style/layout changes and custom code insertion. check out the [tweaks page](https://notion-enhancer.github.io/advanced/tweaks) for more.",
+  "tags": ["extension", "customisation"],
+  "authors": [
+    {
+      "name": "dragonwocky",
+      "email": "thedragonring.bod@gmail.com",
+      "homepage": "https://dragonwocky.me/",
+      "avatar": "https://dragonwocky.me/avatar.jpg"
+    }
+  ],
+  "css": {
+    "client": ["client.css"]
+  },
+  "js": {
+    "client": ["client.mjs"]
+  },
+  "options": [
+    {
+      "type": "file",
+      "key": "insert.css",
+      "label": "css insert",
+      "tooltip": "**upload a css file that will be applied to the notion client**",
+      "extensions": [".css"]
+    },
+    {
+      "type": "number",
+      "key": "tweak.responsive_breakpoint_px",
+      "label": "responsive columns breakpoint (px)",
+      "tooltip": "the **width in pixels below which in-page columns are resized** to appear full-width to reduce content squishing",
+      "value": 600
+    },
+    {
+      "type": "number",
+      "key": "tweak.responsive_breakpoint_percent",
+      "label": "responsive columns breakpoint (%)",
+      "tooltip": "the **percentage of the screen below which in-page columns are resized to appear full-width** to reduce content squishing",
+      "value": 30
+    },
+    {
+      "type": "toggle",
+      "key": "tweak.full_width_pages",
+      "label": "full width pages",
+      "tooltip": "**decreases padding so every page appears full width**",
+      "value": false
+    },
+    {
+      "type": "toggle",
+      "key": "tweak.normalise_table_scroll",
+      "label": "wrap tables to page width",
+      "tooltip": "**force horizontally scrollable tables to respect the width and padding of a page when they overflow**",
+      "value": true
+    },
+    {
+      "type": "toggle",
+      "key": "tweak.snappy_transitions",
+      "label": "snappy transitions",
+      "tooltip": "enabling this **eliminates css animation time**, but will not prevent motion e.g. the sidebar popping out",
+      "value": false
+    },
+    {
+      "type": "toggle",
+      "key": "tweak.hide_help",
+      "label": "hide help button",
+      "value": false
+    },
+    {
+      "type": "toggle",
+      "key": "tweak.hide_slash_for_commands",
+      "label": "hide \"Type '/' for commands\"",
+      "value": false
+    },
+    {
+      "type": "toggle",
+      "key": "tweak.thicker_bold",
+      "label": "thicker bold text",
+      "value": true
+    },
+    {
+      "type": "toggle",
+      "key": "tweak.spaced_lines",
+      "label": "readable line spacing",
+      "tooltip": "**greater line spacing between text blocks**",
+      "value": false
+    },
+    {
+      "type": "toggle",
+      "key": "tweak.condensed_bullets",
+      "label": "condense bullet points",
+      "tooltip": "**tighter line spacing between bullet point blocks**",
+      "value": false
+    },
+    {
+      "type": "toggle",
+      "key": "tweak.bracketed_links",
+      "label": "bracketed links",
+      "tooltip": "**render links surrounded with [[brackets]] instead of __underlined__**",
+      "value": false
+    },
+    {
+      "type": "toggle",
+      "key": "tweak.accented_links",
+      "label": "accented links",
+      "tooltip": "**links are shown by default with notion's blue colour or a theme's equivalent**",
+      "value": false
+    },
+    {
+      "type": "toggle",
+      "key": "tweak.quotation_marks",
+      "label": "quote block quotation marks",
+      "tooltip": "**wrap quote block content in large, decorative serif quotation marks**",
+      "value": false
+    },
+    {
+      "type": "select",
+      "key": "tweak.img_alignment",
+      "label": "image alignment",
+      "values": ["center", "left", "right"]
+    }
+  ]
+}
diff --git a/src/mods/view-scale/client.css b/src/mods/view-scale/client.css
new file mode 100644
index 0000000..652cad1
--- /dev/null
+++ b/src/mods/view-scale/client.css
@@ -0,0 +1,90 @@
+/**
+ * notion-enhancer: view scale
+ * (c) 2021 SP12893678 (https://sp12893678.tk/)
+ * (c) 2021 dragonwocky <thedragonring.bod@gmail.com> (https://dragonwocky.me/)
+ * (https://notion-enhancer.github.io/) under the MIT license
+ */
+
+.view_scale--container {
+  border: 1px solid var(--theme--ui_divider);
+  border-radius: 9999px !important;
+  margin: 0 4px;
+  padding: 0 5px 0 4px;
+  align-items: center;
+  justify-content: center;
+  display: flex;
+}
+
+.view_scale--slider {
+  appearance: none;
+  outline: 0;
+  border: 0px;
+  overflow: hidden;
+  width: 150px;
+  height: 20px;
+  margin: auto 4px auto 0;
+  cursor: ew-resize;
+  border-radius: 9999px;
+}
+.view_scale--slider::-webkit-slider-runnable-track {
+  appearance: none;
+  height: 20px;
+  background-color: var(--theme--ui_toggle-off);
+}
+.view_scale--slider::-webkit-slider-thumb {
+  appearance: none;
+  position: relative;
+  width: 20px;
+  height: 20px;
+  border-radius: 9999px;
+  border: 0px;
+  background: var(--theme--ui_toggle-on);
+  box-shadow: -100px 0 0 90px var(--theme--ui_toggle-on),
+    inset 0 0 0 20px var(--theme--ui_toggle-on);
+  transition: 0.2s;
+}
+.view_scale--slider:active::-webkit-slider-thumb {
+  background: var(--theme--ui_toggle-feature);
+  box-shadow: -100px 0 0 90px var(--theme--ui_toggle-on),
+    inset 0 0 0 2px var(--theme--ui_toggle-on);
+}
+
+.view_scale--counter {
+  font-size: 14px;
+  margin: auto 4px auto 0;
+  width: 5ch;
+  text-align: right;
+}
+
+.view_scale--button {
+  user-select: none;
+  transition: background 20ms ease-in 0s;
+  cursor: pointer;
+  display: inline-flex;
+  align-items: center;
+  justify-content: center;
+  flex-shrink: 0;
+  border-radius: 9999px;
+  height: 20px;
+  width: 20px;
+  padding: 0 0.25px 0 0;
+
+  margin-left: 2px;
+  border: none;
+  background: transparent;
+  font-size: 18px;
+}
+.view_scale--button:focus,
+.view_scale--button:hover {
+  background: var(--theme--ui_interactive-hover);
+}
+.view_scale--button:active {
+  background: var(--theme--ui_interactive-active);
+}
+.view_scale--button svg {
+  display: block;
+  width: 14px;
+  height: 14px;
+  fill: var(--theme--icon);
+  color: var(--theme--icon);
+}
diff --git a/src/mods/view-scale/client.mjs b/src/mods/view-scale/client.mjs
new file mode 100644
index 0000000..95ae64c
--- /dev/null
+++ b/src/mods/view-scale/client.mjs
@@ -0,0 +1,87 @@
+/**
+ * notion-enhancer: view scale
+ * (c) 2021 SP12893678 (https://sp12893678.tk/)
+ * (c) 2021 dragonwocky <thedragonring.bod@gmail.com> (https://dragonwocky.me/)
+ * (https://notion-enhancer.github.io/) under the MIT license
+ */
+
+export default async function ({ electron, web, components }, db) {
+  let zoomFactor = (await db.get(['default_zoom'])) / 100,
+    updateScale = () => {};
+  electron.webFrame.setZoomFactor(zoomFactor);
+
+  const zoomOffset = (await db.get(['offset'])) / 100,
+    zoomMin = 0.5,
+    zoomMax = 2,
+    getZoomFactor = () => electron.webFrame.getZoomFactor(),
+    setZoomFactor = (zoomFactor) => electron.webFrame.setZoomFactor(zoomFactor),
+    zoomPlus = (multiplier = 1) => {
+      zoomFactor = Math.min(getZoomFactor() + zoomOffset * multiplier, zoomMax);
+      setZoomFactor(zoomFactor);
+      updateScale();
+    },
+    zoomMinus = (multiplier = 1) => {
+      zoomFactor = Math.max(getZoomFactor() - zoomOffset * multiplier, zoomMin);
+      setZoomFactor(zoomFactor);
+      updateScale();
+    };
+
+  const mousewheelModifier = await db.get(['mousewheel']);
+  if (mousewheelModifier !== '-- none --') {
+    const mousewheelModifierKey = {
+      Control: 'ctrlKey',
+      Alt: 'altKey',
+      Command: 'metaKey',
+      Shift: 'shiftKey',
+    }[mousewheelModifier];
+    document.addEventListener('wheel', (event) => {
+      if (event[mousewheelModifierKey] && event.deltaY < 0) zoomPlus();
+      if (event[mousewheelModifierKey] && event.deltaY > 0) zoomMinus();
+    });
+  }
+
+  const showVisualSlider = await db.get(['ui']);
+  if (showVisualSlider) {
+    const topbarActionsSelector =
+      '.notion-topbar-action-buttons > div[style="display: flex;"]';
+    await web.whenReady([topbarActionsSelector]);
+
+    const $topbarActions = document.querySelector(topbarActionsSelector),
+      $scaleContainer = web.html`<div class="view_scale--container"></div>`,
+      $scaleSlider = web.html`<input class="view_scale--slider" type="range" min="50" max="200" value="100"></input>`,
+      $scaleCounter = web.html`<span class="view_scale--counter">100%</span>`,
+      $scalePlus = web.html`<button class="view_scale--button">
+        ${await components.feather('zoom-in')}
+      </button>`,
+      $scaleMinus = web.html`<button class="view_scale--button">
+        ${await components.feather('zoom-out')}
+      </button>`;
+    components.addTooltip($scalePlus, '**Zoom into the window**');
+    components.addTooltip($scaleMinus, '**Zoom out of the window**');
+    updateScale = () => {
+      if (getZoomFactor() !== zoomFactor) zoomFactor = getZoomFactor();
+      $scaleSlider.value = Math.round(zoomFactor * 100);
+      $scaleCounter.innerHTML = Math.round(zoomFactor * 100) + '%';
+    };
+    updateScale();
+
+    $scaleSlider.addEventListener('input', () => {
+      zoomFactor = $scaleSlider.value / 100;
+      $scaleCounter.innerHTML = Math.round(zoomFactor * 100) + '%';
+    });
+    $scaleSlider.addEventListener('change', () => setZoomFactor(zoomFactor));
+    $scalePlus.addEventListener('click', () => zoomPlus());
+    $scaleMinus.addEventListener('click', () => zoomMinus());
+
+    $topbarActions.prepend(
+      web.render($scaleContainer, $scaleSlider, $scaleCounter, $scalePlus, $scaleMinus)
+    );
+
+    web.addHotkeyListener(['Ctrl', '+'], updateScale);
+    web.addHotkeyListener(['Ctrl', '-'], updateScale);
+    web.addHotkeyListener(['Ctrl', '0'], updateScale);
+    web.addHotkeyListener(['Command', '+'], updateScale);
+    web.addHotkeyListener(['Command', '-'], updateScale);
+    web.addHotkeyListener(['Command', '0'], updateScale);
+  }
+}
diff --git a/src/mods/view-scale/mod.json b/src/mods/view-scale/mod.json
new file mode 100644
index 0000000..0a9059c
--- /dev/null
+++ b/src/mods/view-scale/mod.json
@@ -0,0 +1,48 @@
+{
+  "name": "view scale",
+  "id": "e71ce1e0-024c-435e-a25e-7dd50448d1df",
+  "environments": ["linux", "win32", "darwin"],
+  "version": "0.1.0",
+  "description": "zoom in/out of the notion window with the mousewheel or a visual slider (`ctrl/cmd +/-` are available in-app by default).",
+  "preview": "view-scale.jpg",
+  "tags": ["extension", "app"],
+  "authors": [
+    {
+      "name": "SP12893678",
+      "homepage": "https://sp12893678.tk/",
+      "avatar": "https://sp12893678.tk/img/avatar.jpg"
+    }
+  ],
+  "js": {
+    "client": ["client.mjs"]
+  },
+  "css": {
+    "client": ["client.css"]
+  },
+  "options": [
+    {
+      "type": "number",
+      "key": "offset",
+      "label": "scale +/- offset (%)",
+      "value": 10
+    },
+    {
+      "type": "number",
+      "key": "default_zoom",
+      "label": "default scale (%)",
+      "value": 100
+    },
+    {
+      "type": "toggle",
+      "key": "ui",
+      "label": "visual slider",
+      "value": true
+    },
+    {
+      "type": "select",
+      "key": "mousewheel",
+      "label": "mousewheel scaling keyboard modifier",
+      "values": ["Control", "Alt", "Command", "Shift", "-- none --"]
+    }
+  ]
+}
diff --git a/src/mods/view-scale/view-scale.jpg b/src/mods/view-scale/view-scale.jpg
new file mode 100644
index 0000000..f7ee516
Binary files /dev/null and b/src/mods/view-scale/view-scale.jpg differ
diff --git a/src/mods/weekly-view/client.mjs b/src/mods/weekly-view/client.mjs
new file mode 100644
index 0000000..426f5ba
--- /dev/null
+++ b/src/mods/weekly-view/client.mjs
@@ -0,0 +1,71 @@
+/**
+ * notion-enhancer: weekly view
+ * (c) 2021 dragonwocky <thedragonring.bod@gmail.com> (https://dragonwocky.me/)
+ * (https://notion-enhancer.github.io/) under the MIT license
+ */
+
+'use strict';
+
+export default async function ({ web }, db) {
+  const pageSelector = '.notion-page-content',
+    calendarSelector = '.notion-calendar-view',
+    viewSelector =
+      '.notion-page-content > .notion-selectable.notion-collection_view-block',
+    viewControlSelector = ':scope>div>div>div>div>div',
+    todaySelector = '.notion-calendar-view-day[style*="background"]',
+    weekSelector = '[style^="position: relative; display: flex; height: "]',
+    toolbarBtnSelector =
+      '.notion-calendar-view > :first-child > :first-child > :first-child > :nth-last-child(2)';
+
+  const transformCalendarView = () => {
+    const $page = document.querySelector(pageSelector);
+    document.querySelectorAll(viewSelector).forEach(async ($view) => {    
+      let currentText;  
+      // Get view controls children nodes, convert to array, filter out non-text
+      const $viewNodes = []
+        .slice.call($view.querySelector(viewControlSelector).children)
+        .filter(node => node.tagName.toLowerCase().match(/(div|span)/g));
+
+      // Find current view by analyzing children (which changes on viewport) 
+      if ($viewNodes.length === 1)
+      {
+        // Mobile: Simple dropdown button (like legacy), text is current view
+        currentText = $viewNodes[0].innerText.toLowerCase();
+      } else {
+        // Wide/Desktop: Tabs listed, current view indicated by border style
+        currentText = $viewNodes
+          // Find selected view by border style (possibly fragile)
+          .filter(($e) => $e.children[0].style.borderBottomWidth.toString() === '2px')[0]
+          .innerText.toLowerCase();
+      }
+      
+      if (currentText !== 'weekly') return;
+
+      const $calendar = $view.parentElement.parentElement.parentElement.parentElement;
+      if (!$calendar.querySelector(todaySelector)) {
+        $calendar.querySelector(toolbarBtnSelector).click();
+      }
+      await new Promise((res, rej) => requestAnimationFrame(res));
+      if ($page) {
+        for (const $week of $calendar.querySelectorAll(weekSelector)) {
+          if (!$week.querySelector(todaySelector)) {
+            $week.style.height = 0;
+            $week.style.visibility = 'hidden';
+          }
+        }
+      } else {
+        const $weekContainer = $calendar.querySelector(weekSelector).parentElement;
+        for (const $week of $calendar.querySelectorAll(weekSelector)) {
+          if ($week.querySelector(todaySelector)) {
+            $weekContainer.style.maxHeight = $week.style.height;
+            break;
+          } else {
+            $week.style.height = '0';
+            $week.style.visibility = 'hidden';
+          }
+        }
+      }
+    });
+  };
+  web.addDocumentObserver(transformCalendarView, [calendarSelector]);
+}
diff --git a/src/mods/weekly-view/mod.json b/src/mods/weekly-view/mod.json
new file mode 100644
index 0000000..6128450
--- /dev/null
+++ b/src/mods/weekly-view/mod.json
@@ -0,0 +1,21 @@
+{
+  "name": "weekly view",
+  "id": "4c7acaea-6596-4590-85e5-8ac5a1455e8f",
+  "version": "0.6.0",
+  "description": "calendar views named \"weekly\" will show only the current week.",
+  "preview": "weekly-view.jpg",
+  "tags": ["extension", "layout"],
+  "authors": [
+    {
+      "name": "dragonwocky",
+      "email": "thedragonring.bod@gmail.com",
+      "homepage": "https://dragonwocky.me/",
+      "avatar": "https://dragonwocky.me/avatar.jpg"
+    }
+  ],
+  "js": {
+    "client": ["client.mjs"]
+  },
+  "css": {},
+  "options": []
+}
diff --git a/src/mods/weekly-view/weekly-view.jpg b/src/mods/weekly-view/weekly-view.jpg
new file mode 100644
index 0000000..345d33d
Binary files /dev/null and b/src/mods/weekly-view/weekly-view.jpg differ
diff --git a/src/mods/word-counter/client.css b/src/mods/word-counter/client.css
new file mode 100644
index 0000000..bd44781
--- /dev/null
+++ b/src/mods/word-counter/client.css
@@ -0,0 +1,40 @@
+/**
+ * notion-enhancer: word counter
+ * (c) 2021 dragonwocky <thedragonring.bod@gmail.com> (https://dragonwocky.me/)
+ * (https://notion-enhancer.github.io/) under the MIT license
+ */
+
+#word-counter--notice {
+  color: var(--theme--text_secondary);
+  font-size: 14px;
+  margin-top: 0;
+}
+
+.word-counter--stat {
+  display: block;
+  background: var(--theme--ui_interactive-hover);
+  color: var(--theme--text);
+  font-size: 14px;
+  line-height: 1.2;
+  border: 1px solid transparent;
+  border-radius: 3px;
+  padding: 6px 8px;
+  cursor: pointer;
+  user-select: none;
+}
+.word-counter--stat:focus,
+.word-counter--stat:hover {
+  background: transparent;
+  border: 1px solid var(--theme--ui_interactive-hover);
+}
+.word-counter--stat:active {
+  background: var(--theme--ui_interactive-active);
+}
+
+.word-counter--stat svg {
+  display: inline-block;
+  height: 1em;
+  width: 1em;
+  margin: 0 0.4em -2px 0;
+  color: var(--theme--icon_secondary);
+}
diff --git a/src/mods/word-counter/client.mjs b/src/mods/word-counter/client.mjs
new file mode 100644
index 0000000..30722d3
--- /dev/null
+++ b/src/mods/word-counter/client.mjs
@@ -0,0 +1,108 @@
+/**
+ * notion-enhancer: word counter
+ * (c) 2021 dragonwocky <thedragonring.bod@gmail.com> (https://dragonwocky.me/)
+ * (https://notion-enhancer.github.io/) under the MIT license
+ */
+
+const humanTime = (mins) => {
+  let readable = '';
+  if (1 <= mins) {
+    readable += `${Math.floor(mins)} min`;
+    if (2 <= mins) readable += 's';
+  }
+  const secs = Math.round((mins % 1) * 60);
+  if (1 <= secs) {
+    if (1 <= mins) readable += ' ';
+    readable += `${secs} sec`;
+    if (2 <= secs) readable += 's';
+  }
+  return readable;
+};
+
+export default async function ({ web, components }, db) {
+  const dbNoticeText = 'Open a page to see its word count.',
+    pageNoticeText = 'Click a stat to copy it.',
+    $notice = web.html`<p id="word-counter--notice">${dbNoticeText}</p>`;
+
+  const $wordCount = web.html`<b>12</b>`,
+    $characterCount = web.html`<b>12</b>`,
+    $sentenceCount = web.html`<b>12</b>`,
+    $blockCount = web.html`<b>12</b>`,
+    $readingTime = web.html`<b>10 mins</b>`,
+    $readingTooltip = web.html`${await components.feather('info')}`,
+    $speakingTime = web.html`<b>18 secs</b>`,
+    $speakingTooltip = web.html`${await components.feather('info')}`,
+    $statList = web.render(
+      web.html`<div></div>`,
+      web.render(web.html`<p class="word-counter--stat"></p>`, $wordCount, ' words'),
+      web.render(web.html`<p class="word-counter--stat"></p>`, $characterCount, ' characters'),
+      web.render(web.html`<p class="word-counter--stat"></p>`, $sentenceCount, ' sentences'),
+      web.render(web.html`<p class="word-counter--stat"></p>`, $blockCount, ' blocks'),
+      web.render(
+        web.html`<p class="word-counter--stat"></p>`,
+        $readingTooltip,
+        $readingTime,
+        ' reading time'
+      ),
+      web.render(
+        web.html`<p class="word-counter--stat"></p>`,
+        $speakingTooltip,
+        $speakingTime,
+        ' speaking time'
+      )
+    );
+  $statList.querySelectorAll('.word-counter--stat').forEach(($stat) => {
+    $stat.addEventListener('click', () => web.copyToClipboard($stat.innerText));
+  });
+  components.addTooltip($readingTooltip, '**~ 275 wpm**', { offsetDirection: 'left' });
+  components.addTooltip($speakingTooltip, '**~ 180 wpm**', { offsetDirection: 'left' });
+
+  let viewFocused = false,
+    $page;
+  await components.addPanelView({
+    id: 'b99deb52-6955-43d2-a53b-a31540cd19a5',
+    icon: await components.feather('type'),
+    title: 'Word Counter',
+    $content: web.render(web.html`<div></div>`, $notice, $statList),
+    onFocus: () => {
+      viewFocused = true;
+      $page = document.getElementsByClassName('notion-page-content')[0];
+      updateStats();
+    },
+    onBlur: () => {
+      viewFocused = false;
+    },
+  });
+
+  function updateStats() {
+    if (!$page) return;
+    const words = $page.innerText.split(/[^\w]+/).length;
+    $wordCount.innerText = words;
+    $characterCount.innerText = $page.innerText.length;
+    $sentenceCount.innerText = $page.innerText.split('.').length;
+    $blockCount.innerText = $page.querySelectorAll('[data-block-id]').length;
+    $readingTime.innerText = humanTime(words / 275);
+    $speakingTime.innerText = humanTime(words / 180);
+  }
+  const pageObserver = () => {
+    if (!viewFocused) return;
+    if (document.contains($page)) {
+      updateStats();
+    } else {
+      $page = document.getElementsByClassName('notion-page-content')[0];
+      if ($page) {
+        $notice.innerText = pageNoticeText;
+        $statList.style.display = '';
+        updateStats();
+      } else {
+        $notice.innerText = dbNoticeText;
+        $statList.style.display = 'none';
+      }
+    }
+  };
+  web.addDocumentObserver(pageObserver, [
+    '.notion-page-content',
+    '.notion-collection_view_page-block',
+  ]);
+  pageObserver();
+}
diff --git a/src/mods/word-counter/mod.json b/src/mods/word-counter/mod.json
new file mode 100644
index 0000000..ad52d9f
--- /dev/null
+++ b/src/mods/word-counter/mod.json
@@ -0,0 +1,23 @@
+{
+  "name": "word counter",
+  "id": "b99deb52-6955-43d2-a53b-a31540cd19a5",
+  "version": "0.3.0",
+  "description": "view word/character/sentence/block count & speaking/reading times in the side panel.",
+  "preview": "word-counter.jpg",
+  "tags": ["extension", "panel"],
+  "authors": [
+    {
+      "name": "dragonwocky",
+      "email": "thedragonring.bod@gmail.com",
+      "homepage": "https://dragonwocky.me/",
+      "avatar": "https://dragonwocky.me/avatar.jpg"
+    }
+  ],
+  "js": {
+    "client": ["client.mjs"]
+  },
+  "css": {
+    "client": ["client.css"]
+  },
+  "options": []
+}
diff --git a/src/mods/word-counter/word-counter.jpg b/src/mods/word-counter/word-counter.jpg
new file mode 100644
index 0000000..43978fc
Binary files /dev/null and b/src/mods/word-counter/word-counter.jpg differ
diff --git a/yarn.lock b/yarn.lock
index a5954d6..497b305 100644
--- a/yarn.lock
+++ b/yarn.lock
@@ -1,154 +1,235 @@
-# THIS IS AN AUTOGENERATED FILE. DO NOT EDIT THIS FILE DIRECTLY.
-# yarn lockfile v1
+# This file is generated by running "yarn install" inside your project.
+# Manual changes might be lost - proceed with caution!
 
+__metadata:
+  version: 6
+  cacheKey: 8
 
-"@types/glob@^7.1.1":
-  version "7.2.0"
-  resolved "https://registry.yarnpkg.com/@types/glob/-/glob-7.2.0.tgz#bc1b5bf3aa92f25bd5dd39f35c57361bdce5b2eb"
-  integrity sha512-ZUxbzKl0IfJILTS6t7ip5fQQM/J3TJYubDm3nMbgubNNYS62eXeUpoLUC8/7fJNiFYHTrGPQn7hspDUzIHX3UA==
+"@electron/asar@npm:^3.2.2":
+  version: 3.2.2
+  resolution: "@electron/asar@npm:3.2.2"
   dependencies:
-    "@types/minimatch" "*"
-    "@types/node" "*"
+    "@types/glob": ^7.1.1
+    chromium-pickle-js: ^0.2.0
+    commander: ^5.0.0
+    glob: ^7.1.6
+    minimatch: ^3.0.4
+  dependenciesMeta:
+    "@types/glob":
+      optional: true
+  bin:
+    asar: bin/asar.js
+  checksum: 38a3b4a47180f2033a599421175f03706941ba05a32591a639127f6374e0007c6a7c8bde550129de394f4072a0bf39c24aea202540fe1faba6d74b4181c007a8
+  languageName: node
+  linkType: hard
 
-"@types/minimatch@*":
-  version "3.0.5"
-  resolved "https://registry.yarnpkg.com/@types/minimatch/-/minimatch-3.0.5.tgz#1001cc5e6a3704b83c236027e77f2f58ea010f40"
-  integrity sha512-Klz949h02Gz2uZCMGwDUSDS1YBlTdDDgbWHi+81l29tQALUtvz4rAYi5uoVhE5Lagoq6DeqAUlbrHvW/mXDgdQ==
-
-"@types/node@*":
-  version "16.11.6"
-  resolved "https://registry.yarnpkg.com/@types/node/-/node-16.11.6.tgz#6bef7a2a0ad684cf6e90fcfe31cecabd9ce0a3ae"
-  integrity sha512-ua7PgUoeQFjmWPcoo9khiPum3Pd60k4/2ZGXt18sm2Slk0W0xZTqt5Y0Ny1NyBiN1EVQ/+FaF9NcY4Qe6rwk5w==
-
-ansi-styles@^4.1.0:
-  version "4.3.0"
-  resolved "https://registry.yarnpkg.com/ansi-styles/-/ansi-styles-4.3.0.tgz#edd803628ae71c04c85ae7a0906edad34b648937"
-  integrity sha512-zbB9rCJAT1rbjiVDb2hqKFHNYLxgtk8NURxZ3IZwD3F6NtxbXZQCnnSi1Lkx+IDohdPlFp222wVALIheZJQSEg==
+"@types/glob@npm:^7.1.1":
+  version: 7.2.0
+  resolution: "@types/glob@npm:7.2.0"
   dependencies:
-    color-convert "^2.0.1"
+    "@types/minimatch": "*"
+    "@types/node": "*"
+  checksum: 6ae717fedfdfdad25f3d5a568323926c64f52ef35897bcac8aca8e19bc50c0bd84630bbd063e5d52078b2137d8e7d3c26eabebd1a2f03ff350fff8a91e79fc19
+  languageName: node
+  linkType: hard
 
-asar@^3.1.0:
-  version "3.1.0"
-  resolved "https://registry.yarnpkg.com/asar/-/asar-3.1.0.tgz#70b0509449fe3daccc63beb4d3c7d2e24d3c6473"
-  integrity sha512-vyxPxP5arcAqN4F/ebHd/HhwnAiZtwhglvdmc7BR2f0ywbVNTOpSeyhLDbGXtE/y58hv1oC75TaNIXutnsOZsQ==
+"@types/minimatch@npm:*":
+  version: 5.1.2
+  resolution: "@types/minimatch@npm:5.1.2"
+  checksum: 0391a282860c7cb6fe262c12b99564732401bdaa5e395bee9ca323c312c1a0f45efbf34dce974682036e857db59a5c9b1da522f3d6055aeead7097264c8705a8
+  languageName: node
+  linkType: hard
+
+"@types/node@npm:*":
+  version: 18.11.11
+  resolution: "@types/node@npm:18.11.11"
+  checksum: c4b1176a8f1714a3ee3fc2a5e1d568b0cd50209000282db5c68154b3c975952928dbb834ef3a0ce55bd7b345ae29f2cbf4a34635a070294d135a24254231386a
+  languageName: node
+  linkType: hard
+
+"ansi-styles@npm:^4.1.0":
+  version: 4.3.0
+  resolution: "ansi-styles@npm:4.3.0"
   dependencies:
-    chromium-pickle-js "^0.2.0"
-    commander "^5.0.0"
-    glob "^7.1.6"
-    minimatch "^3.0.4"
-  optionalDependencies:
-    "@types/glob" "^7.1.1"
+    color-convert: ^2.0.1
+  checksum: 513b44c3b2105dd14cc42a19271e80f386466c4be574bccf60b627432f9198571ebf4ab1e4c3ba17347658f4ee1711c163d574248c0c1cdc2d5917a0ad582ec4
+  languageName: node
+  linkType: hard
 
-balanced-match@^1.0.0:
-  version "1.0.2"
-  resolved "https://registry.yarnpkg.com/balanced-match/-/balanced-match-1.0.2.tgz#e83e3a7e3f300b34cb9d87f615fa0cbf357690ee"
-  integrity sha512-3oSeUO0TMV67hN1AmbXsK4yaqU7tjiHlbxRDZOpH0KW9+CeX4bRAaX0Anxt0tx2MrpRpWwQaPwIlISEJhYU5Pw==
+"arg@npm:^5.0.2":
+  version: 5.0.2
+  resolution: "arg@npm:5.0.2"
+  checksum: 6c69ada1a9943d332d9e5382393e897c500908d91d5cb735a01120d5f71daf1b339b7b8980cbeaba8fd1afc68e658a739746179e4315a26e8a28951ff9930078
+  languageName: node
+  linkType: hard
 
-brace-expansion@^1.1.7:
-  version "1.1.11"
-  resolved "https://registry.yarnpkg.com/brace-expansion/-/brace-expansion-1.1.11.tgz#3c7fcbf529d87226f3d2f52b966ff5271eb441dd"
-  integrity sha512-iCuPHDFgrHX7H2vEI/5xpz07zSHB00TpugqhmYtVmMO6518mCuRMoOYFldEBl0g187ufozdaHgWKcYFb61qGiA==
+"balanced-match@npm:^1.0.0":
+  version: 1.0.2
+  resolution: "balanced-match@npm:1.0.2"
+  checksum: 9706c088a283058a8a99e0bf91b0a2f75497f185980d9ffa8b304de1d9e58ebda7c72c07ebf01dadedaac5b2907b2c6f566f660d62bd336c3468e960403b9d65
+  languageName: node
+  linkType: hard
+
+"brace-expansion@npm:^1.1.7":
+  version: 1.1.11
+  resolution: "brace-expansion@npm:1.1.11"
   dependencies:
-    balanced-match "^1.0.0"
-    concat-map "0.0.1"
+    balanced-match: ^1.0.0
+    concat-map: 0.0.1
+  checksum: faf34a7bb0c3fcf4b59c7808bc5d2a96a40988addf2e7e09dfbb67a2251800e0d14cd2bfc1aa79174f2f5095c54ff27f46fb1289fe2d77dac755b5eb3434cc07
+  languageName: node
+  linkType: hard
 
-chalk@^4.1.2:
-  version "4.1.2"
-  resolved "https://registry.yarnpkg.com/chalk/-/chalk-4.1.2.tgz#aac4e2b7734a740867aeb16bf02aad556a1e7a01"
-  integrity sha512-oKnbhFyRIXpUuez8iBMmyEa4nbj4IOQyuhc/wy9kY7/WVPcwIO9VA668Pu8RkO7+0G76SLROeyw9CpQ061i4mA==
+"chalk-template@npm:^0.4.0":
+  version: 0.4.0
+  resolution: "chalk-template@npm:0.4.0"
   dependencies:
-    ansi-styles "^4.1.0"
-    supports-color "^7.1.0"
+    chalk: ^4.1.2
+  checksum: 6c706802a79a7963cbce18f022b046fe86e438a67843151868852f80ea7346e975a6a9749991601e7e5d3b6a6c4852a04c53dc966a9a3d04031bd0e0ed53c819
+  languageName: node
+  linkType: hard
 
-chromium-pickle-js@^0.2.0:
-  version "0.2.0"
-  resolved "https://registry.yarnpkg.com/chromium-pickle-js/-/chromium-pickle-js-0.2.0.tgz#04a106672c18b085ab774d983dfa3ea138f22205"
-  integrity sha1-BKEGZywYsIWrd02YPfo+oTjyIgU=
-
-color-convert@^2.0.1:
-  version "2.0.1"
-  resolved "https://registry.yarnpkg.com/color-convert/-/color-convert-2.0.1.tgz#72d3a68d598c9bdb3af2ad1e84f21d896abd4de3"
-  integrity sha512-RRECPsj7iu/xb5oKYcsFHSppFNnsj/52OVTRKb4zP5onXwVF3zVmmToNcOfGC+CRDpfK/U584fMg38ZHCaElKQ==
+"chalk@npm:^4.1.2":
+  version: 4.1.2
+  resolution: "chalk@npm:4.1.2"
   dependencies:
-    color-name "~1.1.4"
+    ansi-styles: ^4.1.0
+    supports-color: ^7.1.0
+  checksum: fe75c9d5c76a7a98d45495b91b2172fa3b7a09e0cc9370e5c8feb1c567b85c4288e2b3fded7cfdd7359ac28d6b3844feb8b82b8686842e93d23c827c417e83fc
+  languageName: node
+  linkType: hard
 
-color-name@~1.1.4:
-  version "1.1.4"
-  resolved "https://registry.yarnpkg.com/color-name/-/color-name-1.1.4.tgz#c2a09a87acbde69543de6f63fa3995c826c536a2"
-  integrity sha512-dOy+3AuW3a2wNbZHIuMZpTcgjGuLU/uBL/ubcZF9OXbDo8ff4O8yVp5Bf0efS8uEoYo5q4Fx7dY9OgQGXgAsQA==
+"chromium-pickle-js@npm:^0.2.0":
+  version: 0.2.0
+  resolution: "chromium-pickle-js@npm:0.2.0"
+  checksum: 5ccacc538b0a1ecf3484c8fb3327eae129ceee858db0f64eb0a5ff87bda096a418d0d3e6f6e0967c6334d336a2c7463f7b683ec0e1cafbe736907fa2ee2f58ca
+  languageName: node
+  linkType: hard
 
-commander@^5.0.0:
-  version "5.1.0"
-  resolved "https://registry.yarnpkg.com/commander/-/commander-5.1.0.tgz#46abbd1652f8e059bddaef99bbdcb2ad9cf179ae"
-  integrity sha512-P0CysNDQ7rtVw4QIQtm+MRxV66vKFSvlsQvGYXZWR3qFU0jlMKHZZZgw8e+8DSah4UDKMqnknRDQz+xuQXQ/Zg==
-
-concat-map@0.0.1:
-  version "0.0.1"
-  resolved "https://registry.yarnpkg.com/concat-map/-/concat-map-0.0.1.tgz#d8a96bd77fd68df7793a73036a3ba0d5405d477b"
-  integrity sha1-2Klr13/Wjfd5OnMDajug1UBdR3s=
-
-fs.realpath@^1.0.0:
-  version "1.0.0"
-  resolved "https://registry.yarnpkg.com/fs.realpath/-/fs.realpath-1.0.0.tgz#1504ad2523158caa40db4a2787cb01411994ea4f"
-  integrity sha1-FQStJSMVjKpA20onh8sBQRmU6k8=
-
-glob@^7.1.6:
-  version "7.2.0"
-  resolved "https://registry.yarnpkg.com/glob/-/glob-7.2.0.tgz#d15535af7732e02e948f4c41628bd910293f6023"
-  integrity sha512-lmLf6gtyrPq8tTjSmrO94wBeQbFR3HbLHbuyD69wuyQkImp2hWqMGB47OX65FBkPffO641IP9jWa1z4ivqG26Q==
+"color-convert@npm:^2.0.1":
+  version: 2.0.1
+  resolution: "color-convert@npm:2.0.1"
   dependencies:
-    fs.realpath "^1.0.0"
-    inflight "^1.0.4"
-    inherits "2"
-    minimatch "^3.0.4"
-    once "^1.3.0"
-    path-is-absolute "^1.0.0"
+    color-name: ~1.1.4
+  checksum: 79e6bdb9fd479a205c71d89574fccfb22bd9053bd98c6c4d870d65c132e5e904e6034978e55b43d69fcaa7433af2016ee203ce76eeba9cfa554b373e7f7db336
+  languageName: node
+  linkType: hard
 
-has-flag@^4.0.0:
-  version "4.0.0"
-  resolved "https://registry.yarnpkg.com/has-flag/-/has-flag-4.0.0.tgz#944771fd9c81c81265c4d6941860da06bb59479b"
-  integrity sha512-EykJT/Q1KjTWctppgIAgfSO0tKVuZUjhgMr17kqTumMl6Afv3EISleU7qZUzoXDFTAHTDC4NOoG/ZxU3EvlMPQ==
+"color-name@npm:~1.1.4":
+  version: 1.1.4
+  resolution: "color-name@npm:1.1.4"
+  checksum: b0445859521eb4021cd0fb0cc1a75cecf67fceecae89b63f62b201cca8d345baf8b952c966862a9d9a2632987d4f6581f0ec8d957dfacece86f0a7919316f610
+  languageName: node
+  linkType: hard
 
-inflight@^1.0.4:
-  version "1.0.6"
-  resolved "https://registry.yarnpkg.com/inflight/-/inflight-1.0.6.tgz#49bd6331d7d02d0c09bc910a1075ba8165b56df9"
-  integrity sha1-Sb1jMdfQLQwJvJEKEHW6gWW1bfk=
+"commander@npm:^5.0.0":
+  version: 5.1.0
+  resolution: "commander@npm:5.1.0"
+  checksum: 0b7fec1712fbcc6230fcb161d8d73b4730fa91a21dc089515489402ad78810547683f058e2a9835929c212fead1d6a6ade70db28bbb03edbc2829a9ab7d69447
+  languageName: node
+  linkType: hard
+
+"concat-map@npm:0.0.1":
+  version: 0.0.1
+  resolution: "concat-map@npm:0.0.1"
+  checksum: 902a9f5d8967a3e2faf138d5cb784b9979bad2e6db5357c5b21c568df4ebe62bcb15108af1b2253744844eb964fc023fbd9afbbbb6ddd0bcc204c6fb5b7bf3af
+  languageName: node
+  linkType: hard
+
+"fs.realpath@npm:^1.0.0":
+  version: 1.0.0
+  resolution: "fs.realpath@npm:1.0.0"
+  checksum: 99ddea01a7e75aa276c250a04eedeffe5662bce66c65c07164ad6264f9de18fb21be9433ead460e54cff20e31721c811f4fb5d70591799df5f85dce6d6746fd0
+  languageName: node
+  linkType: hard
+
+"glob@npm:^7.1.6":
+  version: 7.2.3
+  resolution: "glob@npm:7.2.3"
   dependencies:
-    once "^1.3.0"
-    wrappy "1"
+    fs.realpath: ^1.0.0
+    inflight: ^1.0.4
+    inherits: 2
+    minimatch: ^3.1.1
+    once: ^1.3.0
+    path-is-absolute: ^1.0.0
+  checksum: 29452e97b38fa704dabb1d1045350fb2467cf0277e155aa9ff7077e90ad81d1ea9d53d3ee63bd37c05b09a065e90f16aec4a65f5b8de401d1dac40bc5605d133
+  languageName: node
+  linkType: hard
 
-inherits@2:
-  version "2.0.4"
-  resolved "https://registry.yarnpkg.com/inherits/-/inherits-2.0.4.tgz#0fa2c64f932917c3433a0ded55363aae37416b7c"
-  integrity sha512-k/vGaX4/Yla3WzyMCvTQOXYeIHvqOKtnqBduzTHpzpQZzAskKMhZ2K+EnBiSM9zGSoIFeMpXKxa4dYeZIQqewQ==
+"has-flag@npm:^4.0.0":
+  version: 4.0.0
+  resolution: "has-flag@npm:4.0.0"
+  checksum: 261a1357037ead75e338156b1f9452c016a37dcd3283a972a30d9e4a87441ba372c8b81f818cd0fbcd9c0354b4ae7e18b9e1afa1971164aef6d18c2b6095a8ad
+  languageName: node
+  linkType: hard
 
-minimatch@^3.0.4:
-  version "3.0.4"
-  resolved "https://registry.yarnpkg.com/minimatch/-/minimatch-3.0.4.tgz#5166e286457f03306064be5497e8dbb0c3d32083"
-  integrity sha512-yJHVQEhyqPLUTgt9B83PXu6W3rx4MvvHvSUvToogpwoGDOUQ+yDrR0HRot+yOCdCO7u4hX3pWft6kWBBcqh0UA==
+"inflight@npm:^1.0.4":
+  version: 1.0.6
+  resolution: "inflight@npm:1.0.6"
   dependencies:
-    brace-expansion "^1.1.7"
+    once: ^1.3.0
+    wrappy: 1
+  checksum: f4f76aa072ce19fae87ce1ef7d221e709afb59d445e05d47fba710e85470923a75de35bfae47da6de1b18afc3ce83d70facf44cfb0aff89f0a3f45c0a0244dfd
+  languageName: node
+  linkType: hard
 
-once@^1.3.0:
-  version "1.4.0"
-  resolved "https://registry.yarnpkg.com/once/-/once-1.4.0.tgz#583b1aa775961d4b113ac17d9c50baef9dd76bd1"
-  integrity sha1-WDsap3WWHUsROsF9nFC6753Xa9E=
+"inherits@npm:2":
+  version: 2.0.4
+  resolution: "inherits@npm:2.0.4"
+  checksum: 4a48a733847879d6cf6691860a6b1e3f0f4754176e4d71494c41f3475553768b10f84b5ce1d40fbd0e34e6bfbb864ee35858ad4dd2cf31e02fc4a154b724d7f1
+  languageName: node
+  linkType: hard
+
+"minimatch@npm:^3.0.4, minimatch@npm:^3.1.1":
+  version: 3.1.2
+  resolution: "minimatch@npm:3.1.2"
   dependencies:
-    wrappy "1"
+    brace-expansion: ^1.1.7
+  checksum: c154e566406683e7bcb746e000b84d74465b3a832c45d59912b9b55cd50dee66e5c4b1e5566dba26154040e51672f9aa450a9aef0c97cfc7336b78b7afb9540a
+  languageName: node
+  linkType: hard
 
-path-is-absolute@^1.0.0:
-  version "1.0.1"
-  resolved "https://registry.yarnpkg.com/path-is-absolute/-/path-is-absolute-1.0.1.tgz#174b9268735534ffbc7ace6bf53a5a9e1b5c5f5f"
-  integrity sha1-F0uSaHNVNP+8es5r9TpanhtcX18=
-
-supports-color@^7.1.0:
-  version "7.2.0"
-  resolved "https://registry.yarnpkg.com/supports-color/-/supports-color-7.2.0.tgz#1b7dcdcb32b8138801b3e478ba6a51caa89648da"
-  integrity sha512-qpCAvRl9stuOHveKsn7HncJRvv501qIacKzQlO/+Lwxc9+0q2wLyv4Dfvt80/DPn2pqOBsJdDiogXGR9+OvwRw==
+"notion-enhancer@workspace:.":
+  version: 0.0.0-use.local
+  resolution: "notion-enhancer@workspace:."
   dependencies:
-    has-flag "^4.0.0"
+    "@electron/asar": ^3.2.2
+    arg: ^5.0.2
+    chalk-template: ^0.4.0
+  bin:
+    notion-enhancer: bin.mjs
+  languageName: unknown
+  linkType: soft
 
-wrappy@1:
-  version "1.0.2"
-  resolved "https://registry.yarnpkg.com/wrappy/-/wrappy-1.0.2.tgz#b5243d8f3ec1aa35f1364605bc0d1036e30ab69f"
-  integrity sha1-tSQ9jz7BqjXxNkYFvA0QNuMKtp8=
+"once@npm:^1.3.0":
+  version: 1.4.0
+  resolution: "once@npm:1.4.0"
+  dependencies:
+    wrappy: 1
+  checksum: cd0a88501333edd640d95f0d2700fbde6bff20b3d4d9bdc521bdd31af0656b5706570d6c6afe532045a20bb8dc0849f8332d6f2a416e0ba6d3d3b98806c7db68
+  languageName: node
+  linkType: hard
+
+"path-is-absolute@npm:^1.0.0":
+  version: 1.0.1
+  resolution: "path-is-absolute@npm:1.0.1"
+  checksum: 060840f92cf8effa293bcc1bea81281bd7d363731d214cbe5c227df207c34cd727430f70c6037b5159c8a870b9157cba65e775446b0ab06fd5ecc7e54615a3b8
+  languageName: node
+  linkType: hard
+
+"supports-color@npm:^7.1.0":
+  version: 7.2.0
+  resolution: "supports-color@npm:7.2.0"
+  dependencies:
+    has-flag: ^4.0.0
+  checksum: 3dda818de06ebbe5b9653e07842d9479f3555ebc77e9a0280caf5a14fb877ffee9ed57007c3b78f5a6324b8dbeec648d9e97a24e2ed9fdb81ddc69ea07100f4a
+  languageName: node
+  linkType: hard
+
+"wrappy@npm:1":
+  version: 1.0.2
+  resolution: "wrappy@npm:1.0.2"
+  checksum: 159da4805f7e84a3d003d8841557196034155008f817172d4e986bd591f74aa82aa7db55929a54222309e01079a65a92a9e6414da5a6aa4b01ee44a511ac3ee5
+  languageName: node
+  linkType: hard